{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "02de8d1b-cd0c-4d59-8f48-fb9edf95e002",
          "code": "207740-41-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=207740-41-8",
          "code_system": "CAS",
          "references": [
            "afb8e4fa-bf91-48f7-b6fd-e1e818381b34",
            "d6c241dc-40ea-47f7-92f5-be0af773fbf6"
          ]
        },
        {
          "uuid": "28e1f347-8680-45d6-8d06-04dcd9d038a3",
          "code": "44350127",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/44350127",
          "code_system": "PUBCHEM",
          "references": [
            "afb8e4fa-bf91-48f7-b6fd-e1e818381b34"
          ]
        },
        {
          "uuid": "28c02464-fe67-8231-79d2-ddd9193f2f68",
          "code": "Methallylescaline",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Methallylescaline",
          "code_system": "WIKIPEDIA",
          "references": [
            "35b1f00d-35d1-f319-faea-18942db4fd7d"
          ]
        },
        {
          "uuid": "043732e2-be01-9f78-f3a8-0c32f28f50b4",
          "code": "DTXSID20658380",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20658380",
          "code_system": "EPA CompTox",
          "references": [
            "b35ed4e0-c22d-438f-6d82-157a435f8698"
          ]
        },
        {
          "uuid": "e41d2e4f-c4fe-4aed-aae1-ad7e2f0b09a1",
          "code": "CVN0S9V910",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "17e06d58-b1ca-d12c-66e0-504ce43f4f87",
          "code": "Designer-drugs-Methallylescaline",
          "comments": "Wikipedia|List of designer drugs|Psychedelics|Phenethylamines",
          "type": "CONCEPT",
          "url": "https://en.wikipedia.org/wiki/List_of_designer_drugs",
          "code_system": "WIKIPEDIA",
          "references": [
            "bf3c186a-c2c7-326c-405e-c4d9d6ae4fce"
          ]
        },
        {
          "uuid": "2509b9c7-182b-4c52-8b7f-f74f92884df6",
          "code": "PiHKAL",
          "comments": "Wikipedia|PiHKAL|Phenethylamines",
          "type": "CONCEPT",
          "url": "https://en.wikipedia.org/wiki/PiHKAL",
          "code_system": "WIKIPEDIA"
        }
      ],
      "relationships": [
        {
          "uuid": "6f016a57-8b12-416c-9a4f-40e7561ac727",
          "amount": {
            "uuid": "d7ff6890-fbb1-4bee-a745-887ea31c4255"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "3692fd63-93ba-40d8-87fa-ced079ec0095",
            "refuuid": "d08c8826-9f4d-4720-bb89-18a57b9a6e33",
            "name": "MAL hydrochloride",
            "unii": "BR49EHL4LK",
            "linking_id": "BR49EHL4LK",
            "ref_pname": "MAL hydrochloride",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "944bd82a-d6c5-477c-b68f-bb1e49803c5d",
          "amount": {
            "uuid": "8a67b1e2-b10f-44b2-9b4b-2faff744ff3e"
          },
          "type": "ACTIVE MOIETY",
          "references": [
            "35b1f00d-35d1-f319-faea-18942db4fd7d"
          ],
          "related_substance": {
            "uuid": "e9738f91-cb86-4eb6-976d-08d207e8c06a",
            "refuuid": "8fcaa09f-a126-42a4-a18a-9fe3d40c5be6",
            "name": "MAL",
            "unii": "CVN0S9V910",
            "linking_id": "CVN0S9V910",
            "ref_pname": "MAL",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "fea0f250-1378-48f6-82e1-2fdd9e776037",
          "name": "2-(3,5-DIMETHOXY-4-((2-METHYLPROP-2-EN-1-YL)OXY)PHENYL)ETHAN-1-AMINE",
          "stdName": "2-(3,5-DIMETHOXY-4-((2-METHYLPROP-2-EN-1-YL)OXY)PHENYL)ETHAN-1-AMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d6c241dc-40ea-47f7-92f5-be0af773fbf6"
          ],
          "display_name": false
        },
        {
          "uuid": "ffa444da-fece-4831-af3f-b58c4576ec6b",
          "name": "3,5-DIMETHOXY-4-((2-METHYL-2-PROPEN-1-YL)OXY)BENZENEETHANAMINE",
          "stdName": "3,5-DIMETHOXY-4-((2-METHYL-2-PROPEN-1-YL)OXY)BENZENEETHANAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d6c241dc-40ea-47f7-92f5-be0af773fbf6"
          ],
          "display_name": false
        },
        {
          "uuid": "684f46c3-8d90-4a77-9f04-025ac0a1d16c",
          "name": "4-METHYLALLYLOXY-3,5-DIMETHOXYPHENETHYLAMINE",
          "stdName": "4-METHYLALLYLOXY-3,5-DIMETHOXYPHENETHYLAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35b1f00d-35d1-f319-faea-18942db4fd7d"
          ],
          "display_name": false
        },
        {
          "uuid": "c658b4da-dd9e-4ed2-9e66-3c9113907e64",
          "name": "BENZENEETHANAMINE, 3,5-DIMETHOXY-4-((2-METHYL-2-PROPEN-1-YL)OXY)-",
          "stdName": "BENZENEETHANAMINE, 3,5-DIMETHOXY-4-((2-METHYL-2-PROPEN-1-YL)OXY)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d6c241dc-40ea-47f7-92f5-be0af773fbf6"
          ],
          "display_name": false
        },
        {
          "uuid": "a4134350-bfbd-4092-ac9e-041e9af8ae59",
          "name": "BENZENEETHANAMINE, 3,5-DIMETHOXY-4-((2-METHYL-2-PROPENYL)OXY)-",
          "stdName": "BENZENEETHANAMINE, 3,5-DIMETHOXY-4-((2-METHYL-2-PROPENYL)OXY)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d6c241dc-40ea-47f7-92f5-be0af773fbf6"
          ],
          "display_name": false
        },
        {
          "uuid": "23266895-3308-4866-8d11-e65e4f2408c9",
          "name": "MAL",
          "stdName": "MAL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35b1f00d-35d1-f319-faea-18942db4fd7d"
          ],
          "display_name": true
        },
        {
          "uuid": "697d81b8-2845-4b4e-8131-16612452892c",
          "name": "MAL (PSYCHEDELIC)",
          "stdName": "MAL (PSYCHEDELIC)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35b1f00d-35d1-f319-faea-18942db4fd7d"
