{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "73b82172-8ff9-4cd4-868d-b3f8b5af332b", "code": "30125-47-4", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=30125-47-4", "code_system": "CAS", "references": [ "c1dd41b7-006d-4a5a-acf4-e9191d7bbc05", "42ba0711-9353-490c-a7ba-9680c2544018" ] }, { "uuid": "35cc6cd1-b457-41f9-b519-d735e76c04c9", "code": "21 CFR 178.3297", "comments": "PART 178 -- INDIRECT FOOD ADDITIVES: ADJUVANTS, PRODUCTION AIDS, AND SANITIZERS|Subpart D--Certain Adjuvants and Production Aids|Sec. 178.3297 Colorants for polymers.", "type": "PRIMARY", "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/cfrsearch.cfm?fr=178.3297", "code_system": "CFR", "references": [ "c1dd41b7-006d-4a5a-acf4-e9191d7bbc05" ] }, { "uuid": "223a4f35-3e30-4b15-8ba3-b70ba98c846e", "code": "21 CFR 176.170", "comments": "PART 176 -- INDIRECT FOOD ADDITIVES: PAPER AND PAPERBOARD COMPONENTS|Subpart B--Substances for Use Only as Components of Paper and Paperboard|Sec. 176.170 Components of paper and paperboard in contact with aqueous and fatty foods.", "type": "PRIMARY", "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/cfrsearch.cfm?fr=176.170", "code_system": "CFR", "references": [ "c1dd41b7-006d-4a5a-acf4-e9191d7bbc05" ] }, { "uuid": "84d38621-c8b8-4a37-9424-ec046364cb76", "code": "250-063-5", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.045.497", "code_system": "ECHA (EC/EINECS)", "references": [ "c1dd41b7-006d-4a5a-acf4-e9191d7bbc05" ] }, { "uuid": "87e408c4-f48f-463e-8875-37b17d5f6558", "code": "1438510", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1438510/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "c1dd41b7-006d-4a5a-acf4-e9191d7bbc05" ] }, { "uuid": "cdfb48af-4380-4062-bdca-d727d3347813", "code": "5463973", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5463973", "code_system": "PUBCHEM", "references": [ "c1dd41b7-006d-4a5a-acf4-e9191d7bbc05" ] }, { "uuid": "49c33d89-0668-4e26-2462-773071e2778f", "code": "DTXSID2067539", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2067539", "code_system": "EPA CompTox", "references": [ "82569089-b012-5917-b069-32aa28983da3" ] }, { "uuid": "4b44039d-617f-493e-b6af-8f7cc10e3c97", "code": "CX2Y91T7FY", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "49bcb263-8a32-4063-bd09-d33593769a12", "name": "1H-ISOINDOLE-1,3(2H)-DIONE, 4,5,6,7-TETRACHLORO-2-(2- (4,5,6,7-TETRACHLORO-2,3-DIHYDRO-1,3-DIOXO-1H-INDEN-2-YL)-8- QUINOLINYL)-", "stdName": "1H-ISOINDOLE-1,3(2H)-DIONE, 4,5,6,7-TETRACHLORO-2-(2- (4,5,6,7-TETRACHLORO-2,3-DIHYDRO-1,3-DIOXO-1H-INDEN-2-YL)-8- QUINOLINYL)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a687d20d-c019-4515-9b31-f4fad6bf9bc1", "79cb5a81-8ce7-409f-8b76-668dc255b4f3" ], "display_name": false }, { "uuid": "80dd2788-af78-4c05-bdd6-81db512a521e", "name": "3,4,5,6-TETRACHLORO-N-(2-(4,5,6,7-TETRACHLORO-2,3-DIHYDRO- 1,3-DIOXO-1H-INDEN-2-YL)-8-QUINOLYL)PHTHALIMIDE", "stdName": "3,4,5,6-TETRACHLORO-N-(2-(4,5,6,7-TETRACHLORO-2,3-DIHYDRO- 1,3-DIOXO-1H-INDEN-2-YL)-8-QUINOLYL)PHTHALIMIDE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "a687d20d-c019-4515-9b31-f4fad6bf9bc1", "79cb5a81-8ce7-409f-8b76-668dc255b4f3" ], "display_name": false }, { "uuid": "65324dae-3a9f-454b-bfce-08f6612d19eb", "name": "C.I. 56300", "stdName": "C.I. 56300", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a687d20d-c019-4515-9b31-f4fad6bf9bc1", "e9dd16b5-8d9f-4dce-9841-9c99fa2bc0b7" ], "display_name": false }, { "uuid": "b126ce18-9c9d-43d2-9259-4053bdf77a8a", "name": "C.I. PIGMENT YELLOW 138", "stdName": "C.I. PIGMENT YELLOW 138", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "cc3a96fb-036e-4ef8-a4a3-e648d396c00f" ], "display_name": false }, { "uuid": "94ec93b2-ebdd-4f19-a9cc-3e59f3a622d2", "name": "CI 56300", "stdName": "CI 56300", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a687d20d-c019-4515-9b31-f4fad6bf9bc1", "e414f7b2-02ea-4a7d-a674-cec7c4d26e7b" ], "display_name": false }, { "uuid": "01db35f8-4173-4633-83ff-74314dee7208", "name": "PIGMENT YELLOW 138", "stdName": "PIGMENT YELLOW 138", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a687d20d-c019-4515-9b31-f4fad6bf9bc1", "e9dd16b5-8d9f-4dce-9841-9c99fa2bc0b7" ], "display_name": true }, { "uuid": "f2680159-8fd9-4002-81ce-eeefc4fdf82a", "name": "QUINOPHTHALONE YELLOW", "stdName": "QUINOPHTHALONE YELLOW", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a687d20d-c019-4515-9b31-f4fad6bf9bc1", "e9dd16b5-8d9f-4dce-9841-9c99fa2bc0b7" ], "display_name": false }, { "uuid": "c7c8f05b-7960-4d71-969d-8e965b8597ad", "name": "YELLOW 3A1010", "stdName": "YELLOW 