{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "851479d1-4d98-479a-9132-bd36fa08203c",
          "code": "305-13-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=305-13-5",
          "code_system": "CAS",
          "references": [
            "de16299f-68a0-4300-8145-0c2879f112a9",
            "81c29d36-b486-436d-92fb-547cc566755b"
          ]
        },
        {
          "uuid": "e7b7e896-4820-473a-a35f-75d1bddfed8a",
          "code": "m989",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m989?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "de16299f-68a0-4300-8145-0c2879f112a9"
          ]
        },
        {
          "uuid": "0edc8ef5-e509-4af6-996e-e6d5069250e0",
          "code": "67538",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/67538",
          "code_system": "PUBCHEM",
          "references": [
            "de16299f-68a0-4300-8145-0c2879f112a9"
          ]
        },
        {
          "uuid": "64b2d732-a1c7-ec18-8399-2ee5950707d0",
          "code": "51",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/51",
          "code_system": "DRUG CENTRAL",
          "references": [
            "d0961fc2-146f-e4ad-ce4c-79be21f4c71f"
          ]
        },
        {
          "uuid": "16aef442-fe9d-4ba5-a21b-8c8126d5c7b6",
          "code": "DAP3980556",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "08b56b8a-75cc-6a01-5dde-1c2ccc7e4685",
          "code": "DTXSID60952814",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60952814",
          "code_system": "EPA CompTox",
          "references": [
            "d0961fc2-146f-e4ad-ce4c-79be21f4c71f"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "68bafde7-48fe-403f-a5cc-92285ae0a6cc",
          "name": "2-(4-ALLYL-2-METHOXYPHENOXY)-N,N-DIETHYLACETAMIDE",
          "stdName": "2-(4-ALLYL-2-METHOXYPHENOXY)-N,N-DIETHYLACETAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f9b7dcf8-7492-47ea-a423-3a0ee8b77c10",
            "196fad00-2ac1-46e2-9add-31db2cd96ab5"
          ],
          "display_name": false
        },
        {
          "uuid": "df9a1af6-52d5-4bd2-95ed-c7e4560adfe6",
          "name": "2-M-4-A",
          "stdName": "2-M-4-A",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f9b7dcf8-7492-47ea-a423-3a0ee8b77c10",
            "196fad00-2ac1-46e2-9add-31db2cd96ab5"
          ],
          "display_name": false
        },
        {
          "uuid": "55da94a2-d50b-4e36-a738-0328665aa61f",
          "name": "2-METHOXY-4-ALLYLPHENOXYACETIC ACID N,N-DIETHYLAMIDE",
          "stdName": "2-METHOXY-4-ALLYLPHENOXYACETIC ACID N,N-DIETHYLAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f9b7dcf8-7492-47ea-a423-3a0ee8b77c10",
            "196fad00-2ac1-46e2-9add-31db2cd96ab5"
          ],
          "display_name": false
        },
        {
          "uuid": "77a6e100-6a64-456f-8cc2-64073f8dbff4",
          "name": "ACETAMIDOEUGENOL",
          "stdName": "ACETAMIDOEUGENOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fe44a948-3800-437b-9259-70d33b5ba9bc",
            "196fad00-2ac1-46e2-9add-31db2cd96ab5",
            "af593a9d-162f-4cb2-aba3-c6f7684afb8c",
            "30983d4f-d495-47ff-a4c1-527828f20695"
          ],
          "display_name": true
        },
        {
          "uuid": "c1a4255d-00df-4f02-8b29-494d304fe8d8",
          "name": "ACETAMIDOEUGENOL [MI]",
          "stdName": "ACETAMIDOEUGENOL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "196fad00-2ac1-46e2-9add-31db2cd96ab5",
            "30983d4f-d495-47ff-a4c1-527828f20695"
          ],
          "display_name": false
        },
        {
          "uuid": "94261829-6f77-400f-adaf-1bff5c6a4783",
          "name": "DETROVEL",
          "stdName": "DETROVEL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fe44a948-3800-437b-9259-70d33b5ba9bc",
            "196fad00-2ac1-46e2-9add-31db2cd96ab5"
          ],
          "display_name": false
        },
        {
          "uuid": "cca27afe-8c3a-4a0b-bc37-3f3f1d4a355f",
          "name": "ESTIL",
          "stdName": "ESTIL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fe44a948-3800-437b-9259-70d33b5ba9bc",
            "196fad00-2ac1-46e2-9add-31db2cd96ab5"
          ],
          "display_name": false
        },
        {
          "uuid": "9f8d75b0-f461-4ee6-875f-edffcdb2cab4",
          "name": "G-29505",
          "stdName": "G-29505",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f9b7dcf8-7492-47ea-a423-3a0ee8b77c10",
            "196fad00-2ac1-46e2-9add-31db2cd96ab5"
          ],
          "display_name": false
        },
        {
          "uuid": "20480e31-f61f-443e-9303-140516517fc3",
          "name": "N,N-DIETHYL-2-(2-METHOXY-4-(2-PROPEN-1-YL)PHENOXY)ACETAMIDE",
          "stdName": "N,N-DIETHYL-2-(2-METHOXY-4-(2-PROPEN-1-YL)PHENOXY)ACETAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f9b7dcf8-7492-47ea-a423-3a0ee8b77c10",
            "196fad00-2ac1-46e2-9add-31db2cd96ab5"
          ],
          "display_name": false
        },
        {
          "uuid": "4b2a2184-6da6-4ca2-8714-f68c29aae5f8",
          "name": "N,N-DIETHYL-2-METHOXY-4-ALLYLPHENOXYACETAMIDE",
          "stdName": "N,N-DIETHYL-2-METHOXY-4-ALLYLPHENOXYACETAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f9b7dcf8-7492-47ea-a423-3a0ee8b77c10",
