{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "70a686cb-e423-442f-bb6c-75d19d288a25", "code": "20307-84-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=20307-84-0", "code_system": "CAS", "references": [ "9c32f316-be28-495b-92e5-14d9253340c7", "13ce61e7-69e4-40b3-80b6-147d129bbdcb" ] }, { "uuid": "047eb70f-9129-ed1f-2011-0d699da90c05", "code": "145925530", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/145925530", "code_system": "PUBCHEM", "references": [ "295ed4da-908e-ead7-bdbd-f4e2a720e058" ] }, { "uuid": "a5edaa36-1f82-48e9-aaec-35fb0e56fcbd", "code": "CWB1U36PIU", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "67da2acf-870a-12d8-29e3-2cb692d9e4a0", "code": "DTXSID00864301", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00864301", "code_system": "EPA CompTox" }, { "uuid": "e8866ff9-85b3-0511-8156-66fc541d988e", "code": "100000178303", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "c8cdad64-87cd-c413-71ad-bf92b0e83e6d" ] } ], "substance_class": "chemical", "names": [ { "uuid": "e515a928-aa33-5f61-0f80-4d6e2d83f0a2", "name": "Delta elemene [WHO-DD]", "stdName": "DELTA ELEMENE [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "0ef832c6-81d9-f45b-831f-fe0078122c46" ], "display_name": false }, { "uuid": "0f6f0ec3-53b2-49e4-b75c-20114e50c379", "name": "ELEMENE, DELTA", "stdName": "ELEMENE, DELTA", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "417e834f-65cb-4d20-92c4-c5761692ddaf" ], "display_name": true } ], "references": [ { "uuid": "417e834f-65cb-4d20-92c4-c5761692ddaf", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9c32f316-be28-495b-92e5-14d9253340c7", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392542000, "tags": [ "NOMEN" ] }, { "uuid": "0ef832c6-81d9-f45b-831f-fe0078122c46", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "13ce61e7-69e4-40b3-80b6-147d129bbdcb", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "295ed4da-908e-ead7-bdbd-f4e2a720e058", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "c8cdad64-87cd-c413-71ad-bf92b0e83e6d", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "7ba290e8-36e9-49cd-8a17-9fc3f106e663", "id": "7ba290e8-36e9-49cd-8a17-9fc3f106e663", "molfile": "\n Marvin 01132106252D \n\n 15 15 0 0 1 0 999 V2000\n 0.0000 -4.1286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7142 -3.7158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4285 -4.1286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7142 -2.8901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4285 -2.4772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4285 -1.6514 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 2.1469 -1.2386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8611 -1.6514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3575 -0.4418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7142 -1.2386 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 1.4285 -0.8257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.6514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.4772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7142 -0.4129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 4 2 1 0 0 0 0\n 4 5 2 0 0 0 0\n 13 4 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 6 10 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 9 2 0 0 0 0\n 10 11 1 1 0 0 0\n 10 12 1 0 0 0 0\n 10 14 1 0 0 0 0\n 12 13 1 0 0 0 0\n 14 15 2 0 0 0 0\nM END", "smiles": "C=C[C@@]1(C)CCC(=CC1C(=C)C)C(C)C", "formula": "C15H24", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "EPIMERIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "5498c6e0-b502-4355-b74e-06273d469f0c" }, "defined_stereo": 1, "ez_centers": 0, "molecular_weight": "204.3516", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "INCOMPLETE", "uuid": "c9668fe1-4fc8-4d0c-a10f-746ad4018050", "version": "10", "structure": { "id": "2b5e1427-302c-4da9-baa6-62ba4067fd7c", "molfile": "\n Marvin 01132102212D \n\n 15 15 0 0 1 0 999 V2000\n 13.8324 -3.6572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8324 -4.4830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5466 -4.8959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2609 -4.4830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2609 -3.6572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5466 -3.2445 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 14.5466 -5.7216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8324 -6.1344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2609 -6.1344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5466 -2.4187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8324 -2.0058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2609 -2.8316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9793 -3.2445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.1898 -2.4476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6935 -3.6572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 6 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 3 7 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 13 1 0 0 0 0\n 6 10 1 6 0 0 0\n 6 12 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 9 1 0 0 0 0\n 10 11 2 0 0 0 0\n 13 14 2 0 0 0 0\n 13 15 1 0 0 0 0\nM END", "smiles": "C=C[C@@]1(C)CCC(=CC1C(=C)C)C(C)C", "formula": "C15H24", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "EPIMERIC", "defined_stereo": 1, "ez_centers": 0, "molecular_weight": "204.3516", "optical_activity": "UNSPECIFIED", "references": [ "417e834f-65cb-4d20-92c4-c5761692ddaf", "0ef832c6-81d9-f45b-831f-fe0078122c46" ], "stereo_centers": 2 }, "unii": "CWB1U36PIU" } ] }