{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2321468e-ba6b-4394-ba2c-54d6b7d76b01",
          "code": "60348-60-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=60348-60-9",
          "code_system": "CAS",
          "references": [
            "37616143-dfbf-4299-9ce6-bcc57eabb7e4",
            "dc8e3e72-9c45-4ca5-8ff6-d0dd28d8d049"
          ]
        },
        {
          "uuid": "bbe22505-a69a-449e-ad48-ed473ae9b0a5",
          "code": "36159",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/36159",
          "code_system": "PUBCHEM",
          "references": [
            "37616143-dfbf-4299-9ce6-bcc57eabb7e4"
          ]
        },
        {
          "uuid": "97507309-b737-be82-d544-5faac0430e93",
          "code": "DTXSID9030048",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9030048",
          "code_system": "EPA CompTox",
          "references": [
            "b7517247-2473-72e3-5524-75cd28cde6a6"
          ]
        },
        {
          "uuid": "ade682c8-cc61-4e73-85b3-b939cdec189d",
          "code": "D3A2T91I1E",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "1e7e079d-e032-f771-a821-5f474ecb0cbe",
          "code": "81582",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:81582",
          "code_system": "CHEBI",
          "references": [
            "ce49482c-f325-5bba-3851-6ae9e922cbcb"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "0862aa89-8cab-412f-9fef-9bccaf15f259",
          "name": "2,2',4,4',5-PENTABROMODIPHENYL ETHER",
          "stdName": "2,2',4,4',5-PENTABROMODIPHENYL ETHER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a058766b-c8bc-4755-9774-0c985ea28fc3",
            "e82af9ee-7e48-4bcd-9eb7-666f9315bab8"
          ],
          "display_name": true
        },
        {
          "uuid": "fd0eeddc-deaf-469f-8864-02018b9538ef",
          "name": "2,2',4,4',5-PENTABROMODIPHENYL OXIDE",
          "stdName": "2,2',4,4',5-PENTABROMODIPHENYL OXIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a058766b-c8bc-4755-9774-0c985ea28fc3",
            "e82af9ee-7e48-4bcd-9eb7-666f9315bab8"
          ],
          "display_name": false
        },
        {
          "uuid": "9f388cb6-1c69-4b01-9743-6f9c661e20f8",
          "name": "BENZENE, 1,2,4-TRIBROMO-5-(2,4-DIBROMOPHENOXY)-",
          "stdName": "BENZENE, 1,2,4-TRIBROMO-5-(2,4-DIBROMOPHENOXY)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a058766b-c8bc-4755-9774-0c985ea28fc3",
            "e82af9ee-7e48-4bcd-9eb7-666f9315bab8"
          ],
          "display_name": false
        },
        {
          "uuid": "a5c785da-fdef-46d9-a46f-93a94c56ace8",
          "name": "PBDE 99",
          "stdName": "PBDE 99",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a058766b-c8bc-4755-9774-0c985ea28fc3",
            "e82af9ee-7e48-4bcd-9eb7-666f9315bab8"
          ],
          "display_name": false
        },
        {
          "uuid": "718894da-f5c1-4755-b47e-f83793e0c1a7",
          "name": "TARDEX 50",
          "stdName": "TARDEX 50",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a058766b-c8bc-4755-9774-0c985ea28fc3",
            "e82af9ee-7e48-4bcd-9eb7-666f9315bab8"
          ],
          "display_name": false
        },
        {
          "uuid": "92220487-c31e-4a6e-a937-1a3d6080410a",
          "name": "TARDEX 50L",
          "stdName": "TARDEX 50L",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a058766b-c8bc-4755-9774-0c985ea28fc3",
            "e82af9ee-7e48-4bcd-9eb7-666f9315bab8"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e82af9ee-7e48-4bcd-9eb7-666f9315bab8",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a058766b-c8bc-4755-9774-0c985ea28fc3",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "37616143-dfbf-4299-9ce6-bcc57eabb7e4",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390929000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "241fa261-14b1-451e-b42e-afc9efe00370",
          "citation": "SRS import [D3A2T91I1E]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=D3A2T91I1E",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390929000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5bb3f351-dec2-459f-adda-ebb41dd2b7bc",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b7517247-2473-72e3-5524-75cd28cde6a6",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=60348-60-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ce49482c-f325-5bba-3851-6ae9e922cbcb",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "dc8e3e72-9c45-4ca5-8ff6-d0dd28d8d049",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a696f0db-9e83-4ea3-8ff4-d7c30cfd84ee",
          "id": "a696f0db-9e83-4ea3-8ff4-d7c30cfd84ee",
          "molfile": "\n  Marvin  01132108392D          \n\n 18 19  0  0  0  0            999 V2000\n    9.9223   -5.9686    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    9.2196   -5.6076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2196   -4.7955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5027   -4.3824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7854   -4.7955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0683   -4.3824    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3418   -4.7955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3418   -5.6076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6344   -6.0159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6344   -6.7948    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    4.9173   -5.6076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1003   -6.1015    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    4.9173   -4.7955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6344   -4.3824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6344   -3.5654    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    7.7854   -5.6076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0683   -6.0159    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    8.5027   -6.0159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n 18  2  2  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 16  2  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 14  2  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 11  2  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\nM  END",
          "smiles": "c1cc(c(cc1Br)Br)Oc2cc(c(cc2Br)Br)Br",
          "formula": "C12H5Br5O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ed698d66-b867-4901-84f7-1e239dc92f94"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "564.6856",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "52b356a7-221d-437c-bcb3-de62333974e9",
      "version": "4",
      "structure": {
        "id": "289754f3-292f-4778-ab6f-3f634f5a1c79",
        "molfile": "\n  Marvin  01132102132D          \n\n 18 19  0  0  0  0            999 V2000\n    6.3418   -4.7955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0683   -4.3824    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7854   -4.7955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7854   -5.6076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5027   -6.0159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2196   -5.6076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9223   -5.9686    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    9.2196   -4.7955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5027   -4.3824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0683   -6.0159    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    5.6344   -4.3824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9173   -4.7955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9173   -5.6076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1003   -6.1015    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    5.6344   -6.0159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3418   -5.6076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6344   -6.7948    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    5.6344   -3.5654    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9  8  2  0  0  0  0\n  3  9  1  0  0  0  0\n  4 10  1  0  0  0  0\n  1 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 13  2  0  0  0  0\n 16 15  1  0  0  0  0\n  1 16  2  0  0  0  0\n 15 17  1  0  0  0  0\n 11 18  1  0  0  0  0\nM  END",
        "smiles": "c1cc(c(cc1Br)Br)Oc2cc(c(cc2Br)Br)Br",
        "formula": "C12H5Br5O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "564.6856",
        "optical_activity": "NONE",
        "references": [
          "5bb3f351-dec2-459f-adda-ebb41dd2b7bc",
          "241fa261-14b1-451e-b42e-afc9efe00370"
        ],
        "stereo_centers": 0
      },
      "unii": "D3A2T91I1E"
    }
  ]
}