{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "d987b532-0241-44a7-9c3a-7a7fdd9a9006", "code": "200509-41-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=200509-41-7", "code_system": "CAS", "references": [ "e3fb1b08-9008-4b15-ab27-3a051503b1a5", "84808cb8-46de-4e64-8834-879b19509993" ] }, { "uuid": "af2c072c-f35b-43a3-82ef-41c787912155", "code": "14601092", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/14601092", "code_system": "PUBCHEM", "references": [ "e3fb1b08-9008-4b15-ab27-3a051503b1a5" ] }, { "uuid": "22e0c827-f1c8-465f-b107-88c81da98da4", "code": "CV677O0SU1", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "aaea2443-7236-e16e-a262-135654fd07dd", "code": "81944", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:81944", "code_system": "CHEBI", "references": [ "fff7da57-6e10-c683-ec9f-1ca1525a49dd" ] }, { "uuid": "ef62a96b-252b-8f30-5434-9c7fefe9032d", "code": "DTXSID101331653", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID101331653", "code_system": "EPA CompTox", "references": [ "6f172e50-aebf-d8c8-2d9c-8908994a087b" ] }, { "uuid": "46322878-b1f6-ab5f-a582-ca0785960ec3", "code": "quizalofop-P-tefuryl", "type": "PRIMARY", "url": "https://pesticidecompendium.bcpc.org/quizalofop-P-tefuryl.html", "code_system": "ALANWOOD", "references": [ "1df11090-4e16-ac62-e177-13c781f4c1dc" ] }, { "uuid": "89ae0059-e2c4-dc69-1851-83b3a0db1def", "code": "300000053545", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "4c146b10-9102-dca8-89ce-a00b7309beae" ] } ], "substance_class": "chemical", "names": [ { "uuid": "453dde3b-6005-43c5-89f7-15dd9e44c7b3", "name": "C-4874", "stdName": "C-4874", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "bc398451-5d0e-477d-ad68-becc6806f4f5", "ffb1174d-aeeb-44c2-ba14-fb6b7da81701" ], "display_name": false }, { "uuid": "07bce35c-4743-4324-8ab9-6250a628c17d", "name": "PANTERA", "stdName": "PANTERA", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "bc398451-5d0e-477d-ad68-becc6806f4f5", "ffb1174d-aeeb-44c2-ba14-fb6b7da81701" ], "display_name": false }, { "uuid": "bb9240bb-c6a7-4fa9-aeaf-afe0025ee5da", "name": "PROPANOIC ACID, 2-(4-((6-CHLORO-2-QUINOXALINYL)OXY)PHENOXY)-, (TETRAHYDRO-2-FURANYL)METHYL ESTER, (2R)-", "stdName": "PROPANOIC ACID, 2-(4-((6-CHLORO-2-QUINOXALINYL)OXY)PHENOXY)-, (TETRAHYDRO-2-FURANYL)METHYL ESTER, (2R)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "bc398451-5d0e-477d-ad68-becc6806f4f5", "ffb1174d-aeeb-44c2-ba14-fb6b7da81701" ], "display_name": false }, { "uuid": "3ae19be4-7183-463f-b89f-08eb5b53e51f", "name": "QUIZALOFOP-P-TEFURYL", "stdName": "QUIZALOFOP-P-TEFURYL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b3a6aa2f-b5eb-4498-8681-56fb759b8ba4", "bc398451-5d0e-477d-ad68-becc6806f4f5", "ffb1174d-aeeb-44c2-ba14-fb6b7da81701", "0a651161-016d-4baf-a32c-3a7eb725ed8d" ], "display_name": true }, { "uuid": "2f637ca3-95a9-40d9-a26e-74c1669dbf34", "name": "QUIZALOFOP-P-TEFURYL [ISO]", "stdName": "QUIZALOFOP-P-TEFURYL [ISO]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ffb1174d-aeeb-44c2-ba14-fb6b7da81701", "0a651161-016d-4baf-a32c-3a7eb725ed8d" ], "display_name": false }, { "uuid": "a4076315-a890-4c4a-99b6-5ba890ddf32b", "name": "UBI-C-4874", "stdName": "UBI-C-4874", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "bc398451-5d0e-477d-ad68-becc6806f4f5", "ffb1174d-aeeb-44c2-ba14-fb6b7da81701" ], "display_name": false } ], "references": [ { "uuid": "bc398451-5d0e-477d-ad68-becc6806f4f5", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "ffb1174d-aeeb-44c2-ba14-fb6b7da81701", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "0a651161-016d-4baf-a32c-3a7eb725ed8d", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e3fb1b08-9008-4b15-ab27-3a051503b1a5", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392453000, "tags": [ "NOMEN" ] }, { "uuid": "2ab5babc-a8e1-4337-8346-21e1f98f75c9", "citation": "SRS import [CV677O0SU1]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=CV677O0SU1", "doc_type": "SRS", "public_domain": true, "document_date": 1493392453000, "tags": [ "NOMEN" ] }, { "uuid": "b3a6aa2f-b5eb-4498-8681-56fb759b8ba4", "citation": "QUIZALOFOP-P-TEFURYL [ISO]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "1df11090-4e16-ac62-e177-13c781f4c1dc", "citation": "AW", "doc_type": "ALANWOOD", "public_domain": true }, { "uuid": "84808cb8-46de-4e64-8834-879b19509993", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "fff7da57-6e10-c683-ec9f-1ca1525a49dd", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "6f172e50-aebf-d8c8-2d9c-8908994a087b", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true }, { "uuid": "4c146b10-9102-dca8-89ce-a00b7309beae", "citation": "SMS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "f1424bc7-d63e-45cf-a395-2e651d40f35b", "id": "f1424bc7-d63e-45cf-a395-2e651d40f35b", "molfile": "\n Marvin 01132112312D \n\n 30 33 0 0 1 0 999 V2000\n 9.7125 -8.7351 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 8.9995 -8.3202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7125 -9.5620 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9928 -9.9712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9928 -10.7949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2808 -11.2098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5678 -10.