{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "29dec068-4b07-43b9-8585-53022d61bcc8",
          "code": "C61853",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C61853",
          "code_system": "NCI_THESAURUS",
          "references": [
            "5e4ce350-be2b-4af0-bd44-45e8c84d02bd"
          ]
        },
        {
          "uuid": "ec0cf554-f4f6-4dbf-a374-9392fd4747d1",
          "code": "537-55-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=537-55-3",
          "code_system": "CAS",
          "references": [
            "5e4ce350-be2b-4af0-bd44-45e8c84d02bd",
            "956c6787-3d99-43d8-aa2d-0cebda5bafa6"
          ]
        },
        {
          "uuid": "89b1491d-b3a0-4071-8568-cfa214b441da",
          "code": "C025787",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67025787",
          "code_system": "MESH",
          "references": [
            "5e4ce350-be2b-4af0-bd44-45e8c84d02bd"
          ]
        },
        {
          "uuid": "d98d893a-33d1-4ba3-b97a-cb598ffa76d6",
          "code": "31005",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/31005/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "5e4ce350-be2b-4af0-bd44-45e8c84d02bd"
          ]
        },
        {
          "uuid": "c87a7912-6f8b-43c5-94f4-cdabb650aaf9",
          "code": "SUB12166MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "5e4ce350-be2b-4af0-bd44-45e8c84d02bd"
          ]
        },
        {
          "uuid": "c040cd8d-f001-4685-ab73-acdd02acd000",
          "code": "208-671-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.007.885",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "5e4ce350-be2b-4af0-bd44-45e8c84d02bd"
          ]
        },
        {
          "uuid": "20b9689e-3f85-47aa-83be-0d0468af1ef7",
          "code": "68310",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/68310",
          "code_system": "PUBCHEM",
          "references": [
            "5e4ce350-be2b-4af0-bd44-45e8c84d02bd"
          ]
        },
        {
          "uuid": "22aeb48d-4ad1-52c7-b951-14406bdc324d",
          "code": "DTXSID7046045",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7046045",
          "code_system": "EPA CompTox",
          "references": [
            "1f9110a1-f8fc-300f-4b46-c4bb32ec8933"
          ]
        },
        {
          "uuid": "c1bbf699-44f6-8ddf-2708-f2fa4c7bdcc8",
          "code": "C73539",
          "comments": "Drug or Chemical by Structure[C1913]|Organic Chemical[C718]|Amino Acid, Peptide, or Protein[C232]|Amino Acid Derivative",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C73539",
          "code_system": "NCI_THESAURUS",
          "references": [
            "16848105-36e4-b84d-7abe-d79f40d66f39"
          ]
        },
        {
          "uuid": "5e230634-b6c1-f140-d09f-853874de4ede",
          "code": "25119-9",
          "comments": "LOINC|ACTIVE|CHEM|Urine|N-acetyltyrosine/Creatinine [Molar ratio] in Urine",
          "type": "PRIMARY",
          "url": "https://loinc.org/25119-9/",
          "code_system": "LOINC",
          "references": [
            "16848105-36e4-b84d-7abe-d79f40d66f39"
          ]
        },
        {
          "uuid": "677e6331-d1ef-f412-15b6-a739a3348561",
          "code": "13780-2",
          "comments": "LOINC|DISCOURAGED|CHEM|Urine|N-acetyltyrosine/Creatinine [Mass Ratio] in Urine",
          "type": "PRIMARY",
          "url": "https://loinc.org/13780-2/",
          "code_system": "LOINC",
          "references": [
            "16848105-36e4-b84d-7abe-d79f40d66f39"
          ]
        },
        {
          "uuid": "c19b7047-3583-f864-cd18-492a8ddc6700",
          "code": "29632-7",
          "comments": "LOINC|ACTIVE|CHEM|Urine|N-acetyltyrosine [Presence] in Urine",
          "type": "PRIMARY",
          "url": "https://loinc.org/29632-7/",
          "code_system": "LOINC",
          "references": [
            "16848105-36e4-b84d-7abe-d79f40d66f39"
          ]
        },
        {
          "uuid": "02d81a55-811c-984c-20f9-a8a0ffef1d79",
          "code": "79514-6",
          "comments": "LOINC|ACTIVE|CHEM|Ser/Plas|N-acetyltyrosine [Moles/volume] in Serum or Plasma",
          "type": "PRIMARY",
          "url": "https://loinc.org/79514-6/",
          "code_system": "LOINC",
          "references": [
            "16848105-36e4-b84d-7abe-d79f40d66f39"
          ]
        },
        {
          "uuid": "cd42a39a-f94a-614e-01ba-d32cf21052c0",
          "code": "4481",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/4481",
