{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "4b733156-3af8-40dc-9954-737f4f022152",
          "code": "13170-23-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=13170-23-5",
          "code_system": "CAS",
          "references": [
            "e860ffec-fabd-42d5-9de4-b4ce450f8ba7",
            "aee84fe5-6ae9-43d1-a25b-762002887ba2"
          ]
        },
        {
          "uuid": "73053004-c679-4ec1-94ef-173c73b92078",
          "code": "236-112-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.032.815",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "e860ffec-fabd-42d5-9de4-b4ce450f8ba7"
          ]
        },
        {
          "uuid": "97e60a0f-6451-4b4c-a356-a5ba84553b71",
          "code": "83199",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/83199",
          "code_system": "PUBCHEM",
          "references": [
            "e860ffec-fabd-42d5-9de4-b4ce450f8ba7"
          ]
        },
        {
          "uuid": "f090d4c2-3ddf-9912-d658-73b967073e7d",
          "code": "DTXSID3065372",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3065372",
          "code_system": "EPA CompTox",
          "references": [
            "bd4028e0-25d2-7b27-5099-a4e42269c2c6"
          ]
        },
        {
          "uuid": "bcfd8db6-5712-4736-a06d-9b2500acf11f",
          "code": "D36B6TC1DM",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "28c0980a-8daf-4831-b5a7-fe6e94b94427",
          "name": "ACETIC ACID, 1,1'-DIANHYDRIDE WITH SILICIC ACID (H4SIO4) BIS(1,1-DIMETHYLETHYL) ESTER",
          "stdName": "ACETIC ACID, 1,1'-DIANHYDRIDE WITH SILICIC ACID (H4SIO4) BIS(1,1-DIMETHYLETHYL) ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b9fc525-acd1-481c-b6dc-fda85294142b",
            "2b949ac0-3e25-45de-aa0e-b7c22d287ab1"
          ],
          "display_name": false
        },
        {
          "uuid": "a627c149-aa70-4a45-a3bb-514e042c2360",
          "name": "DI-TERT-BUTOXYDIACETOXYSILANE",
          "stdName": "DI-TERT-BUTOXYDIACETOXYSILANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "976fa208-56c3-46a5-9f15-202862b63a46"
          ],
          "display_name": true
        },
        {
          "uuid": "f4daa249-a24b-47d6-b943-e8239be26760",
          "name": "SILANE, DI(TERT-BUTOXY)DIACETOXY-",
          "stdName": "SILANE, DI(TERT-BUTOXY)DIACETOXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "43f2938c-54d2-4924-8549-f774ceed9348",
            "2b949ac0-3e25-45de-aa0e-b7c22d287ab1"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "976fa208-56c3-46a5-9f15-202862b63a46",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3b9fc525-acd1-481c-b6dc-fda85294142b",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2b949ac0-3e25-45de-aa0e-b7c22d287ab1",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "43f2938c-54d2-4924-8549-f774ceed9348",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e860ffec-fabd-42d5-9de4-b4ce450f8ba7",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391117000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eeffad10-f41b-4a7c-b4ac-f6b1ebb6fb67",
          "citation": "SRS import [D36B6TC1DM]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=D36B6TC1DM",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391117000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0f36d6fb-b4c9-4107-a88d-946fe0029305",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bd4028e0-25d2-7b27-5099-a4e42269c2c6",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=13170-23-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "aee84fe5-6ae9-43d1-a25b-762002887ba2",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a51131b2-1475-4914-959d-fdeb1f21e039",
          "id": "a51131b2-1475-4914-959d-fdeb1f21e039",
          "molfile": "\n  Marvin  01132108342D          \n\n 19 18  0  0  0  0            999 V2000\n    9.0173   -4.7092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0173   -5.5368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7370   -5.9506    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3022   -5.9506    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4473   -5.4526    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    6.7265   -5.8664    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7265   -6.6881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4410   -7.0986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0068   -7.0973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9807   -4.8229    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6424   -3.8889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1755   -4.0558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4223   -3.6078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3612   -3.1136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8121   -4.6899    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6729   -4.8877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7550   -5.3800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5328   -4.0766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8571   -5.0325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 10  1  0  0  0  0\n  5 15  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  7  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 11 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 16 19  1  0  0  0  0\nM  END",
          "smiles": "CC(=O)O[Si](OC(=O)C)(OC(C)(C)C)OC(C)(C)C",
          "formula": "C12H24O6Si",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5a143a32-27d8-4c19-85ca-bee5f618db54"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "292.4012",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d0008713-f501-45e9-ab37-a9ef89d9d445",
      "version": "3",
      "structure": {
        "id": "a831f387-7cd2-4dae-8fce-d7cfa64e0626",
        "molfile": "\n  Marvin  01132108442D          \n\n 19 18  0  0  0  0            999 V2000\n    6.0068   -7.0973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7265   -6.6881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7265   -5.8664    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4473   -5.4526    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    8.3022   -5.9506    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0173   -5.5368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7370   -5.9506    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0173   -4.7092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9807   -4.8229    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6424   -3.8889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1755   -4.0558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4223   -3.6078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3612   -3.1136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8121   -4.6899    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6729   -4.8877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7550   -5.3800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5328   -4.0766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8571   -5.0325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4410   -7.0986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  6  8  1  0  0  0  0\n  4  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 10 13  1  0  0  0  0\n  4 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 15 18  1  0  0  0  0\n  2 19  1  0  0  0  0\nM  END",
        "smiles": "CC(=O)O[Si](OC(=O)C)(OC(C)(C)C)OC(C)(C)C",
        "formula": "C12H24O6Si",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "292.4012",
        "optical_activity": "NONE",
        "references": [
          "eeffad10-f41b-4a7c-b4ac-f6b1ebb6fb67",
          "0f36d6fb-b4c9-4107-a88d-946fe0029305"
        ],
        "stereo_centers": 0
      },
      "unii": "D36B6TC1DM"
    }
  ]
}