{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b090aa83-5a43-4862-b315-bfcca5e28d39",
          "code": "1246371-29-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1246371-29-8",
          "code_system": "CAS",
          "references": [
            "15e8af67-0e4e-44d2-9941-97be3bd5e368",
            "3a14430a-ad22-4ec0-a1d3-8160a5bd2af8"
          ]
        },
        {
          "uuid": "844e40a5-68b4-4fac-892d-994d25d5b0f9",
          "code": "1427065",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1427065/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "15e8af67-0e4e-44d2-9941-97be3bd5e368"
          ]
        },
        {
          "uuid": "2c14a54b-c1e6-41ac-992e-07db9341a6eb",
          "code": "56843908",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/56843908",
          "code_system": "PUBCHEM",
          "references": [
            "15e8af67-0e4e-44d2-9941-97be3bd5e368"
          ]
        },
        {
          "uuid": "7d66c2d3-d61f-c224-2ce0-2a1063c78c31",
          "code": "DB11272",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB11272",
          "code_system": "DRUG BANK",
          "references": [
            "2cc96125-0981-e2ed-f39a-e79acd8e64b8"
          ]
        },
        {
          "uuid": "03889b43-c7fb-412c-b92d-dac70c44b6ed",
          "code": "D7PH6N3IEI",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "281c3e2c-f2fe-0346-0f6b-45043a58dbe6",
          "code": "D7PH6N3IEI",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=D7PH6N3IEI",
          "code_system": "DAILYMED",
          "references": [
            "d4b660a3-7108-4d01-df73-adb12e04fe0e"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "7a3b7f1f-653f-426c-9cf0-46d95311f145",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "9b43492b-4ea4-41e5-9590-164befab5785",
            "refuuid": "b78ba023-5e04-43a2-9749-17304e607edd",
            "name": "METHYL UNDECENOYL LEUCINATE",
            "unii": "D7PH6N3IEI",
            "linking_id": "D7PH6N3IEI",
            "ref_pname": "METHYL UNDECENOYL LEUCINATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "53bdcc46-e2f5-4bcf-bf1e-343dd2206af6",
          "name": "L-LEUCINE, N-(1-OXO-10-UNDECEN-1-YL)-, METHYL ESTER",
          "stdName": "L-LEUCINE, N-(1-OXO-10-UNDECEN-1-YL)-, METHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1f7d1119-b7fe-42c7-9418-0dbc474e504b",
            "c81ec184-c49c-4365-8b57-fb783b9ca39f"
          ],
          "display_name": false
        },
        {
          "uuid": "1aa0cf4e-e8dc-4215-836b-be758949d4ac",
          "name": "METHYL UNDECENOYL LEUCINATE",
          "stdName": "METHYL UNDECENOYL LEUCINATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "425f8a10-4691-48f1-bc9f-da3d3a6807f6",
            "1f7d1119-b7fe-42c7-9418-0dbc474e504b",
            "85065c54-3d0c-44f7-a444-684b12ad9518"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "b5fc38c7-5597-439d-821b-7fabc2d6286a",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "85065c54-3d0c-44f7-a444-684b12ad9518",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1f7d1119-b7fe-42c7-9418-0dbc474e504b",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c81ec184-c49c-4365-8b57-fb783b9ca39f",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "15e8af67-0e4e-44d2-9941-97be3bd5e368",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391232000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ef6bf40a-4bad-454e-bb73-34be92e6f24d",
          "citation": "SRS import [D7PH6N3IEI]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=D7PH6N3IEI",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391232000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "425f8a10-4691-48f1-bc9f-da3d3a6807f6",
          "citation": "METHYL UNDECENOYL LEUCINATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2cc96125-0981-e2ed-f39a-e79acd8e64b8",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "3a14430a-ad22-4ec0-a1d3-8160a5bd2af8",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d4b660a3-7108-4d01-df73-adb12e04fe0e",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "043107d4-76c4-4f46-8dab-ee9490acd716",
          "id": "043107d4-76c4-4f46-8dab-ee9490acd716",
          "molfile": "\n  Marvin  01132100312D          \n\n 22 21  0  0  1  0            999 V2000\n   13.9371   -7.6710    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   13.9371   -8.4960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8119   -9.0743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8119   -9.8992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5264   -8.6618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2227   -7.2585    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5082   -7.6710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5082   -8.4960    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7936   -7.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0792   -7.6710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3647   -7.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6502   -7.6710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9358   -7.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2213   -7.6710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5069   -7.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7924   -7.6710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0779   -7.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3635   -7.6710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6516   -7.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6516   -6.4335    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3661   -7.6710    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0805   -7.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  6  1  6  0  0  0\n  1 19  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  2  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 20  2  0  0  0  0\n 19 21  1  0  0  0  0\n 21 22  1  0  0  0  0\nM  END",
          "smiles": "C=CCCCCCCCCC(=O)N[C@@H](CC(C)C)C(=O)OC",
          "formula": "C18H33NO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1f1ea709-d9cf-4b81-8123-dd960f34b262"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "311.4602",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b78ba023-5e04-43a2-9749-17304e607edd",
      "version": "6",
      "structure": {
        "id": "f70ce92a-21aa-4c8e-9042-92433429ca4f",
        "molfile": "\n  Marvin  01132112482D          \n\n 22 21  0  0  1  0            999 V2000\n    5.3635   -7.6710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0779   -7.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7924   -7.6710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5069   -7.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2213   -7.6710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9358   -7.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6502   -7.6710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3647   -7.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0792   -7.6710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7936   -7.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5082   -7.6710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2227   -7.2585    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9371   -7.6710    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   14.6516   -7.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3661   -7.6710    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0805   -7.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5082   -8.4960    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9371   -8.4960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8119   -9.0743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8119   -9.8992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5264   -8.6618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6516   -6.4335    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 11 17  2  0  0  0  0\n 13 18  1  6  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  1  0  0  0  0\n 14 22  2  0  0  0  0\nM  END",
        "smiles": "C=CCCCCCCCCC(=O)N[C@@H](CC(C)C)C(=O)OC",
        "formula": "C18H33NO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "311.4602",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "ef6bf40a-4bad-454e-bb73-34be92e6f24d",
          "85065c54-3d0c-44f7-a444-684b12ad9518"
        ],
        "stereo_centers": 1
      },
      "unii": "D7PH6N3IEI"
    }
  ]
}