{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2ba33b45-608f-4103-b02d-50dde426fd4b",
          "code": "60-81-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=60-81-1",
          "code_system": "CAS",
          "references": [
            "341f17a8-d77c-48d0-b2a3-911b11ec6707",
            "35867439-30ab-4a72-bc75-04b20f135d96"
          ]
        },
        {
          "uuid": "2f7a7fee-5fbb-4082-9614-c43851b46f8f",
          "code": "D010695",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68010695",
          "code_system": "MESH",
          "references": [
            "341f17a8-d77c-48d0-b2a3-911b11ec6707"
          ]
        },
        {
          "uuid": "8589c6e4-bdb6-4cad-94ed-7209c26e3a1c",
          "code": "PHLORIZIN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Phlorizin",
          "code_system": "WIKIPEDIA",
          "references": [
            "341f17a8-d77c-48d0-b2a3-911b11ec6707"
          ]
        },
        {
          "uuid": "1aa9dd41-7327-4e6a-9132-23aa72c9a644",
          "code": "200-487-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.443",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "341f17a8-d77c-48d0-b2a3-911b11ec6707"
          ]
        },
        {
          "uuid": "00f9abf4-e823-4920-a730-ffc6a718768a",
          "code": "1362735",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1362735/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "341f17a8-d77c-48d0-b2a3-911b11ec6707"
          ]
        },
        {
          "uuid": "b3129b85-f0c5-4a24-aea6-54649d6fdcff",
          "code": "m8708",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8708?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "341f17a8-d77c-48d0-b2a3-911b11ec6707"
          ]
        },
        {
          "uuid": "3d3acd18-e99c-465c-ab62-d8dbd1d03d85",
          "code": "6072",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6072",
          "code_system": "PUBCHEM",
          "references": [
            "341f17a8-d77c-48d0-b2a3-911b11ec6707"
          ]
        },
        {
          "uuid": "f3682011-07ec-a0e0-b6cd-4b2ffb382db7",
          "code": "DTXSID3075339",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3075339",
          "code_system": "EPA CompTox",
          "references": [
            "15483002-6ae3-2a46-b0fa-e45f37a346f9"
          ]
        },
        {
          "uuid": "f97db3eb-110f-9680-e82f-fe875adba3d9",
          "code": "4325 (Number of products:2)",
          "comments": "Dietary Supplement Label Database|TBD|Phlorizin",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=4325&item=Phlorizin",
          "code_system": "DSLD",
          "references": [
            "47942102-4079-1d42-e526-eac3585b5a92"
          ]
        },
        {
          "uuid": "ef8948cb-fce5-4acb-871c-ba9abc064bb1",
          "code": "CU9S17279X",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0d546163-1a2a-bf7b-e5b1-add8f3049824",
          "code": "8113",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:8113",
          "code_system": "CHEBI",
          "references": [
            "47942102-4079-1d42-e526-eac3585b5a92"
          ]
        },
        {
          "uuid": "cf8806aa-65eb-17da-79ea-6f61ff921807",
          "code": "CU9S17279X",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=CU9S17279X",
          "code_system": "DAILYMED",
          "references": [
            "09462505-a7d9-8350-16b9-6059ae7656ee"
          ]
        },
        {
          "uuid": "93670b8c-054b-acde-54bc-e755ad2fa95a",
          "code": "2833",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=2833",
          "code_system": "NSC",
          "references": [
            "d25b3960-32d5-5ce7-75b4-f5f768ab79be"
          ]
        },
        {
          "uuid": "b76aea79-67ec-6793-b18c-c7ca952ce412",
          "code": "300000050157",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "715fc4a3-b854-9d28-be11-1e75b0442efb"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "dc21c6db-3c17-47f7-a99e-6f5cdefc4fed",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "684bd6f4-ab83-4b97-94f6-4e2c829be8d7",
            "refuuid": "f1a09e45-4508-4121-9911-f518f5f3c5ba",
            "name": "PHLORIZIN",
            "unii": "CU9S17279X",
            "linking_id": "CU9S17279X",
            "ref_pname": "PHLORIZIN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d58707a9-293a-83f0-3527-5c2560585c1d",
          "type": "SOLVATE->ANHYDROUS",
          "references": [
            "35867439-30ab-4a72-bc75-04b20f135d96"
          ],
          "related_substance": {
            "uuid": "b43bad44-aea7-4591-b936-ac68af06b915",
            "refuuid": "cda8775c-097b-4742-9a9c-338c95c74cbe",
            "name": "PHLORIDZIN DIHYDRATE",
            "unii": "CRK54BIJ5D",
            "linking_id": "CRK54BIJ5D",
