{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "194c2d7e-fb54-456c-8ed6-bd142d40c2d6", "code": "3478-15-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=3478-15-7", "code_system": "CAS", "references": [ "e0258907-1976-403a-91d5-3813d65786e5", "f58a0a10-0f52-4771-b035-613ca5ac42c0" ] }, { "uuid": "6d502503-69d1-4341-b24f-fc48f59e577a", "code": "C65578", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C65578", "code_system": "NCI_THESAURUS", "references": [ "e0258907-1976-403a-91d5-3813d65786e5" ] }, { "uuid": "2be5cc11-0740-46f2-8d9a-a01677866380", "code": "SUB07306MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "e0258907-1976-403a-91d5-3813d65786e5" ] }, { "uuid": "654e547d-bd12-432d-925b-eee9f4424aea", "code": "2774", "type": "PRIMARY", "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=2774", "code_system": "INN", "references": [ "e0258907-1976-403a-91d5-3813d65786e5" ] }, { "uuid": "f12eb3b3-ade9-4b26-862a-015e96717e9c", "code": "222-453-5", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.020.413", "code_system": "ECHA (EC/EINECS)", "references": [ "e0258907-1976-403a-91d5-3813d65786e5" ] }, { "uuid": "689abb22-b40f-402e-9511-f14efd959db8", "code": "CHEMBL2110828", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2110828", "code_system": "ChEMBL", "references": [ "e0258907-1976-403a-91d5-3813d65786e5" ] }, { "uuid": "b8b78e5e-4dc0-4f51-8f96-7b37e12db008", "code": "71521", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71521", "code_system": "PUBCHEM", "references": [ "e0258907-1976-403a-91d5-3813d65786e5" ] }, { "uuid": "611d7f7f-406c-467f-df3c-95805e6e0ae4", "code": "C29704", "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Anticholinergic Agent[C66880]|Antimuscarinic Agent", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29704", "code_system": "NCI_THESAURUS", "references": [ "90f41adb-a6c6-a7c6-dc94-236f5468ea1b" ] }, { "uuid": "0be87d29-b106-4526-8832-78bb12efb797", "code": "D6FH7ALQ18", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "3bf9ea10-c581-df75-a470-052e2ddb1573", "code": "100000082077", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "5e01b2a6-3f8d-f247-f17e-1b31181da616" ] }, { "uuid": "7c4ea150-2deb-aa3c-4a1b-de7f415cd77f", "code": "DTXSID40956259", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40956259", "code_system": "EPA CompTox", "references": [ "90f41adb-a6c6-a7c6-dc94-236f5468ea1b" ] } ], "relationships": [ { "uuid": "53d2ac92-8e4d-4ba3-88dd-38a25a24d297", "type": "PARENT->SALT/SOLVATE", "related_substance": { "uuid": "83ec3f19-f5e1-42ff-99d6-a0bdd9f37e53", "refuuid": "481b4e06-29ea-401c-bfeb-f51135021732", "name": "ETIPIRIUM", "unii": "M102M1O19A", "linking_id": "M102M1O19A", "ref_pname": "ETIPIRIUM", "substance_class": "reference" } }, { "uuid": "89fda5d1-5c74-4d0b-ae90-010440ce68d0", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "a42ac6b8-fae7-49ea-a816-bea73a452150", "refuuid": "481b4e06-29ea-401c-bfeb-f51135021732", "name": "ETIPIRIUM", "unii": "M102M1O19A", "linking_id": "M102M1O19A", "ref_pname": "ETIPIRIUM", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "6d5fa13a-ff44-45d9-b517-52d1b6608cbe", "name": "1-(2-HYDROXYETHYL)-1-METHYLPYRROLIDINIUM IODIDE BENZILATE (ESTER)", "stdName": "1-(2-HYDROXYETHYL)-1-METHYLPYRROLIDINIUM IODIDE BENZILATE (ESTER)", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "73700278-05ba-41c6-86c7-44fd75a38ca0" ], "display_name": false }, { "uuid": "1546a050-174c-47f0-bdb3-e175614a2c69", "name": "ETIPIRIUM IODIDE", "stdName": "ETIPIRIUM IODIDE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "e160da58-8390-4753-aa8d-d37cc529b8ad", "137c1fee-f086-4651-a22c-ea539bd5a740", "6339dd2b-5553-4d05-967a-2612da16250c" ], "display_name": true, "domains": [ "drug" ], "name_orgs": [ { "uuid": "dbe92346-e7b3-495e-9427-0bfe5e4778fc", "name_org": "INN" } ] }, { "uuid": "f9652203-9f72-43b0-a328-366d6e99b6b8", "name": "IMPE", "stdName": "IMPE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "73700278-05ba-41c6-86c7-44fd75a38ca0" ], "display_name": false }, { "uuid": "87975a51-6a37-4852-bcb7-4b24612163e5", "name": "etipirium iodide [INN]", "stdName": "ETIPIRIUM IODIDE [INN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "137c1fee-f086-4651-a22c-ea539bd5a740" ], "display_name": false } ], "references": [ { "uuid": "6339dd2b-5553-4d05-967a-2612da16250c", "citation": "USP Dictionary 2009", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "73700278-05ba-41c6-86c7-44fd75a38ca0", "citation": "USP DICTIONARY 2009", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "137c1fee-f086-4651-a22c-ea539bd5a740", "citation": "INN Proposed List 22", "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL22.pdf", "doc_type": "INN_LIST", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "e0258907-1976-403a-91d5-3813d65786e5", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390689000, "tags": [ "NOMEN" ] }, { "uuid": "a17da06c-858f-4f1f-95af-2175bf795961", "citation": "SRS import [D6FH7ALQ18]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=D6FH7ALQ18", "doc_type": "SRS", "public_domain": true, "document_date": 1493390689000, "tags": [ "NOMEN" ] }, { "uuid": "e160da58-8390-4753-aa8d-d37cc529b8ad", "citation": "ETIPIRIUM IODIDE [INN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "90f41adb-a6c6-a7c6-dc94-236f5468ea1b", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "f58a0a10-0f52-4771-b035-613ca5ac42c0", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "5e01b2a6-3f8d-f247-f17e-1b31181da616", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "62745553-6a15-4edf-a738-afe17044cab8", "id": "62745553-6a15-4edf-a738-afe17044cab8", "molfile": "\n