{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "648dcb1d-dc80-4a81-8c09-5f3fc0676879",
          "code": "52328-98-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=52328-98-0",
          "code_system": "CAS",
          "references": [
            "913abf00-7dd6-44ea-8465-288839dff8a6",
            "01fad0e8-85aa-41af-b4b9-d92c19103d44"
          ]
        },
        {
          "uuid": "703c0478-9dca-4c37-8fff-31f1f1a93fdc",
          "code": "160096-59-3",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=160096-59-3",
          "code_system": "CAS",
          "references": [
            "913abf00-7dd6-44ea-8465-288839dff8a6",
            "a2d1ec6a-2b92-403d-8a14-77500703fe24"
          ]
        },
        {
          "uuid": "8a6c165f-64d3-4b3e-9d2a-dc9b0e840d99",
          "code": "55094-77-4",
          "type": "NON-SPECIFIC STEREOCHEMISTRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=55094-77-4",
          "code_system": "CAS",
          "references": [
            "913abf00-7dd6-44ea-8465-288839dff8a6",
            "b1941982-034c-4138-8e38-50af925cd1e4"
          ]
        },
        {
          "uuid": "10891929-7510-4220-8796-31bfd87154dc",
          "code": "98886-01-2",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=98886-01-2",
          "code_system": "CAS",
          "references": [
            "913abf00-7dd6-44ea-8465-288839dff8a6",
            "e4fec181-4a16-47a6-bb33-8bd4b3c9a460"
          ]
        },
        {
          "uuid": "cacb6241-796e-455a-b0ed-c3f641a4863b",
          "code": "115851-85-9",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=115851-85-9",
          "code_system": "CAS",
          "references": [
            "913abf00-7dd6-44ea-8465-288839dff8a6",
            "f129e880-db23-4210-9f5b-54e616fbec63"
          ]
        },
        {
          "uuid": "d6f7d537-bf57-4e38-b3c6-7dbbd8591bea",
          "code": "917813-54-8",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=917813-54-8",
          "code_system": "CAS",
          "references": [
            "913abf00-7dd6-44ea-8465-288839dff8a6",
            "b262edf0-759c-4771-adfd-c4e072b41c05"
          ]
        },
        {
          "uuid": "268dc1f7-26a0-49f4-8299-88b1a5f2adb2",
          "code": "9952605",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9952605",
          "code_system": "PUBCHEM",
          "references": [
            "913abf00-7dd6-44ea-8465-288839dff8a6"
          ]
        },
        {
          "uuid": "e5ba26ec-8f01-1441-6619-9f29a2ab7530",
          "code": "DTXSID10200352",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10200352",
          "code_system": "EPA CompTox",
          "references": [
            "d0bfe223-d269-c9a4-a552-3ba6fbf826b2"
          ]
        },
        {
          "uuid": "076dd190-31a5-7064-8cb2-8d49267b9efc",
          "code": "DB06133",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB06133",
          "code_system": "DRUG BANK",
          "references": [
            "f50f6d3f-07f3-adf3-c3bc-34926411f7c5"
          ]
        },
        {
          "uuid": "6d63f4ef-5b35-4f5f-adf4-ffaccb752e9b",
          "code": "D60XLY608D",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c2f1bc9f-38a2-4f2f-af89-98dca096a1bb",
          "code": "Dimethylcurcumin",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Dimethylcurcumin",
          "code_system": "WIKIPEDIA",
          "references": [
            "b645ebec-f35e-e534-c328-134639ee52a8"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e20469d0-9b06-4343-8f11-70fdea4ab4b1",
          "name": "1,6-HEPTADIENE-3,5-DIONE, 1,7-BIS(3,4-DIMETHOXYPHENYL)-, (1E,6E)-",
          "stdName": "1,6-HEPTADIENE-3,5-DIONE, 1,7-BIS(3,4-DIMETHOXYPHENYL)-, (1E,6E)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a22dfa0-92f6-43b0-b97e-bdeb63e58850",
            "a84789be-614d-4f45-bb4c-6e58827adf99"
          ],
          "display_name": false
        },
        {
          "uuid": "b9cf3044-d5ab-46e8-9bc5-b48690ee5a2e",
          "name": "ASCJ-9",
          "stdName": "ASCJ-9",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a22dfa0-92f6-43b0-b97e-bdeb63e58850",
            "93f2e625-8991-45fe-a358-51dccb02f34d"
          ],
          "display_name": false
        },
        {
          "uuid": "6dd81423-6f68-45fd-af9a-e1054a514b09",
          "name": "CHC-004",
          "stdName": "CHC-004",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a22dfa0-92f6-43b0-b97e-bdeb63e58850",
            "93f2e625-8991-45fe-a358-51dccb02f34d"
          ],
          "display_name": false
        },
        {
          "uuid": "eeacddfd-0b90-4fef-9d5c-6b7c2c4ade9b",
          "name": "DIMETHYLCURCUMIN",
          "stdName": "DIMETHYLCURCUMIN",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a22dfa0-92f6-43b0-b97e-bdeb63e58850",
            "93f2e625-8991-45fe-a358-51dccb02f34d"
          ],
          "display_name": true
        },
        {
          "uuid": "edd0e709-3484-494b-91cf-b56fb79d0808",
          "name": "GO-Y-025",
          "stdName": "GO-Y-025",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a22dfa0-92f6-43b0-b97e-bdeb63e58850",
            "93f2e625-8991-45fe-a358-51dccb02f34d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "7a22dfa0-92f6-43b0-b97e-bdeb63e58850",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a84789be-614d-4f45-bb4c-6e58827adf99",
          "citation": "ACD 9.0",
          "doc_type": "ACD",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "93f2e625-8991-45fe-a358-51dccb02f34d",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "913abf00-7dd6-44ea-8465-288839dff8a6",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392612000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ba088183-849d-4c96-bab8-6bd1b1c0d072",
          "citation": "SRS import [D60XLY608D]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=D60XLY608D",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392612000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d0bfe223-d269-c9a4-a552-3ba6fbf826b2",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=52328-98-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b645ebec-f35e-e534-c328-134639ee52a8",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "f50f6d3f-07f3-adf3-c3bc-34926411f7c5",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "01fad0e8-85aa-41af-b4b9-d92c19103d44",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a2d1ec6a-2b92-403d-8a14-77500703fe24",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b1941982-034c-4138-8e38-50af925cd1e4",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "e4fec181-4a16-47a6-bb33-8bd4b3c9a460",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f129e880-db23-4210-9f5b-54e616fbec63",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b262edf0-759c-4771-adfd-c4e072b41c05",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f79c5f34-45f4-4a0d-b907-67c87aa65250",
