{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ea9d0324-d242-4352-bcb3-63141ac5b8db",
          "code": "585-88-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=585-88-6",
          "code_system": "CAS",
          "references": [
            "f5a524d0-ae93-4adc-a8d4-9a47bb7a4a4e",
            "8579701b-edbd-47cb-9c14-6cb96b3caf0a"
          ]
        },
        {
          "uuid": "b8a10fdf-a1a7-4ec8-9c1d-79a7ede3c44d",
          "code": "C77138",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C77138",
          "code_system": "NCI_THESAURUS",
          "references": [
            "f5a524d0-ae93-4adc-a8d4-9a47bb7a4a4e"
          ]
        },
        {
          "uuid": "50b563b4-cb35-491d-9c68-7041d57c9068",
          "code": "C010745",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67010745",
          "code_system": "MESH",
          "references": [
            "f5a524d0-ae93-4adc-a8d4-9a47bb7a4a4e"
          ]
        },
        {
          "uuid": "dd76b687-1b2d-4513-8bb6-88bfd47ac0c5",
          "code": "MALTITOL",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Maltitol",
          "code_system": "WIKIPEDIA",
          "references": [
            "f5a524d0-ae93-4adc-a8d4-9a47bb7a4a4e"
          ]
        },
        {
          "uuid": "9fbdb7ee-b141-49b3-93b6-8df73b70aa0e",
          "code": "INS-965(I)",
          "comments": "Codex Alimentarius|Functional Classification|Bulking agent|Emulsifier|Humectant|Stabilizer|Sweetener|Thickener",
          "type": "PRIMARY",
          "url": "http://www.fao.org/gsfaonline/additives/details.html?id=159",
          "code_system": "CODEX ALIMENTARIUS (GSFA)",
          "references": [
            "f5a524d0-ae93-4adc-a8d4-9a47bb7a4a4e"
          ]
        },
        {
          "uuid": "c1e089d7-ba59-4588-8885-101c8236491e",
          "code": "INS-965(I)",
          "comments": "JECFA|Functional Classification|Bulking agent|Humectant|Stabilizer|Sweetener",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemINS=965(i)",
          "code_system": "JECFA EVALUATION",
          "references": [
            "f5a524d0-ae93-4adc-a8d4-9a47bb7a4a4e"
          ]
        },
        {
          "uuid": "8df18f67-3183-41f2-861b-3eff0c48ec61",
          "code": "1363049",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1363049/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "f5a524d0-ae93-4adc-a8d4-9a47bb7a4a4e"
          ]
        },
        {
          "uuid": "bb92efda-58a6-4c10-8b15-2e61f3d0401e",
          "code": "SUB12136MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "f5a524d0-ae93-4adc-a8d4-9a47bb7a4a4e"
          ]
        },
        {
          "uuid": "119c4317-613c-4fa6-869e-1d2a2a944bd1",
          "code": "CHEMBL63558",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL63558",
          "code_system": "ChEMBL",
          "references": [
            "f5a524d0-ae93-4adc-a8d4-9a47bb7a4a4e"
          ]
        },
        {
          "uuid": "5e8327ac-70de-4667-9e74-5b96b667dd8a",
          "code": "209-567-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.008.699",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "f5a524d0-ae93-4adc-a8d4-9a47bb7a4a4e"
          ]
        },
        {
          "uuid": "af3a2b06-2efe-4077-85af-641faacc694b",
          "code": "493591",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/493591",
          "code_system": "PUBCHEM",
          "references": [
            "f5a524d0-ae93-4adc-a8d4-9a47bb7a4a4e"
          ]
        },
        {
          "uuid": "0d8cf5b3-8540-250c-0ea0-b7cf4c1b3af7",
          "code": "7971",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7971",
          "code_system": "HSDB",
          "references": [
            "809ac299-f832-e09d-925c-ad859b75eade"
          ]
        },
        {
          "uuid": "641daf23-8212-ddb9-d069-3ccb6ccdb5c8",
          "code": "DTXSID0044444",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0044444",
          "code_system": "EPA CompTox",
          "references": [
            "055be20b-6e6b-ee7f-c3f4-23128936599c"
          ]
        },
        {
          "uuid": "ea29ac05-6ba3-12ce-aec5-ed40509f6cfd",
          "code": "C283",
          "comments": "Food or Food Product[C1949]|Food Component[C1930]|Artificial Sweetener",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C283",
          "code_system": "NCI_THESAURUS",
          "references": [
            "e7432877-6725-b296-cd37-73780f6a4897"
          ]
        },
        {
          "uuid": "a568db39-8548-2f20-5fd3-3139ee988abd",
          "code": "3248 (Number of products:4)",
          "comments": "Dietary Supplement Label Database|chemical|Maltitol",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=3248&item=Maltitol",
          "code_system": "DSLD",
          "references": [
            "e7432877-6725-b296-cd37-73780f6a4897"
          ]
        },
        {
          "uuid": "d1b92d56-4d3b-45ca-b8d1-094acada293a",
