{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ca4a6bf4-a23c-4c14-aa38-7a8aa078310c",
          "code": "5026-62-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=5026-62-0",
          "code_system": "CAS",
          "references": [
            "b145c08a-e2bd-4e4a-b072-477276411efb",
            "7dd71610-151b-4cf0-b4af-217ad2515dc2"
          ]
        },
        {
          "uuid": "487564e5-be9d-44ec-ad78-69d0eb97f6a9",
          "code": "C77479",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C77479",
          "code_system": "NCI_THESAURUS",
          "references": [
            "b145c08a-e2bd-4e4a-b072-477276411efb"
          ]
        },
        {
          "uuid": "fa3bbfa1-3b9a-4a5d-b31a-13364f407e15",
          "code": "SODIUM METHYLPARABEN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Sodium_methylparaben",
          "code_system": "WIKIPEDIA",
          "references": [
            "b145c08a-e2bd-4e4a-b072-477276411efb"
          ]
        },
        {
          "uuid": "c2a3dcd3-5475-479d-b313-f0988ee8a9df",
          "code": "61207",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2863",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "b145c08a-e2bd-4e4a-b072-477276411efb"
          ]
        },
        {
          "uuid": "f17bf557-fb96-4b11-94f9-d591d7454fe9",
          "code": "225-714-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.023.377",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "b145c08a-e2bd-4e4a-b072-477276411efb"
          ]
        },
        {
          "uuid": "aad81737-b35a-4225-af3f-b87676527524",
          "code": "1310557",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1310557/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "b145c08a-e2bd-4e4a-b072-477276411efb"
          ]
        },
        {
          "uuid": "9d9cccd1-839b-45b5-993d-f6505eded34b",
          "code": "SUB12300MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "b145c08a-e2bd-4e4a-b072-477276411efb"
          ]
        },
        {
          "uuid": "c3e78e73-2012-4fca-ad53-8036be2c20ad",
          "code": "CHEMBL325372",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL325372",
          "code_system": "ChEMBL",
          "references": [
            "b145c08a-e2bd-4e4a-b072-477276411efb"
          ]
        },
        {
          "uuid": "dd5aaa21-0b5f-4394-bcbb-1e2b7f9dadc6",
          "code": "23663626",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/23663626",
          "code_system": "PUBCHEM",
          "references": [
            "b145c08a-e2bd-4e4a-b072-477276411efb"
          ]
        },
        {
          "uuid": "80506fb6-4edc-8bc9-6c95-91cb3630670e",
          "code": "DTXSID1042156",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1042156",
          "code_system": "EPA CompTox",
          "references": [
            "f549c262-d26e-e51f-a715-4fe0e52a816c"
          ]
        },
        {
          "uuid": "6063f122-ff7c-9614-e280-3b0b001fddea",
          "code": "C92608",
          "comments": "Industrial Aid[C45678]|Paraben",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C92608",
          "code_system": "NCI_THESAURUS",
          "references": [
            "fac55777-7ae4-b7ac-378a-63514789af33"
          ]
        },
        {
          "uuid": "7db69ce1-1b7d-337e-3c02-c6e2356c2005",
          "code": "DBSALT002761",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DBSALT002761",
          "code_system": "DRUG BANK",
          "references": [
            "fac55777-7ae4-b7ac-378a-63514789af33"
          ]
        },
        {
          "uuid": "c73f1195-0a46-4c0d-8d97-094d8adade8c",
          "code": "CR6K9C2NHK",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "25f14981-5e8f-fd55-339a-edf256ef6959",
          "code": "Y-26",
          "type": "PRIMARY",
          "url": "https://searchusan.ama-assn.org/finder/usan/search/Y-26/relevant/1/",
          "code_system": "USAN",
          "references": [
            "6b5d5726-9e28-4f81-e835-4042f10bffa6"
          ]
        },
        {
          "uuid": "5e767e89-94d5-6905-aaf0-a54c1e9b367a",
          "code": "CR6K9C2NHK",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=CR6K9C2NHK",
          "code_system": "DAILYMED",
          "references": [
            "956be265-592f-bb9c-64b3-1669281d5b13"
          ]
        },
        {
          "uuid": "f95d0362-3ac9-f8f2-382b-20e38475db3b",
          "code": "100000079320",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "46fb6026-766c-d321-6dab-df71e7d0d726"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "87101182-b1ca-463b-b75c-d2d2c094d577",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "b3555a08-0aff-4060-b7e8-0acfdfff5199",
            "refuuid": "41d561b6-77a4-4b1a-b973-9150c536fa00",
            "name": "METHYLPARABEN",
            "unii": "A2I8C7HI9T",
            "linking_id": "A2I8C7HI9T",
            "ref_pname": "METHYLPARABEN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "07b3d51d-81d2-4b00-b655-fa800cb9ece4",
          "amount": {
            "uuid": "f1fd90a6-bf4e-4ce0-bec7-245605869656"
          },
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "21266d1d-3650-40a8-a58a-0a33aebc7aec",
            "refuuid": "41d561b6-77a4-4b1a-b973-9150c536fa00",
