{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "4e7d4316-e9a9-45c3-8581-5e1309069f98",
          "code": "97-24-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=97-24-5",
          "code_system": "CAS",
          "references": [
            "4f2134ac-d8a0-4a3c-b0b9-2728699af017",
            "922aa426-ad39-4c0b-98d0-246e0eaf005a"
          ]
        },
        {
          "uuid": "0286db06-1b6e-4a07-a5ff-e609209b1839",
          "code": "C65671",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C65671",
          "code_system": "NCI_THESAURUS",
          "references": [
            "4f2134ac-d8a0-4a3c-b0b9-2728699af017"
          ]
        },
        {
          "uuid": "5d48066e-6679-4ffc-9e02-99adb96fb826",
          "code": "SUB07599MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "4f2134ac-d8a0-4a3c-b0b9-2728699af017"
          ]
        },
        {
          "uuid": "9b65148a-6d83-4209-8d79-c30c87e31cd5",
          "code": "64209",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3274",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "4f2134ac-d8a0-4a3c-b0b9-2728699af017"
          ]
        },
        {
          "uuid": "72457a87-0ae6-45ea-992f-55f02db9af4f",
          "code": "2830",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=2830",
          "code_system": "INN",
          "references": [
            "4f2134ac-d8a0-4a3c-b0b9-2728699af017"
          ]
        },
        {
          "uuid": "e6d230aa-d355-420f-bd58-33d09c668079",
          "code": "202-568-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.002.336",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "4f2134ac-d8a0-4a3c-b0b9-2728699af017"
          ]
        },
        {
          "uuid": "28fb5f86-875f-4c76-b0e9-15c5b716675b",
          "code": "m5301",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5301?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "4f2134ac-d8a0-4a3c-b0b9-2728699af017"
          ]
        },
        {
          "uuid": "363ea9c8-fe74-44b1-b2a9-fe6a481e7d42",
          "code": "CHEMBL473535",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL473535",
          "code_system": "ChEMBL",
          "references": [
            "4f2134ac-d8a0-4a3c-b0b9-2728699af017"
          ]
        },
        {
          "uuid": "b1bb5f4c-568b-4b57-9fb1-e2df5df3369d",
          "code": "7329",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/7329",
          "code_system": "PUBCHEM",
          "references": [
            "4f2134ac-d8a0-4a3c-b0b9-2728699af017"
          ]
        },
        {
          "uuid": "e4485e4f-d9d2-0f1d-a50f-2382ed95d015",
          "code": "Fenticlor",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Fenticlor",
          "code_system": "WIKIPEDIA",
          "references": [
            "c9b98efc-440d-94ca-aad2-d07fd9893b08"
          ]
        },
        {
          "uuid": "fba5511f-be49-4c3e-40fe-6a4e30647726",
          "code": "DTXSID4026137",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4026137",
          "code_system": "EPA CompTox",
          "references": [
            "ee6940c7-8e2e-894a-78d4-0b4d75e5ba0a"
          ]
        },
        {
          "uuid": "71e4b792-e1c2-485a-b4de-d3122968e7fc",
          "code": "C28394",
          "comments": "Pharmacologic Substance[C1909]|Anti-Infective Agent[C254]|Topical Anti-Infective Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C28394",
          "code_system": "NCI_THESAURUS",
          "references": [
            "05ed4591-f540-2220-3aa9-1995f99b903f"
          ]
        },
        {
          "uuid": "19e24b2f-24b0-4c45-b5ff-7655d219e4ca",
          "code": "D61659OVD0",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a9532fda-1303-7e75-03da-c7aa39ab07cd",
          "code": "3227",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3227",
          "code_system": "DRUG CENTRAL",
          "references": [
            "05ed4591-f540-2220-3aa9-1995f99b903f"
          ]
        },
        {
          "uuid": "ef89902e-3b02-f8fd-4406-ba1c02e9d992",
          "code": "556580",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:556580",
          "code_system": "CHEBI",
          "references": [
            "05ed4591-f540-2220-3aa9-1995f99b903f"
          ]
        },
        {
          "uuid": "3145f047-1748-05b8-b88f-93434154db59",
          "code": "55636",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=55636",
          "code_system": "NSC",
          "references": [
            "e03a7575-dcd9-eabf-fc9b-667b93945ba1"
          ]
        },
        {
          "uuid": "a16e830b-b7bd-a436-36f2-bc678683272c",
          "code": "100000081489",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "93000845-3458-5600-4623-d2bfaa923b1c"
          ]
        },
        {
          "uuid": "35477103-ba24-fdf0-51cc-62d60d5c50b4",
          "code": "4112",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=4112",
          "code_system": "NSC",
          "references": [
            "e03a7575-dcd9-eabf-fc9b-667b93945ba1"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "9ba447a4-95bd-4d92-9c20-39f9248a2612",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "5c523755-b0c6-4d99-9de2-c8b2d2fbf493",
            "refuuid": "c4bae39a-8b0d-44dd-a53e-10067f60e832",
            "name": "FENTICLOR",
            "unii": "D61659OVD0",
            "linking_id": "D61659OVD0",
            "ref_pname": "FENTICLOR",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3e0a7fa0-157c-448a-92b1-07559adc5ccb",
          "name": "2,2'-THIOBIS(4-CHLOROPHENOL)",
