{
"meta": {
"disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
"terms": "https://open.fda.gov/terms/",
"license": "https://open.fda.gov/license/",
"last_updated": "2025-09-19",
"results": {
"skip": 0,
"limit": 1,
"total": 1
}
},
"results": [
{
"codes": [
{
"uuid": "9d8b338f-e85f-4084-b9fa-7fb5c75b97b0",
"code": "827306-88-7",
"type": "PRIMARY",
"url": "https://commonchemistry.cas.org/detail?cas_rn=827306-88-7",
"code_system": "CAS",
"references": [
"11ab606e-1bf4-4187-b12d-91959a20aecc",
"07e61f69-459c-4284-93f9-4918ae020c2c"
]
},
{
"uuid": "dc0b1184-68c5-4928-a8e4-83cbb0eba0cb",
"code": "D1HW9N9QBX",
"type": "PRIMARY",
"code_system": "FDA UNII"
},
{
"uuid": "ac8dc8b4-26bc-cb10-7e46-95911c603673",
"code": "D1HW9N9QBX",
"type": "PRIMARY",
"url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=D1HW9N9QBX",
"code_system": "DAILYMED",
"references": [
"8799403e-0558-800f-e9c4-1298fcfd08ae"
]
},
{
"uuid": "03932912-981f-f8b3-b3fb-520486d3c8a4",
"code": "2000919",
"type": "PRIMARY",
"url": "https://rxnav.nlm.nih.gov/REST/rxcui/2000919/allProperties.xml?prop=all",
"code_system": "RXCUI",
"references": [
"d369694e-e089-ceda-4d4d-68f8d775928c"
]
},
{
"uuid": "b6ea4926-d7b1-673b-7619-543671338d71",
"code": "11752568",
"type": "PRIMARY",
"url": "https://pubchem.ncbi.nlm.nih.gov/compound/11752568",
"code_system": "PUBCHEM",
"references": [
"649a5647-570e-5505-6208-8442346807d2"
]
}
],
"relationships": [
{
"uuid": "f34636d7-fa30-440b-9dd4-a2ca04983f5d",
"amount": {
"uuid": "b8b780a9-f9c0-43b7-8b7f-e5f8da1c3cc7"
},
"type": "SUBSTANCE->SUB_ALTERNATE",
"related_substance": {
"uuid": "1ed14b35-ece1-43d4-b9fb-359b661e400e",
"refuuid": "84eb0b9b-e400-4fb2-a2ce-f60ee1ab1156",
"name": "ALTERNATIVE DEFINITION for [Acetyl Tetrapeptide-3]",
"linking_id": "84eb0b9b-e400-4fb2-a2ce-f60ee1ab1156",
"ref_pname": "NO NAME"
}
}
],
"substance_class": "chemical",
"names": [
{
"uuid": "659d0817-ecce-444f-9bda-c73b8028606a",
"name": "AC-LYS-GLY-HIS-LYS-NH2",
"stdName": "AC-LYS-GLY-HIS-LYS-NH2",
"type": "cn",
"languages": [
"en"
],
"preferred": false,
"references": [
"3a57dbf8-252e-4005-9769-2336cac97450",
"2716ade4-40de-4f40-a927-6dca5e37376e"
],
"display_name": false
},
{
"uuid": "17949ec5-3400-4693-955f-08e07e183d32",
"name": "ACETYL TETRAPEPTIDE-1",
"stdName": "ACETYL TETRAPEPTIDE-1",
"type": "cn",
"languages": [
"en"
],
"preferred": false,
"references": [
"a5f8616a-63a1-4942-9d55-0af4ea4bd446",
"2716ade4-40de-4f40-a927-6dca5e37376e"
],
"display_name": false
},
{
"uuid": "442e485c-22c8-4995-be14-a1c28a39912f",
"name": "Acetyl Tetrapeptide-3",
"stdName": "ACETYL TETRAPEPTIDE-3",
"type": "of",
"languages": [
"en"
],
"preferred": false,
"references": [
"a5f8616a-63a1-4942-9d55-0af4ea4bd446",
"0ce062af-1043-44e7-aa92-b8930c947b66",
"2716ade4-40de-4f40-a927-6dca5e37376e"
],
"display_name": true,
"domains": [
"cosmetic"
],
"name_orgs": [
{
"uuid": "dd5d27b4-edfb-4cc3-82cc-e0a14891bc31",
"name_org": "INCI"
}
]
},
{
"uuid": "c4547f32-e1cc-4c01-9edd-109e3e7a636f",
"name": "FOLIXYL",
"stdName": "FOLIXYL",
"type": "bn",
"languages": [
"en"
],
"preferred": false,
"references": [
"a5f8616a-63a1-4942-9d55-0af4ea4bd446",
"2716ade4-40de-4f40-a927-6dca5e37376e"
],
"display_name": false
},
{
"uuid": "79c52716-2964-4e5f-aa2b-691e252c0e69",
"name": "KOLLAREN 6",
"stdName": "KOLLAREN 6",
"type": "bn",
"languages": [
"en"
],
"preferred": false,
"references": [
"a5f8616a-63a1-4942-9d55-0af4ea4bd446",
"2716ade4-40de-4f40-a927-6dca5e37376e"
],
"display_name": false
},
{
"uuid": "405ab9e7-05c6-4a1f-a62e-9566026e03d2",
"name": "L-Lysinamide, N2-acetyl-L-lysylglycyl-L-histidyl-",
"stdName": "L-LYSINAMIDE, N2-ACETYL-L-LYSYLGLYCYL-L-HISTIDYL-",
"type": "sys",
"languages": [
"en"
],
"preferred": false,
"references": [
"2716ade4-40de-4f40-a927-6dca5e37376e",
"4cf6e25c-b88f-4b14-b1df-950d74a125d0"
],
"display_name": false
},
{
"uuid": "3d57aa7f-8ad1-4cba-b75d-2b8c9b864741",
"name": "N2-Acetyl-L-lysylglycyl-L-histidyl-L-lysinamide",
"stdName": "N2-ACETYL-L-LYSYLGLYCYL-L-HISTIDYL-L-LYSINAMIDE",
"type": "sys",
"languages": [
"en"
],
"preferred": false,
"references": [
"07e61f69-459c-4284-93f9-4918ae020c2c"
],
"display_name": false
},
{
"uuid": "ab76ab1c-1f2e-46e9-974d-1230946a40e5",
"name": "UXI HAIR GROWTH PEPTIDE",
"stdName": "UXI HAIR GROWTH PEPTIDE",
"type": "bn",
"languages": [
"en"
],
"preferred": false,
"references": [
"a5f8616a-63a1-4942-9d55-0af4ea4bd446",
"2716ade4-40de-4f40-a927-6dca5e37376e"
],
"display_name": false
}
],
"references": [
{
"uuid": "a5f8616a-63a1-4942-9d55-0af4ea4bd446",
"citation": "PCPC-DB",
"doc_type": "SRS",
"public_domain": true,
"tags": [
"NOMEN",