          "id": "f79c5f34-45f4-4a0d-b907-67c87aa65250",
          "molfile": "\n  Marvin  01132112502D          \n\n 29 30  0  0  0  0            999 V2000\n   -2.2383   -0.8940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5246   -1.3078    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8094   -0.8966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0964   -1.3108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6206   -0.8963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6186   -0.0674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3315    0.3478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0475   -0.0621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7605    0.3531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7524    1.1756    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4731   -0.0575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1856    0.3570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1829    1.1828    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9014   -0.0532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6145    0.3616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3304   -0.0486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3283   -0.8719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0433   -1.2821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7575   -0.8672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4738   -1.2763    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1864   -0.8606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7521   -0.0379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4638    0.3795    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1810   -0.0281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0365    0.3685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0977    0.3413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8085   -0.0700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5230    0.3426    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2375   -0.0698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n 27  3  2  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6 26  2  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 25 16  2  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 22  2  0  0  0  0\n 20 21  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 25  1  0  0  0  0\n 23 24  1  0  0  0  0\n 26 27  1  0  0  0  0\n 27 28  1  0  0  0  0\n 28 29  1  0  0  0  0\nM  END",
          "smiles": "COc1ccc(/C=C/C(=O)CC(=O)/C=C/c2ccc(c(c2)OC)OC)cc1OC",
          "formula": "C23H24O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "917da1a8-134b-46f9-8323-151463b936ab"
          },
          "defined_stereo": 0,
          "ez_centers": 2,
          "molecular_weight": "396.4339",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "81186c82-4d01-4e00-8b85-653c387b2e12",
      "version": "7",
      "structure": {
        "id": "7af49c84-95d9-4441-a568-0ee517808951",
        "molfile": "\n  Marvin  01132106232D          \n\n 29 30  0  0  0  0            999 V2000\n   -0.8085   -0.0700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8094   -0.8966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0964   -1.3108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6206   -0.8963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6186   -0.0674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0977    0.3413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5230    0.3426    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5246   -1.3078    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3315    0.3478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0475   -0.0621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7605    0.3531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4731   -0.0575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1856    0.3570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1829    1.1828    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7524    1.1756    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9014   -0.0532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6145    0.3616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3304   -0.0486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3283   -0.8719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0433   -1.2821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7575   -0.8672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7521   -0.0379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0365    0.3685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4638    0.3795    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4738   -1.2763    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2375   -0.0698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2383   -0.8940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1810   -0.0281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1864   -0.8606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  7  1  0  0  0  0\n 15 11  2  0  0  0  0\n  3  4  2  0  0  0  0\n 13 16  1  0  0  0  0\n  2  8  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n  5  9  1  0  0  0  0\n 18 19  2  0  0  0  0\n  4  5  1  0  0  0  0\n 19 20  1  0  0  0  0\n  9 10  2  0  0  0  0\n 20 21  2  0  0  0  0\n  2  3  1  0  0  0  0\n 21 22  1  0  0  0  0\n 10 11  1  0  0  0  0\n 22 23  2  0  0  0  0\n 23 18  1  0  0  0  0\n  5  6  2  0  0  0  0\n 22 24  1  0  0  0  0\n 11 12  1  0  0  0  0\n 21 25  1  0  0  0  0\n  6  1  1  0  0  0  0\n  7 26  1  0  0  0  0\n 12 13  1  0  0  0  0\n  8 27  1  0  0  0  0\n  1  2  2  0  0  0  0\n 24 28  1  0  0  0  0\n 13 14  2  0  0  0  0\n 25 29  1  0  0  0  0\nM  END",
        "smiles": "COc1ccc(/C=C/C(=O)CC(=O)/C=C/c2ccc(c(c2)OC)OC)cc1OC",
        "formula": "C23H24O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 2,
        "molecular_weight": "396.4339",
        "optical_activity": "NONE",
        "references": [
          "7a22dfa0-92f6-43b0-b97e-bdeb63e58850",
          "ba088183-849d-4c96-bab8-6bd1b1c0d072"
        ],
        "stereo_centers": 0
      },
      "unii": "D60XLY608D"
    }
  ]
}