          "stdName": "2,2'-THIOBIS(4-CHLOROPHENOL)",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "78ae0f46-2329-4bd2-a6cc-69a9154ec70b",
            "79819f44-9957-477a-a394-bd19e1d37468",
            "7d3a3b7b-46a4-489e-b114-a39a6e283f91"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "0e196f0c-b515-4d5b-9675-1c87efce83d2",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "dfea005d-358b-4ce8-9d2f-94e2070a4b61",
          "name": "FENTICLOR",
          "stdName": "FENTICLOR",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a5d2fc24-6337-4478-affd-72b2d7b84d04",
            "803ce92c-1690-487b-9b19-60b0104e5040",
            "130949d6-ae1f-4798-922a-4ca286df014d",
            "d30d2ca4-fcc9-4d21-96ca-3088a8b3e2b3",
            "d344da14-c3fa-4533-9cdd-0dfd91bbfc1a",
            "3bc6ff70-aaba-4776-be9a-a980fc3f4dd0",
            "ae8c9055-0c06-4738-9098-f7cdff62fa82",
            "79819f44-9957-477a-a394-bd19e1d37468",
            "035a2823-260a-47fd-8482-7849697d752d",
            "7d735269-f8d7-4722-8a5d-981a4645a8e2",
            "0be2e8e4-2c57-42d1-9100-587769ed0298"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "b25a3ed3-4a66-4e04-8bb2-bd471a6b0e2c",
              "name_org": "INN"
            },
            {
              "uuid": "39284199-66ea-4d72-b62b-ac1b57bb8d98",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "b0b6ef58-cd27-4c20-a440-5f34c6476f0b",
          "name": "FENTICLOR [MART.]",
          "stdName": "FENTICLOR [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3bc6ff70-aaba-4776-be9a-a980fc3f4dd0"
          ],
          "display_name": false
        },
        {
          "uuid": "be21d855-fa0c-48f7-ab94-f8e47e9895be",
          "name": "FENTICLOR [MI]",
          "stdName": "FENTICLOR [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "803ce92c-1690-487b-9b19-60b0104e5040"
          ],
          "display_name": false
        },
        {
          "uuid": "268a28dc-47c2-4c59-b1ed-7932c363b14c",
          "name": "FENTICLOR [USAN]",
          "stdName": "FENTICLOR [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a5d2fc24-6337-4478-affd-72b2d7b84d04"
          ],
          "display_name": false
        },
        {
          "uuid": "114ec2c2-0678-f1ff-9a08-e7431e1766f0",
          "name": "Fenticlor [WHO-DD]",
          "stdName": "FENTICLOR [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "37474f09-0fa3-5c6d-65be-9b99759f9e41"
          ],
          "display_name": false
        },
        {
          "uuid": "df952bfe-4a96-4c5e-b675-79abfe03d09f",
          "name": "NSC-4112",
          "stdName": "NSC-4112",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "79819f44-9957-477a-a394-bd19e1d37468"
          ],
          "display_name": false
        },
        {
          "uuid": "7ec43301-abff-4d12-81f7-3572d5b0fb41",
          "name": "NSC-55636",
          "stdName": "NSC-55636",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4dbf9356-79b6-43fb-85fd-f953bb7230ce"
          ],
          "display_name": false
        },
        {
          "uuid": "c01f4137-8a7a-4222-8187-69c878068f03",
          "name": "PHENOL, 2,2'-THIOBIS(4-CHLORO-",
          "stdName": "PHENOL, 2,2'-THIOBIS(4-CHLORO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "79819f44-9957-477a-a394-bd19e1d37468"
          ],
          "display_name": false
        },
        {
          "uuid": "3f25a8eb-2dcf-41bc-b90e-c5a6d971007d",
          "name": "S 7",
          "stdName": "S 7",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "79819f44-9957-477a-a394-bd19e1d37468"
          ],
          "display_name": false
        },
        {
          "uuid": "6637e2e6-9618-4457-be04-b84921adfe71",
          "name": "S-7",
          "stdName": "S-7",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1597ee26-f2c3-493c-91c7-a207c2aed91c"
          ],
          "display_name": false
        },
        {
          "uuid": "13fb3b0b-7fb5-4afc-9b8d-21739cab93fe",
          "name": "fenticlor [INN]",
          "stdName": "FENTICLOR [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d344da14-c3fa-4533-9cdd-0dfd91bbfc1a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "79819f44-9957-477a-a394-bd19e1d37468",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d344da14-c3fa-4533-9cdd-0dfd91bbfc1a",
          "citation": "INN Proposed List 23",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL23.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a5d2fc24-6337-4478-affd-72b2d7b84d04",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3bc6ff70-aaba-4776-be9a-a980fc3f4dd0",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "803ce92c-1690-487b-9b19-60b0104e5040",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "78ae0f46-2329-4bd2-a6cc-69a9154ec70b",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7d735269-f8d7-4722-8a5d-981a4645a8e2",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1597ee26-f2c3-493c-91c7-a207c2aed91c",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4dbf9356-79b6-43fb-85fd-f953bb7230ce",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4f2134ac-d8a0-4a3c-b0b9-2728699af017",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389652000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5207aa55-0b69-4f3f-ba83-54e761f557ec",
          "citation": "SRS import [D61659OVD0]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=D61659OVD0",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389652000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "322e4252-9561-409e-9328-c50bc87d1984",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "130949d6-ae1f-4798-922a-4ca286df014d",
