{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "74b0bc05-efff-4b60-928a-afe8e1896e43", "code": "17676-33-4", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=17676-33-4", "code_system": "CAS", "references": [ "f3d4648a-7617-4750-bc69-f76d82ee5fcf", "b283953e-b015-406e-88d1-7335ed29810f" ] }, { "uuid": "b74a2416-b93f-4927-b440-33f228dd9352", "code": "241-660-1", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.037.857", "code_system": "ECHA (EC/EINECS)", "references": [ "f3d4648a-7617-4750-bc69-f76d82ee5fcf" ] }, { "uuid": "27d93ae0-e341-4d69-a2ba-4be2ea0567bc", "code": "9910474", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9910474", "code_system": "PUBCHEM", "references": [ "f3d4648a-7617-4750-bc69-f76d82ee5fcf" ] }, { "uuid": "1d75e496-a52b-4015-bc56-f106f9d141f7", "code": "D4E4KC2TUK", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "51b085e0-2b65-5268-1034-0b5c24d1047b", "code": "DTXSID60938850", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60938850", "code_system": "EPA CompTox", "references": [ "9f05a4d2-850f-5407-0103-ec748e4f1cb5" ] } ], "substance_class": "chemical", "names": [ { "uuid": "48275342-0d98-4174-93cb-3b4b9d1c7bfd", "name": "25(27)-DEHYDRORUSCOGENIN", "stdName": "25(27)-DEHYDRORUSCOGENIN", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "6f283d09-7ce5-479b-b120-f0928da898b5" ], "display_name": false }, { "uuid": "bc6c1258-df9d-4f7c-9a8d-24d7c6f1c221", "name": "NEORUSCOGENIN", "stdName": "NEORUSCOGENIN", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "6f283d09-7ce5-479b-b120-f0928da898b5" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "37e055cb-5ad4-4be2-b72c-9f227385c674", "name_org": "INCI" } ] }, { "uuid": "ecffa108-495e-4bde-9016-832ea2d604f4", "name": "SPIROSTA-5,25(27)-DIENE-1,3-DIOL, (1.BETA.,3.BETA.)-", "stdName": "SPIROSTA-5,25(27)-DIENE-1,3-DIOL, (1.BETA.,3.BETA.)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "6f283d09-7ce5-479b-b120-f0928da898b5" ], "display_name": false }, { "uuid": "c604f5d1-5e37-4d71-acf6-3affb2c558c9", "name": "SPIROSTA-5,25(27)-DIENE-1BETA,3BETA-DIOL", "stdName": "SPIROSTA-5,25(27)-DIENE-1BETA,3BETA-DIOL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ef9e8e7c-b92b-43db-a7d2-a420da480499" ], "display_name": false } ], "references": [ { "uuid": "ef9e8e7c-b92b-43db-a7d2-a420da480499", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "6f283d09-7ce5-479b-b120-f0928da898b5", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f3d4648a-7617-4750-bc69-f76d82ee5fcf", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493394072000, "tags": [ "NOMEN" ] }, { "uuid": "9160904a-ba9b-4feb-b452-717a70b09039", "citation": "SRS import [D4E4KC2TUK]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=D4E4KC2TUK", "doc_type": "SRS", "public_domain": true, "document_date": 1493394072000, "tags": [ "NOMEN" ] }, { "uuid": "cd262024-5065-1a69-e9d6-9f92eb30d869", "citation": "PCPC", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true }, { "uuid": "b283953e-b015-406e-88d1-7335ed29810f", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "9f05a4d2-850f-5407-0103-ec748e4f1cb5", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "93d31463-462f-412f-b93f-343baa6e3aea", "id": "93d31463-462f-412f-b93f-343baa6e3aea", "molfile": "\n Marvin 01132107402D \n\n 31 36 0 0 1 0 999 V2000\n 8.6160 -5.4071 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 8.0639 -6.0202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3103 -5.6846 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 6.5566 -6.0202 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 6.4703 -6.8407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7167 -7.1763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0492 -6.6913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2955 -7.0269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6281 -6.5420 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 2.8745 -6.8775 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7144 -5.7215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4681 -5.3859 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 4.5543 -4.5654 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1355 -5.8709 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 5.2217 -5.0504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8892 -5.5353 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 5.9754 -4.7149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7290 -4.3793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3965 -4.8642 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 7.5680 -4.0572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2035 -4.6926 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 8.7555 -4.0796 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 8.5840 -3.2726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5092 -4.4151 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 9.5092 -3.5901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2236 -3.1777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9381 -3.5901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6526 -3.1777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9381 -4.4151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2236 -4.8277 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4229 -5.2357 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 21 1 1 0 0 0 0\n 1 31 1 0 0 0 0\n 3 2 1 1 0 0 0\n 3 4 1 0 0 0 0\n 19 3 1 0 0 0 0\n 4 5 1 6 0 0 0\n 4 16 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 14 7 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 1 0 0 0\n 11 9 1 0 0 0 0\n 12 11 1 0 0 0 0\n 12 13 1 1 0 0 0\n 14 12 1 0 0 0 0\n 14 15 1 1 0 0 0\n 16 14 1 0 0 0 0\n 16 17 1 1 0 0 0\n 18 17 1 0 0 0 0\n 19 18 1 0 0 0 0\n 19 20 1 0 0 0 0\n 21 19 1 1 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 6 0 0 0\n 22 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 24 30 1 0 0 0 0\n 24 31 1 1 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 2 0 0 0 0\n 29 27 1 0 0 0 0\n 30 29 1 0 0 0 0\nM END", "smiles": "C=C1CC[C@@]2([C@@H](C)[C@H]3[C@H](C[C@H]4[C@@H]5CC=C6C[C@H](C[C@H]([C@]6(C)[C@H]5CCC43C)O)O)O2)OC1", "formula": "C27H40O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "3528d84d-71c0-4436-b386-79ad505ec982" }, "defined_stereo": 10, "ez_centers": 0, "molecular_weight": "428.6051", "optical_activity": "UNSPECIFIED", "stereo_centers": 11 } ], "definition_level": "COMPLETE", "uuid": "ea3b276d-8afd-4a62-9bca-e78485fdc103", "version": "7", "structure": { "id": "929cd66b-3408-49b6-b54d-5237d915b01d", "molfile": "\n Marvin 01132107362D \n\n 36 41 0 0 1 0 999 V2000\n 7.5680 -4.0572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3965 -4.8642 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.2035 -4.6926 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 8.6160 -5.4071 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 8.0639 -6.0202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3103 -5.6846 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 6.5566 -6.0202 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 5.8892 -5.5353 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 5.9754 -4.7149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7290 -4.3793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1355 -5.8709 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 5.2217 -5.0504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0492 -6.6913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7167 -7.1763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4703 -6.8407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2955 -7.0269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6281 -6.5420 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 3.7144 -5.7215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4681 -5.3859 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 4.5543 -4.5654 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8745 -6.8775 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8029 -6.3558 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6428 -5.1998 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3103 -6.5096 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4229 -5.2357 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5092 -4.4151 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.7555 -4.0796 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.5840 -3.2726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5092 -3.5901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2236 -3.1777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9381 -3.5901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9381 -4.4151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2236 -4.8277 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6526 -3.1777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9515 -4.6535 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8679 -5.4463 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 1 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 6 5 1 0 0 0 0\n 2 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 2 10 1 0 0 0 0\n 8 11 1 0 0 0 0\n 11 12 1 1 0 0 0\n 11 13 1 0 0 0 0\n 14 13 2 0 0 0 0\n 15 14 1 0 0 0 0\n 7 15 1 0 0 0 0\n 13 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 18 17 1 0 0 0 0\n 19 18 1 0 0 0 0\n 11 19 1 0 0 0 0\n 19 20 1 1 0 0 0\n 17 21 1 1 0 0 0\n 8 22 1 6 0 0 0\n 7 23 1 1 0 0 0\n 6 24 1 6 0 0 0\n 4 25 1 0 0 0 0\n 26 25 1 1 0 0 0\n 27 26 1 0 0 0 0\n 3 27 1 0 0 0 0\n 27 28 1 6 0 0 0\n 26 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 32 31 1 0 0 0 0\n 33 32 1 0 0 0 0\n 26 33 1 0 0 0 0\n 31 34 2 0 0 0 0\n 4 35 1 6 0 0 0\n 3 36 1 6 0 0 0\nM END", "smiles": "C=C1CC[C@@]2([C@@H](C)[C@@]3([H])[C@]([H])(C[C@@]4([H])[C@]5([H])CC=C6C[C@H](C[C@H]([C@]6(C)[C@@]5([H])CC[C@@]43C)O)O)O2)OC1", "formula": "C27H40O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 11, "ez_centers": 0, "molecular_weight": "428.6051", "optical_activity": "UNSPECIFIED", "references": [ "9160904a-ba9b-4feb-b452-717a70b09039", "ef9e8e7c-b92b-43db-a7d2-a420da480499" ], "stereo_centers": 11 }, "unii": "D4E4KC2TUK" } ] }