            "ref_pname": "PHLORIDZIN DIHYDRATE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "63394f0f-ad99-4fff-879e-03296e128ad2",
          "name": "1-PROPANONE, 1-(2-(.BETA.-D-GLUCOPYRANOSYLOXY)-4,6-DIHYDROXYPHENYL)-3-(4-HYDROXYPHENYL)-",
          "stdName": "1-PROPANONE, 1-(2-(.BETA.-D-GLUCOPYRANOSYLOXY)-4,6-DIHYDROXYPHENYL)-3-(4-HYDROXYPHENYL)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "087dab6b-df1e-4917-b0c5-74cd0d26b804"
          ],
          "display_name": false
        },
        {
          "uuid": "116c29f9-87e7-40b6-8644-79ff4de9345d",
          "name": "2'-(.BETA.-D-GLUCOPYRANOSYLOXY)-4',6'-DIHYDROXY-3-(4-HYDROXYPHENYL)PROPIOPHENONE",
          "stdName": "2'-(.BETA.-D-GLUCOPYRANOSYLOXY)-4',6'-DIHYDROXY-3-(4-HYDROXYPHENYL)PROPIOPHENONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "70a90af3-f293-42ff-a88d-bcb02a823574"
          ],
          "display_name": false
        },
        {
          "uuid": "7439127b-09d0-454c-a725-c82315ec4382",
          "name": "FLORIDZIN",
          "stdName": "FLORIDZIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e58576e-7d84-40db-b588-7e95803f6207"
          ],
          "display_name": false
        },
        {
          "uuid": "49d7318d-89e5-4c9d-ac3d-2ee5f60c8f05",
          "name": "NSC-2833",
          "stdName": "NSC-2833",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e58576e-7d84-40db-b588-7e95803f6207"
          ],
          "display_name": false
        },
        {
          "uuid": "6bc3ace2-f4c6-4274-b16c-b56026869905",
          "name": "PHLORETIN 2'-O-GLUCOSIDE",
          "stdName": "PHLORETIN 2'-O-GLUCOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e58576e-7d84-40db-b588-7e95803f6207"
          ],
          "display_name": false
        },
        {
          "uuid": "072f98e9-0b57-47c6-944c-610ccaf599cd",
          "name": "PHLORETIN-2'-O-.BETA.-GLUCOSIDE",
          "stdName": "PHLORETIN-2'-O-.BETA.-GLUCOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "70a90af3-f293-42ff-a88d-bcb02a823574"
          ],
          "display_name": false
        },
        {
          "uuid": "70d9be82-98c2-4d89-b55c-a9993256935a",
          "name": "PHLORHIZIN",
          "stdName": "PHLORHIZIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c6dcdf20-85a7-4c9c-a9ba-53c1139c568c"
          ],
          "display_name": false
        },
        {
          "uuid": "7ab9c0fb-216a-48dd-a88f-88e76a859b9e",
          "name": "PHLORIDZIN",
          "stdName": "PHLORIDZIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "c74b46dd-c82a-4f29-80dc-07deed68809d",
            "21dd3475-1f38-4f71-86d6-e246a789a2f8",
            "4ab79b40-42c3-4c88-997b-514522db3a29",
            "531bce98-9955-46c7-b099-2a2edcd5b514",
            "c6dcdf20-85a7-4c9c-a9ba-53c1139c568c",
            "7a5ac88f-e399-42b9-bc8d-3d864544be70",
            "45572ec2-fd43-491b-8175-15f45a9b2646"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "8999d76c-c718-4b3f-9707-70983f30bd34",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "c0b23d1a-72fa-40e2-be43-0d52697e53ec",
          "name": "PHLORIDZIN [MI]",
          "stdName": "PHLORIDZIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c74b46dd-c82a-4f29-80dc-07deed68809d"
          ],
          "display_name": false
        },
        {
          "uuid": "8192609f-019a-4bc2-afd1-e47982b59042",
          "name": "PHLORIDZINUM",
          "stdName": "PHLORIDZINUM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b08215cc-26f4-492f-a43c-ed07d936e207",
            "bc30dfa5-81b7-450d-ba4e-3df5590ba023",
            "22577120-fd62-46f3-9352-0616c0c97eb5"
          ],
          "display_name": false
        },
        {
          "uuid": "802c00e9-51e2-4575-82dd-77a37af9903d",
          "name": "PHLORIDZINUM [HPUS]",
          "stdName": "PHLORIDZINUM [HPUS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b08215cc-26f4-492f-a43c-ed07d936e207",
            "22577120-fd62-46f3-9352-0616c0c97eb5"
          ],
          "display_name": false
        },
        {
          "uuid": "ce2f27cd-ba60-455c-9554-4ffeb19eb439",
          "name": "PHLORIZIN",
          "stdName": "PHLORIZIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ebfc6531-be18-4788-8c38-57dcfae5a825"
          ],
          "display_name": true
        },
        {
          "uuid": "f2211a7d-1e83-4bba-9657-97186a28390c",
          "name": "PHLORIZINE",
          "stdName": "PHLORIZINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e58576e-7d84-40db-b588-7e95803f6207"
          ],
          "display_name": false
        },
        {
          "uuid": "c1cf95c3-6bdb-81d9-21d6-c0354ae2e054",
          "name": "Phloridzin [WHO-DD]",
          "stdName": "PHLORIDZIN [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f5e3f36f-a956-7b72-c7e2-c9256aed2069"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "ebfc6531-be18-4788-8c38-57dcfae5a825",