Marvin 01132105062D \n\n 1 0 0 0 0 0 999 V2000\n 6.0340 -0.6954 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0\nM END", "smiles": "I", "formula": "HI", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "e59feb85-1e5d-4c26-ad8b-6cd5244e79c7" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "127.9124", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "13ec3623-9521-4263-9210-9f4676971c00", "id": "13ec3623-9521-4263-9210-9f4676971c00", "molfile": "\n Marvin 01132101142D \n\n 25 27 0 0 0 0 999 V2000\n 3.6354 0.4040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8816 -0.3498 0.0000 N 0 3 0 0 0 0 0 0 0 3 0 0\n 2.2904 0.2873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5783 -0.1249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8662 0.2873 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1541 -0.1249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1541 -0.9494 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5580 0.2873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2701 -0.1249 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 0.0999 1.0036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3158 1.7101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0885 2.4261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9171 2.4335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3334 1.7209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9254 1.0055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1243 1.0036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.9483 0.9990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3663 1.7118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.9545 2.4356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1250 2.4377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7093 1.7219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2170 -0.7862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4694 -1.5700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2939 -1.5700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5505 -0.7862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 22 1 0 0 0 0\n 25 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 6 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 10 1 0 0 0 0\n 8 16 1 0 0 0 0\n 11 10 1 0 0 0 0\n 10 15 2 0 0 0 0\n 12 11 2 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 2 0 0 0 0\n 15 14 1 0 0 0 0\n 17 16 1 0 0 0 0\n 16 21 2 0 0 0 0\n 18 17 2 0 0 0 0\n 19 18 1 0 0 0 0\n 20 19 2 0 0 0 0\n 21 20 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\nM CHG 2 2 1 9 -1\nM END", "smiles": "C[N+]1(CCCC1)CCOC(=O)C(c2ccccc2)(c3ccccc3)[O-]", "formula": "C21H25NO3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "01aabf2e-859d-4b76-ac0c-da23b30d7cef" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "339.4289", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "06c85ad7-78fc-4af6-8a89-ab3e090f419a", "version": "6", "structure": { "id": "e902dbe7-f9f8-4b85-be76-e9d71ebdb491", "molfile": "\n Marvin 01132112032D \n\n 26 27 0 0 0 0 999 V2000\n 2.4694 -1.5700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2939 -1.5700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5505 -0.7862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8816 -0.3498 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 2.2170 -0.7862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2904 0.2873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5783 -0.1249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8662 0.2873 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1541 -0.1249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5580 0.2873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2701 -0.1249 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1541 -0.9494 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1243 1.0036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0999 1.0036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9254 1.0055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3334 1.7209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9171 2.4335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0885 2.4261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3158 1.7101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7093 1.7219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1250 2.4377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.9545 2.4356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3663 1.7118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.9483 0.9990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6354 0.4040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0340 -0.6954 0.0000 I 0 5 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 10 13 1 0 0 0 0\n 4 6 1 0 0 0 0\n 10 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 6 7 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 7 8 1 0 0 0 0\n 17 18 1 0 0 0 0\n 2 3 1 0 0 0 0\n 18 19 2 0 0 0 0\n 19 14 1 0 0 0 0\n 8 9 1 0 0 0 0\n 13 20 2 0 0 0 0\n 3 4 1 0 0 0 0\n 20 21 1 0 0 0 0\n 9 10 1 0 0 0 0\n 21 22 2 0 0 0 0\n 4 5 1 0 0 0 0\n 22 23 1 0 0 0 0\n 10 11 1 0 0 0 0\n 23 24 2 0 0 0 0\n 24 13 1 0 0 0 0\n 5 1 1 0 0 0 0\n 25 4 1 0 0 0 0\n 9 12 2 0 0 0 0\nM CHG 2 4 1 26 -1\nM END", "smiles": "C[N+]1(CCCC1)CCOC(=O)C(c2ccccc2)(c3ccccc3)O.[I-]", "formula": "C21H26NO3.I", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "467.3413", "optical_activity": "NONE", "references": [ "a17da06c-858f-4f1f-95af-2175bf795961", "6339dd2b-5553-4d05-967a-2612da16250c", "137c1fee-f086-4651-a22c-ea539bd5a740" ], "stereo_centers": 0 }, "unii": "D6FH7ALQ18" } ] }