            "196fad00-2ac1-46e2-9add-31db2cd96ab5"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "fe44a948-3800-437b-9259-70d33b5ba9bc",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "30983d4f-d495-47ff-a4c1-527828f20695",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "196fad00-2ac1-46e2-9add-31db2cd96ab5",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f9b7dcf8-7492-47ea-a423-3a0ee8b77c10",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "de16299f-68a0-4300-8145-0c2879f112a9",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391011000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4e0143cb-cdd0-46d3-a6e3-36df0d1dbee4",
          "citation": "SRS import [DAP3980556]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=DAP3980556",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391011000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bdd2725c-eaa6-4d28-8534-95c8d0290e49",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "af593a9d-162f-4cb2-aba3-c6f7684afb8c",
          "citation": "ACETAMIDOEUGENOL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d0961fc2-146f-e4ad-ce4c-79be21f4c71f",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "81c29d36-b486-436d-92fb-547cc566755b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ec7c0d2f-980c-4bd9-bc51-502dce1a6f9f",
          "id": "ec7c0d2f-980c-4bd9-bc51-502dce1a6f9f",
          "molfile": "\n  Marvin  01132112142D          \n\n 20 20  0  0  0  0            999 V2000\n    4.3110   -5.4800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0226   -5.0617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0226   -4.2246    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3110   -3.8063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6040   -4.2246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7335   -3.8063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7335   -2.9693    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4452   -4.2246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4452   -5.0617    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1568   -5.4800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1568   -6.3170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8678   -6.7307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5795   -6.3170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2911   -6.7307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0021   -6.3170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7138   -6.7307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5795   -5.4800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8678   -5.0617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8678   -4.2246    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1568   -3.8063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3  6  1  0  0  0  0\n  5  4  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 18 10  2  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 17 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n 17 18  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\nM  END",
          "smiles": "C=CCc1ccc(c(c1)OC)OCC(=O)N(CC)CC",
          "formula": "C16H23NO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1fe4eb15-da39-472e-92f5-05fe4ed94856"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "277.3593",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "267f291b-3b66-4ea6-88b4-52d811349e4c",
      "version": "4",
      "structure": {
        "id": "ce07a507-82c6-406b-9bb9-29db70af6833",
        "molfile": "\n  Marvin  01132110382D          \n\n 20 20  0  0  0  0            999 V2000\n    5.7330   -3.8059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0221   -4.2242    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0221   -5.0612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3106   -5.4795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3106   -3.8059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6037   -4.2242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4446   -4.2242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4446   -5.0612    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1561   -5.4795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8671   -5.0612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5787   -5.4795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5787   -6.3164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8671   -6.7301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1561   -6.3164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2902   -6.7301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0012   -6.3164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7128   -6.7301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8671   -4.2242    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1561   -3.8059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7330   -2.9690    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14  9  1  0  0  0  0\n 15 12  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 10  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20  1  2  0  0  0  0\nM  END",
        "smiles": "C=CCc1ccc(c(c1)OC)OCC(=O)N(CC)CC",
        "formula": "C16H23NO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "277.3593",
        "optical_activity": "NONE",
        "references": [
          "bdd2725c-eaa6-4d28-8534-95c8d0290e49",
          "4e0143cb-cdd0-46d3-a6e3-36df0d1dbee4"
        ],
        "stereo_centers": 0
      },
      "unii": "DAP3980556"
    }
  ]
}