{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "0c86eb98-ba98-4ce1-bb07-bc8a5fa0c561",
          "code": "2688-77-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2688-77-9",
          "code_system": "CAS",
          "references": [
            "93516b81-26a2-4830-8183-97bd99286167",
            "a56aad0f-fa2c-4402-aff8-0c258ac7cf17"
          ]
        },
        {
          "uuid": "d65814cb-9c78-41b5-b40c-a1d594f169c6",
          "code": "C001522",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67001522",
          "code_system": "MESH",
          "references": [
            "93516b81-26a2-4830-8183-97bd99286167"
          ]
        },
        {
          "uuid": "51cb39d6-0f7c-4799-aa39-9b9570abe909",
          "code": "LAUDANOSINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Laudanosine",
          "code_system": "WIKIPEDIA",
          "references": [
            "93516b81-26a2-4830-8183-97bd99286167"
          ]
        },
        {
          "uuid": "41e311f2-296f-4409-8d00-de91565083ba",
          "code": "m6706",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6706?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "93516b81-26a2-4830-8183-97bd99286167"
          ]
        },
        {
          "uuid": "779f6919-2b93-4cb2-b951-9c2d0beb07ff",
          "code": "220-253-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.018.412",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "93516b81-26a2-4830-8183-97bd99286167"
          ]
        },
        {
          "uuid": "281d01d7-f401-4f4d-82c8-6e9a7585bcbf",
          "code": "73397",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/73397",
          "code_system": "PUBCHEM",
          "references": [
            "93516b81-26a2-4830-8183-97bd99286167"
          ]
        },
        {
          "uuid": "75519e4f-93bb-4c29-a8f7-6822301959a6",
          "code": "DA7R5WVN48",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "2733686d-0809-2bfb-ed8a-382536e2b686",
          "code": "300000043559",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "f220f8f3-d7ef-9fd8-a1d2-596158ef2b79"
          ]
        },
        {
          "uuid": "da1567ab-fa2a-4e8d-9590-6bf6f98aff56",
          "code": "1699-51-0",
          "codeText": "CAS# 1699-51-0 does not show stereochemistry",
          "type": "NON-SPECIFIC STEREOCHEMISTRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=$CODE$",
          "code_system": "CAS",
          "references": [
            "a56aad0f-fa2c-4402-aff8-0c258ac7cf17"
          ]
        },
        {
          "uuid": "35607748-2244-70b3-121f-32c8b5d98729",
          "code": "DTXSID30878577",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30878577",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "2bf7bc35-94ca-3c55-c2d4-9d7ab8a65606",
          "code": "35045",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=35045",
          "code_system": "NSC",
          "references": [
            "f0f4b610-5a38-de5a-7a7a-43a316efc925"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "5faa2049-5563-4a1b-bbd2-5826a49f2367",
          "name": "(1S)-1-((3,4-DIMETHOXYPHENYL)METHYL)-1,2,3,4-TETRAHYDRO-6,7-DIMETHOXY-2-METHYLISOQUINOLINE",
          "stdName": "(1S)-1-((3,4-DIMETHOXYPHENYL)METHYL)-1,2,3,4-TETRAHYDRO-6,7-DIMETHOXY-2-METHYLISOQUINOLINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9b843509-e41c-4774-9864-3c49f9690db5",
            "04c91391-6ee7-4d9d-bd93-c0be5a1ac13e"
          ],
          "display_name": false
        },
        {
          "uuid": "b80c0eb9-c2b0-426a-9812-3e666ce95595",
          "name": "(S)-(+)-LAUDANOSINE",
          "stdName": "(S)-(+)-LAUDANOSINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9b843509-e41c-4774-9864-3c49f9690db5",
            "04c91391-6ee7-4d9d-bd93-c0be5a1ac13e"
          ],
          "display_name": false
        },
        {
          "uuid": "395e0418-6b6c-436c-9c30-d882b595ee33",
          "name": "1,2,3,4-TETRAHYDRO-6,7-DIMETHOXY-2-METHYL-1-VERATRYLISOQUINOLINE",
          "stdName": "1,2,3,4-TETRAHYDRO-6,7-DIMETHOXY-2-METHYL-1-VERATRYLISOQUINOLINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9b843509-e41c-4774-9864-3c49f9690db5",
            "04c91391-6ee7-4d9d-bd93-c0be5a1ac13e"
          ],
          "display_name": false
        },
        {
          "uuid": "45cbdb13-d34d-481e-8af0-cf177fd2d615",
          "name": "Isoquinoline, 1-[(3,4-dimethoxyphenyl)methyl]-1,2,3,4-tetrahydro-6,7-dimethoxy-2-methyl-, (1S)-",
          "stdName": "ISOQUINOLINE, 1-((3,4-DIMETHOXYPHENYL)METHYL)-1,2,3,4-TETRAHYDRO-6,7-DIMETHOXY-2-METHYL-, (1S)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a56aad0f-fa2c-4402-aff8-0c258ac7cf17"
          ],