          "code": "D65DG142WK",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "fd923a34-7bc2-882c-4646-83b621fb6275",
          "code": "68428",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:68428",
          "code_system": "CHEBI",
          "references": [
            "e7432877-6725-b296-cd37-73780f6a4897"
          ]
        },
        {
          "uuid": "82a0f8e3-a62a-5040-ebf0-0f352ab87a49",
          "code": "1374907",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1374907",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "e7432877-6725-b296-cd37-73780f6a4897"
          ]
        },
        {
          "uuid": "ed796eb9-a5d8-ba34-9b16-463736f3d485",
          "code": "100000080142",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "69b8431a-a7fa-ea97-9f42-7962e73c95a7"
          ]
        },
        {
          "uuid": "b936569e-34f7-2a4f-9deb-45a374e24708",
          "code": "D65DG142WK",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=D65DG142WK",
          "code_system": "DAILYMED",
          "references": [
            "cabb3a91-9eea-cf13-73ae-220a0fcbf77b"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "78d22322-0cef-45cd-97d0-b6417d3c1122",
          "amount": {
            "uuid": "fb71f735-6ceb-4c4d-ae61-57a46a2a4f79"
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "44dc6864-dd73-4d66-bb7d-0b7bf5116cbc"
          ],
          "related_substance": {
            "uuid": "36fab77a-df2d-4640-9345-bb1afe2835b5",
            "refuuid": "bc66b10a-77d0-4001-8f9a-ba22ca91aa2f",
            "name": "SORBITOL",
            "unii": "506T60A25R",
            "linking_id": "506T60A25R",
            "ref_pname": "SORBITOL"
          }
        },
        {
          "uuid": "467a014c-a399-4ef2-abe6-f8f389494daa",
          "amount": {
            "uuid": "984d1126-6084-458b-9c5c-6b4f4cdedf2f"
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "061f7ac3-0d17-46c9-94ac-0fc4b99b80ff"
          ],
          "related_substance": {
            "uuid": "3872d174-7b8d-4bc4-a47f-1b4629e0050c",
            "refuuid": "da7aed2a-55b5-4617-a35b-868e65d857b8",
            "name": "MALTOTRIITOL",
            "unii": "53T184B7B7",
            "linking_id": "53T184B7B7",
            "ref_pname": "MALTOTRIITOL"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "38237a07-b32b-4d86-90e3-c911ec81f926",
          "name": "AMALTY MR 100",
          "stdName": "AMALTY MR 100",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a48ce80-c877-4cce-b4f5-004836786a76",
            "5737372c-2478-46ff-8942-750889394eab"
          ],
          "display_name": false
        },
        {
          "uuid": "20c25184-c561-40e9-ace0-d69692d7a2fb",
          "name": "CERESTAR 16303",
          "stdName": "CERESTAR 16303",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a48ce80-c877-4cce-b4f5-004836786a76",
            "5737372c-2478-46ff-8942-750889394eab"
          ],
          "display_name": false
        },
        {
          "uuid": "ded88d5f-a0ea-4e54-9346-2811eb500114",
          "name": "DRIED MALTITOL SYRUP",
          "stdName": "DRIED MALTITOL SYRUP",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "37d9c48a-50a4-4cfb-8c7b-81b936913032",
            "5737372c-2478-46ff-8942-750889394eab"
          ],
          "display_name": false
        },
        {
          "uuid": "f9d9eab2-69b4-41c0-8165-99ba14da0844",
          "name": "E-965(I)",
          "stdName": "E-965(I)",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "37d9c48a-50a4-4cfb-8c7b-81b936913032",
            "5737372c-2478-46ff-8942-750889394eab"
          ],
          "display_name": false
        },
        {
          "uuid": "9f6efd32-95ac-4963-9d60-4f92e630b299",
          "name": "HYDROGENATED HIGH MALTOSE-CONTENT GLUCOSE SYRUP",
          "stdName": "HYDROGENATED HIGH MALTOSE-CONTENT GLUCOSE SYRUP",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "37d9c48a-50a4-4cfb-8c7b-81b936913032",
            "5737372c-2478-46ff-8942-750889394eab"
          ],
          "display_name": false
        },
        {
          "uuid": "eec9067c-1bc7-413f-b2f6-656734b37e34",
          "name": "HYDROGENATED MALTOSE",
          "stdName": "HYDROGENATED MALTOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "37d9c48a-50a4-4cfb-8c7b-81b936913032",
            "5737372c-2478-46ff-8942-750889394eab"
          ],
          "display_name": false
        },
        {
          "uuid": "bb167235-4196-4bfd-9db7-ffcafd1918de",
          "name": "INS NO.965(I)",
          "stdName": "INS NO.965(I)",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "37d9c48a-50a4-4cfb-8c7b-81b936913032",
            "5737372c-2478-46ff-8942-750889394eab"
          ],
          "display_name": false
        },
        {
          "uuid": "1d44eb88-b46f-4cdf-95a8-3521c74fa886",
          "name": "INS-965(I)",
          "stdName": "INS-965(I)",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "37d9c48a-50a4-4cfb-8c7b-81b936913032",
