{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "e3ab7da7-527f-45a7-8eb6-e40ca90b0b6e", "code": "D6H647726W", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "d838cf8b-0ae6-7e2e-7d12-758071482c59", "code": "739884", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/739884", "code_system": "PUBCHEM", "references": [ "d1045551-9e46-2807-de3e-9422c54dfc6e" ] } ], "relationships": [ { "uuid": "37e7babe-d33a-4fe6-97f9-ac0d6318063b", "amount": { "uuid": "ec4e09f4-2718-4f3a-9777-d69c16d848a1", "average": 3.19, "units": "MICROMOLAR" }, "qualification": "IC50", "type": "TARGET->INHIBITOR", "references": [ "936eb761-15d0-7e14-7df9-9c6a54260ea4" ], "related_substance": { "uuid": "de4cad96-6182-4173-91c7-56ad5e4db8ef", "refuuid": "4a74bd50-afd5-47d1-a7e7-ab061601f831", "name": "(3-METHYL-2-OXOBUTANOATE DEHYDROGENASE (LIPOAMIDE)) KINASE, MITOCHONDRIAL", "unii": "TNF61X6TFD", "linking_id": "TNF61X6TFD", "ref_pname": "(3-METHYL-2-OXOBUTANOATE DEHYDROGENASE (LIPOAMIDE)) KINASE, MITOCHONDRIAL", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "1154860f-fb8f-2262-c8f8-9caa29a1c008", "name": "3,6-DICHLORO-1-BENZOTHIOPHENE-2-CARBOXYLIC ACID", "stdName": "3,6-DICHLORO-1-BENZOTHIOPHENE-2-CARBOXYLIC ACID", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "936eb761-15d0-7e14-7df9-9c6a54260ea4" ], "display_name": true }, { "uuid": "bc7d5232-5ee9-3567-52dc-6baf5a913f1f", "name": "3,6-DICHLOROBENZO(B)THIOPHENE-2-CARBOXYLIC ACID", "stdName": "3,6-DICHLOROBENZO(B)THIOPHENE-2-CARBOXYLIC ACID", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "1766fc21-65d7-7f1b-965f-69fd7d6e4513" ], "display_name": false }, { "uuid": "43720c9e-5fcd-e877-42d7-568d0326deb1", "name": "3,6-DICHLOROBENZOTHIOPHENE-2-CARBOXYLIC ACID", "stdName": "3,6-DICHLOROBENZOTHIOPHENE-2-CARBOXYLIC ACID", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "1766fc21-65d7-7f1b-965f-69fd7d6e4513" ], "display_name": false }, { "uuid": "834ab638-88c0-5351-0114-2bea9bfe586d", "name": "BENZO(B)THIOPHENE-2-CARBOXYLIC ACID, 3,6-DICHLORO-", "stdName": "BENZO(B)THIOPHENE-2-CARBOXYLIC ACID, 3,6-DICHLORO-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "1766fc21-65d7-7f1b-965f-69fd7d6e4513" ], "display_name": false } ], "references": [ { "uuid": "1766fc21-65d7-7f1b-965f-69fd7d6e4513", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "936eb761-15d0-7e14-7df9-9c6a54260ea4", "citation": "Inxight Drugs", "doc_type": "NCATS List", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "d1045551-9e46-2807-de3e-9422c54dfc6e", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "39e6d559-af81-0705-a288-30f833b6f84b", "id": "39e6d559-af81-0705-a288-30f833b6f84b", "molfile": "\n Marvin 01132103042D \n\n 14 15 0 0 0 0 999 V2000\n 16.1202 -5.2085 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8653 -4.4239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0807 -4.1689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0807 -3.3439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8653 -3.0890 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3502 -3.7565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1752 -3.7565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.5877 -4.4709 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.5877 -3.0420 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3662 -2.9315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6517 -3.3439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6517 -4.1689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3662 -4.5815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9373 -2.9315 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 6 2 0 0 0 0\n 3 4 2 0 0 0 0\n 3 13 1 0 0 0 0\n 4 5 1 0 0 0 0\n 4 10 1 0 0 0 0\n 6 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 9 2 0 0 0 0\n 10 11 2 0 0 0 0\n 12 11 1 0 0 0 0\n 11 14 1 0 0 0 0\n 13 12 2 0 0 0 0\nM END", "smiles": "c1cc2c(cc1Cl)sc(c2Cl)C(=O)O", "formula": "C9H4Cl2O2S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "3cd29959-2653-4969-8ef1-b55a4765a8c3" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "247.0992", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "3782db03-3d7d-4c8f-b84a-9993234508b7", "version": "7", "structure": { "id": "95a0fbed-d97b-08fc-e489-2dc85a1711cf", "molfile": "\n Marvin 01132107462D \n\n 14 15 0 0 0 0 999 V2000\n 16.1202 -2.9314 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8652 -3.7161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0806 -3.9711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0806 -4.7961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3662 -5.2086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6518 -4.7961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9373 -5.2086 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3662 -3.5586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6518 -3.9711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3502 -4.3836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8652 -5.0510 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1752 -4.3836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.5877 -3.6691 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.5877 -5.0980 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 3 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 6 9 1 0 0 0 0\n 2 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 4 11 1 0 0 0 0\n 10 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 14 2 0 0 0 0\nM END", "smiles": "c1cc2c(cc1Cl)sc(c2Cl)C(=O)O", "formula": "C9H4Cl2O2S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "247.0992", "optical_activity": "NONE", "references": [ "1766fc21-65d7-7f1b-965f-69fd7d6e4513" ], "stereo_centers": 0 }, "unii": "D6H647726W" } ] }