{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "98e61c42-7f4c-473f-8c59-01d980e11a88", "code": "78508-21-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=78508-21-1", "code_system": "CAS", "references": [ "f52eaf17-2f41-4285-b4cf-9ad1ce33b610" ] }, { "uuid": "5755c245-70d5-64b0-49a7-844235526035", "code": "67253069", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/67253069", "code_system": "PUBCHEM", "references": [ "e6ae4c6f-39be-7c39-0c76-fd3ffda50fdc" ] }, { "uuid": "b58dc855-d668-4344-a62b-01168003f30d", "code": "CU6QX38B9U", "type": "PRIMARY", "code_system": "FDA UNII" } ], "relationships": [ { "uuid": "9d4b0f25-dd05-44ea-a068-7a39efca69a2", "comments": "Limit: – sum of impurities H and I: any spot is not more intense than the spot due to fructose obtained with reference solution (b) (0.1 per cent).", "qualification": "EP", "type": "PARENT->IMPURITY", "interaction_type": "CHROMATOGRAPHIC PURITY (TLC)", "references": [ "bdb039d3-6579-146f-5d3d-6d08b42a0779" ], "related_substance": { "uuid": "80591c70-5371-4d73-ae66-44214157a218", "refuuid": "ab51b9aa-fd47-4039-9cca-e305b091befb", "name": "SUCRALOSE", "unii": "96K6UQ3ZD4", "linking_id": "96K6UQ3ZD4", "ref_pname": "SUCRALOSE", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "1ebfad84-2180-1559-efc0-1cbe08c6156d", "name": ".BETA.-D-FRUCTOFURANOSE, 1,6-DICHLORO-1,6-DIDEOXY-", "stdName": ".BETA.-D-FRUCTOFURANOSE, 1,6-DICHLORO-1,6-DIDEOXY-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ad77e99a-f104-7264-f945-e02022dad08e" ], "display_name": false }, { "uuid": "2b5d14cc-81e3-eb0a-6e03-f888fc2b7ff2", "name": "1,6-DICHLORO-1,6-DIDEOXY-.BETA.-D-FRUCTOFURANOSE", "stdName": "1,6-DICHLORO-1,6-DIDEOXY-.BETA.-D-FRUCTOFURANOSE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "bdb039d3-6579-146f-5d3d-6d08b42a0779" ], "display_name": true }, { "uuid": "2f8344f5-9df8-3882-5e41-52851d3112d0", "name": "SUCRALOSE IMPURITY H [EP IMPURITY]", "stdName": "SUCRALOSE IMPURITY H [EP IMPURITY]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "bdb039d3-6579-146f-5d3d-6d08b42a0779" ], "display_name": false } ], "references": [ { "uuid": "ad77e99a-f104-7264-f945-e02022dad08e", "citation": "stn", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "bdb039d3-6579-146f-5d3d-6d08b42a0779", "citation": "European Pharmacopoeia Online 9.8, Sucralose Monograph", "url": "http://online6.edqm.eu/ep908/", "doc_type": "EP", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "f52eaf17-2f41-4285-b4cf-9ad1ce33b610", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "e6ae4c6f-39be-7c39-0c76-fd3ffda50fdc", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "f5c5a85d-683e-fdd6-bc74-894a06356249", "id": "f5c5a85d-683e-fdd6-bc74-894a06356249", "molfile": "\n Marvin 01132112442D \n\n 12 12 0 0 1 0 999 V2000\n 15.9020 -3.9350 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 16.5694 -3.4501 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1174 -3.6801 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 14.8623 -2.8954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6323 -4.3476 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 13.9179 -4.7601 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9179 -3.9350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2034 -4.3476 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1174 -5.0150 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9020 -4.7601 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 16.5694 -5.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3232 -4.9095 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 6 0 0 0\n 1 3 1 0 0 0 0\n 1 10 1 0 0 0 0\n 3 4 1 1 0 0 0\n 3 5 1 0 0 0 0\n 5 6 1 1 0 0 0\n 5 7 1 0 0 0 0\n 5 9 1 0 0 0 0\n 7 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 1 1 0 0 0\n 11 12 1 0 0 0 0\nM END", "smiles": "C([C@@H]1[C@H]([C@@H]([C@](CCl)(O)O1)O)O)Cl", "formula": "C6H10Cl2O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "97cb3e8d-6050-4b5b-8271-1dc5b3c3c1fc" }, "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "217.0473", "optical_activity": "UNSPECIFIED", "stereo_centers": 4 } ], "definition_level": "COMPLETE", "uuid": "705a18e8-3d71-4b4a-99b4-241dd39d4dae", "version": "9", "structure": { "id": "dd680f41-3961-a23a-33c7-00f426959fa3", "molfile": "\n Marvin 01132111292D \n\n 12 12 0 0 1 0 999 V2000\n 13.9179 -3.9350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1174 -3.6801 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 14.8623 -2.8954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9020 -3.9350 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 16.5694 -3.4501 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9020 -4.7601 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 15.1174 -5.0150 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5694 -5.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6323 -4.3476 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 13.9179 -4.7601 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3232 -4.9095 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2034 -4.3476 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 2 3 1 1 0 0 0\n 2 4 1 0 0 0 0\n 4 5 1 6 0 0 0\n 4 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 6 8 1 1 0 0 0\n 9 10 1 1 0 0 0\n 2 9 1 0 0 0 0\n 9 1 1 6 0 0 0\n 9 7 1 0 0 0 0\n 8 11 1 0 0 0 0\n 1 12 1 0 0 0 0\nM END", "smiles": "C([C@@H]1[C@H]([C@@H]([C@](CCl)(O)O1)O)O)Cl", "formula": "C6H10Cl2O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "217.0473", "optical_activity": "UNSPECIFIED", "references": [ "bdb039d3-6579-146f-5d3d-6d08b42a0779" ], "stereo_centers": 4 }, "unii": "CU6QX38B9U" } ] }