            "5737372c-2478-46ff-8942-750889394eab"
          ],
          "display_name": false
        },
        {
          "uuid": "a304fc04-fd00-407f-baeb-4e7ec8167c65",
          "name": "LYCASIN HBC",
          "stdName": "LYCASIN HBC",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a48ce80-c877-4cce-b4f5-004836786a76",
            "5737372c-2478-46ff-8942-750889394eab"
          ],
          "display_name": false
        },
        {
          "uuid": "6e6ab63c-53a8-4782-9d2d-27ccd038844e",
          "name": "MALBIT CH 16385",
          "stdName": "MALBIT CH 16385",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a48ce80-c877-4cce-b4f5-004836786a76",
            "5737372c-2478-46ff-8942-750889394eab"
          ],
          "display_name": false
        },
        {
          "uuid": "b79b40ad-25d4-4e62-aa46-69f37660ce28",
          "name": "MALTIDEX CH 16385",
          "stdName": "MALTIDEX CH 16385",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a48ce80-c877-4cce-b4f5-004836786a76",
            "5737372c-2478-46ff-8942-750889394eab"
          ],
          "display_name": false
        },
        {
          "uuid": "66dfa227-f3ea-4c6d-895c-93fbec547e5c",
          "name": "MALTISWEET 3145",
          "stdName": "MALTISWEET 3145",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a48ce80-c877-4cce-b4f5-004836786a76",
            "5737372c-2478-46ff-8942-750889394eab"
          ],
          "display_name": false
        },
        {
          "uuid": "7a4e4411-0616-498d-b527-21ca345455f6",
          "name": "MALTITOL",
          "stdName": "MALTITOL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd87daaf-e57b-47a1-b8ae-3b3f129eadb2",
            "5bd2db1d-db9e-4c28-ad78-d50e6195f52e",
            "3bd82f38-4fd5-4c1d-8ed3-d5ed2376a01d",
            "1f6e95be-f22e-43eb-947e-04ad662b7dd7",
            "8446fe4b-3dc9-4283-a590-3b804a794224",
            "ee9149eb-1a40-4a1b-b4c2-de9076ba00ca",
            "57f68b75-1183-428d-80cb-ec870ecc4ca6",
            "3dd4521c-e543-4dcd-a7c0-aa2c7798c7a4",
            "755c747d-d1c2-43fb-a673-5e751b50df54",
            "fd1b2a52-5406-4132-8630-ee33d3a111e0",
            "cb284789-a2e6-43d0-be99-1c4190ece7aa",
            "925c8523-b627-4d92-a647-78262e32290b",
            "5737372c-2478-46ff-8942-750889394eab"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "c323147d-ddc2-47c1-aafb-afc137a46467",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "5d872dc4-b9c3-8623-7388-8a1eef5e665d",
          "name": "MALTITOL SOLUTION",
          "stdName": "MALTITOL SOLUTION",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee9149eb-1a40-4a1b-b4c2-de9076ba00ca"
          ],
          "display_name": false
        },
        {
          "uuid": "4366d7d4-4ed4-6438-7292-a856315e90ce",
          "name": "MALTITOL SOLUTION [NF]",
          "stdName": "MALTITOL SOLUTION [NF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee9149eb-1a40-4a1b-b4c2-de9076ba00ca"
          ],
          "display_name": false
        },
        {
          "uuid": "e51beb88-83bc-4b44-8666-fd6d36c40846",
          "name": "MALTITOL SYRUP POWDER",
          "stdName": "MALTITOL SYRUP POWDER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "37d9c48a-50a4-4cfb-8c7b-81b936913032",
            "5737372c-2478-46ff-8942-750889394eab"
          ],
          "display_name": false
        },
        {
          "uuid": "88d57ba0-04cf-4898-ce2f-c1941f56d88e",
          "name": "MALTITOL [EP MONOGRAPH]",
          "stdName": "MALTITOL [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "441e0882-f55c-4110-aef0-87149c103de2"
          ],
          "display_name": false
        },
        {
          "uuid": "76e9b6de-2abf-49b1-95e1-c2b272c445fe",
          "name": "MALTITOL [FCC]",
          "stdName": "MALTITOL [FCC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "57f68b75-1183-428d-80cb-ec870ecc4ca6",
            "5737372c-2478-46ff-8942-750889394eab"
          ],
          "display_name": false
        },
        {
          "uuid": "1c040925-8cca-491d-a498-ea6b59c316f2",
          "name": "MALTITOL [II]",
          "stdName": "MALTITOL [II]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3dd4521c-e543-4dcd-a7c0-aa2c7798c7a4"
          ],
          "display_name": false
        },
        {
          "uuid": "9bec1f3e-2b4e-496b-9eaf-06814ecc3831",
          "name": "MALTITOL [MART.]",
          "stdName": "MALTITOL [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd87daaf-e57b-47a1-b8ae-3b3f129eadb2"
          ],
          "display_name": false
        },
        {
          "uuid": "f722b634-4d74-436c-be4c-87416534b533",
          "name": "MALTITOL [USP-RS]",
          "stdName": "MALTITOL [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee9149eb-1a40-4a1b-b4c2-de9076ba00ca",
            "5737372c-2478-46ff-8942-750889394eab"
          ],
          "display_name": false
