{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "5862fc5e-2b09-41ec-8bb8-2cbaf15bf31e",
          "code": "54556-98-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=54556-98-8",
          "code_system": "CAS",
          "references": [
            "f367184d-aeab-4d6a-9053-181f56bf4c3f",
            "6ba90f66-b145-47b2-9caa-986aea20060b"
          ]
        },
        {
          "uuid": "937bc271-ff59-428f-b31e-6d827d692ab4",
          "code": "55176",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/55176/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "f367184d-aeab-4d6a-9053-181f56bf4c3f"
          ]
        },
        {
          "uuid": "3616d5c4-420a-45d2-84bb-05240e04a4cc",
          "code": "m9215",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9215?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "f367184d-aeab-4d6a-9053-181f56bf4c3f"
          ]
        },
        {
          "uuid": "9b595322-c9cd-464f-800e-f727007c585c",
          "code": "SUB04087MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "f367184d-aeab-4d6a-9053-181f56bf4c3f"
          ]
        },
        {
          "uuid": "b69fec4a-0088-421b-b410-ceb44118059b",
          "code": "CHEMBL1078261",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1078261",
          "code_system": "ChEMBL",
          "references": [
            "f367184d-aeab-4d6a-9053-181f56bf4c3f"
          ]
        },
        {
          "uuid": "49b512a8-9ff3-e24e-124b-f034757ea5e1",
          "code": "DTXSID1046847",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1046847",
          "code_system": "EPA CompTox",
          "references": [
            "43c916f4-ce82-8a85-be15-d4373bb2498d"
          ]
        },
        {
          "uuid": "2e019fca-3c7f-0f2f-b9a2-c403e27455b7",
          "code": "41125",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/41125",
          "code_system": "PUBCHEM",
          "references": [
            "74019ba9-8f72-5c4d-943d-9c5e447e1ae0"
          ]
        },
        {
          "uuid": "7e497cbb-f99a-3340-dc46-cfc589512437",
          "code": "DBSALT002169",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DBSALT002169",
          "code_system": "DRUG BANK",
          "references": [
            "1f8ed647-1a70-fd1f-2039-e5be6c9f18f4"
          ]
        },
        {
          "uuid": "d85c61b6-f541-4837-91c6-ffe71b2f8cf7",
          "code": "DC4GZD10H3",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "699b960c-9dc8-fecf-d985-a69a40373367",
          "code": "100000085092",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "27e44b8e-a6f4-db1a-dfce-eabe72694da9"
          ]
        },
        {
          "uuid": "981ad03f-9b64-9c4f-5a12-c82d87139225",
          "code": "172140",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=172140",
          "code_system": "NSC",
          "references": [
            "f18c90a2-dcb6-a712-0504-8d28ceeb0fbb"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "3f2a7871-cc1f-4dbf-9e68-33d6e53378a7",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "25cdab29-0012-4aa8-bf0a-62ed725b1798",
            "refuuid": "0e535c74-86b9-47c3-9161-902ff2eb1b01",
            "name": "PROPIVERINE",
            "unii": "468GE2241L",
            "linking_id": "468GE2241L",
            "ref_pname": "PROPIVERINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e8f9a9da-0665-4771-867d-0ba663ba735d",
          "name": "1-METHYL-4-PIPERIDYL DIPHENYLPROPOXYACETATE HYDROCHLORIDE",
          "stdName": "1-METHYL-4-PIPERIDYL DIPHENYLPROPOXYACETATE HYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9df269c6-12c4-4f22-a59b-97dd84950083",
            "42afacd9-7b2c-4f22-aa22-d50c14791473"
          ],
          "display_name": false
        },
        {
          "uuid": "f9f620c9-5404-4b9c-872b-0c4f0b9e23b6",
          "name": "DETRUNORM",
          "stdName": "DETRUNORM",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "580dc009-3876-4e14-86ee-397439e5f04a",
            "9df269c6-12c4-4f22-a59b-97dd84950083"
          ],
          "display_name": false
        },
        {
          "uuid": "ee837850-aff2-49cf-96f1-63c791292820",
          "name": "MICTONETTEN",
          "stdName": "MICTONETTEN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "580dc009-3876-4e14-86ee-397439e5f04a",
            "9df269c6-12c4-4f22-a59b-97dd84950083"
          ],
          "display_name": false
        },
        {
          "uuid": "14c8a05c-636f-4dbf-8b98-79dbce752417",
          "name": "MICTONORM",
          "stdName": "MICTONORM",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "580dc009-3876-4e14-86ee-397439e5f04a",
            "9df269c6-12c4-4f22-a59b-97dd84950083"
          ],
          "display_name": false
        },
        {
          "uuid": "e501bd40-33aa-42ad-9f76-7ab5f8a28c8a",
          "name": "NSC-172140",
          "stdName": "NSC-172140",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9df269c6-12c4-4f22-a59b-97dd84950083",
            "909c2255-a587-4423-a142-0bb0d6ccfd76"
          ],