          "citation": "FENTICLOR [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0be2e8e4-2c57-42d1-9100-587769ed0298",
          "citation": "FENTICLOR [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "035a2823-260a-47fd-8482-7849697d752d",
          "citation": "FENTICLOR [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ae8c9055-0c06-4738-9098-f7cdff62fa82",
          "citation": "FENTICLOR [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7d3a3b7b-46a4-489e-b114-a39a6e283f91",
          "citation": "2,2'-THIOBIS(4-CHLOROPHENOL) [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d30d2ca4-fcc9-4d21-96ca-3088a8b3e2b3",
          "citation": "FENTICLOR [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c9b98efc-440d-94ca-aad2-d07fd9893b08",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Fenticlor",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ee6940c7-8e2e-894a-78d4-0b4d75e5ba0a",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=97-24-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "05ed4591-f540-2220-3aa9-1995f99b903f",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "922aa426-ad39-4c0b-98d0-246e0eaf005a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "37474f09-0fa3-5c6d-65be-9b99759f9e41",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "e03a7575-dcd9-eabf-fc9b-667b93945ba1",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "93000845-3458-5600-4623-d2bfaa923b1c",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1ed5ccbb-b3cf-4907-b849-afee5c42f35d",
          "id": "1ed5ccbb-b3cf-4907-b849-afee5c42f35d",
          "molfile": "\n  Marvin  01132101462D          \n\n 17 18  0  0  0  0            999 V2000\n    0.7141    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7141   -0.8224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.2400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.0520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7141   -2.4696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7141   -3.2894    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    1.4256   -2.0520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4256   -1.2400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1371   -0.8224    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8563   -1.2400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8563   -2.0520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5678   -2.4696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5678   -3.2894    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.2793   -2.0520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2793   -1.2400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5678   -0.8224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5678    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  8  2  0  0  0  0\n  4  3  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 16 10  2  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 12  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 17 16  1  0  0  0  0\nM  END",
          "smiles": "c1cc(c(cc1Cl)Sc2cc(ccc2O)Cl)O",
          "formula": "C12H8Cl2O2S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6308a50a-e297-4533-b398-199dffe5ec0c"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "287.1631",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c4bae39a-8b0d-44dd-a53e-10067f60e832",
      "version": "15",
      "structure": {
        "id": "e700c93f-058c-440b-8b34-7bc70a443d7f",
        "molfile": "\n  Marvin  01132111572D          \n\n 17 18  0  0  0  0            999 V2000\n    2.1371   -0.8224    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8563   -1.2400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4256   -1.2400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8563   -2.0520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4256   -2.0520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7141   -0.8224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5678   -0.8224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.2400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2793   -1.2400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7141   -2.4696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5678   -2.4696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2793   -2.0520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.0520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5678   -3.2894    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    0.7141   -3.2894    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    0.7141    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5678    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  2  2  0  0  0  0\n  5  3  2  0  0  0  0\n  6  3  1  0  0  0  0\n  7  2  1  0  0  0  0\n  8  6  2  0  0  0  0\n  9  7  2  0  0  0  0\n 10  5  1  0  0  0  0\n 11  4  1  0  0  0  0\n 12  9  1  0  0  0  0\n 13  8  1  0  0  0  0\n 14 11  1  0  0  0  0\n 15 10  1  0  0  0  0\n 16  6  1  0  0  0  0\n 17  7  1  0  0  0  0\n 13 10  2  0  0  0  0\n 12 11  2  0  0  0  0\nM  END",
        "smiles": "c1cc(c(cc1Cl)Sc2cc(ccc2O)Cl)O",
        "formula": "C12H8Cl2O2S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "287.1631",
        "optical_activity": "NONE",
        "references": [
          "322e4252-9561-409e-9328-c50bc87d1984",
          "5207aa55-0b69-4f3f-ba83-54e761f557ec",
          "d344da14-c3fa-4533-9cdd-0dfd91bbfc1a"
        ],
        "stereo_centers": 0
      },
      "unii": "D61659OVD0"
    }
  ]
}