{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b18e2495-43c5-4144-a3b7-6c73d25cbe4e",
          "code": "10208-80-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=10208-80-7",
          "code_system": "CAS",
          "references": [
            "e7a3d683-5197-47f3-995f-a28edb38e477",
            "710dbc83-68ed-435e-9776-aebd587b6e13"
          ]
        },
        {
          "uuid": "0a475e76-3955-42ac-b4f9-302c760b3be6",
          "code": "12306047",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/12306047",
          "code_system": "PUBCHEM",
          "references": [
            "e7a3d683-5197-47f3-995f-a28edb38e477"
          ]
        },
        {
          "uuid": "f70cd5de-6fb6-7b0e-0a3f-361afc1b1af6",
          "code": "64797",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:64797",
          "code_system": "CHEBI",
          "references": [
            "7977c6fb-558f-960a-60cf-45906c50ef48"
          ]
        },
        {
          "uuid": "cb622cdc-7149-40be-b3c6-8d91e21a26ee",
          "code": "D2ZGB75M36",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "da3b2ec5-cd8b-3396-b5de-2f9c3a9fdef1",
          "code": "DTXSID90144629",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90144629",
          "code_system": "EPA CompTox",
          "references": [
            "744235d2-0f64-7354-8c69-cf14784a71b3"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c8249051-081f-4bb2-86f3-b8aee3cd50e0",
          "name": "(-)-.ALPHA.-MUUROLENE",
          "stdName": "(-)-.ALPHA.-MUUROLENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0bf03ae3-19d9-403c-82c9-5736137137e1",
            "ba2db19f-55ef-414d-8a21-666b9fee5f68"
          ],
          "display_name": false
        },
        {
          "uuid": "434dc2d4-58d9-4927-bfda-34177951b5e8",
          "name": "(1S,4AS,8AR)-1,2,4A,5,6,8A-HEXAHYDRO-4,7-DIMETHYL-1-(1-METHYLETHYL)NAPHTHALENE",
          "stdName": "(1S,4AS,8AR)-1,2,4A,5,6,8A-HEXAHYDRO-4,7-DIMETHYL-1-(1-METHYLETHYL)NAPHTHALENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "710dbc83-68ed-435e-9776-aebd587b6e13"
          ],
          "display_name": false
        },
        {
          "uuid": "825fa975-6693-456f-af36-54957a8b5488",
          "name": ".ALPHA.-MUUROLENE",
          "stdName": ".ALPHA.-MUUROLENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0bf03ae3-19d9-403c-82c9-5736137137e1",
            "ba2db19f-55ef-414d-8a21-666b9fee5f68"
          ],
          "display_name": false
        },
        {
          "uuid": "27f794f0-08f6-4ca1-8989-b131c1a2a9d7",
          "name": ".ALPHA.-MUUROLENE, (-)-",
          "stdName": ".ALPHA.-MUUROLENE, (-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "710dbc83-68ed-435e-9776-aebd587b6e13"
          ],
          "display_name": true
        },
        {
          "uuid": "39190bb1-8744-4050-9a80-cd16c68a1ea1",
          "name": "1.BETA.-CADINA-4,9-DIENE",
          "stdName": "1.BETA.-CADINA-4,9-DIENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0bf03ae3-19d9-403c-82c9-5736137137e1",
            "ba2db19f-55ef-414d-8a21-666b9fee5f68"
          ],
          "display_name": false
        },
        {
          "uuid": "379fa786-8884-4733-8ec8-01646e785138",
          "name": "B1-CADINENE",
          "stdName": "B1-CADINENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0bf03ae3-19d9-403c-82c9-5736137137e1",
            "ba2db19f-55ef-414d-8a21-666b9fee5f68"
          ],
          "display_name": false
        },
        {
          "uuid": "a87a7f10-505d-4f43-bafe-57ea5c4a002c",
          "name": "NAPHTHALENE, 1,2,4A,5,6,8A-HEXAHYDRO-4,7-DIMETHYL-1-(1-METHYLETHYL)-, (1S,4AS,8AR)-",
          "stdName": "NAPHTHALENE, 1,2,4A,5,6,8A-HEXAHYDRO-4,7-DIMETHYL-1-(1-METHYLETHYL)-, (1S,4AS,8AR)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0bf03ae3-19d9-403c-82c9-5736137137e1",
            "ba2db19f-55ef-414d-8a21-666b9fee5f68"
          ],
          "display_name": false
        },
        {
          "uuid": "7171afbc-2130-40e1-8ba6-200c05d3e6f0",
          "name": "NAPHTHALENE, 1,2,4A,5,6,8A-HEXAHYDRO-4,7-DIMETHYL-1-(1-METHYLETHYL)-, (1S-(1.ALPHA.,4A.ALPHA.,8A.ALPHA.))-",
          "stdName": "NAPHTHALENE, 1,2,4A,5,6,8A-HEXAHYDRO-4,7-DIMETHYL-1-(1-METHYLETHYL)-, (1S-(1.ALPHA.,4A.ALPHA.,8A.ALPHA.))-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0bf03ae3-19d9-403c-82c9-5736137137e1",