"PUBLIC_DOMAIN_RELEASE",
"AUTO_SELECTED"
]
},
{
"uuid": "2716ade4-40de-4f40-a927-6dca5e37376e",
"citation": "PERSONAL CARE PRODUCTS COUNCIL",
"doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
"public_domain": true,
"tags": [
"NOMEN"
]
},
{
"uuid": "3a57dbf8-252e-4005-9769-2336cac97450",
"citation": "FDA_SRS",
"doc_type": "SRS",
"public_domain": true,
"tags": [
"NOMEN"
]
},
{
"uuid": "4cf6e25c-b88f-4b14-b1df-950d74a125d0",
"citation": "STN",
"doc_type": "SRS",
"public_domain": true,
"tags": [
"NOMEN"
]
},
{
"uuid": "11ab606e-1bf4-4187-b12d-91959a20aecc",
"citation": "SRS CODE IMPORT",
"doc_type": "SRS",
"public_domain": true,
"document_date": 1493392872000,
"tags": [
"NOMEN"
]
},
{
"uuid": "70b12443-2eb4-4096-a11e-3269c4bd99bd",
"citation": "SRS import [D1HW9N9QBX]",
"url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=D1HW9N9QBX",
"doc_type": "SRS",
"public_domain": true,
"document_date": 1493392872000,
"tags": [
"NOMEN"
]
},
{
"uuid": "6307b416-5d34-4f61-87b8-41e35bfeeb32",
"citation": "http://www.lucasmeyercosmetics.com/docs/tech_file/6.tech_file_Capixyl_a.pdf",
"url": "http://www.lucasmeyercosmetics.com/docs/tech_file/6.tech_file_Capixyl_a.pdf",
"doc_type": "SRS",
"public_domain": true,
"tags": [
"NOMEN"
]
},
{
"uuid": "0ce062af-1043-44e7-aa92-b8930c947b66",
"citation": "ACETYL TETRAPEPTIDE-3 [INCI]",
"doc_type": "SRS_LOCATOR",
"public_domain": true
},
{
"uuid": "d369694e-e089-ceda-4d4d-68f8d775928c",
"citation": "RXNORM",
"doc_type": "NLM",
"public_domain": true
},
{
"uuid": "07e61f69-459c-4284-93f9-4918ae020c2c",
"citation": "STN",
"doc_type": "STN (SCIFINDER)",
"public_domain": true
},
{
"uuid": "649a5647-570e-5505-6208-8442346807d2",
"citation": "PUBCHEM",
"doc_type": "PUBCHEM",
"public_domain": true
},
{
"uuid": "8799403e-0558-800f-e9c4-1298fcfd08ae",
"citation": "DailyMed",
"doc_type": "DAILYMED",
"public_domain": true
}
],
"definition_type": "PRIMARY",
"moieties": [
{
"uuid": "aade5f2f-9004-4846-aa40-586b890e3122",
"id": "aade5f2f-9004-4846-aa40-586b890e3122",
"molfile": "\n Marvin 01132108522D \n\n 36 36 0 0 1 0 999 V2000\n 13.8087 -10.0223 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 14.5230 -10.4348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2375 -10.0223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9519 -10.4348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6664 -10.0223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3808 -10.4348 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0942 -10.4348 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3798 -10.0223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3798 -9.1973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6653 -10.4348 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 10.9508 -10.0223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2364 -10.4348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1501 -11.2553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3432 -11.4268 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9308 -10.7123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4828 -10.0992 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6653 -11.2598 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3798 -11.6723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3798 -12.4972 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0942 -11.2598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7261 -11.7901 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5829 -12.6025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8076 -12.8847 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2148 -13.1328 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 14.0717 -13.9452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7036 -14.4755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5603 -15.2880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1923 -15.8183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0490 -16.6306 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9900 -12.8506 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6221 -13.3809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4788 -14.1934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3973 -13.0988 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8087 -9.1973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5230 -8.7848 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0942 -8.7848 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 7 1 6 0 0 0\n 1 34 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 8 9 2 0 0 0 0\n 10 8 1 0 0 0 0\n 10 11 1 0 0 0 0\n 10 17 1 1 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 12 16 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 16 15 2 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 18 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 2 0 0 0 0\n 22 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 24 30 1 1 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 31 33 2 0 0 0 0\n 34 35 1 0 0 0 0\n 34 36 2 0 0 0 0\nM END",