        },
        {
          "uuid": "542f157c-a457-4531-adf1-ee65d63ed5ae",
          "name": "SWEETPEARL P 200",
          "stdName": "SWEETPEARL P 200",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a48ce80-c877-4cce-b4f5-004836786a76",
            "5737372c-2478-46ff-8942-750889394eab"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "8579701b-edbd-47cb-9c14-6cb96b3caf0a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "061f7ac3-0d17-46c9-94ac-0fc4b99b80ff",
          "citation": "European Pharmacopoeia Online 9.8, Maltitol Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "80c12555-d966-4497-9a08-d4266553b49c",
          "citation": "European Pharmacopoeia Online 9.8, Maltitol Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3dd4521c-e543-4dcd-a7c0-aa2c7798c7a4",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d863bc3f-8e30-4684-b69b-df3e48188d11",
          "citation": "STN 2007",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "755c747d-d1c2-43fb-a673-5e751b50df54",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cd87daaf-e57b-47a1-b8ae-3b3f129eadb2",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fd1b2a52-5406-4132-8630-ee33d3a111e0",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5737372c-2478-46ff-8942-750889394eab",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "57f68b75-1183-428d-80cb-ec870ecc4ca6",
          "citation": "FCC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ee9149eb-1a40-4a1b-b4c2-de9076ba00ca",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "37d9c48a-50a4-4cfb-8c7b-81b936913032",
          "citation": "http://www.codexalimentarius.net/gsfaonline/additives/details.html?id=159",
          "url": "http://www.codexalimentarius.net/gsfaonline/additives/details.html?id=159",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7a48ce80-c877-4cce-b4f5-004836786a76",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f5a524d0-ae93-4adc-a8d4-9a47bb7a4a4e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390499000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7bc075ba-10b8-4783-a478-eab65643673b",
          "citation": "SRS import [D65DG142WK]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=D65DG142WK",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390499000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "380a09ab-ee12-46d4-b284-f84c2bb86625",
          "citation": "ChemIDplus 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5bd2db1d-db9e-4c28-ad78-d50e6195f52e",
          "citation": "MALTITOL [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3bd82f38-4fd5-4c1d-8ed3-d5ed2376a01d",
          "citation": "MALTITOL [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8446fe4b-3dc9-4283-a590-3b804a794224",
          "citation": "MALTITOL [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cb284789-a2e6-43d0-be99-1c4190ece7aa",
          "citation": "MALTITOL [FCC]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "925c8523-b627-4d92-a647-78262e32290b",
          "citation": "MALTITOL [II]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1f6e95be-f22e-43eb-947e-04ad662b7dd7",
          "citation": "MALTITOL [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "809ac299-f832-e09d-925c-ad859b75eade",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+585-88-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "055be20b-6e6b-ee7f-c3f4-23128936599c",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=585-88-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e7432877-6725-b296-cd37-73780f6a4897",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "441e0882-f55c-4110-aef0-87149c103de2",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "cabb3a91-9eea-cf13-73ae-220a0fcbf77b",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "69b8431a-a7fa-ea97-9f42-7962e73c95a7",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "44dc6864-dd73-4d66-bb7d-0b7bf5116cbc",
          "citation": "European Pharmacopoeia Online 9.8, Maltitol Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a01c4d10-c16c-47ca-bb8c-a823a6b1d837",
          "id": "a01c4d10-c16c-47ca-bb8c-a823a6b1d837",
          "molfile": "\n  Marvin  01132108192D          \n\n 23 23  0  0  1  0            999 V2000\n    4.3299    1.4237    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    4.3299    2.2505    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0438    1.0104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7578    1.4237    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6159    1.0104    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    3.6159    0.1837    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9019    1.4237    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    2.1879    1.0104    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1962    0.1837    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    2.9102   -0.2297    