{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "266156ac-3a8f-4d8d-9e9a-ffaa73e7db38",
          "code": "90-69-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=90-69-7",
          "code_system": "CAS",
          "references": [
            "4c3f908c-8d25-4f4d-b37e-29464dabcdd7",
            "d62ad530-9ed5-4646-8718-e1b9985d7dd4"
          ]
        },
        {
          "uuid": "dc309852-f5d9-4069-9084-eba7988d9973",
          "code": "C93261",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C93261",
          "code_system": "NCI_THESAURUS",
          "references": [
            "4c3f908c-8d25-4f4d-b37e-29464dabcdd7"
          ]
        },
        {
          "uuid": "8388fc31-03ee-4de2-bb4a-10456f636a78",
          "code": "D008120",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68008120",
          "code_system": "MESH",
          "references": [
            "4c3f908c-8d25-4f4d-b37e-29464dabcdd7"
          ]
        },
        {
          "uuid": "9b6110dc-9087-4785-bf63-5a329c6f7d3c",
          "code": "QV04CV01",
          "comments": "VATC|DIAGNOSTIC AGENTS|OTHER DIAGNOSTIC AGENTS|Tests for respiratory function|lobeline",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QV04CV01&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "4c3f908c-8d25-4f4d-b37e-29464dabcdd7"
          ]
        },
        {
          "uuid": "760e8df7-ff9a-4799-abf6-fe7897512814",
          "code": "SUB08541MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "4c3f908c-8d25-4f4d-b37e-29464dabcdd7"
          ]
        },
        {
          "uuid": "22c69adc-6fda-470b-a715-b19ca56b0fc5",
          "code": "394",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=394",
          "code_system": "INN",
          "references": [
            "4c3f908c-8d25-4f4d-b37e-29464dabcdd7"
          ]
        },
        {
          "uuid": "171d5539-5728-44b3-bedb-5d2212977380",
          "code": "6464",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/6464/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "4c3f908c-8d25-4f4d-b37e-29464dabcdd7"
          ]
        },
        {
          "uuid": "8a0515a3-6013-4635-99c0-59088f876c0f",
          "code": "m6879",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6879?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "4c3f908c-8d25-4f4d-b37e-29464dabcdd7"
          ]
        },
        {
          "uuid": "7d90f8b0-6d1d-4c63-a3d9-879e3f237976",
          "code": "CHEMBL2103769",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2103769",
          "code_system": "ChEMBL",
          "references": [
            "4c3f908c-8d25-4f4d-b37e-29464dabcdd7"
          ]
        },
        {
          "uuid": "3ec13ba3-5925-4c4f-9355-00dbec8b7246",
          "code": "202-012-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.830",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "4c3f908c-8d25-4f4d-b37e-29464dabcdd7"
          ]
        },
        {
          "uuid": "0dfa49d7-792a-41c0-8960-8902d4004a2a",
          "code": "101616",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/101616",
          "code_system": "PUBCHEM",
          "references": [
            "4c3f908c-8d25-4f4d-b37e-29464dabcdd7"
          ]
        },
        {
          "uuid": "56c97fcb-8d9a-ce01-3c8d-34e915846728",
          "code": "DTXSID3023219",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3023219",
          "code_system": "EPA CompTox",
          "references": [
            "ebe998e8-c701-4680-ab7c-63586df417ab"
          ]
        },
        {
          "uuid": "04fd9b4f-84a2-19c9-db6d-d29fbc83c0dc",
          "code": "C73579",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Cholinergic Agonist[C47796]|Nicotinic Agonist",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C73579",
          "code_system": "NCI_THESAURUS",
          "references": [
            "df028ba9-0fac-c7e0-6e02-0d528f7f0b1e"
          ]
        },
        {
          "uuid": "9a8f410d-7eda-4012-b1ed-57043a6b03c8",
          "code": "D0P25S3P81",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "90b4199d-1b74-1042-f9a6-18e921538ff7",
          "code": "DB05137",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB05137",
          "code_system": "DRUG BANK",
          "references": [
            "df028ba9-0fac-c7e0-6e02-0d528f7f0b1e"
          ]
        },
        {
          "uuid": "f9a0a380-a162-c0f5-8416-a0af5a802b25",
          "code": "48723",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:48723",
          "code_system": "CHEBI",
          "references": [
            "df028ba9-0fac-c7e0-6e02-0d528f7f0b1e"
          ]
        },
        {
          "uuid": "bc392436-4e5f-d1e1-2d60-7b206cc9deed",
          "code": "Lobeline",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Lobeline",
          "code_system": "WIKIPEDIA",