          "code_system": "DRUG CENTRAL",
          "references": [
            "16848105-36e4-b84d-7abe-d79f40d66f39"
          ]
        },
        {
          "uuid": "14e8f99e-30db-d4f9-96cd-192e1a0f5707",
          "code": "DB11102",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB11102",
          "code_system": "DRUG BANK",
          "references": [
            "16848105-36e4-b84d-7abe-d79f40d66f39"
          ]
        },
        {
          "uuid": "b3ed08eb-5bd3-423d-ae37-dd2469880b65",
          "code": "DA8G610ZO5",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "023c0e3a-76a5-683e-07b1-133bf8448503",
          "code": "3506 (Number of products:19)",
          "comments": "Dietary Supplement Label Database|chemical|Acetyl L-Tyrosine",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=3506&item=Acetyl L-Tyrosine",
          "code_system": "DSLD",
          "references": [
            "16848105-36e4-b84d-7abe-d79f40d66f39"
          ]
        },
        {
          "uuid": "18da6fbb-505d-9613-15f8-cb90b924d11f",
          "code": "3129 (Number of products:660)",
          "comments": "Dietary Supplement Label Database|chemical|N-Acetyl-Tyrosine",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=3129&item=N-Acetyl-Tyrosine",
          "code_system": "DSLD",
          "references": [
            "16848105-36e4-b84d-7abe-d79f40d66f39"
          ]
        },
        {
          "uuid": "d9a6c1db-9f22-f55b-6579-e5c6de218b03",
          "code": "68561",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:68561",
          "code_system": "CHEBI",
          "references": [
            "16848105-36e4-b84d-7abe-d79f40d66f39"
          ]
        },
        {
          "uuid": "a4da2a26-f3d4-6e2f-418e-f0d28301836d",
          "code": "21563",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:21563",
          "code_system": "CHEBI",
          "references": [
            "16848105-36e4-b84d-7abe-d79f40d66f39"
          ]
        },
        {
          "uuid": "d9100084-a693-6ba2-4e7b-6736f09bbfde",
          "code": "1010106",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1010106",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "16848105-36e4-b84d-7abe-d79f40d66f39"
          ]
        },
        {
          "uuid": "8db2d8d9-177a-0ac7-8074-912bdb273d67",
          "code": "N-Acetyl-L-tyrosine",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/N-Acetyl-L-tyrosine",
          "code_system": "WIKIPEDIA",
          "references": [
            "05f52679-1d05-34df-9ef2-2518c92b40ac"
          ]
        },
        {
          "uuid": "4ae707aa-39ff-505f-df4a-6effdd16feee",
          "code": "100000088304",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "77606d82-7ac2-5201-8323-6a09ce92da1c"
          ]
        },
        {
          "uuid": "0f79725f-bdf4-5470-bf69-b4922d0e779d",
          "code": "10853",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=10853",
          "code_system": "NSC",
          "references": [
            "3d8da9f8-703e-a83a-05df-1d19a87b511c"
          ]
        },
        {
          "uuid": "c57f27ee-f5e7-785f-5713-81a2d251b188",
          "code": "DA8G610ZO5",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=DA8G610ZO5",
          "code_system": "DAILYMED",
          "references": [
            "0d01ad32-611d-86ed-c775-34ee15ffd317"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "15afa4b2-801e-454c-a530-2fb063c9ee8d",
          "citation": "NDC 10-OCT-2007",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f3adf553-5bf7-4153-9d72-4319b2e98274",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4bf1ea67-1d89-4d84-9a5e-65727f588291",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5c0208a4-e3f0-401c-942a-4433c46430f7",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "84502b77-0384-4f20-9bb6-464b44677bb0",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "15d0e8b8-8eb4-473f-b4c0-ad149dd680f6",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5adf5680-8319-45c5-8399-f008bf2e1406",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d0c6d5b9-3f05-4b65-8f08-c006b7a46f7b",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b95ab901-c083-4732-9e77-6ee71d3a4322",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5e4ce350-be2b-4af0-bd44-45e8c84d02bd",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390170000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0bacb087-e8d6-4bd3-a458-d15a66d00d6b",