3A1010", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a687d20d-c019-4515-9b31-f4fad6bf9bc1", "e9dd16b5-8d9f-4dce-9841-9c99fa2bc0b7" ], "display_name": false } ], "references": [ { "uuid": "cc3a96fb-036e-4ef8-a4a3-e648d396c00f", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "79cb5a81-8ce7-409f-8b76-668dc255b4f3", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a687d20d-c019-4515-9b31-f4fad6bf9bc1", "citation": "CHEMID", "doc_type": "CHEMID", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e9dd16b5-8d9f-4dce-9841-9c99fa2bc0b7", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e414f7b2-02ea-4a7d-a674-cec7c4d26e7b", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c1dd41b7-006d-4a5a-acf4-e9191d7bbc05", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391007000, "tags": [ "NOMEN" ] }, { "uuid": "0762e013-4008-4279-bf6d-2db5d4c4e751", "citation": "SRS import [CX2Y91T7FY]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=CX2Y91T7FY", "doc_type": "SRS", "public_domain": true, "document_date": 1493391007000, "tags": [ "NOMEN" ] }, { "uuid": "e4b0f338-d1de-4841-9ab7-1e0823f57a58", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "82569089-b012-5917-b069-32aa28983da3", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=30125-47-4", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "42ba0711-9353-490c-a7ba-9680c2544018", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "42207755-cbf7-3b06-0a71-740ad266eea0", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "75733078-b019-4792-950d-382b72bc0487", "id": "75733078-b019-4792-950d-382b72bc0487", "molfile": "\n Marvin 01132106062D \n\n 40 45 0 0 0 0 999 V2000\n 5.8706 -6.8972 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5784 -7.3315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2862 -6.8972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4861 -6.1113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9346 -5.4816 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3111 -5.9940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6235 -6.7800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4531 -6.9362 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9939 -7.3315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9939 -8.1565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7016 -8.5908 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3298 -8.5517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3298 -9.3767 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5784 -8.1173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8316 -8.5081 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7454 -5.2863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5703 -5.2863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0000 -4.5786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5703 -3.8709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0000 -3.1630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6094 -2.4553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7844 -2.4553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3501 -3.1630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5251 -3.1630 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0128 -2.4944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2862 -1.7085 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2268 -2.7287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2268 -3.5927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0128 -3.8317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2862 -4.6176 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5191 -3.9880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5191 -4.8130 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8114 -3.5927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1036 -3.9880 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8114 -2.7287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1036 -2.3381 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5191 -2.3381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5191 -1.5085 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7454 -3.8709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3501 -4.5786 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 14 2 2 0 0 0 0\n 4 3 1 0 0 0 0\n 9 3 2 0 0 0 0\n 5 4 2 0 0 0 0\n 4 6 1 0 0 0 0\n 7 6 1 0 0 0 0\n 6 16 1 0 0 0 0\n 8 7 2 0 0 0 0\n 7 9 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 10 2 0 0 0 0\n 13 12 1 0 0 0 0\n 14 12 1 0 0 0 0\n 15 14 1 0 0 0 0\n 17 16 1 0 0 0 0\n 16 40 2 0 0 0 0\n 17 18 2 0 0 0 0\n 18 19 1 0 0 0 0\n 20 19 1 0 0 0 