{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "7040874a-e2d3-45ff-802f-215d4e288d3c", "code": "124172-53-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=124172-53-8", "code_system": "CAS", "references": [ "c1a4c803-237f-467f-8663-19ba82fab443", "4e227533-a648-42f2-b420-f5f9435bef9d" ] }, { "uuid": "6a0a7881-d514-48c8-b1e2-eb67d8c759d6", "code": "FCN NO. 647", "comments": "FCN|UV LIGHT STABILIZER|POLYMERS", "type": "PRIMARY", "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=647", "code_system": "Food Contact Sustance Notif, (FCN No.)", "references": [ "c1a4c803-237f-467f-8663-19ba82fab443" ] }, { "uuid": "69119b19-288f-4331-8acc-26daea5a4c41", "code": "14419064", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/14419064", "code_system": "PUBCHEM", "references": [ "c1a4c803-237f-467f-8663-19ba82fab443" ] }, { "uuid": "bdce63eb-1157-be49-aa08-753c1cbbd2b4", "code": "DTXSID9073094", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9073094", "code_system": "EPA CompTox", "references": [ "1f39b4c8-73e4-640f-27fa-af365d151b14" ] }, { "uuid": "df8e8be4-17c8-4156-96b0-f4c345545163", "code": "D695806T7B", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "726e5314-d5af-4591-a067-84828010550a", "name": "4050H", "stdName": "4050H", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4302de29-0967-4cf8-bad5-1debe4945461" ], "display_name": false }, { "uuid": "5c7f7610-4163-4971-94c8-6fc1d40cc0e1", "name": "FORMAMIDE, N,N'-1,6-HEXANEDIYLBIS(N-(2,2,6,6-TETRAMETHYL-4- PIPERIDINYL)-", "stdName": "FORMAMIDE, N,N'-1,6-HEXANEDIYLBIS(N-(2,2,6,6-TETRAMETHYL-4- PIPERIDINYL)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "20dbedfa-436f-4113-87d8-0fb2c71fd005" ], "display_name": false }, { "uuid": "0d8498e7-e218-44f9-934d-8d8223a2d16b", "name": "N,N'-1,6-HEXANEDIYLBIS(N-(2,2,6,6-TETRAMETHYL-4-PIPERIDINYL)FORMAMIDE)", "stdName": "N,N'-1,6-HEXANEDIYLBIS(N-(2,2,6,6-TETRAMETHYL-4-PIPERIDINYL)FORMAMIDE)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "f634aef4-bba0-4c1e-bcf0-c937aafa6b25" ], "display_name": false }, { "uuid": "770afdf9-880d-4e44-b65b-82e3500b8308", "name": "N,N'-BIS(2,2,6,6-TETRAMETHYL-4-PIPERIDYL)-N,N'-DIFORMYLHEXAMETHYLENEDIAMINE", "stdName": "N,N'-BIS(2,2,6,6-TETRAMETHYL-4-PIPERIDYL)-N,N'-DIFORMYLHEXAMETHYLENEDIAMINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "4302de29-0967-4cf8-bad5-1debe4945461" ], "display_name": true }, { "uuid": "0eb81292-a6cd-40bb-8fe1-d85a15ab452d", "name": "N,N'-BIS(FORMYL)-N,N'-BIS(2,2,6,6-TETRAMETHYL-4-PIPERIDYL)-1,6-HEXAMETHYLENEDIAMINE", "stdName": "N,N'-BIS(FORMYL)-N,N'-BIS(2,2,6,6-TETRAMETHYL-4-PIPERIDYL)-1,6-HEXAMETHYLENEDIAMINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4302de29-0967-4cf8-bad5-1debe4945461" ], "display_name": false }, { "uuid": "f85e0571-3f18-46c4-96be-0ea211300658", "name": "N,N'-BISFORMYL-N,N'-BIS(2,2,6,6-TETRAMETHYL-4-PIPERIDYL)HEXAMETHYLENEDIAMINE", "stdName": "N,N'-BISFORMYL-N,N'-BIS(2,2,6,6-TETRAMETHYL-4-PIPERIDYL)HEXAMETHYLENEDIAMINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "4302de29-0967-4cf8-bad5-1debe4945461" ], "display_name": false }, { "uuid": "28d983ac-2ffd-4609-8e66-a34636469c4e", "name": "UVINUL FK 4145", "stdName": "UVINUL FK 4145", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4302de29-0967-4cf8-bad5-1debe4945461" ], "display_name": false } ], "references": [ { "uuid": "f634aef4-bba0-4c1e-bcf0-c937aafa6b25", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "20dbedfa-436f-4113-87d8-0fb2c71fd005", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4302de29-0967-4cf8-bad5-1debe4945461", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c1a4c803-237f-467f-8663-19ba82fab443", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391756000, "tags": [ "NOMEN" ] }, { "uuid": "425a712a-803a-46a3-a099-312c9a082ce3", "citation": "SRS import [D695806T7B]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=D695806T7B", "doc_type": "SRS", "public_domain": true, "document_date": 1493391756000, "tags": [ "NOMEN" ] }, { "uuid": "1f39b4c8-73e4-640f-27fa-af365d151b14", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=124172-53-8", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "4e227533-a648-42f2-b420-f5f9435bef9d", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "3aa7782d-5e9d-45c5-96b3-0c77ffee75dd", "id": "3aa7782d-5e9d-45c5-96b3-0c77ffee75dd", "molfile": "\n Marvin 01132103072D \n\n 32 33 0 0 0 0 999 V2000\n 0.9612 2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7862 2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3737 2.9832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7862 1.4437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5006 1.0312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2151 1.4437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2151 2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6276 2.9832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0401 2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5006 2.6812 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5006 0.2062 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7862 -0.2063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0717 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3572 -0.2063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3572 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0717 -0.2063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7862 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5006 -0.2063 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2151 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9296 -0.2063 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5006 -1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7862 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7862 -2.2688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9612 -2.2688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3737 -2.9832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5006 -2.6813 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2151 -2.2688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6276 -2.9832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.0401 -2.2688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2151 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2151 -0.2063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9296 0.2062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 4 2 1 0 0 0 0\n 10 2 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 11 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 9 1 0 0 0 0\n 10 7 1 0 0 0 0\n 12 11 1 0 0 0 0\n 31 11 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 19 18 1 0 0 0 0\n 18 21 1 0 0 0 0\n 19 20 2 0 0 0 0\n 21 22 1 0 0 0 0\n 30 21 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 23 25 1 0 0 0 0\n 26 23 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 27 29 1 0 0 0 0\n 27 30 1 0 0 0 0\n 31 32 2 0 0 0 0\nM END", "smiles": "CC1(C)CC(CC(C)(C)N1)N(CCCCCCN(C=O)C2CC(C)(C)NC(C)(C)C2)C=O", "formula": "C26H50N4O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "bc42a721-a70f-4e4a-8648-013ef37a477e" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "450.7018", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "7f301409-8f64-446b-9550-75a789a15aad", "version": "3", "structure": { "id": "d1716c3b-1a9f-43ca-a171-9533855c7e41", "molfile": "\n Marvin 01132110492D \n\n 32 33 0 0 0 0 999 V2000\n 1.7862 -0.2063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0717 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3572 -0.2063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3572 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0717 -0.2063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7862 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2151 -0.2063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9296 0.2062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5006 0.2062 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5006 2.6812 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2151 2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2151 1.4437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5006 1.0312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7862 1.4437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7862 2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9612 2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3737 2.9832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6276 2.9832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0401 2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2151 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9296 -0.2063 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5006 -0.2063 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5006 -2.6813 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2151 -2.2688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2151 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5006 -1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7862 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7862 -2.2688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9612 -2.2688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3737 -2.9832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6276 -2.9832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.0401 -2.2688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 7 8 2 0 0 0 0\n 7 9 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 10 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 15 17 1 0 0 0 0\n 11 18 1 0 0 0 0\n 11 19 1 0 0 0 0\n 9 13 1 0 0 0 0\n 1 9 1 0 0 0 0\n 20 21 2 0 0 0 0\n 20 22 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 23 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 28 30 1 0 0 0 0\n 24 31 1 0 0 0 0\n 24 32 1 0 0 0 0\n 22 26 1 0 0 0 0\n 6 22 1 0 0 0 0\nM END", "smiles": "CC1(C)CC(CC(C)(C)N1)N(CCCCCCN(C=O)C2CC(C)(C)NC(C)(C)C2)C=O", "formula": "C26H50N4O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "450.7018", "optical_activity": "NONE", "references": [ "425a712a-803a-46a3-a099-312c9a082ce3", "20dbedfa-436f-4113-87d8-0fb2c71fd005" ], "stereo_centers": 0 }, "unii": "D695806T7B" } ] }