          "display_name": false
        },
        {
          "uuid": "3b7f6d98-78bf-4869-88dd-a27f975aec20",
          "name": "P-4",
          "stdName": "P-4",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "580dc009-3876-4e14-86ee-397439e5f04a",
            "9df269c6-12c4-4f22-a59b-97dd84950083"
          ],
          "display_name": false
        },
        {
          "uuid": "2f461859-8cb1-478b-96ff-440ddefe438d",
          "name": "PROPIVERINE HYDROCHLORIDE",
          "stdName": "PROPIVERINE HYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "877fc035-1648-4b53-9a34-e92dabcfcb4c",
            "7e515c37-21d2-418c-aed2-6c97824bcba1",
            "6784cbe4-e084-45f2-9b33-783dc949f2c4",
            "580dc009-3876-4e14-86ee-397439e5f04a",
            "9df269c6-12c4-4f22-a59b-97dd84950083",
            "aa3d57f7-83fc-48b3-9253-dc1c4cf31c92",
            "42afacd9-7b2c-4f22-aa22-d50c14791473"
          ],
          "display_name": true
        },
        {
          "uuid": "b8e2ecc7-a68e-4de5-9e10-c4cf1389b2d8",
          "name": "PROPIVERINE HYDROCHLORIDE [JAN]",
          "stdName": "PROPIVERINE HYDROCHLORIDE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9df269c6-12c4-4f22-a59b-97dd84950083",
            "42afacd9-7b2c-4f22-aa22-d50c14791473"
          ],
          "display_name": false
        },
        {
          "uuid": "4a2acb4e-1526-483b-acbc-eb6f8845ab32",
          "name": "PROPIVERINE HYDROCHLORIDE [MI]",
          "stdName": "PROPIVERINE HYDROCHLORIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "580dc009-3876-4e14-86ee-397439e5f04a",
            "9df269c6-12c4-4f22-a59b-97dd84950083"
          ],
          "display_name": false
        },
        {
          "uuid": "67a5ceac-caa6-652f-2455-ffbe10c8c7f2",
          "name": "Propiverine hydrochloride [WHO-DD]",
          "stdName": "PROPIVERINE HYDROCHLORIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4534f37a-4c0a-4db0-6251-cc57e0b9127d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "580dc009-3876-4e14-86ee-397439e5f04a",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "9df269c6-12c4-4f22-a59b-97dd84950083",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "42afacd9-7b2c-4f22-aa22-d50c14791473",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aa3d57f7-83fc-48b3-9253-dc1c4cf31c92",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "909c2255-a587-4423-a142-0bb0d6ccfd76",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f367184d-aeab-4d6a-9053-181f56bf4c3f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390703000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "28194059-2fd8-4675-b951-f959a40de092",
          "citation": "SRS import [DC4GZD10H3]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=DC4GZD10H3",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390703000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "877fc035-1648-4b53-9a34-e92dabcfcb4c",
          "citation": "PROPIVERINE HYDROCHLORIDE [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7e515c37-21d2-418c-aed2-6c97824bcba1",
          "citation": "PROPIVERINE HYDROCHLORIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6784cbe4-e084-45f2-9b33-783dc949f2c4",
          "citation": "PROPIVERINE HYDROCHLORIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "43c916f4-ce82-8a85-be15-d4373bb2498d",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=54556-98-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1f8ed647-1a70-fd1f-2039-e5be6c9f18f4",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "6ba90f66-b145-47b2-9caa-986aea20060b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "74019ba9-8f72-5c4d-943d-9c5e447e1ae0",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "f18c90a2-dcb6-a712-0504-8d28ceeb0fbb",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "4534f37a-4c0a-4db0-6251-cc57e0b9127d",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "27e44b8e-a6f4-db1a-dfce-eabe72694da9",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f4740a96-eb3e-419b-bd3a-a17e7afe7bcc",
          "id": "f4740a96-eb3e-419b-bd3a-a17e7afe7bcc",
          "molfile": "\n  Marvin  01132112412D          \n\n  1  0  0  0  0  0            999 V2000\n    2.3430   -0.7013    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ac1c4f32-6e0c-4393-a36a-301491cabb4f"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "7d5b21ee-f45a-49a3-a9de-8dec67c6edc3",
          "id": "7d5b21ee-f45a-49a3-a9de-8dec67c6edc3",