          "display_name": false
        },
        {
          "uuid": "d359ccfb-258b-453d-a826-c93f6af45c2e",
          "name": "LAUDANOSINE",
          "stdName": "LAUDANOSINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9b843509-e41c-4774-9864-3c49f9690db5",
            "c9547704-55a6-4194-aee6-a72072b361af",
            "8a73421f-f5de-4ec3-b831-cb20355d0b87",
            "9a365023-e338-4890-9b15-3635899e0215",
            "4acecaa9-0947-432e-85f3-1c7f8390be58",
            "1823acca-2c76-48b5-be37-8214f659633f",
            "04e28d50-a975-4d27-8f96-c55c48cab33b"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "78987f10-8328-4979-8e16-eac214a65920",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "9453ff9d-ffbc-4dfa-bd91-583498802a6f",
          "name": "LAUDANOSINE [MI]",
          "stdName": "LAUDANOSINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9b843509-e41c-4774-9864-3c49f9690db5",
            "9a365023-e338-4890-9b15-3635899e0215"
          ],
          "display_name": false
        },
        {
          "uuid": "f33bcee9-de46-4232-996b-feefcf26aa6e",
          "name": "N-METHYLTETRAHYDROPAPAVERINE",
          "stdName": "N-METHYLTETRAHYDROPAPAVERINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9b843509-e41c-4774-9864-3c49f9690db5",
            "04c91391-6ee7-4d9d-bd93-c0be5a1ac13e"
          ],
          "display_name": false
        },
        {
          "uuid": "0e2db302-8aeb-4911-8ae9-56cfd3fde320",
          "name": "NSC-35045",
          "stdName": "NSC-35045",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9b843509-e41c-4774-9864-3c49f9690db5",
            "575465b5-2061-4c0e-aa8a-6d6512335127"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "1823acca-2c76-48b5-be37-8214f659633f",
          "citation": "CHEMID 2011 Drugportal",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "4acecaa9-0947-432e-85f3-1c7f8390be58",
          "citation": "DRUGPORTAL 2011",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9a365023-e338-4890-9b15-3635899e0215",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9b843509-e41c-4774-9864-3c49f9690db5",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "04c91391-6ee7-4d9d-bd93-c0be5a1ac13e",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8a73421f-f5de-4ec3-b831-cb20355d0b87",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "575465b5-2061-4c0e-aa8a-6d6512335127",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "93516b81-26a2-4830-8183-97bd99286167",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391213000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7c8c1509-d120-4855-87b2-d3cc72c7519b",
          "citation": "SRS import [DA7R5WVN48]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=DA7R5WVN48",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391213000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4f47dee0-98bf-48db-ad8b-f623269bda6f",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c9547704-55a6-4194-aee6-a72072b361af",
          "citation": "LAUDANOSINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "04e28d50-a975-4d27-8f96-c55c48cab33b",
          "citation": "LAUDANOSINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a56aad0f-fa2c-4402-aff8-0c258ac7cf17",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f0f4b610-5a38-de5a-7a7a-43a316efc925",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "f220f8f3-d7ef-9fd8-a1d2-596158ef2b79",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0df9be3a-2941-4cfd-ab5f-0ff093ad1e1b",
          "id": "0df9be3a-2941-4cfd-ab5f-0ff093ad1e1b",
          "molfile": "\n  Marvin  01132100582D          \n\n 26 28  0  0  1  0            999 V2000\n    3.3882   -1.6963    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    3.3876   -0.8689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6680   -0.4625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9572   -0.8737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2429   -0.4609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2423    0.3663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5260    0.7702    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1844    0.3530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9474    0.7771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9531    1.5990    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6666    2.0134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6700    0.3678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6806   -2.1102    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9573   -1.6952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6807   -2.9316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3885   -3.3390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1052   -2.9273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8164   -3.3374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5299   -2.9231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2493   -3.3296    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2473   -4.1599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5324   -2.0986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2401   -1.6846    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2373   -0.8664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8161   -1.6947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0960   -2.1038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n 13  1  1  0  0  0  0\n  1 26  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n 12  3  2  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  6  9  2  0  0  0  0\n  8  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n  9 12  1  0  0  0  0\n 11 10  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 13  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  1  0  0  0  0\n 17 26  2  0  0  0  0\n 19 18  2  0  0  0  0\n 20 19  1  0  0  0  0\n 19 22  1  0  0  0  0\n 21 20  1  0  0  0  0\n 23 22  1  0  0  0  0\n 22 25  2  0  0  0  0\n 24 23  1  0  0  0  0\n 25 26  1  0  0  0  0\nM  END",
          "smiles": "CN1CCc2cc(c(cc2[C@@H]1Cc3ccc(c(c3)OC)OC)OC)OC",
          "formula": "C21H27NO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "358abc52-bd2c-4837-ab9d-866959c819ae"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "357.4442",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "7f1e79d7-2682-4908-84cb-ba8716906651",
      "version": "9",
      "structure": {
        "id": "aa8b45a1-8322-42d2-98d8-3f80877fbd1c",
        "molfile": "\n  Marvin  01132108512D          \n\n 26 28  0  0  1  0            999 V2000\n    4.0960   -2.1038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3882   -1.6963    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.6806   -2.1102    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1052   -2.9273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8161   -1.6947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5324   -2.0986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8164   -3.3374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5299   -2.9231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9474    0.7771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3876   -0.8689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6807   -2.9316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2423    0.3663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6700    0.3678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6680   -0.4625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3885   -3.3390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2429   -0.4609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9572   -0.8737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2401   -1.6846    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2493   -3.3296    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9531    1.5990    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5260    0.7702    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9573   -1.6952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2473   -4.1599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2373   -0.8664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6666    2.0134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1844    0.3530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  1  2  0  0  0  0\n  5  1  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  4  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9 13  1  0  0  0  0\n  2 10  1  1  0  0  0\n 11 15  1  0  0  0  0\n 12 16  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 10  1  0  0  0  0\n 15  4  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 14  1  0  0  0  0\n 18  6  1  0  0  0  0\n 19  8  1  0  0  0  0\n 20  9  1  0  0  0  0\n 21 12  1  0  0  0  0\n 22  3  1  0  0  0  0\n 23 19  1  0  0  0  0\n 24 18  1  0  0  0  0\n 25 20  1  0  0  0  0\n 26 21  1  0  0  0  0\n  8  7  2  0  0  0  0\n 11  3  1  0  0  0  0\n 12  9  2  0  0  0  0\nM  END",
        "smiles": "CN1CCc2cc(c(cc2[C@@H]1Cc3ccc(c(c3)OC)OC)OC)OC",
        "formula": "C21H27NO4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "357.4442",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "7c8c1509-d120-4855-87b2-d3cc72c7519b",
          "4f47dee0-98bf-48db-ad8b-f623269bda6f"
        ],
        "stereo_centers": 1
      },
      "unii": "DA7R5WVN48"
    }
  ]
}