          "citation": "SRS import [DA8G610ZO5]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=DA8G610ZO5",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390170000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d767e98f-a55a-43de-8ee5-0075aed47c07",
          "citation": "N-ACETYLTYROSINE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "590dd95a-9da7-4f46-b3bb-347e7e24915d",
          "citation": "ACETYL TYROSINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a8d43327-4959-4d97-8dc8-75672de73a0f",
          "citation": "N-ACETYL-L-TYROSINE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cdcba0a0-525e-415b-b61b-012447667d7d",
          "citation": "N-ACETYLTYROSIN [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0d01ad32-611d-86ed-c775-34ee15ffd317",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "1f9110a1-f8fc-300f-4b46-c4bb32ec8933",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=537-55-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "16848105-36e4-b84d-7abe-d79f40d66f39",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "05f52679-1d05-34df-9ef2-2518c92b40ac",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "956c6787-3d99-43d8-aa2d-0cebda5bafa6",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "2ea21e24-7dd4-4071-a413-4ba0b7ae1a7d",
          "citation": "https://ods.od.nih.gov/Research/Dietary_Supplement_Label_Database.aspx",
          "url": "https://ods.od.nih.gov/Research/Dietary_Supplement_Label_Database.aspx",
          "doc_type": "WEB PAGE",
          "public_domain": true
        },
        {
          "uuid": "1ca8f1ce-4b42-ca7f-f543-720f8a2ad470",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "2bda16fb-de64-43a6-a2a9-035f79845678",
          "citation": "EP 10.6",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ad969a8c-ac7f-421d-a37e-9ddd7db39cee",
          "citation": "EP 10.6",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "8d9ffdf5-d84b-f2ac-9e50-024ef7134125",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "3d8da9f8-703e-a83a-05df-1d19a87b511c",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "77606d82-7ac2-5201-8323-6a09ce92da1c",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "aff37c39-aadc-44c1-be6b-c813ff3f3396",
          "id": "aff37c39-aadc-44c1-be6b-c813ff3f3396",
          "molfile": "\n  Marvin  01132109072D          \n\n 16 16  0  0  1  0            999 V2000\n    5.1436   -3.0053    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.1436   -2.1803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4291   -1.7678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4291   -0.9428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7146   -0.5303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0002   -0.9428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2857   -0.5303    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0002   -1.7678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7146   -2.1803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4291   -3.4178    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4291   -4.2428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7146   -4.6554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1436   -4.6554    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8581   -3.4178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8581   -4.2428    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5725   -3.0053    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1 10  1  1  0  0  0\n  1 14  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  9  3  2  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  2  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  2  0  0  0  0\nM  END",
          "smiles": "CC(=O)N[C@@H](Cc1ccc(cc1)O)C(=O)O",
          "formula": "C11H13NO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8634fccf-999d-4692-af6e-18676a7a8df2"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "223.2256",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "fad46cde-efd9-416d-950e-e42ea4d9302e",
      "version": "30",
      "structure": {
        "id": "0585dacb-df4b-423b-b465-f974f22db7b3",