          "references": [
            "8d6c076c-6d65-81a0-5913-88cd1281cbce"
          ]
        },
        {
          "uuid": "6de80075-2845-77ff-555c-eb4bc4b9efcb",
          "code": "100000082528",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "86a74db3-961a-1fb9-bb18-01911ba2d151"
          ]
        },
        {
          "uuid": "fce976f5-a715-f14f-8833-b110a930f409",
          "code": "757421",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=757421",
          "code_system": "NSC",
          "references": [
            "bcabc06f-8269-8798-a550-43ba7c8d6760"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "67672fab-9115-485f-8187-ba21360cf5cd",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "49ce0d54-c717-40d9-bda5-7d7b095cbb81",
            "refuuid": "c7921532-d6b7-4c03-a128-9e4ff8691c3d",
            "name": "LOBELINE",
            "unii": "D0P25S3P81",
            "linking_id": "D0P25S3P81",
            "ref_pname": "LOBELINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "0add8189-6654-49d0-9f7f-b066ee96a0d3",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "0c74bdbc-6125-444a-87d3-f35a5790cebb",
            "refuuid": "0e9e96e8-b018-402e-83cc-722e6b13c647",
            "name": "LOBELINE HYDROCHLORIDE",
            "unii": "96J834CB88",
            "linking_id": "96J834CB88",
            "ref_pname": "LOBELINE HYDROCHLORIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "cb739365-a5b9-4917-99c7-021b2eae55a9",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "b49bd682-9c3a-4177-b8aa-69e7c38a1e85",
            "refuuid": "7126a305-5647-471d-9e29-a591de773617",
            "name": "LOBELINE SULFATE",
            "unii": "4CJ480V2HP",
            "linking_id": "4CJ480V2HP",
            "ref_pname": "LOBELINE SULFATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1186a125-12cf-4184-8b47-a64f1a5afc3d",
          "name": ".ALPHA.-LOBELINE",
          "stdName": ".ALPHA.-LOBELINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7ced9284-e06e-4fd4-8478-d5ce5f21b407",
            "0f1da3df-b11e-4d1d-8d7d-a85994760fc9"
          ],
          "display_name": false
        },
        {
          "uuid": "98c7b124-62d9-40bd-90df-8caa1446f6a0",
          "name": "2-((2R,6S)-6-((2S)-2-HYDROXY-2-PHENYLETHYL)-1-METHYL-2-PIPERIDINYL)-1-PHENYLETHANONE",
          "stdName": "2-((2R,6S)-6-((2S)-2-HYDROXY-2-PHENYLETHYL)-1-METHYL-2-PIPERIDINYL)-1-PHENYLETHANONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7ced9284-e06e-4fd4-8478-d5ce5f21b407",
            "0f1da3df-b11e-4d1d-8d7d-a85994760fc9"
          ],
          "display_name": false
        },
        {
          "uuid": "a7ac3bd8-e3d4-4c2c-b989-1022f8075c06",
          "name": "2-(6-(.BETA.-HYDROXYPHENETHYL)-1-METHYL-2-PIPERIDYL)ACETOPHENONE",
          "stdName": "2-(6-(.BETA.-HYDROXYPHENETHYL)-1-METHYL-2-PIPERIDYL)ACETOPHENONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7ced9284-e06e-4fd4-8478-d5ce5f21b407",
            "dfa33709-5de0-4916-abde-a4c4d8fcc208"
          ],
          "display_name": false
        },
        {
          "uuid": "f68d835c-bda8-45a4-a95c-2f43bfd13b29",
          "name": "INFLATINE",
          "stdName": "INFLATINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7ced9284-e06e-4fd4-8478-d5ce5f21b407",
            "0f1da3df-b11e-4d1d-8d7d-a85994760fc9"
          ],
          "display_name": false
        },
        {
          "uuid": "dddade13-14b3-4b43-8f0b-1e65efa6492d",
          "name": "LOBELINE",
          "stdName": "LOBELINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7ced9284-e06e-4fd4-8478-d5ce5f21b407",
            "627743ee-f669-490e-934e-b5f2b116c414",
            "4721ce91-f930-4160-9da6-6c62345061c0",
            "7a4de0dd-4897-4cd5-8f80-b8009acd08d9",
            "e0332055-337a-4a52-a744-db44892d01e8",
            "3bf95897-78ee-4ac1-9e2e-d66cdad16943",
            "b1b14f14-84cf-42c8-8b3d-dcd25492e966",
            "56479ca5-dde7-4731-a38c-a00cca75238e"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "42a375f7-88fb-4e47-a058-d674a16a2899",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "ec808238-12e5-4b5d-9816-720de5f98739",
          "name": "LOBELINE [MI]",
          "stdName": "LOBELINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7ced9284-e06e-4fd4-8478-d5ce5f21b407",
            "627743ee-f669-490e-934e-b5f2b116c414"
          ],
          "display_name": false
        },
        {
          "uuid": "767a2bdf-48a2-4a06-85ce-3d4fa99051eb",
          "name": "LOBELINUM",
          "stdName": "LOBELINUM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7ced9284-e06e-4fd4-8478-d5ce5f21b407",
            "010d739a-3ade-439b-8fb9-0a8528cc4fd4",
            "6ab41592-bc1b-45bf-827d-77961690ef53",
            "61f64e23-8eb1-498d-a1b9-033a4735e0b3"
          ],
          "display_name": false