          "citation": "WIKIPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "087dab6b-df1e-4917-b0c5-74cd0d26b804",
          "citation": "STN COMMON CHEMISTRY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6e58576e-7d84-40db-b588-7e95803f6207",
          "citation": "COMMON CHEMISTRY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b08215cc-26f4-492f-a43c-ed07d936e207",
          "citation": "HPUS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "70a90af3-f293-42ff-a88d-bcb02a823574",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "22577120-fd62-46f3-9352-0616c0c97eb5",
          "citation": "HPUS 2011",
          "doc_type": "HOMEOPATHIC PHARMACOPOEIA US",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c74b46dd-c82a-4f29-80dc-07deed68809d",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c6dcdf20-85a7-4c9c-a9ba-53c1139c568c",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "21dd3475-1f38-4f71-86d6-e246a789a2f8",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4ab79b40-42c3-4c88-997b-514522db3a29",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "341f17a8-d77c-48d0-b2a3-911b11ec6707",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390820000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "75041cf4-20d5-4b6c-a2b3-cc334bc88483",
          "citation": "SRS import [CU9S17279X]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=CU9S17279X",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390820000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bc30dfa5-81b7-450d-ba4e-3df5590ba023",
          "citation": "PHLORIDZINUM [HPUS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7a5ac88f-e399-42b9-bc8d-3d864544be70",
          "citation": "PHLORIDZIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "531bce98-9955-46c7-b099-2a2edcd5b514",
          "citation": "PHLORIDZIN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "45572ec2-fd43-491b-8175-15f45a9b2646",
          "citation": "PHLORIDZIN [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "15483002-6ae3-2a46-b0fa-e45f37a346f9",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=60-81-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "47942102-4079-1d42-e526-eac3585b5a92",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "35867439-30ab-4a72-bc75-04b20f135d96",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f5e3f36f-a956-7b72-c7e2-c9256aed2069",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "d25b3960-32d5-5ce7-75b4-f5f768ab79be",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "09462505-a7d9-8350-16b9-6059ae7656ee",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "715fc4a3-b854-9d28-be11-1e75b0442efb",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1c056c4f-7e52-4f42-9246-2401ef03d666",
          "id": "1c056c4f-7e52-4f42-9246-2401ef03d666",
          "molfile": "\n  Marvin  01132101382D          \n\n 31 33  0  0  1  0            999 V2000\n    4.5347   -4.4354    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    3.8185   -4.0170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8185   -3.1926    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2506   -4.0259    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9575   -4.4353    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.6736   -4.0168    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3931   -4.4256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3931   -5.2405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1102   -5.6550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1102   -6.4816    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8132   -5.2392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8132   -4.4151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5216   -3.9995    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0973   -4.0120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0973   -3.1799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3625   -2.8481    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8297   -2.7927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8297   -1.9675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5798   -1.5764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5798   -0.7453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3195   -0.3458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0169   -0.7798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7439   -0.3978    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0169   -1.6007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2801   -2.0021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9575   -5.2632    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.5187   -5.6405    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2506   -5.6726    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.2506   -6.4913    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5347   -5.2633    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    3.8185   -5.6817    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  4  1  0  0  0  0\n 30  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  1  0  0  0\n 26  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  7 14  2  0  0  0  0\n  9  8  2  0  0  0  0\n  9 10  1  0  0  0  0\n 11  9  1  0  0  0  0\n 12 11  2  0  0  0  0\n 12 13  1  0  0  0  0\n 14 12  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 15 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 25 19  2  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  2  0  0  0  0\n 24 25  1  0  0  0  0\n 26 27  1  6  0  0  0\n 28 26  1  0  0  0  0\n 28 29  1  1  0  0  0\n 30 28  1  0  0  0  0\n 30 31  1  6  0  0  0\nM  END",
          "smiles": "c1cc(ccc1CCC(=O)c2c(cc(cc2O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O)O)O)O)O",
          "formula": "C21H24O10",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c7d43503-efff-4571-9e08-2cedef5654b9"
          },
          "defined_stereo": 5,
          "ez_centers": 0,
          "molecular_weight": "436.4101",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 5
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f1a09e45-4508-4121-9911-f518f5f3c5ba",
      "version": "16",
      "structure": {
        "id": "190ec573-bf99-45da-af1e-5cb4940407d3",
        "molfile": "\n  Marvin  01132101292D          \n\n 31 33  0  0  1  0            999 V2000\n    6.6736   -4.0168    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9575   -4.4353    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.2506   -4.0259    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5347   -4.4354    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.5347   -5.2633    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.2506   -5.6726    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.9575   -5.2632    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.5187   -5.6405    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2506   -6.4913    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8185   -5.6817    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8185   -4.0170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8185   -3.1926    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3931   -4.4256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3931   -5.2405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1102   -5.6550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8132   -5.2392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8132   -4.4151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5216   -3.9995    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0973   -4.0120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0973   -3.1799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8297   -2.7927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8297   -1.9675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5798   -1.5764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5798   -0.7453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3195   -0.3458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0169   -0.7798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0169   -1.6007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2801   -2.0021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7439   -0.3978    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3625   -2.8481    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1102   -6.4816    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  1  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  2  7  1  0  0  0  0\n  7  8  1  6  0  0  0\n  6  9  1  1  0  0  0\n  5 10  1  6  0  0  0\n  4 11  1  1  0  0  0\n 12 11  1  0  0  0  0\n  1 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  2  0  0  0  0\n 17 18  1  0  0  0  0\n 19 17  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  2  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  2  0  0  0  0\n 26 27  1  0  0  0  0\n 27 28  2  0  0  0  0\n 28 23  1  0  0  0  0\n 26 29  1  0  0  0  0\n 20 30  2  0  0  0  0\n 13 19  2  0  0  0  0\n 15 31  1  0  0  0  0\nM  END",
        "smiles": "c1cc(ccc1CCC(=O)c2c(cc(cc2O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O)O)O)O)O",
        "formula": "C21H24O10",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 5,
        "ez_centers": 0,
        "molecular_weight": "436.4101",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "75041cf4-20d5-4b6c-a2b3-cc334bc88483",
          "087dab6b-df1e-4917-b0c5-74cd0d26b804"
        ],
        "stereo_centers": 5
      },
      "unii": "CU9S17279X"
    }
  ]
}