{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f54a79c2-5267-47c6-bd71-d635d31190e0",
          "code": "2163-68-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2163-68-0",
          "code_system": "CAS",
          "references": [
            "5209ad8d-7013-46bf-91f4-08cf287b94ed",
            "259b79a0-bb73-4e76-a185-3626f049917d"
          ]
        },
        {
          "uuid": "8ea2c054-8dad-4e07-9ccf-b15b11c0e1e2",
          "code": "600803",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:122",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "5209ad8d-7013-46bf-91f4-08cf287b94ed"
          ]
        },
        {
          "uuid": "b3689127-f76d-bffc-2f4c-eff7738b8ee6",
          "code": "DTXSID6037807",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6037807",
          "code_system": "EPA CompTox",
          "references": [
            "a25f694d-b7d5-a7a4-d9f4-de06e25378c9"
          ]
        },
        {
          "uuid": "5a245e45-f4c8-990e-4ede-9a16218ef0d9",
          "code": "135398733",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/135398733",
          "code_system": "PUBCHEM",
          "references": [
            "a92082ae-90e2-ccaf-bf0b-5c23e42145b2"
          ]
        },
        {
          "uuid": "a0f4b833-618d-4a40-a049-463c47b26a44",
          "code": "D9Y04ELA63",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c58887a7-07a0-3993-c4f7-b6271151e7aa",
          "code": "18316",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:18316",
          "code_system": "CHEBI",
          "references": [
            "35eb585f-cef4-c64a-6f95-a82c7cc5986c"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3955805e-d0c8-4aca-a418-7ece6be861ec",
          "name": "2-HYDROXYATRAZINE",
          "stdName": "2-HYDROXYATRAZINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "56990038-1bee-4f65-9228-878f3d098326",
            "9246e94d-335f-4436-8a20-bfea314fec7b"
          ],
          "display_name": false
        },
        {
          "uuid": "f2e3092c-9cd2-4828-8cd4-d1f542ec860e",
          "name": "4-(ETHYLAMINO)-6-((1-METHYLETHYL)AMINO)-1,3,5-TRIAZIN-2(1H)-ONE",
          "stdName": "4-(ETHYLAMINO)-6-((1-METHYLETHYL)AMINO)-1,3,5-TRIAZIN-2(1H)-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "56990038-1bee-4f65-9228-878f3d098326",
            "9246e94d-335f-4436-8a20-bfea314fec7b"
          ],
          "display_name": false
        },
        {
          "uuid": "e894a72a-8ad9-430a-9b1f-2fb5cca21d2d",
          "name": "G-34048",
          "stdName": "G-34048",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "56990038-1bee-4f65-9228-878f3d098326",
            "9246e94d-335f-4436-8a20-bfea314fec7b"
          ],
          "display_name": false
        },
        {
          "uuid": "1fe94544-04f7-4a5f-9693-20a5ba1b9267",
          "name": "HYDROXYATRAZINE",
          "stdName": "HYDROXYATRAZINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "56990038-1bee-4f65-9228-878f3d098326",
            "9246e94d-335f-4436-8a20-bfea314fec7b"
          ],
          "display_name": true
        },
        {
          "uuid": "82a8215a-b656-4ef6-9b05-5037c8545d63",
          "name": "HYDROXYATRAZINE, 2-",
          "stdName": "HYDROXYATRAZINE, 2-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e0071957-e31a-4f0a-bf1f-2a8d11e10f6e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e0071957-e31a-4f0a-bf1f-2a8d11e10f6e",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "56990038-1bee-4f65-9228-878f3d098326",
          "citation": "chemid",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9246e94d-335f-4436-8a20-bfea314fec7b",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5209ad8d-7013-46bf-91f4-08cf287b94ed",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390954000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d98e39e8-c689-4d9c-b552-b3395cccbc36",
          "citation": "SRS import [D9Y04ELA63]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=D9Y04ELA63",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390954000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8c531dd4-d4c0-4c63-8732-3c2f924f7b56",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a25f694d-b7d5-a7a4-d9f4-de06e25378c9",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2163-68-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "259b79a0-bb73-4e76-a185-3626f049917d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a92082ae-90e2-ccaf-bf0b-5c23e42145b2",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "35eb585f-cef4-c64a-6f95-a82c7cc5986c",
          "doc_type": "SYSTEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a3f6ef62-ad92-408e-bb85-2c0129a2c164",
          "id": "a3f6ef62-ad92-408e-bb85-2c0129a2c164",
          "molfile": "\n  Marvin  01132108312D          \n\n 14 14  0  0  0  0            999 V2000\n    9.1615   -6.1220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4565   -6.5505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7389   -6.1427    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7389   -5.3111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9982   -4.9078    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9982   -4.0948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2441   -3.6364    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5391   -4.0304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8228   -3.6020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5391   -4.8148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7138   -3.6742    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4360   -4.0416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1310   -3.6364    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4360   -4.8905    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  4 14  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6 11  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  1  0  0  0  0\nM  END",
          "smiles": "CCNc1nc(NC(C)C)nc(=O)[nH]1",
          "formula": "C8H15N5O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ff4139a3-40dd-4d6b-a537-fdd482d54788"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "197.2379",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "4aea23a7-4b36-47c9-8821-f577d5d0e384",
      "version": "8",
      "structure": {
        "id": "ee0a696a-d1a5-4f11-913d-2a6484e312e1",
        "molfile": "\n  Marvin  01132112192D          \n\n 14 14  0  0  0  0            999 V2000\n    6.9982   -4.0948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9982   -4.9078    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7389   -5.3111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4360   -4.8905    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4360   -4.0416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7138   -3.6742    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1310   -3.6364    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7389   -6.1427    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4565   -6.5505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1615   -6.1220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2441   -3.6364    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5391   -4.0304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8228   -3.6020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5391   -4.8148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  1  6  2  0  0  0  0\n  5  7  1  0  0  0  0\n  3  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  1 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\nM  END",
        "smiles": "CCNc1nc(NC(C)C)nc(n1)O",
        "formula": "C8H15N5O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "197.2379",
        "optical_activity": "NONE",
        "references": [
          "d98e39e8-c689-4d9c-b552-b3395cccbc36",
          "8c531dd4-d4c0-4c63-8732-3c2f924f7b56"
        ],
        "stereo_centers": 0
      },
      "unii": "D9Y04ELA63"
    }
  ]
}