{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d53d4797-38c8-1b26-9f77-8c1182efae48",
          "code": "109976",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/109976",
          "code_system": "PUBCHEM",
          "references": [
            "59d32216-c6a7-5d83-f46b-4507a7526c66"
          ]
        },
        {
          "uuid": "2f7e073d-f0d4-42ec-b550-12bd0b9f2cc8",
          "code": "CV5TH1CFM0",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "2eb6e3fc-0d96-4870-aa70-eb67c99922f9",
          "name": "CAPROAMPHOCARBOXYGLYCINATE",
          "stdName": "CAPROAMPHOCARBOXYGLYCINATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "645752df-0358-4064-bf9f-dc14048c4d15",
            "42a5e115-e3fa-4acd-a9b8-1b0848b6e299"
          ],
          "display_name": false
        },
        {
          "uuid": "510fe5a3-56ce-465f-9fcb-c934a516fbb6",
          "name": "CAPROAMPHODIACETATE",
          "stdName": "CAPROAMPHODIACETATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "645752df-0358-4064-bf9f-dc14048c4d15",
            "42a5e115-e3fa-4acd-a9b8-1b0848b6e299"
          ],
          "display_name": false
        },
        {
          "uuid": "ebbaac65-298b-43f5-920e-fd070e07c1f6",
          "name": "DISODIUM CAPROAMPHODIACETATE",
          "stdName": "DISODIUM CAPROAMPHODIACETATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "645752df-0358-4064-bf9f-dc14048c4d15",
            "42a5e115-e3fa-4acd-a9b8-1b0848b6e299",
            "fa6456f7-79c6-40e7-9647-5f50104dfcc7",
            "fa7119d1-44a6-4783-b73a-4957a092bcd5"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "add320ca-6e74-40fa-b77b-16e128059162",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "645752df-0358-4064-bf9f-dc14048c4d15",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "42a5e115-e3fa-4acd-a9b8-1b0848b6e299",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fa7119d1-44a6-4783-b73a-4957a092bcd5",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ab877f84-3305-4c7e-ab19-db9c5adb4aa2",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391015000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c6176510-1e65-4539-b861-058d9c0996bb",
          "citation": "SRS import [CV5TH1CFM0]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=CV5TH1CFM0",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391015000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fa6456f7-79c6-40e7-9647-5f50104dfcc7",
          "citation": "DISODIUM CAPROAMPHODIACETATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "59d32216-c6a7-5d83-f46b-4507a7526c66",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "600a3735-a256-4b67-9c22-721d6b83014e",
          "id": "600a3735-a256-4b67-9c22-721d6b83014e",
          "molfile": "\n  Marvin  01132104582D          \n\n  1  0  0  0  0  0            999 V2000\n    5.1862   -5.5070    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "746f765d-c8fd-4ad5-9325-19293a8aff58"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "2317d1ba-6b8d-461c-b45a-117eec35502e",
          "id": "2317d1ba-6b8d-461c-b45a-117eec35502e",
          "molfile": "\n  Marvin  01132101582D          \n\n 26 25  0  0  0  0            999 V2000\n    8.9628   -1.6956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2482   -2.1080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5337   -1.6956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8192   -2.1080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1092   -1.6956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3948   -2.1080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6800   -1.6956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9656   -2.1080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2511   -1.6956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5365   -2.1080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5365   -2.9329    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8220   -1.6956    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1120   -2.1080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3975   -1.6956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3170   -2.1080    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3170   -2.9329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3975   -3.3453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3975   -4.1700    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1120   -4.5826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1120   -5.4073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8220   -5.6652    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    0.3975   -5.8197    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0317   -1.6956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7462   -2.1080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4607   -1.6956    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   -1.7462   -2.9329    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 23  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 22  2  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  2  0  0  0  0\nM  CHG  2  21  -1  25  -1\nM  END",
          "smiles": "CCCCCCCCCC(=O)NCCN(CCOCC(=O)[O-])CC(=O)[O-]",
          "formula": "C18H32N2O6",
          "atropisomerism": "No",
          "charge": -2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "12ce29e5-6bab-4faa-9e15-bf0c4dfa7ff3"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "372.4572",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "441d7b8e-7034-4389-bbdf-87c14c6249f3",
      "version": "5",
      "structure": {
        "id": "a81a2290-69d0-47bf-bb16-533f86409ded",
        "molfile": "\n  Marvin  01132108442D          \n\n 28 25  0  0  0  0            999 V2000\n    1.8220   -5.6652    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    1.1120   -5.4073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3975   -5.8197    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1120   -4.5826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3975   -4.1700    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3975   -3.3453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3170   -2.9329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3170   -2.1080    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3975   -1.6956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1120   -2.1080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8220   -1.6956    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5365   -2.1080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2511   -1.6956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9656   -2.1080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6800   -1.6956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3948   -2.1080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1092   -1.6956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8192   -2.1080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5337   -1.6956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2482   -2.1080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9628   -1.6956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5365   -2.9329    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0317   -1.6956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7462   -2.1080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4607   -1.6956    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   -1.7462   -2.9329    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1862   -5.5070    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n    5.1862   -5.5070    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 12  2  0  0  0  0\n  8 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  2  0  0  0  0\n  2  1  1  0  0  0  0\nM  CHG  4   1  -1  25  -1  27   1  28   1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1  2  27  28\nM  SPA   1  1  27\nM  SDI   1  4    4.7662   -5.9270    4.7662   -5.0870\nM  SDI   1  4    5.6062   -5.0870    5.6062   -5.9270\nM  SMT   1 2\nM  END",
        "smiles": "CCCCCCCCCC(=O)NCCN(CCOCC(=O)[O-])CC(=O)[O-].[Na+].[Na+]",
        "formula": "C18H32N2O6.2Na",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "418.4367",
        "optical_activity": "NONE",
        "references": [
          "645752df-0358-4064-bf9f-dc14048c4d15",
          "c6176510-1e65-4539-b861-058d9c0996bb"
        ],
        "stereo_centers": 0
      },
      "unii": "CV5TH1CFM0"
    }
  ]
}