        },
        {
          "uuid": "5d00680c-0669-40b1-be9f-8210110fe67e",
          "name": "LOBELINUM [HPUS]",
          "stdName": "LOBELINUM [HPUS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "010d739a-3ade-439b-8fb9-0a8528cc4fd4",
            "61f64e23-8eb1-498d-a1b9-033a4735e0b3"
          ],
          "display_name": false
        },
        {
          "uuid": "24e35d1c-eb6f-dc1d-2124-1dd9132ff659",
          "name": "Lobeline [WHO-DD]",
          "stdName": "LOBELINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8dbe629a-6e41-38a9-c2d4-dfbdf3d83cb7"
          ],
          "display_name": false
        },
        {
          "uuid": "967f3a12-3c42-335a-6c5c-11b1c07b9bfc",
          "name": "NSC-757421",
          "stdName": "NSC-757421",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bcabc06f-8269-8798-a550-43ba7c8d6760"
          ],
          "display_name": false
        },
        {
          "uuid": "bcc0cd2f-435d-42ad-ab1b-28a1cdcb5b86",
          "name": "lobeline [INN]",
          "stdName": "LOBELINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4721ce91-f930-4160-9da6-6c62345061c0"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "7a4de0dd-4897-4cd5-8f80-b8009acd08d9",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "dfa33709-5de0-4916-abde-a4c4d8fcc208",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7ced9284-e06e-4fd4-8478-d5ce5f21b407",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "010d739a-3ade-439b-8fb9-0a8528cc4fd4",
          "citation": "HPUS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0f1da3df-b11e-4d1d-8d7d-a85994760fc9",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4721ce91-f930-4160-9da6-6c62345061c0",
          "citation": "INN Proposed List 4",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL04.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "61f64e23-8eb1-498d-a1b9-033a4735e0b3",
          "citation": "HPUS 2011",
          "doc_type": "HOMEOPATHIC PHARMACOPOEIA US",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "627743ee-f669-490e-934e-b5f2b116c414",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e0332055-337a-4a52-a744-db44892d01e8",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4c3f908c-8d25-4f4d-b37e-29464dabcdd7",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390560000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "934a4da3-1e9c-4959-bbc2-7fbe189eeb15",
          "citation": "SRS import [D0P25S3P81]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=D0P25S3P81",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390560000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "98e9e18c-be55-438d-8ee0-e18866118a01",
          "citation": "merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b1b14f14-84cf-42c8-8b3d-dcd25492e966",
          "citation": "LOBELINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6ab41592-bc1b-45bf-827d-77961690ef53",
          "citation": "LOBELINUM [HPUS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3bf95897-78ee-4ac1-9e2e-d66cdad16943",
          "citation": "LOBELINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "56479ca5-dde7-4731-a38c-a00cca75238e",
          "citation": "LOBELINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ebe998e8-c701-4680-ab7c-63586df417ab",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=90-69-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "df028ba9-0fac-c7e0-6e02-0d528f7f0b1e",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "8d6c076c-6d65-81a0-5913-88cd1281cbce",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "d62ad530-9ed5-4646-8718-e1b9985d7dd4",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "bcabc06f-8269-8798-a550-43ba7c8d6760",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "8dbe629a-6e41-38a9-c2d4-dfbdf3d83cb7",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "86a74db3-961a-1fb9-bb18-01911ba2d151",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9e75e307-d669-47eb-93f5-c96d41f7aaf9",
          "id": "9e75e307-d669-47eb-93f5-c96d41f7aaf9",
          "molfile": "\n  Marvin  01132108142D          \n\n 25 27  0  0  1  0            999 V2000\n    1.6602   -0.2741    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    1.6602   -1.1094    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3662    0.1215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0877   -0.2741    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    3.0877   -1.1094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8014   -1.5232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5151   -1.1094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5151   -0.2741    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.2159    0.1215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9426   -0.2741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9426   -1.1094    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6641    0.1215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3778   -0.2741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0993    0.1215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0993    0.