          "molfile": "\n  Marvin  01132106302D          \n\n 27 29  0  0  0  0            999 V2000\n   -3.4613   -3.3383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6363   -3.3383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2238   -2.6238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3988   -2.6238    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9863   -1.9094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2719   -2.3219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2719   -3.1469    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4427   -1.9094    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1571   -2.3219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1571   -3.1469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8716   -3.5594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5861   -3.1469    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3005   -3.5594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5861   -2.3219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8716   -1.9094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7008   -1.4969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7008   -0.6719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4153   -0.2594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.1297   -0.6719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.1297   -1.4969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4153   -1.9094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5738   -1.1949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2512   -1.1949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6637   -0.4804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2512    0.2340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5738    0.2340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9863   -0.4804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n 16  5  1  0  0  0  0\n  5 22  1  0  0  0  0\n  6  7  2  0  0  0  0\n  6  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n  9 15  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 21  2  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  2  0  0  0  0\n 21 20  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 27  2  0  0  0  0\n 24 23  2  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  2  0  0  0  0\n 27 26  1  0  0  0  0\nM  END",
          "smiles": "CCCOC(c1ccccc1)(c2ccccc2)C(=O)OC3CCN(C)CC3",
          "formula": "C23H29NO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "fc92c249-cf68-4019-8900-c8fa6efa08cc"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "367.4821",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a086395d-ca70-4385-9057-24df18c68c42",
      "version": "10",
      "structure": {
        "id": "4fad730d-7ba6-4cb8-9a82-097ccec977bf",
        "molfile": "\n  Marvin  01132104092D          \n\n 28 29  0  0  0  0            999 V2000\n   -1.7008   -1.4969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4153   -1.9094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.1297   -1.4969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.1297   -0.6719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4153   -0.2594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7008   -0.6719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2719   -2.3219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9863   -1.9094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2719   -3.1469    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4427   -1.9094    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3988   -2.6238    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2238   -2.6238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6363   -3.3383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.4613   -3.3383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5738   -1.1949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9863   -0.4804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5738    0.2340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2512    0.2340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6637   -0.4804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2512   -1.1949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5861   -3.1469    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8716   -3.5594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1571   -3.1469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1571   -2.3219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8716   -1.9094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5861   -2.3219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3005   -3.5594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3430   -0.7013    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  1  6  2  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  2  0  0  0  0\n  7 10  1  0  0  0  0\n  1  8  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 11 12  1  0  0  0  0\n  8 11  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 15 20  2  0  0  0  0\n  8 15  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 21 26  1  0  0  0  0\n 21 27  1  0  0  0  0\n 10 24  1  0  0  0  0\nM  END",
        "smiles": "CCCOC(c1ccccc1)(c2ccccc2)C(=O)OC3CCN(C)CC3.Cl",
        "formula": "C23H29NO3.ClH",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "403.943",
        "optical_activity": "NONE",
        "references": [
          "28194059-2fd8-4675-b951-f959a40de092",
          "42afacd9-7b2c-4f22-aa22-d50c14791473"
        ],
        "stereo_centers": 0
      },
      "unii": "DC4GZD10H3"
    }
  ]
}