{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "8c45eaa9-37a9-48c7-860b-72909ce1cd06", "code": "27251-75-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=27251-75-8", "code_system": "CAS", "references": [ "2ecb55de-64e8-466c-b5af-95c75821b07a", "f9f7d4be-9ee1-402b-b743-30768b75d952" ] }, { "uuid": "01f19d0e-265b-433b-9403-a4ee99a77b8a", "code": "248-365-7", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.043.954", "code_system": "ECHA (EC/EINECS)", "references": [ "2ecb55de-64e8-466c-b5af-95c75821b07a" ] }, { "uuid": "810b5d34-0484-4a17-87bd-37b1dbc2fed5", "code": "21871905", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/21871905", "code_system": "PUBCHEM", "references": [ "2ecb55de-64e8-466c-b5af-95c75821b07a" ] }, { "uuid": "a2c97521-e157-4de2-99f5-65db4dbf39f6", "code": "CX7AKB1590", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "126f4719-38d3-4478-8c82-7ffc927617dc", "name": "1,2,4-BENZENETRICARBOXYLIC ACID, 1,2,4-TRIISOOCTYL ESTER", "stdName": "1,2,4-BENZENETRICARBOXYLIC ACID, 1,2,4-TRIISOOCTYL ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "7a3058f0-3715-4dec-868c-5758df1a7d8a" ], "display_name": false }, { "uuid": "e9f4aef1-cb91-40c0-820e-faa07e99f92c", "name": "1,2,4-BENZENETRICARBOXYLIC ACID, TRIISOOCTYL ESTER", "stdName": "1,2,4-BENZENETRICARBOXYLIC ACID, TRIISOOCTYL ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "39688290-46ad-4e16-b7f8-c51b62da0dd3" ], "display_name": false }, { "uuid": "8311666f-383b-4315-89ed-c02f52b56bb0", "name": "TRIISOOCTYL TRIMELLITATE", "stdName": "TRIISOOCTYL TRIMELLITATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7a3058f0-3715-4dec-868c-5758df1a7d8a" ], "display_name": true }, { "uuid": "1e82381e-3c45-497b-9259-c8905412391f", "name": "TRIMELLITIC ACID, TRIISOOCTYL ESTER", "stdName": "TRIMELLITIC ACID, TRIISOOCTYL ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "7a3058f0-3715-4dec-868c-5758df1a7d8a" ], "display_name": false } ], "references": [ { "uuid": "39688290-46ad-4e16-b7f8-c51b62da0dd3", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "7a3058f0-3715-4dec-868c-5758df1a7d8a", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "2ecb55de-64e8-466c-b5af-95c75821b07a", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392073000, "tags": [ "NOMEN" ] }, { "uuid": "af610f70-1cc2-4df7-8acd-d555b955c118", "citation": "SRS import [CX7AKB1590]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=CX7AKB1590", "doc_type": "SRS", "public_domain": true, "document_date": 1493392073000, "tags": [ "NOMEN" ] }, { "uuid": "f5a6f6a2-dfe9-a45a-1012-94a4cd023548", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=27251-75-8", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "f9f7d4be-9ee1-402b-b743-30768b75d952", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "8d64341a-9506-4bf3-902f-3d86f1b4b833", "id": "8d64341a-9506-4bf3-902f-3d86f1b4b833", "molfile": "\n Marvin 01132107202D \n\n 39 39 0 0 0 0 999 V2000\n 0.0000 -4.9544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7137 -5.3541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7137 -6.1825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4279 -4.9544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1415 -5.3541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8557 -4.9544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5694 -5.3541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2836 -4.9544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9972 -5.3541 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7114 -4.9544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7114 -4.1266 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4251 -5.3541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4251 -6.1825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1393 -6.5964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8529 -6.1825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5667 -6.5964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5667 -7.4247 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2808 -6.1825 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9945 -6.5964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7087 -6.1825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4223 -6.5964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1365 -6.1825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8502 -6.5964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5787 -6.1825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2780 -6.5964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5787 -5.3541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8529 -5.3541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1393 -4.9544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5667 -4.9544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2808 -5.3541 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5667 -4.1266 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2808 -3.7121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2808 -2.8843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9945 -2.4703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9945 -1.6562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7087 -1.2280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7087 -0.4139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4223 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9945 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 4 2 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 2 0 0 0 0\n 12 10 1 0 0 0 0\n 13 12 1 0 0 0 0\n 12 28 2 0 0 0 0\n 14 13 2 0 0 0 0\n 15 14 1 0 0 0 0\n 15 16 1 0 0 0 0\n 15 27 2 0 0 0 0\n 16 17 2 0 0 0 0\n 16 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 24 26 1 0 0 0 0\n 28 27 1 0 0 0 0\n 27 29 1 0 0 0 0\n 29 30 2 0 0 0 0\n 29 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 33 34 1 0 0 0 0\n 34 35 1 0 0 0 0\n 35 36 1 0 0 0 0\n 36 37 1 0 0 0 0\n 37 38 1 0 0 0 0\n 37 39 1 0 0 0 0\nM END", "smiles": "CC(C)CCCCCOC(=O)c1ccc(c(c1)C(=O)OCCCCCC(C)C)C(=O)OCCCCCC(C)C", "formula": "C33H54O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "ee88d4e4-5d70-441a-a9e9-cc183b5e8d0b" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "546.7795", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "REPRESENTATIVE", "uuid": "d247f585-f96c-430b-b62c-7675a76dcc28", "version": "4", "structure": { "id": "f8c29a91-3016-48c5-bd76-30e78930a620", "molfile": "\n Marvin 01132112532D \n\n 39 39 0 0 0 0 999 V2000\n 7.8524 -6.1821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1388 -6.5960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4247 -6.1821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4247 -5.3538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1388 -4.9541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8524 -5.3538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5662 -6.5960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5662 -7.4242 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2802 -6.1821 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5662 -4.9541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2802 -5.3538 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5662 -4.1263 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7110 -4.9541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7110 -4.1263 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9969 -5.3538 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9939 -6.5960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7080 -6.1821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2802 -3.7119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2802 -2.8841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2833 -4.9541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5692 -5.3538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8555 -4.9541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1414 -5.3538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4278 -4.9541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7137 -5.3538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -4.9541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7137 -6.1821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4216 -6.5960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1357 -6.1821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8494 -6.5960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5778 -6.1821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2771 -6.5960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5778 -5.3538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9939 -2.4701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9939 -1.6561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7080 -1.2279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7080 -0.4139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4216 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9939 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 1 6 1 0 0 0 0\n 1 7 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 4 13 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 10 1 0 0 0 0\n 7 8 2 0 0 0 0\n 7 9 1 0 0 0 0\n 9 16 1 0 0 0 0\n 10 11 2 0 0 0 0\n 10 12 1 0 0 0 0\n 12 18 1 0 0 0 0\n 13 14 2 0 0 0 0\n 13 15 1 0 0 0 0\n 15 20 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 28 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 34 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 25 27 1 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 31 33 1 0 0 0 0\n 34 35 1 0 0 0 0\n 35 36 1 0 0 0 0\n 36 37 1 0 0 0 0\n 37 38 1 0 0 0 0\n 37 39 1 0 0 0 0\nM END", "smiles": "CC(C)CCCCCOC(=O)c1ccc(c(c1)C(=O)OCCCCCC(C)C)C(=O)OCCCCCC(C)C", "formula": "C33H54O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "546.7795", "optical_activity": "NONE", "references": [ "af610f70-1cc2-4df7-8acd-d555b955c118", "39688290-46ad-4e16-b7f8-c51b62da0dd3" ], "stereo_centers": 0 }, "unii": "CX7AKB1590" } ] }