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9102   -1.0564    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    3.6242   -1.4697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3382   -1.0564    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1962   -1.4697    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    2.1879   -2.2964    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4865   -1.0564    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    0.7683   -1.4697    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4865   -0.2297    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    0.7683    0.1837    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9019    2.2505    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    3.6159    2.6638    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1879    2.6638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4739    2.2505    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  5  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  6  1  1  0  0  0\n  7  5  1  0  0  0  0\n  7  8  1  6  0  0  0\n  7 20  1  0  0  0  0\n  9  8  1  1  0  0  0\n  9 10  1  0  0  0  0\n 18  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  6  0  0  0\n 14 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 15  1  1  0  0  0\n 16 14  1  0  0  0  0\n 16 17  1  6  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  1  0  0  0\n 20 21  1  1  0  0  0\n 20 22  1  0  0  0  0\n 23 22  1  0  0  0  0\nM  END",
          "smiles": "C([C@@H]([C@H]([C@@H]([C@@H](CO)O)O[C@@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)O)O)O",
          "formula": "C12H24O11",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f912c26b-343b-4670-a057-1832b1fa55ee"
          },
          "defined_stereo": 9,
          "ez_centers": 0,
          "molecular_weight": "344.3129",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 9
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e2391c2f-a293-4438-b317-7630adb8efd5",
      "version": "25",
      "structure": {
        "id": "c87f1cb6-81e4-4cb0-bb8b-8d529b36e09a",
        "molfile": "\n  Marvin  01132110212D          \n\n 24 24  0  0  1  0            999 V2000\n    2.1962    0.1837    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    1.4865   -0.2297    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    1.4865   -1.0564    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.9102   -0.2297    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9019    1.4237    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.1879    1.0104    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1962   -1.4697    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.9102   -1.0564    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.6159    1.0104    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.9019    2.2505    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.3299    1.4237    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    0.7683    0.1837    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7683   -1.4697    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1879   -2.2964    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6159    0.1837    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6159    2.6638    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3299    2.2505    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6242   -1.4697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3382   -1.0564    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7578    1.4237    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4739    2.2505    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1879    2.6638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0438    1.0104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1879    1.8371    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  6  1  0  0  0  0\n  1  6  1  1  0  0  0\n  7  8  1  0  0  0  0\n  8  4  1  0  0  0  0\n  9  5  1  0  0  0  0\n 10  5  1  0  0  0  0\n 11  9  1  0  0  0  0\n  2 12  1  1  0  0  0\n  3 13  1  6  0  0  0\n  7 14  1  1  0  0  0\n  9 15  1  1  0  0  0\n 10 16  1  1  0  0  0\n 11 17  1  1  0  0  0\n  8 18  1  6  0  0  0\n 19 18  1  0  0  0  0\n 20 23  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 10  1  0  0  0  0\n 23 11  1  0  0  0  0\n  5 24  1  1  0  0  0\n  7  3  1  0  0  0  0\nM  END",
        "smiles": "C([C@@H]([C@H]([C@@]([H])([C@@H](CO)O)O[C@@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)O)O)O",
        "formula": "C12H24O11",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 9,
        "ez_centers": 0,
        "molecular_weight": "344.3129",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "380a09ab-ee12-46d4-b284-f84c2bb86625",
          "7bc075ba-10b8-4783-a478-eab65643673b"
        ],
        "stereo_centers": 9
      },
      "unii": "D65DG142WK"
    }
  ]
}