{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "15b6034c-081b-4dca-bfe9-a0243a166ca2", "code": "185018-43-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=185018-43-3", "code_system": "CAS", "references": [ "17f26062-a8b9-4b2d-9a2c-a0c3bc8e966a", "e1551f0a-6474-4b8c-bf28-e2eb9875c666" ] }, { "uuid": "f39dfada-41ad-4ad2-b87f-8c29c92266ec", "code": "71587596", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71587596", "code_system": "PUBCHEM", "references": [ "17f26062-a8b9-4b2d-9a2c-a0c3bc8e966a" ] }, { "uuid": "b2b29c96-18a1-456d-90c7-68416ea31a2e", "code": "DE09065B2O", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "c05d4deb-b7b7-b212-746a-b599f62ae259", "code": "DTXSID001021869", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID001021869", "code_system": "EPA CompTox" } ], "substance_class": "chemical", "names": [ { "uuid": "c7bc7746-7456-4032-861d-9260f7a1bcef", "name": "AVC-10", "stdName": "AVC-10", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "65920e84-1483-4566-bd03-d5caa517d8c4", "2c44b354-705c-4e16-9ba9-f5c26aee7059" ], "display_name": false }, { "uuid": "499c6116-eb42-4ea5-a976-efd0be2b5e1f", "name": "L-ASCORBIC ACID, 2-((3.BETA.)-CHOLEST-5-EN-3-YL HYDROGEN PHOSPHATE), MONOSODIUM SALT", "stdName": "L-ASCORBIC ACID, 2-((3.BETA.)-CHOLEST-5-EN-3-YL HYDROGEN PHOSPHATE), MONOSODIUM SALT", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4d329627-f5ea-4f76-a0c0-db84a7dba23a", "65920e84-1483-4566-bd03-d5caa517d8c4" ], "display_name": false }, { "uuid": "5372c0ef-7cb3-4a90-9ee9-33046a5813d1", "name": "SODIUM ASCORBYL/CHOLESTERYL PHOSPHATE", "stdName": "SODIUM ASCORBYL/CHOLESTERYL PHOSPHATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "dd808085-c6a3-4614-8838-9f67618ed4a6", "65920e84-1483-4566-bd03-d5caa517d8c4", "2c44b354-705c-4e16-9ba9-f5c26aee7059" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "f35d1f33-340c-4f81-be9b-cf104529986e", "name_org": "INCI" } ] } ], "references": [ { "uuid": "2c44b354-705c-4e16-9ba9-f5c26aee7059", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "65920e84-1483-4566-bd03-d5caa517d8c4", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4d329627-f5ea-4f76-a0c0-db84a7dba23a", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "17f26062-a8b9-4b2d-9a2c-a0c3bc8e966a", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391593000, "tags": [ "NOMEN" ] }, { "uuid": "ec6138e7-310c-46bc-9aff-463507f76a62", "citation": "SRS import [DE09065B2O]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=DE09065B2O", "doc_type": "SRS", "public_domain": true, "document_date": 1493391593000, "tags": [ "NOMEN" ] }, { "uuid": "dd808085-c6a3-4614-8838-9f67618ed4a6", "citation": "SODIUM ASCORBYL/CHOLESTERYL PHOSPHATE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "e1551f0a-6474-4b8c-bf28-e2eb9875c666", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "6eb06e23-18ad-4d06-ba78-d3101cae18de", "id": "6eb06e23-18ad-4d06-ba78-d3101cae18de", "molfile": "\n Marvin 01132105452D \n\n 1 0 0 0 1 0 999 V2000\n 3.3730 -5.9415 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 1\nM END", "smiles": "[Na+]", "formula": "Na", "atropisomerism": "No", "charge": 1, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "b7142d7b-c53d-4fc9-bad9-795762d87d29" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "22.9898", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "8da8f63a-ef05-475c-9efa-8342140ea7c4", "id": "8da8f63a-ef05-475c-9efa-8342140ea7c4", "molfile": "\n Marvin 01132107212D \n\n 43 47 0 0 1 0 999 V2000\n 10.8161 -2.8357 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 10.2114 -2.2585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6132 -2.6708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8606 -1.9012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6851 -1.7088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9325 -0.9392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7295 -0.7743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3553 -0.3620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5413 -3.6328 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 11.0360 -4.2924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5413 -4.9796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7716 -4.7047 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 9.0570 -5.1170 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 9.0570 -5.9415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3424 -6.3538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6278 -5.9415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9132 -6.3538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1986 -5.9415 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 6.1986 -5.1170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9132 -4.7047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6278 -5.1170 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 7.6278 -4.2924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3424 -4.7047 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 8.3424 -3.8801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0570 -3.4678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7716 -3.8801 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 9.8541 -3.0556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4839 -6.3538 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7693 -5.9415 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0547 -6.3538 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7693 -5.1170 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1965 -6.8138 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5793 -7.3416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7768 -7.1501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4626 -6.3833 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3539 -7.8494 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8895 -8.4930 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 4.6485 -8.1525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3556 -8.6018 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6981 -9.2956 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 2.9078 -9.5307 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2970 -9.8629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1057 -10.6655 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 1 2 1 6 0 0 0\n 1 3 1 0 0 0 0\n 9 1 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 6 8 1 0 0 0 0\n 9 10 1 1 0 0 0\n 26 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 1 0 0 0\n 13 12 1 0 0 0 0\n 12 26 1 0 0 0 0\n 13 14 1 6 0 0 0\n 13 23 1 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 2 0 0 0 0\n 17 16 1 0 0 0 0\n 21 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 18 19 1 0 0 0 0\n 18 28 1 1 0 0 0\n 19 20 1 0 0 0 0\n 21 20 1 0 0 0 0\n 21 22 1 1 0 0 0\n 23 21 1 0 0 0 0\n 23 24 1 1 0 0 0\n 25 24 1 0 0 0 0\n 26 25 1 0 0 0 0\n 26 27 1 1 0 0 0\n 29 28 1 0 0 0 0\n 29 30 1 0 0 0 0\n 29 31 2 0 0 0 0\n 29 32 1 0 0 0 0\n 33 32 1 0 0 0 0\n 34 33 2 3 0 0 0\n 38 33 1 0 0 0 0\n 34 35 1 0 0 0 0\n 36 34 1 0 0 0 0\n 37 36 1 1 0 0 0\n 37 38 1 0 0 0 0\n 40 37 1 0 0 0 0\n 39 38 2 0 0 0 0\n 40 41 1 6 0 0 0\n 40 42 1 0 0 0 0\n 42 43 1 0 0 0 0\nM CHG 1 43 -1\nM END", "smiles": "CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)OP(=O)(O)OC5=C(O)O[C@H]([C@H](C[O-])O)C5=O", "formula": "C33H52O9P", "atropisomerism": "No", "charge": -1, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "9823a104-8a5d-4c8b-aee4-8536a645398d" }, "defined_stereo": 10, "ez_centers": 0, "molecular_weight": "623.7356", "optical_activity": "UNSPECIFIED", "stereo_centers": 10 } ], "definition_level": "COMPLETE", "uuid": "4cc073a6-e7db-496b-9a57-e68d5b7c0872", "version": "4", "structure": { "id": "b3929b9e-43cc-4a1b-89fd-49abe2e0b84b", "molfile": "\n Marvin 01132109182D \n\n 47 50 0 0 1 0 999 V2000\n 3.3730 -5.9415 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\n 4.7693 -5.9415 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1965 -6.8138 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5793 -7.3416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7768 -7.1501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3539 -7.8494 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8895 -8.4930 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 4.6485 -8.1525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3556 -8.6018 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6981 -9.2956 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 2.9078 -9.5307 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2970 -9.8629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1057 -10.6655 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4626 -6.3833 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0547 -6.3538 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 5.4839 -6.3538 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1986 -5.9415 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 6.9132 -6.3538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6278 -5.9415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6278 -5.1170 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.6278 -4.2924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3424 -4.7047 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 9.0570 -5.1170 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 9.0570 -5.9415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3424 -6.3538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7716 -4.7047 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 9.7716 -3.8801 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 9.8541 -3.0556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5413 -3.6328 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 10.8161 -2.8357 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 10.2114 -2.2585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6132 -2.6708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8606 -1.9012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6851 -1.7088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9325 -0.9392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7295 -0.7743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3553 -0.3620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0360 -4.2924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5413 -4.9796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0570 -3.4678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3424 -3.8801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9132 -4.7047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1986 -5.1170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7693 -5.1170 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2621 -5.5348 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7716 -5.4838 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0570 -4.3379 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 2 44 2 0 0 0 0\n 17 43 1 0 0 0 0\n 43 42 1 0 0 0 0\n 42 20 1 0 0 0 0\n 41 22 1 0 0 0 0\n 40 41 1 0 0 0 0\n 27 40 1 0 0 0 0\n 26 39 1 0 0 0 0\n 39 38 1 0 0 0 0\n 29 38 1 1 0 0 0\n 35 37 1 0 0 0 0\n 35 36 1 0 0 0 0\n 34 35 1 0 0 0 0\n 33 34 1 0 0 0 0\n 32 33 1 0 0 0 0\n 30 32 1 0 0 0 0\n 30 31 1 6 0 0 0\n 29 30 1 0 0 0 0\n 29 27 1 0 0 0 0\n 27 28 1 1 0 0 0\n 26 27 1 0 0 0 0\n 23 26 1 0 0 0 0\n 19 25 2 0 0 0 0\n 25 24 1 0 0 0 0\n 24 23 1 0 0 0 0\n 23 22 1 0 0 0 0\n 22 20 1 0 0 0 0\n 20 21 1 1 0 0 0\n 19 20 1 0 0 0 0\n 18 19 1 0 0 0 0\n 17 18 1 0 0 0 0\n 17 16 1 1 0 0 0\n 2 16 1 0 0 0 0\n 2 15 1 0 0 0 0\n 5 14 2 0 0 0 0\n 12 13 1 0 0 0 0\n 10 12 1 0 0 0 0\n 10 11 1 6 0 0 0\n 7 10 1 0 0 0 0\n 8 4 2 0 0 0 0\n 9 8 1 0 0 0 0\n 8 7 1 0 0 0 0\n 7 6 1 1 0 0 0\n 6 5 1 0 0 0 0\n 5 4 1 0 0 0 0\n 4 3 1 0 0 0 0\n 2 3 1 0 0 0 0\n 22 45 1 6 0 0 0\n 26 46 1 6 0 0 0\n 23 47 1 1 0 0 0\nM CHG 2 1 1 15 -1\nM END", "smiles": "CC(C)CCC[C@@H](C)[C@H]1CC[C@@]2([H])[C@]3([H])CC=C4C[C@H](CC[C@]4(C)[C@@]3([H])CC[C@]12C)OP(=O)([O-])OC5=C([C@@H]([C@H](CO)O)OC5=O)O.[Na+]", "formula": "C33H52O9P.Na", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 10, "ez_centers": 0, "molecular_weight": "646.7254", "optical_activity": "UNSPECIFIED", "references": [ "4d329627-f5ea-4f76-a0c0-db84a7dba23a", "ec6138e7-310c-46bc-9aff-463507f76a62" ], "stereo_centers": 10 }, "unii": "DE09065B2O" } ] }