{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "3f1fc2d2-492e-43f6-9710-4900810100b1",
          "code": "1181226-24-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1181226-24-3",
          "code_system": "CAS",
          "references": [
            "4596a927-51f7-46e2-aa26-5e7d113e11bc",
            "0e823d61-ad66-44f4-88ba-7bf4aa84551c"
          ]
        },
        {
          "uuid": "228d7391-6b9c-453c-9959-4b2717026e51",
          "code": "C546682",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67546682",
          "code_system": "MESH",
          "references": [
            "4596a927-51f7-46e2-aa26-5e7d113e11bc"
          ]
        },
        {
          "uuid": "2e7c537a-3fb8-4cc7-a192-7aa3951a371d",
          "code": "44192911",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/44192911",
          "code_system": "PUBCHEM",
          "references": [
            "4596a927-51f7-46e2-aa26-5e7d113e11bc"
          ]
        },
        {
          "uuid": "d6ac1544-2aaa-b2b3-44bf-62b3222262c0",
          "code": "DTXSID70152020",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70152020",
          "code_system": "EPA CompTox",
          "references": [
            "154837b8-7efb-aa3b-6d1f-6cf7dc9e3bb7"
          ]
        },
        {
          "uuid": "9fe76df6-bec9-4a01-9c13-430661b4143a",
          "code": "D613CY80RW",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "4fa0c7dc-4d24-49d0-8cc2-210fce50fec2",
          "name": "1H-ISOINDOL-1-ONE, 2,3-DIHYDRO-6-HYDROXY-2-(4-HYDROXYPHENYL)-4-METHOXY-",
          "stdName": "1H-ISOINDOL-1-ONE, 2,3-DIHYDRO-6-HYDROXY-2-(4-HYDROXYPHENYL)-4-METHOXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7f24dac8-b16e-4cf4-acd7-51988e3ed60b",
            "401bce4c-7793-497d-8592-b50a57e1778f"
          ],
          "display_name": false
        },
        {
          "uuid": "f71604b9-60ef-437d-8d92-564794d41777",
          "name": "CLITOCYBIN B",
          "stdName": "CLITOCYBIN B",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "694606a1-4278-4995-a9f4-feeab35a981f",
            "401bce4c-7793-497d-8592-b50a57e1778f"
          ],
          "display_name": false
        },
        {
          "uuid": "76937576-0086-4196-99e8-18ecc6c0b640",
          "name": "HYDROXYPHENYL HYDROXYMETHOXYISOINDOLINONE",
          "stdName": "HYDROXYPHENYL HYDROXYMETHOXYISOINDOLINONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "694606a1-4278-4995-a9f4-feeab35a981f",
            "401bce4c-7793-497d-8592-b50a57e1778f",
            "897f84fa-87e7-49b8-8ac1-a680e0877fc7"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "a0e8338f-2b89-4573-aa48-218cbce0c3f9",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "56b9e25e-32e3-4a45-b2cb-ce1d74bc753a",
          "citation": "SRS import [D613CY80RW]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=D613CY80RW",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391531000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "897f84fa-87e7-49b8-8ac1-a680e0877fc7",
          "citation": "HYDROXYPHENYL HYDROXYMETHOXYISOINDOLINONE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "694606a1-4278-4995-a9f4-feeab35a981f",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "401bce4c-7793-497d-8592-b50a57e1778f",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7f24dac8-b16e-4cf4-acd7-51988e3ed60b",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4596a927-51f7-46e2-aa26-5e7d113e11bc",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391531000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "154837b8-7efb-aa3b-6d1f-6cf7dc9e3bb7",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1181226-24-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0e823d61-ad66-44f4-88ba-7bf4aa84551c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "16b18ca4-fd49-4250-89ea-662d35996b2d",
          "id": "16b18ca4-fd49-4250-89ea-662d35996b2d",
          "molfile": "\n  Marvin  01132101222D          \n\n 20 22  0  0  0  0            999 V2000\n    4.4968   -3.2485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2112   -3.6610    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2112   -4.4860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4968   -4.8985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4968   -5.7235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7823   -6.1360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2113   -6.1360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9257   -5.7235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7104   -5.9784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9653   -6.7630    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1953   -5.3110    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7104   -4.6436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9257   -4.8985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0203   -5.3110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4328   -6.0254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2578   -6.0254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6703   -5.3110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4953   -5.3110    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2578   -4.5965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4328   -4.5965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n 13  3  2  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  8  7  2  0  0  0  0\n  8  9  1  0  0  0  0\n 13  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 14 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 15 14  1  0  0  0  0\n 14 20  2  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 17  2  0  0  0  0\n 19 20  1  0  0  0  0\nM  END",
          "smiles": "COc1cc(cc2c1CN(c3ccc(cc3)O)C2=O)O",
          "formula": "C15H13NO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6517443d-ab97-4980-a9ed-5cc1c8066f67"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "271.2686",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3184107c-ce77-4ffe-b30a-a9408d4e76f0",
      "version": "4",
      "structure": {
        "id": "a880739a-a1c2-4e3b-b6a9-6aea56120695",
        "molfile": "\n  Marvin  01132108452D          \n\n 20 22  0  0  0  0            999 V2000\n    7.1953   -5.3110    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7104   -4.6436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7104   -5.9784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9257   -5.7235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9257   -4.8985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2112   -4.4860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4968   -4.8985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4968   -5.7235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2113   -6.1360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9653   -6.7630    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4968   -3.2485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2112   -3.6610    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7823   -6.1360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2578   -6.0254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4328   -6.0254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0203   -5.3110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4328   -4.5965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2578   -4.5965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6703   -5.3110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4953   -5.3110    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  5  2  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  4  9  1  0  0  0  0\n  3 10  2  0  0  0  0\n 11 12  1  0  0  0  0\n  6 12  1  0  0  0  0\n  8 13  1  0  0  0  0\n 19 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  2  0  0  0  0\n 20 19  1  0  0  0  0\n 16  1  1  0  0  0  0\nM  END",
        "smiles": "COc1cc(cc2c1CN(c3ccc(cc3)O)C2=O)O",
        "formula": "C15H13NO4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "271.2686",
        "optical_activity": "NONE",
        "references": [
          "7f24dac8-b16e-4cf4-acd7-51988e3ed60b",
          "56b9e25e-32e3-4a45-b2cb-ce1d74bc753a"
        ],
        "stereo_centers": 0
      },
      "unii": "D613CY80RW"
    }
  ]
}