{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "661bc809-2c49-4b06-b755-c4dc26f17d23",
          "code": "25739-41-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=25739-41-7",
          "code_system": "CAS",
          "references": [
            "26f37c7c-a426-4f75-a124-4f5105cc217f",
            "a5d3159c-8c4a-4346-a0fe-22fe2cd809ba"
          ]
        },
        {
          "uuid": "7acb9189-985c-4dee-99ea-87066db6666a",
          "code": "5464381",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5464381",
          "code_system": "PUBCHEM",
          "references": [
            "26f37c7c-a426-4f75-a124-4f5105cc217f"
          ]
        },
        {
          "uuid": "7a676cc9-a25a-97dd-8c16-850458348659",
          "code": "Velutin",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Velutin",
          "code_system": "WIKIPEDIA",
          "references": [
            "ea00bc19-fd56-fceb-1e80-82c9ce0844c1"
          ]
        },
        {
          "uuid": "5da3fe19-f4b1-d928-6f07-44af5a5d614e",
          "code": "DTXSID90180421",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90180421",
          "code_system": "EPA CompTox",
          "references": [
            "308c96df-1f08-0181-06ec-b408cef89441"
          ]
        },
        {
          "uuid": "64a5014e-8b3b-4af3-bedf-8c89d3f4cbf7",
          "code": "CT1Q4E0I0W",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "relationships": [
        {
          "uuid": "ed854351-b0e7-4ff2-a50a-065cd8ec71f4",
          "comments": "ORAC value expressed as umol TE/g for this compound 13643.3 +/- 1119.5.\nORAC is a chemical antioxidant assay that is based on the inhibition of the peroxyl-radical induced oxidation initiated by thermal decomposition of AAPH.",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "c962f972-9e09-46e7-b77a-373e1c8065e4"
          ],
          "related_substance": {
            "uuid": "2ceb9938-e3b5-4c20-9d3e-f474431640ae",
            "refuuid": "39e1efc1-f4cc-4d06-87fb-d9557dd1ff9e",
            "name": "ACAI",
            "unii": "46AM2VJ0AW",
            "linking_id": "46AM2VJ0AW",
            "ref_pname": "ACAI",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "ed244217-e1c2-495c-888c-999675c4df64",
          "comments": "Velutin significantly\ninhibited p38 and JNK phosphorylation at 5 and 10 uM.The SEAP reporter assay was conducted to evaluate the inhibitory\neffects of velutin in inhibiting NF-.KAPPA.B activation in our\nprevious report. The IC50 values of this compound was\nestimated at 2.0 uM for velutin.",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "aa2c1476-7c21-4603-b4b2-af9cb4844ff0"
          ],
          "related_substance": {
            "uuid": "d9a78846-3818-4b8a-b490-4fdf59982c71",
            "refuuid": "39e1efc1-f4cc-4d06-87fb-d9557dd1ff9e",
            "name": "ACAI",
            "unii": "46AM2VJ0AW",
            "linking_id": "46AM2VJ0AW",
            "ref_pname": "ACAI",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ec579387-0846-4f76-b05c-5f66c3b5f615",
          "name": "3',7-DIMETHYLLUTEOLIN",
          "stdName": "3',7-DIMETHYLLUTEOLIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e5e97e0-5cf4-4dfe-9b3a-ed683659223f"
          ],
          "display_name": false
        },
        {
          "uuid": "0caeac7c-0a10-4f4e-83fd-8d920c7fb674",
          "name": "4H-1-BENZOPYRAN-4-ONE, 5-HYDROXY-2-(4-HYDROXY-3-METHOXYPHENYL)-7-METHOXY-",
          "stdName": "4H-1-BENZOPYRAN-4-ONE, 5-HYDROXY-2-(4-HYDROXY-3-METHOXYPHENYL)-7-METHOXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e5e97e0-5cf4-4dfe-9b3a-ed683659223f"
          ],
          "display_name": false
        },
        {
          "uuid": "441853db-0788-49f6-8525-f440624e07a6",
          "name": "CHRYSOERIOL 7-METHYL ETHER",
          "stdName": "CHRYSOERIOL 7-METHYL ETHER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e5e97e0-5cf4-4dfe-9b3a-ed683659223f"
          ],
          "display_name": false
        },
        {
          "uuid": "d066b67d-c01b-4d16-a996-0e20e3b67ee8",
          "name": "DR 9606128",
          "stdName": "DR 9606128",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e5e97e0-5cf4-4dfe-9b3a-ed683659223f"
          ],
          "display_name": false
        },
        {
          "uuid": "bfb0e641-9b21-41fd-90da-8849234c9b1e",
          "name": "FLAVONE, 4',5-DIHYDROXY-3',7-DIMETHOXY-",
          "stdName": "FLAVONE, 4',5-DIHYDROXY-3',7-DIMETHOXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e5e97e0-5cf4-4dfe-9b3a-ed683659223f"
          ],
          "display_name": false
        },
        {
          "uuid": "400b27b0-eb57-4b40-9de9-8b4e268e0189",
          "name": "FLAVOYADORIGENIN B",
          "stdName": "FLAVOYADORIGENIN B",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e5e97e0-5cf4-4dfe-9b3a-ed683659223f"
          ],
          "display_name": false
        },
        {
          "uuid": "b17a6ea9-666d-4583-a536-05896e45f82d",
          "name": "LUTEOLIN 3',7-DIMETHYL ETHER",
          "stdName": "LUTEOLIN 3',7-DIMETHYL ETHER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e5e97e0-5cf4-4dfe-9b3a-ed683659223f"
          ],
          "display_name": false
        },
        {
          "uuid": "b96ccad1-6053-429c-91b0-0659554e2018",
          "name": "VELUTIN",
          "stdName": "VELUTIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0abca6da-45cf-42df-ad64-4a88809663ba"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "b8fe6fcd-ecd0-4da7-9021-8591b85a70c5",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "0abca6da-45cf-42df-ad64-4a88809663ba",
          "citation": "Xie, C, et al,  Journal of nutritional biochemistry, 23(9)1184-1191,2012",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "5e5e97e0-5cf4-4dfe-9b3a-ed683659223f",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "26f37c7c-a426-4f75-a124-4f5105cc217f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392689000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c962f972-9e09-46e7-b77a-373e1c8065e4",
          "citation": "KANG, J ET AL, FOOD CHEMISTRY, 128(1)152-157,2011",