"smiles": "CC(=O)N[C@@H](CCCCN)C(=O)NCC(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@@H](CCCCN)C(=O)N",
"formula": "C22H39N9O5",
"atropisomerism": "No",
"charge": 0,
"count": 1,
"stereochemistry": "ABSOLUTE",
"count_amount": {
"type": "MOL RATIO",
"average": 1,
"units": "MOL RATIO",
"uuid": "d33b4bb9-c98c-455f-9e78-fa7aa9ae2618"
},
"defined_stereo": 3,
"ez_centers": 0,
"molecular_weight": "509.6032",
"optical_activity": "UNSPECIFIED",
"stereo_centers": 3
}
],
"definition_level": "COMPLETE",
"uuid": "d69a6f66-d7d7-44cd-990e-36ea24ac9221",
"version": "16",
"structure": {
"id": "814358de-b27c-4a09-8619-cf90aeb16215",
"molfile": "\n Marvin 01132106422D \n\n 36 36 0 0 1 0 999 V2000\n 11.6653 -10.4348 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 14.2148 -13.1328 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 13.8087 -10.0223 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 11.6653 -11.2598 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3798 -11.6723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3798 -12.4972 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0942 -11.2598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7261 -11.7901 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5829 -12.6025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8076 -12.8847 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9900 -12.8506 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6221 -13.3809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3973 -13.0988 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4788 -14.1934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0717 -13.9452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7036 -14.4755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5603 -15.2880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1923 -15.8183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0490 -16.6306 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3798 -10.0223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3798 -9.1973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0942 -10.4348 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8087 -9.1973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0942 -8.7848 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5230 -8.7848 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5230 -10.4348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2375 -10.0223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9519 -10.4348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6664 -10.0223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3808 -10.4348 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9508 -10.0223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2364 -10.4348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4828 -10.0992 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9308 -10.7123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3432 -11.4268 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1501 -11.2553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 4 1 1 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 5 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 9 2 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 2 11 1 1 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 12 14 1 0 0 0 0\n 2 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 1 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 22 3 1 0 0 0 0\n 20 22 1 0 0 0 0\n 3 23 1 6 0 0 0\n 23 24 2 0 0 0 0\n 23 25 1 0 0 0 0\n 3 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 1 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 33 34 1 0 0 0 0\n 35 34 2 0 0 0 0\n 36 35 1 0 0 0 0\n 32 36 2 0 0 0 0\nM END",
"smiles": "CC(=O)N[C@@H](CCCCN)C(=O)NCC(=O)N[C@@H](Cc1cnc[nH]1)C(=O)N[C@@H](CCCCN)C(=O)N",
"formula": "C22H39N9O5",
"atropisomerism": "No",
"charge": 0,
"count": 1,
"stereochemistry": "ABSOLUTE",
"defined_stereo": 3,
"ez_centers": 0,
"molecular_weight": "509.6032",
"optical_activity": "UNSPECIFIED",
"references": [
"70b12443-2eb4-4096-a11e-3269c4bd99bd",
"6307b416-5d34-4f61-87b8-41e35bfeeb32"
],
"stereo_centers": 3
},
"unii": "D1HW9N9QBX"
}
]
}