{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1c56131e-60a1-4a93-82bd-7d4a9e1a1b68",
          "code": "D8A2RW282W",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "2240817a-a283-426b-be46-a87565522ba6",
          "code": "574-09-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=574-09-4",
          "code_system": "CAS",
          "references": [
            "ec881f22-734b-428d-b36d-6973b2672b04",
            "aa6b71df-97bd-48bf-9dd9-16dd0743341a"
          ]
        },
        {
          "uuid": "a87131a9-5b06-48c2-9aab-797e7154d202",
          "code": "209-366-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.008.516",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "ec881f22-734b-428d-b36d-6973b2672b04"
          ]
        },
        {
          "uuid": "bf0e7454-dc1d-4256-8733-effca8483b1c",
          "code": "101778",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/101778",
          "code_system": "PUBCHEM",
          "references": [
            "ec881f22-734b-428d-b36d-6973b2672b04"
          ]
        },
        {
          "uuid": "7999b1e3-5b11-6be1-5439-a0ebd1514b9b",
          "code": "DTXSID40862220",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40862220",
          "code_system": "EPA CompTox",
          "references": [
            "9fe60bfa-9217-244d-07d4-eebd9b93d542"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "36c84023-29d5-40aa-9405-6953069f26a0",
          "amount": {
            "uuid": "ea3e28e1-f16b-4082-bb58-aa5782ff78e8"
          },
          "type": "ENANTIOMER->RACEMATE",
          "references": [
            "9d94a2da-fd38-47cd-952b-b3c8dae9ea32"
          ],
          "related_substance": {
            "uuid": "2d5c2c5f-df32-4596-87c4-f925ff37b97c",
            "refuuid": "d3c125d7-9cd3-45e6-9d7d-c67a8310fe8e",
            "name": "Benzoin ethyl ether, (R)-",
            "unii": "QQ96QT6GZZ",
            "linking_id": "QQ96QT6GZZ",
            "ref_pname": "Benzoin ethyl ether, (R)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "91208fd4-a229-4567-91d1-66327812f894",
          "amount": {
            "uuid": "74a5734e-bbbb-49e9-b6c3-14e4162b294d"
          },
          "type": "ENANTIOMER->RACEMATE",
          "references": [
            "64f81a3c-8bee-4752-b993-4f439ff65e8e"
          ],
          "related_substance": {
            "uuid": "bdeb3b83-94d1-48c9-ab4f-0cdbaf461088",
            "refuuid": "3876f578-806b-4378-87e6-b204da1b142f",
            "name": "Benzoin ethyl ether, (S)-",
            "unii": "32Z64YX4XA",
            "linking_id": "32Z64YX4XA",
            "ref_pname": "Benzoin ethyl ether, (S)-",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "70377037-d4ab-4563-9cc6-8c430c85eb26",
          "name": "2-Ethoxy-1,2-diphenylethanone",
          "stdName": "2-ETHOXY-1,2-DIPHENYLETHANONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aa6b71df-97bd-48bf-9dd9-16dd0743341a"
          ],
          "display_name": false
        },
        {
          "uuid": "f0e0cd33-4f6f-4495-9a85-dc06991c18be",
          "name": "Benzoin ethyl ether",
          "stdName": "BENZOIN ETHYL ETHER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "03e7dfa2-2ce7-4667-b502-db6e175a3a9e"
          ],
          "display_name": true
        },
        {
          "uuid": "039e9ff6-f6d1-40da-a5e4-50d9bfc3d525",
          "name": "Ethanone, 2-ethoxy-1,2-diphenyl-",
          "stdName": "ETHANONE, 2-ETHOXY-1,2-DIPHENYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aa6b71df-97bd-48bf-9dd9-16dd0743341a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "03e7dfa2-2ce7-4667-b502-db6e175a3a9e",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ec881f22-734b-428d-b36d-6973b2672b04",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392770000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9fe60bfa-9217-244d-07d4-eebd9b93d542",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "aa6b71df-97bd-48bf-9dd9-16dd0743341a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9d94a2da-fd38-47cd-952b-b3c8dae9ea32",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "64f81a3c-8bee-4752-b993-4f439ff65e8e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f12ea308-b817-4a65-a247-8e1c4a8fd218",
          "id": "f12ea308-b817-4a65-a247-8e1c4a8fd218",
          "molfile": "\n  CDK     12262418362D\n\n 18 19  0  0  0  0  0  0  0  0999 V2000\n   22.0485  -11.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.0485   -9.6463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.3995   -8.8664    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.3995   -7.3064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.7504   -6.5265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.7499   -4.9657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.1009   -4.1857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.4523   -4.9665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.4529   -6.5273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.1019   -7.3073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.0485   -6.5265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.0485   -4.9665    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   20.6976   -7.3064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.6981   -8.8672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.3471   -9.6472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.9957   -8.8664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.9951   -7.3056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.3461   -6.5256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n  5 10  1  0  0  0  0\n  4 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 13 18  1  0  0  0  0\nM  END",
          "smiles": "CCOC(c1ccccc1)C(=O)c2ccccc2",
          "formula": "C16H16O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "adecf98b-7f98-4a06-9012-0be2cffe2894"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "240.2976",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "32be984d-0902-404f-b722-ac899edce480",
      "version": "11",
      "structure": {
        "id": "9d630c07-bc64-4666-9055-dd42798d7c5c",
        "molfile": "\n   JSDraw212262418362D\n\n 18 19  0  0  0  0              0 V2000\n   22.0485  -11.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.0485   -9.6463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.3995   -8.8664    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.3995   -7.3064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.7504   -6.5265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.7499   -4.9657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.1009   -4.1857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.4523   -4.9665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.4529   -6.5273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.1019   -7.3073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.0485   -6.5265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.0485   -4.9665    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   20.6976   -7.3064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.6981   -8.8672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.3471   -9.6472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.9957   -8.8664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.9951   -7.3056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.3461   -6.5256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n  5 10  1  0  0  0  0\n  4 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 13 18  1  0  0  0  0\nM  END",
        "smiles": "CCOC(c1ccccc1)C(=O)c2ccccc2",
        "formula": "C16H16O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "240.2976",
        "optical_activity": "( + / - )",
        "references": [
          "03e7dfa2-2ce7-4667-b502-db6e175a3a9e"
        ],
        "stereo_centers": 1
      },
      "unii": "D8A2RW282W"
    }
  ]
}