        "molfile": "\n  Marvin  01132100352D          \n\n 16 16  0  0  1  0            999 V2000\n    4.4291   -0.9428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7146   -0.5303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0002   -0.9428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2857   -0.5303    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0002   -1.7678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7146   -2.1803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4291   -1.7678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1436   -2.1803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1436   -3.0053    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.8581   -3.4178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8581   -4.2428    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5725   -3.0053    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4291   -3.4178    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4291   -4.2428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1436   -4.6554    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7146   -4.6554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  1  2  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  1  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n  9 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 14 16  1  0  0  0  0\nM  END",
        "smiles": "CC(=O)N[C@@H](Cc1ccc(cc1)O)C(=O)O",
        "formula": "C11H13NO4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "223.2256",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "0bacb087-e8d6-4bd3-a458-d15a66d00d6b",
          "15afa4b2-801e-454c-a530-2fb063c9ee8d"
        ],
        "stereo_centers": 1
      },
      "unii": "DA8G610ZO5",
      "relationships": [
        {
          "uuid": "a8015b87-d808-4be6-8670-c0fd4448838c",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "6fb54e49-80d5-425f-aecf-f48f4ab89b0a",
            "refuuid": "fad46cde-efd9-416d-950e-e42ea4d9302e",
            "name": "ACETYL L-TYROSINE",
            "unii": "DA8G610ZO5",
            "linking_id": "DA8G610ZO5",
            "ref_pname": "ACETYL L-TYROSINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "8c086648-71db-493a-a41c-056537c1c1b9",
          "amount": {
            "uuid": "9aadaf93-ba26-413a-8e52-54c90bd2d9e5",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.8
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "ad969a8c-ac7f-421d-a37e-9ddd7db39cee"
          ],
          "related_substance": {
            "uuid": "21ef5f83-8ae2-4d75-a16f-504a8dbbcd9b",
            "refuuid": "c046990c-117a-4cde-bf88-3d61abd25ab2",
            "name": "TYROSINE",
            "unii": "42HK56048U",
            "linking_id": "42HK56048U",
            "ref_pname": "TYROSINE"
          }
        },
        {
          "uuid": "8b391190-f9d2-4ba4-8b17-47d62a89153a",
          "amount": {
            "uuid": "6748eeee-3b7e-46f8-9538-55f74111ce10",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "2bda16fb-de64-43a6-a2a9-035f79845678"
          ],
          "related_substance": {
            "uuid": "269bb2d1-dba9-4377-9a7c-b8d97bf9d91e",
            "refuuid": "746b3bce-410f-4238-8138-20360d34596e",
            "name": "DIACETYLTYROSINE",
            "unii": "2YW8SXH2W8",
            "linking_id": "2YW8SXH2W8",
            "ref_pname": "DIACETYLTYROSINE"
          }
        }
      ],
      "names": [
        {
          "uuid": "28d209cc-51b9-4000-8655-9505a7a342be",
          "name": "(+)-(2S)-2-(ACETYLAMINO)-3-(4-HYDROXYPHENYL)PROPANOIC ACID",
          "stdName": "(+)-(2S)-2-(ACETYLAMINO)-3-(4-HYDROXYPHENYL)PROPANOIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f3adf553-5bf7-4153-9d72-4319b2e98274",
            "5adf5680-8319-45c5-8399-f008bf2e1406"
          ],
          "display_name": false
        },
        {
          "uuid": "86bf105b-227d-467a-b6da-d8b0c6906d12",
          "name": "(2S)-2-ACETYLAMINO-3-(4-HYDROXYPHENYL)PROPANOIC ACID",
          "stdName": "(2S)-2-ACETYLAMINO-3-(4-HYDROXYPHENYL)PROPANOIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f3adf553-5bf7-4153-9d72-4319b2e98274",
            "5adf5680-8319-45c5-8399-f008bf2e1406"
          ],
          "display_name": false
        },
        {
          "uuid": "8386a040-2763-4770-ba39-c30dc60954da",
          "name": "ACETYL L-TYROSINE",
          "stdName": "ACETYL L-TYROSINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2ea21e24-7dd4-4071-a413-4ba0b7ae1a7d"
          ],
          "display_name": true
        },
        {
          "uuid": "e2ccedd7-ec11-44e8-9292-48f967040adc",
          "name": "ACETYL TYROSINE",
          "stdName": "ACETYL TYROSINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "15d0e8b8-8eb4-473f-b4c0-ad149dd680f6",
            "590dd95a-9da7-4f46-b3bb-347e7e24915d",
            "5adf5680-8319-45c5-8399-f008bf2e1406"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "3eec6372-c28c-4d6d-a947-9ef8f5f643ff",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "35d6d875-744d-4f43-9973-662745bdf29a",