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3778    1.3654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6641    0.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8014    0.1215    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8014    0.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9387    0.1215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9387    0.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2250    1.3654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4965    0.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4965    0.1215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2250   -0.2741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1 20  1  0  0  0  0\n  4  3  1  1  0  0  0\n  5  4  1  0  0  0  0\n  4 18  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  1  0  0  0\n  8 18  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 17 12  2  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 21 20  1  0  0  0  0\n 25 20  2  0  0  0  0\n 22 21  2  0  0  0  0\n 23 22  1  0  0  0  0\n 23 24  2  0  0  0  0\n 24 25  1  0  0  0  0\nM  END",
          "smiles": "CN1[C@@H](CCC[C@@H]1CC(=O)c2ccccc2)C[C@@H](c3ccccc3)O",
          "formula": "C22H27NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8914d62f-6343-4162-9d26-6962a96d0242"
          },
          "defined_stereo": 3,
          "ez_centers": 0,
          "molecular_weight": "337.4561",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c7921532-d6b7-4c03-a128-9e4ff8691c3d",
      "version": "15",
      "structure": {
        "id": "805a8095-854c-4103-8fd6-8ea38b9ef3ba",
        "molfile": "\n  Marvin  01132106402D          \n\n 25 27  0  0  1  0            999 V2000\n    3.8014    0.1215    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5151   -0.2741    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.0877   -0.2741    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.2159    0.1215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3662    0.1215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9426   -0.2741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6602   -0.2741    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.9426   -1.1094    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6641    0.1215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9387    0.1215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8014    0.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6602   -1.1094    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5151   -1.1094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0877   -1.1094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8014   -1.5232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3778   -0.2741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6641    0.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2250   -0.2741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9387    0.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2250    1.3654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0993    0.1215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3778    1.3654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4965    0.1215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4965    0.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0993    0.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  2  4  1  1  0  0  0\n  3  5  1  1  0  0  0\n  6  4  1  0  0  0  0\n  7  5  1  0  0  0  0\n  8  6  2  0  0  0  0\n  9  6  1  0  0  0  0\n 10  7  1  0  0  0  0\n 11  1  1  0  0  0  0\n  7 12  1  6  0  0  0\n 13  2  1  0  0  0  0\n 14  3  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16  9  2  0  0  0  0\n 17  9  1  0  0  0  0\n 18 10  2  0  0  0  0\n 19 10  1  0  0  0  0\n 20 19  2  0  0  0  0\n 21 16  1  0  0  0  0\n 22 17  2  0  0  0  0\n 23 18  1  0  0  0  0\n 24 20  1  0  0  0  0\n 25 22  1  0  0  0  0\n 15 13  1  0  0  0  0\n 24 23  2  0  0  0  0\n 25 21  2  0  0  0  0\nM  END",
        "smiles": "CN1[C@@H](CCC[C@@H]1CC(=O)c2ccccc2)C[C@@H](c3ccccc3)O",
        "formula": "C22H27NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 3,
        "ez_centers": 0,
        "molecular_weight": "337.4561",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "98e9e18c-be55-438d-8ee0-e18866118a01",
          "934a4da3-1e9c-4959-bbc2-7fbe189eeb15",
          "4721ce91-f930-4160-9da6-6c62345061c0"
        ],
        "stereo_centers": 3
      },
      "unii": "D0P25S3P81"
    }
  ]
}