0\n 19 39 2 0 0 0 0\n 21 20 2 0 0 0 0\n 22 21 1 0 0 0 0\n 22 23 2 0 0 0 0\n 23 24 1 0 0 0 0\n 23 39 1 0 0 0 0\n 25 24 1 0 0 0 0\n 29 24 1 0 0 0 0\n 26 25 2 0 0 0 0\n 25 27 1 0 0 0 0\n 28 27 1 0 0 0 0\n 37 27 2 0 0 0 0\n 29 28 1 0 0 0 0\n 31 28 2 0 0 0 0\n 30 29 2 0 0 0 0\n 32 31 1 0 0 0 0\n 33 31 1 0 0 0 0\n 34 33 1 0 0 0 0\n 35 33 2 0 0 0 0\n 36 35 1 0 0 0 0\n 35 37 1 0 0 0 0\n 38 37 1 0 0 0 0\n 39 40 1 0 0 0 0\nM END", "smiles": "c1cc2ccc(C3C(=O)c4c(c(c(c(c4Cl)Cl)Cl)Cl)C3=O)nc2c(c1)N5C(=O)c6c(c(c(c(c6Cl)Cl)Cl)Cl)C5=O", "formula": "C26H6Cl8N2O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "3f8bc80c-1980-471d-90ad-19045fb1ab83" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "693.9613", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "5e1a4497-b5b4-4e74-b146-bf07737e119a", "version": "5", "structure": { "id": "2a1d4523-bc62-45a0-b393-d1019e8fde8b", "molfile": "\n Marvin 01132102172D \n\n 40 45 0 0 0 0 999 V2000\n 6.2268 -2.7287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2268 -3.5927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0128 -3.8317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5251 -3.1630 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0128 -2.4944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2862 -1.7085 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3501 -3.1630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7454 -3.8709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3501 -4.5786 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7454 -5.2863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5703 -5.2863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0000 -4.5786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5703 -3.8709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0000 -3.1630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6094 -2.4553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7844 -2.4553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3111 -5.9940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4861 -6.1113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2862 -6.8972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9939 -7.3315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6235 -6.7800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4531 -6.9362 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9939 -8.1565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3298 -8.5517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5784 -8.1173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5784 -7.3315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8706 -6.8972 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8316 -8.5081 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3298 -9.3767 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7016 -8.5908 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9346 -5.4816 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2862 -4.6176 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5191 -3.9880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8114 -3.5927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8114 -2.7287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5191 -2.3381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5191 -1.5085 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1036 -2.3381 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1036 -3.9880 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5191 -4.8130 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 5 4 1 0 0 0 0\n 5 1 1 0 0 0 0\n 6 5 2 0 0 0 0\n 7 4 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 13 8 1 0 0 0 0\n 14 13 1 0 0 0 0\n 15 14 2 0 0 0 0\n 16 15 1 0 0 0 0\n 16 7 2 0 0 0 0\n 17 10 1 0 0 0 0\n 18 17 1 0 0 0 0\n 18 19 1 0 0 0 0\n 20 19 2 0 0 0 0\n 21 20 1 0 0 0 0\n 21 17 1 0 0 0 0\n 22 21 2 0 0 0 0\n 23 20 1 0 0 0 0\n 24 23 2 0 0 0 0\n 25 24 1 0 0 0 0\n 25 26 2 0 0 0 0\n 26 19 1 0 0 0 0\n 27 26 1 0 0 0 0\n 28 25 1 0 0 0 0\n 29 24 1 0 0 0 0\n 30 23 1 0 0 0 0\n 31 18 2 0 0 0 0\n 32 3 2 0 0 0 0\n 33 2 1 0 0 0 0\n 34 33 2 0 0 0 0\n 35 34 1 0 0 0 0\n 35 36 2 0 0 0 0\n 36 1 1 0 0 0 0\n 37 36 1 0 0 0 0\n 38 35 1 0 0 0 0\n 39 34 1 0 0 0 0\n 40 33 1 0 0 0 0\nM END", "smiles": "c1cc2ccc(C3C(=O)c4c(c(c(c(c4Cl)Cl)Cl)Cl)C3=O)nc2c(c1)N5C(=O)c6c(c(c(c(c6Cl)Cl)Cl)Cl)C5=O", "formula": "C26H6Cl8N2O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "693.9613", "optical_activity": "NONE", "references": [ "0762e013-4008-4279-bf6d-2db5d4c4e751", "e4b0f338-d1de-4841-9ab7-1e0823f57a58" ], "stereo_centers": 0 }, "unii": "CX2Y91T7FY" } ] }