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8525 -11.2075 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1380 -10.7902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4196 -11.2067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7103 -10.7902 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7103 -9.9664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9843 -9.5593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9843 -8.7403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2702 -8.3354 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6981 -8.3206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4196 -8.7277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4196 -9.5546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1380 -9.9664 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5678 -9.9680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2845 -9.5578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4253 -8.3293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1383 -8.7443 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4253 -7.4977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1454 -7.0919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1454 -6.2682 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 11.8147 -5.7877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5584 -4.9990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7334 -4.9990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4746 -5.7763 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 6 0 0 0\n 1 3 1 0 0 0 0\n 1 22 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 4 21 2 0 0 0 0\n 6 5 2 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 20 7 2 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 9 19 2 0 0 0 0\n 11 10 2 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 12 18 2 0 0 0 0\n 14 13 2 0 0 0 0\n 14 15 1 0 0 0 0\n 16 14 1 0 0 0 0\n 17 16 2 0 0 0 0\n 18 17 1 0 0 0 0\n 19 18 1 0 0 0 0\n 21 20 1 0 0 0 0\n 22 23 2 0 0 0 0\n 22 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 27 26 1 0 0 0 0\n 26 30 1 0 0 0 0\n 28 27 1 0 0 0 0\n 29 28 1 0 0 0 0\n 30 29 1 0 0 0 0\nM END", "smiles": "C[C@H](C(=O)OCC1CCCO1)Oc2ccc(cc2)Oc3cnc4cc(ccc4n3)Cl", "formula": "C22H21ClN2O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "EPIMERIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "a98ec335-36a9-4f9e-a7a0-d7fbf8dd90ac" }, "defined_stereo": 1, "ez_centers": 0, "molecular_weight": "428.8663", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "COMPLETE", "uuid": "d29b3323-5501-4d8a-91d7-82b75a0d8887", "version": "6", "structure": { "id": "23ba50a6-13dd-4253-95bf-9a20c5b62de9", "molfile": "\n Marvin 01132102002D \n\n 30 33 0 0 1 0 999 V2000\n 6.1380 -9.9664 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4196 -9.5546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4196 -8.7277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6981 -8.3206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9843 -8.7403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2702 -8.3354 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9843 -9.5593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7103 -9.9664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7103 -10.7902 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4196 -11.2067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1380 -10.7902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8525 -11.2075 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5678 -10.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2808 -11.2098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9928 -10.7949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9928 -9.9712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7125 -9.5620 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7125 -8.7351 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 8.9995 -8.3202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4253 -8.3293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1383 -8.7443 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4253 -7.4977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1454 -7.0919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1454 -6.2682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4746 -5.7763 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7334 -4.9990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5584 -4.9990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8147 -5.7877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2845 -9.5578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5678 -9.9680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 2 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 11 1 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 6 0 0 0\n 18 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 20 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 24 1 0 0 0 0\n 16 29 2 0 0 0 0\n 29 30 1 0 0 0 0\n 30 13 2 0 0 0 0\nM END", "smiles": "C[C@H](C(=O)OCC1CCCO1)Oc2ccc(cc2)Oc3cnc4cc(ccc4n3)Cl", "formula": "C22H21ClN2O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "EPIMERIC", "defined_stereo": 1, "ez_centers": 0, "molecular_weight": "428.8663", "optical_activity": "UNSPECIFIED", "references": [ "2ab5babc-a8e1-4337-8346-21e1f98f75c9", "bc398451-5d0e-477d-ad68-becc6806f4f5" ], "stereo_centers": 2 }, "unii": "CV677O0SU1" } ] }