            "ba2db19f-55ef-414d-8a21-666b9fee5f68"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "0bf03ae3-19d9-403c-82c9-5736137137e1",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ba2db19f-55ef-414d-8a21-666b9fee5f68",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e7a3d683-5197-47f3-995f-a28edb38e477",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392474000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1e9c0411-2f2e-5d96-7c04-bc7fd739520d",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=10208-80-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7977c6fb-558f-960a-60cf-45906c50ef48",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "710dbc83-68ed-435e-9776-aebd587b6e13",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "744235d2-0f64-7354-8c69-cf14784a71b3",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "aebfefc8-2491-4ae1-8565-bd83f87c46ca",
          "id": "aebfefc8-2491-4ae1-8565-bd83f87c46ca",
          "molfile": "\n  Marvin  01132109042D          \n\n 15 16  0  0  1  0            999 V2000\n    7.8430   -5.9714    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    7.1285   -6.3840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1285   -7.2090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8430   -7.6214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8430   -8.4465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5574   -7.2090    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    9.2719   -7.6215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9864   -7.2090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9864   -6.3840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7008   -5.9714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2719   -5.9714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5574   -6.3840    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    7.8430   -5.1464    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.1285   -4.7340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5574   -4.7340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n 12  1  1  0  0  0  0\n  1 13  1  1  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  4  1  0  0  0  0\n  6  7  1  6  0  0  0\n  6 12  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11  9  2  0  0  0  0\n 12 11  1  6  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\nM  END",
          "smiles": "CC(C)[C@@H]1CC=C(C)[C@H]2CCC(=C[C@@H]12)C",
          "formula": "C15H24",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "71064dd9-a059-4ae9-8698-087bf20f2143"
          },
          "defined_stereo": 3,
          "ez_centers": 0,
          "molecular_weight": "204.3516",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ce6271e8-0440-48c5-a845-f5ddf5a431fa",
      "version": "9",
      "structure": {
        "id": "03f1642d-02e9-4fc0-a34a-4471fb995c2a",
        "molfile": "\n  Marvin  01132100302D          \n\n 17 18  0  0  1  0            999 V2000\n    7.8430   -5.1464    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.1285   -4.7340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5574   -4.7340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8430   -5.9714    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.5574   -6.3840    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.5574   -7.2090    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.8430   -7.6214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1285   -7.2090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1285   -6.3840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8430   -8.4465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2719   -7.6215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9864   -7.2090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9864   -6.3840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2719   -5.9714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7008   -5.9714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5574   -8.0340    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5574   -5.5590    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  4  1  1  1  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n  4  9  1  0  0  0  0\n  7 10  1  0  0  0  0\n  6 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n  5 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n  6 16  1  1  0  0  0\n  5 17  1  1  0  0  0\nM  END",
        "smiles": "CC(C)[C@@H]1CC=C(C)[C@@]2([H])CCC(=C[C@@]12[H])C",
        "formula": "C15H24",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 3,
        "ez_centers": 0,
        "molecular_weight": "204.3516",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "0bf03ae3-19d9-403c-82c9-5736137137e1",
          "710dbc83-68ed-435e-9776-aebd587b6e13"
        ],
        "stereo_centers": 3
      },
      "unii": "D2ZGB75M36"
    }
  ]
}