          "name": "L-N-ACETYLTYROSINE",
          "stdName": "L-N-ACETYLTYROSINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f3adf553-5bf7-4153-9d72-4319b2e98274"
          ],
          "display_name": false
        },
        {
          "uuid": "485f6374-2726-4944-b3f7-f6e2d6b21cbc",
          "name": "L-TYROSINE, N-ACETYL",
          "stdName": "L-TYROSINE, N-ACETYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5c0208a4-e3f0-401c-942a-4433c46430f7"
          ],
          "display_name": false
        },
        {
          "uuid": "73147acb-d1e0-4287-84f9-7dae1d8d1aaa",
          "name": "MELANOWHITE-A",
          "stdName": "MELANOWHITE-A",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "15d0e8b8-8eb4-473f-b4c0-ad149dd680f6",
            "5adf5680-8319-45c5-8399-f008bf2e1406"
          ],
          "display_name": false
        },
        {
          "uuid": "977c1284-02d2-4542-b713-06a50ac749ec",
          "name": "N-ACETYL-L-TYROSINE",
          "stdName": "N-ACETYL-L-TYROSINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a8d43327-4959-4d97-8dc8-75672de73a0f",
            "f3adf553-5bf7-4153-9d72-4319b2e98274",
            "d0c6d5b9-3f05-4b65-8f08-c006b7a46f7b",
            "5adf5680-8319-45c5-8399-f008bf2e1406"
          ],
          "display_name": false
        },
        {
          "uuid": "4f6ad4e4-3242-489a-bbee-9ac425e7ce77",
          "name": "N-ACETYL-L-TYROSINE [USP-RS]",
          "stdName": "N-ACETYL-L-TYROSINE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d0c6d5b9-3f05-4b65-8f08-c006b7a46f7b",
            "5adf5680-8319-45c5-8399-f008bf2e1406"
          ],
          "display_name": false
        },
        {
          "uuid": "faebd3d9-4a4f-4975-99be-47b197b4cb52",
          "name": "N-ACETYL-TYROSINE",
          "stdName": "N-ACETYL-TYROSINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "15afa4b2-801e-454c-a530-2fb063c9ee8d"
          ],
          "display_name": false
        },
        {
          "uuid": "6fd0f96f-ec33-46ea-b400-7977e5ed6789",
          "name": "N-ACETYLTYROSIN",
          "stdName": "N-ACETYLTYROSIN",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cdcba0a0-525e-415b-b61b-012447667d7d",
            "b95ab901-c083-4732-9e77-6ee71d3a4322",
            "5adf5680-8319-45c5-8399-f008bf2e1406"
          ],
          "display_name": false
        },
        {
          "uuid": "0f3be2ad-f4f6-4952-a1e7-9c465d385360",
          "name": "N-ACETYLTYROSINE",
          "stdName": "N-ACETYLTYROSINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "84502b77-0384-4f20-9bb6-464b44677bb0",
            "4bf1ea67-1d89-4d84-9a5e-65727f588291",
            "d767e98f-a55a-43de-8ee5-0075aed47c07"
          ],
          "display_name": false
        },
        {
          "uuid": "4616dae8-adab-c190-7a06-72b08cfa8d34",
          "name": "N-ACETYLTYROSINE [EP MONOGRAPH]",
          "stdName": "N-ACETYLTYROSINE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1ca8f1ce-4b42-ca7f-f543-720f8a2ad470"
          ],
          "display_name": false
        },
        {
          "uuid": "4a7ba9a9-1314-068f-c7f1-d421f3c268ec",
          "name": "N-acetyltyrosin [WHO-DD]",
          "stdName": "N-ACETYLTYROSIN [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8d9ffdf5-d84b-f2ac-9e50-024ef7134125"
          ],
          "display_name": false
        },
        {
          "uuid": "da834cf6-7047-409c-81b4-afbb169267a2",
          "name": "NSC-10853",
          "stdName": "NSC-10853",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f3adf553-5bf7-4153-9d72-4319b2e98274",
            "5adf5680-8319-45c5-8399-f008bf2e1406"
          ],
          "display_name": false
        },
        {
          "uuid": "aa6722e1-9544-4039-a51d-f6fd999f9572",
          "name": "TANOGEN HB",
          "stdName": "TANOGEN HB",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "15d0e8b8-8eb4-473f-b4c0-ad149dd680f6",
            "5adf5680-8319-45c5-8399-f008bf2e1406"
          ],
          "display_name": false
        },
        {
          "uuid": "2ccfd617-2418-491e-9100-14ac13dd8c7e",
          "name": "TYR-EXCEL",
          "stdName": "TYR-EXCEL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f3adf553-5bf7-4153-9d72-4319b2e98274",
            "5adf5680-8319-45c5-8399-f008bf2e1406"
          ],
          "display_name": false
        }
      ],
      "modifications": {
        "uuid": "52491fed-1077-4900-b6b4-7594bf4cc715"
      }
    }
  ]
}