          "url": "http://ac.els-cdn.com/S0308814611003773/1-s2.0-S0308814611003773-main.pdf?_tid=d8a7770c-653d-11e4-a72e-00000aab0f6b&acdnat=1415227883_9bf0d89be7ed4aa146020609a89ac711",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aa2c1476-7c21-4603-b4b2-af9cb4844ff0",
          "citation": "XIE, C, ET AL, JOURNAL OF NUTRITIONAL BIOCHEMISTRY, 23(9)1184-1191,2012",
          "url": "http://ac.els-cdn.com/S0955286311002099/1-s2.0-S0955286311002099-main.pdf?_tid=356dc566-6531-11e4-a86b-00000aacb361&acdnat=1415222455_6a59cf52731cfba5e7bd34284567906b",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "549b1225-aedf-4701-85ff-f7fb054aff80",
          "citation": "SRS import [CT1Q4E0I0W]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=CT1Q4E0I0W",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392689000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ea00bc19-fd56-fceb-1e80-82c9ce0844c1",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Velutin",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "308c96df-1f08-0181-06ec-b408cef89441",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=25739-41-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a5d3159c-8c4a-4346-a0fe-22fe2cd809ba",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d5bea74d-017d-473c-95fd-62a58e0e24d2",
          "id": "d5bea74d-017d-473c-95fd-62a58e0e24d2",
          "molfile": "\n  Marvin  01132111042D          \n\n 23 25  0  0  0  0            999 V2000\n    1.9923   -4.5425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7067   -4.1299    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4211   -4.5425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4211   -5.3675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1356   -5.7800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1356   -6.6050    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8501   -5.3675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8501   -4.5425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1356   -4.1300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5646   -4.1300    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2791   -4.5425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2791   -5.3675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5646   -5.7800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5646   -6.6050    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9935   -4.1301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7080   -4.5426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4225   -4.1301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4225   -3.3051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1370   -2.8925    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7081   -2.8925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7081   -2.0676    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4225   -1.6550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9936   -3.3050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3  9  2  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7 13  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n 11 15  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 15 23  2  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 20 23  1  0  0  0  0\n 21 22  1  0  0  0  0\nM  END",
          "smiles": "COc1cc(c2c(=O)cc(-c3ccc(c(c3)OC)O)oc2c1)O",
          "formula": "C17H14O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6c840898-dd2f-4dd7-b279-3ec800696470"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "314.2901",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "09e4a52f-2d84-4a9e-a91d-75580508dfa2",
      "version": "7",
      "structure": {
        "id": "8e4fab54-eb64-40b2-93b7-4440d86190bd",
        "molfile": "\n  Marvin  01132107232D          \n\n 23 25  0  0  0  0            999 V2000\n    1.9923   -4.5425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7067   -4.1299    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4211   -4.5425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4211   -5.3675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1356   -4.1300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8501   -4.5425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8501   -5.3675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1356   -5.7800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5646   -4.1300    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2791   -4.5425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2791   -5.3675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5646   -5.7800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9935   -4.1301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7080   -4.5426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9936   -3.3050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7081   -2.8925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4225   -3.3051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4225   -4.1301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7081   -2.0676    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4225   -1.6550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1370   -2.8925    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5646   -6.6050    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1356   -6.6050    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  3  5  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  4  8  1  0  0  0  0\n  6  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n  7 12  1  0  0  0  0\n 10 13  1  0  0  0  0\n 14 13  2  0  0  0  0\n 13 15  1  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  2  0  0  0  0\n 14 18  1  0  0  0  0\n 16 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 17 21  1  0  0  0  0\n 12 22  2  0  0  0  0\n  8 23  1  0  0  0  0\nM  END",
        "smiles": "COc1cc(c2c(=O)cc(-c3ccc(c(c3)OC)O)oc2c1)O",
        "formula": "C17H14O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "314.2901",
        "optical_activity": "NONE",
        "references": [
          "0abca6da-45cf-42df-ad64-4a88809663ba",
          "549b1225-aedf-4701-85ff-f7fb054aff80"
        ],
        "stereo_centers": 0
      },
      "unii": "CT1Q4E0I0W"
    }
  ]
}