{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "39ae1e42-a547-4081-8f39-c7e7eb7fb1d4", "code": "14051-53-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=14051-53-7", "code_system": "CAS", "references": [ "c25ddfe9-a61e-4297-8b09-654ee62ed3c2" ] }, { "uuid": "be0ded7f-690c-4429-86f3-7cd2878ac0e6", "code": "145858", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/145858", "code_system": "PUBCHEM" }, { "uuid": "28f2ecc0-b96a-4f40-be56-6494f41b6a6b", "code": "D9PP99SH3U", "type": "PRIMARY", "code_system": "FDA UNII" } ], "relationships": [ { "uuid": "a7494df9-4e0f-4277-b2c0-09f2b456b074", "amount": { "uuid": "e1224b96-390f-4ed9-8cc8-36180cd5d1bd" }, "type": "SALT/SOLVATE->PARENT", "references": [ "b5eb8677-2bf2-4468-88c4-b76535902380" ], "related_substance": { "uuid": "3c93fc23-e896-4de0-b240-9d18672067cf", "refuuid": "b7b015f4-76e0-4e15-ae3c-a61778d486b9", "name": "Flavylium bromide", "unii": "25GYF4532E", "linking_id": "25GYF4532E", "ref_pname": "Flavylium bromide", "substance_class": "reference" } }, { "uuid": "4209bfdc-75cf-4fe9-aab2-09722a65202e", "amount": { "uuid": "06fc9b10-5bc4-4f83-bd18-59712d8e0118" }, "type": "IONIC MOIETY", "references": [ "c25ddfe9-a61e-4297-8b09-654ee62ed3c2" ], "related_substance": { "uuid": "f446e334-3824-48a7-8837-160c96e73729", "refuuid": "f8889aaf-2d86-4c58-8ab8-aa4d8bcac6a9", "name": "Flavylium", "unii": "D9PP99SH3U", "linking_id": "D9PP99SH3U", "ref_pname": "Flavylium", "substance_class": "reference" } }, { "uuid": "51e40cad-5713-462b-a424-cd3ededf51ac", "amount": { "uuid": "90ca5af4-2896-44e2-8adc-f57c057f8537" }, "type": "SALT/SOLVATE->PARENT", "related_substance": { "uuid": "f703ba3f-e6d9-428d-b589-8fb548a1dd5c", "refuuid": "2313a8a1-a46e-4b6d-b3da-d7c079d52db0", "name": "Flavylium chloride", "unii": "XL6JYL22YS", "linking_id": "XL6JYL22YS", "ref_pname": "Flavylium chloride", "substance_class": "reference" } }, { "uuid": "446f6907-592b-4b07-aebb-ec6217dc7007", "amount": { "uuid": "167b92b9-e059-412a-b06f-a8bec08fed44" }, "type": "SALT/SOLVATE->PARENT", "related_substance": { "uuid": "d5988403-780e-476d-82b4-05d165c01d6d", "refuuid": "ab018e65-5eb9-4fa1-99df-d04e20412208", "name": "Flavylium perchlorate", "unii": "28D26EQ8NU", "linking_id": "28D26EQ8NU", "ref_pname": "Flavylium perchlorate", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "e962d20a-3d21-4fed-bc68-c103d3800c07", "name": "1-Benzopyrylium, 2-phenyl-", "stdName": "1-BENZOPYRYLIUM, 2-PHENYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "c25ddfe9-a61e-4297-8b09-654ee62ed3c2" ], "display_name": false }, { "uuid": "27c28078-a2bf-4e64-a8e6-1caf5dd6b0d7", "name": "2-Phenyl-1-benzopyrylium", "stdName": "2-PHENYL-1-BENZOPYRYLIUM", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "c25ddfe9-a61e-4297-8b09-654ee62ed3c2" ], "display_name": false }, { "uuid": "5fead037-df0e-4ded-be5c-8c976d91c682", "name": "Flavylium", "stdName": "FLAVYLIUM", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c25ddfe9-a61e-4297-8b09-654ee62ed3c2" ], "display_name": true } ], "references": [ { "uuid": "c25ddfe9-a61e-4297-8b09-654ee62ed3c2", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE", "NOMEN" ] }, { "uuid": "b5eb8677-2bf2-4468-88c4-b76535902380", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "e1e64842-bab3-4219-b0f5-7da0ee4a54db", "id": "e1e64842-bab3-4219-b0f5-7da0ee4a54db", "molfile": "\n CDK 07052416372D\n\n 16 18 0 0 0 0 0 0 0 0999 V2000\n 6.4968 3.0006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1971 3.7512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8982 3.0010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8989 1.5002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1986 0.7496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4975 1.4998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6000 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6000 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6000 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6000 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3000 1.5000 0.0000 O 0 3 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 1 6 1 0 0 0 0\n 4 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 10 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 7 16 1 0 0 0 0\nM CHG 1 16 1\nM END", "smiles": "c1ccc(cc1)-c2ccc3ccccc3[o+]2", "formula": "C15H11O", "atropisomerism": "No", "charge": 1, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "1ae9d9ba-de2e-442e-a018-220c42101a1e" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "207.2478", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "f8889aaf-2d86-4c58-8ab8-aa4d8bcac6a9", "version": "5", "structure": { "id": "ac96fdfb-8c1a-4201-86c7-a2be0c085518", "molfile": "\n CDK 07052416372D\n\n 16 18 0 0 0 0 0 0 0 0999 V2000\n 6.4968 3.0006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1971 3.7512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8982 3.0010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8989 1.5002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1986 0.7496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4975 1.4998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6000 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6000 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6000 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6000 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3000 1.5000 0.0000 O 0 3 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 1 6 1 0 0 0 0\n 4 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 10 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 7 16 1 0 0 0 0\nM CHG 1 16 1\nM END", "smiles": "c1ccc(cc1)-c2ccc3ccccc3[o+]2", "formula": "C15H11O", "atropisomerism": "No", "charge": 1, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "207.2478", "optical_activity": "NONE", "references": [ "c25ddfe9-a61e-4297-8b09-654ee62ed3c2" ], "stereo_centers": 0 }, "unii": "D9PP99SH3U" } ] }