          ],
          "display_name": false
        },
        {
          "uuid": "3941f727-974a-4f60-968e-2733f327e670",
          "name": "METHALLYLESCALINE",
          "stdName": "METHALLYLESCALINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35b1f00d-35d1-f319-faea-18942db4fd7d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "bf3c186a-c2c7-326c-405e-c4d9d6ae4fce",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "a10e547a-5ee3-415f-859a-6f8f96a57a45",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "afb8e4fa-bf91-48f7-b6fd-e1e818381b34",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392886000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5c63e588-573e-4f0b-9b2a-0f150fcceb0f",
          "citation": "SRS import [CVN0S9V910]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=CVN0S9V910",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392886000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "62656d6a-15f8-470a-95d1-6de244ef4239",
          "citation": "CHEMID RECORD 207740-41-8",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "35b1f00d-35d1-f319-faea-18942db4fd7d",
          "citation": "https://en.wikipedia.org/wiki/Methallylescaline",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b35ed4e0-c22d-438f-6d82-157a435f8698",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=207740-41-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d6c241dc-40ea-47f7-92f5-be0af773fbf6",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "22bc5f1a-c456-d098-a9ae-7d30d2ba10d9",
          "id": "22bc5f1a-c456-d098-a9ae-7d30d2ba10d9",
          "molfile": "\n  Marvin  01132101572D          \n\n 18 18  0  0  0  0            999 V2000\n   13.4763   -3.0387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1908   -2.6262    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9052   -3.0387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6197   -2.6262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3342   -3.0387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0486   -2.6262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7631   -3.0387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4776   -2.6262    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3342   -3.8637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6197   -4.2762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6197   -5.1012    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9052   -5.5137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9052   -3.8637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1908   -4.2762    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4763   -3.8637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7618   -4.2762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0474   -3.8637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7618   -5.1012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n 13  3  2  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  9  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n 10 11  1  0  0  0  0\n 13 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  2  0  0  0  0\nM  END",
          "smiles": "C=C(C)COc1c(cc(CCN)cc1OC)OC",
          "formula": "C14H21NO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7b9d1415-17e9-4821-a33e-85247a2544f4"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "251.322",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "8fcaa09f-a126-42a4-a18a-9fe3d40c5be6",
      "version": "12",
      "structure": {
        "id": "e2a001d6-377c-4dfc-9e89-64e9bb572afe",
        "molfile": "Benzeneethanamine, 3,5-dimethoxy-4-[(2-methyl-2-propen-1-yl)oxy]-\n  Marvin  01132111442D          \n\n 18 18  0  0  0  0            999 V2000\n   14.1908   -4.2762    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4763   -3.8637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7618   -4.2762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0474   -3.8637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7618   -5.1012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9052   -3.8637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9052   -3.0387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1908   -2.6262    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4763   -3.0387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6197   -2.6262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3342   -3.0387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3342   -3.8637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6197   -4.2762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6197   -5.1012    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9052   -5.5137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0486   -2.6262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7631   -3.0387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4776   -2.6262    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  2  0  0  0  0\n  1  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  7 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n  6 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 11 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\nM  END",
        "smiles": "C=C(C)COc1c(cc(CCN)cc1OC)OC",
        "formula": "C14H21NO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "251.322",
        "optical_activity": "NONE",
        "references": [
          "d6c241dc-40ea-47f7-92f5-be0af773fbf6",
          "35b1f00d-35d1-f319-faea-18942db4fd7d"
        ],
        "stereo_centers": 0
      },
      "unii": "CVN0S9V910"
    }
  ]
}