            "name": "METHYLPARABEN",
            "unii": "A2I8C7HI9T",
            "linking_id": "A2I8C7HI9T",
            "ref_pname": "METHYLPARABEN",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "8d7dcee7-1984-4a22-98f5-94f8b3b97eab",
          "name": "METHYLPARABEN SODIUM",
          "stdName": "METHYLPARABEN SODIUM",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2efbd8c-e79d-4332-94e3-f0b6084d93d2",
            "e703ba26-7645-4738-a3e1-fcda9ccbafcc",
            "48f77060-67b3-4823-a812-f096c4e1abf8",
            "f6c64261-ad5c-4fac-823d-14eee7966ca3"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "841675b1-ec10-41fd-a45b-a24fde387fef",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "41cc1556-aa2d-4377-b18d-9899832dbeeb",
          "name": "METHYLPARABEN SODIUM [II]",
          "stdName": "METHYLPARABEN SODIUM [II]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2efbd8c-e79d-4332-94e3-f0b6084d93d2"
          ],
          "display_name": false
        },
        {
          "uuid": "5b04fbef-98b0-4617-8983-268412a5f273",
          "name": "METHYLPARABEN SODIUM [USAN]",
          "stdName": "METHYLPARABEN SODIUM [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f6c64261-ad5c-4fac-823d-14eee7966ca3"
          ],
          "display_name": false
        },
        {
          "uuid": "d4db0c64-e8e3-49c0-ad0e-aa6c4957d0d9",
          "name": "NIPAGIN M SODIUM",
          "stdName": "NIPAGIN M SODIUM",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "855ae1d9-0734-4b71-ae55-1ceb4c3e3938",
            "296615f9-f076-45a0-842e-85cf74a1423d"
          ],
          "display_name": false
        },
        {
          "uuid": "be213e17-cbe1-48f5-ac8d-86f0d4ffb1f4",
          "name": "NS 3500S",
          "stdName": "NS 3500S",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c6903c81-6840-45f2-9f78-8e9c2f4b2de2",
            "855ae1d9-0734-4b71-ae55-1ceb4c3e3938"
          ],
          "display_name": false
        },
        {
          "uuid": "e1f93614-b0fb-4a93-8003-c7b3daf9a6e1",
          "name": "PARATEXIN MS",
          "stdName": "PARATEXIN MS",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c6903c81-6840-45f2-9f78-8e9c2f4b2de2",
            "855ae1d9-0734-4b71-ae55-1ceb4c3e3938"
          ],
          "display_name": false
        },
        {
          "uuid": "a923370d-9fe7-4194-acef-6d83e0be9fb7",
          "name": "PARIDOL MNA",
          "stdName": "PARIDOL MNA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c6903c81-6840-45f2-9f78-8e9c2f4b2de2",
            "855ae1d9-0734-4b71-ae55-1ceb4c3e3938"
          ],
          "display_name": false
        },
        {
          "uuid": "cbd5fb3a-e2f0-4723-ab28-78426214cb79",
          "name": "SODIUM METHYL HYDROXYBENZOATE",
          "stdName": "SODIUM METHYL HYDROXYBENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c6903c81-6840-45f2-9f78-8e9c2f4b2de2",
            "9d79f9d8-ba3f-4e52-9e60-37667f0309c4",
            "bd3fb7b4-1328-4916-a837-a7c6497609c7",
            "33addfa8-b526-46fc-bdc9-d9e955cb3fed"
          ],
          "display_name": false
        },
        {
          "uuid": "a1e59984-3f5c-451a-a5e5-d746c7c643bd",
          "name": "SODIUM METHYL HYDROXYBENZOATE [MART.]",
          "stdName": "SODIUM METHYL HYDROXYBENZOATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9d79f9d8-ba3f-4e52-9e60-37667f0309c4"
          ],
          "display_name": false
        },
        {
          "uuid": "a18eb11e-76e5-4386-bac8-4c8afcf37e3d",
          "name": "SODIUM METHYL P-HYDROXYBENZOATE ( E 219)",
          "stdName": "SODIUM METHYL P-HYDROXYBENZOATE ( E 219)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "74d9bba2-7aaf-4ba3-bfe8-dec3d03063d0",
            "c6903c81-6840-45f2-9f78-8e9c2f4b2de2"
          ],
          "display_name": false
        },
        {
          "uuid": "5ac49e39-c9d9-4327-9fad-a5d639274238",
          "name": "SODIUM METHYL PARABEN",
          "stdName": "SODIUM METHYL PARABEN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c6903c81-6840-45f2-9f78-8e9c2f4b2de2",
            "0a631d7b-0aa9-47b2-99cb-7ce10614c7c8"
          ],
          "display_name": false
        },
        {
          "uuid": "1af23e0d-2fc6-4429-88d8-cb0f9f59a15e",
          "name": "SODIUM METHYL PARAHYDROXYBENZOATE",
          "stdName": "SODIUM METHYL PARAHYDROXYBENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c6903c81-6840-45f2-9f78-8e9c2f4b2de2",
            "0f105956-83bf-4d0e-bd74-7a254378b5ac",
            "e42956c0-ee90-4054-a54a-9829204220ff",
            "caa28d94-4143-4176-908f-319b7b2ae65b"
          ],
          "display_name": false
        },
        {
          "uuid": "49df3a36-b10d-3a57-c544-db94a94a7079",
          "name": "SODIUM METHYL PARAHYDROXYBENZOATE [EP MONOGRAPH]",
          "stdName": "SODIUM METHYL PARAHYDROXYBENZOATE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "af9f2bfb-46a1-f20e-3ed1-d8a3509691ba"
          ],
          "display_name": false
        },
        {
          "uuid": "48e97586-ae11-47aa-a6bf-87341b328517",
          "name": "SODIUM METHYLPARABEN",
          "stdName": "SODIUM METHYLPARABEN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "255fe339-323d-475c-9861-36a6093c924d",
            "c6903c81-6840-45f2-9f78-8e9c2f4b2de2",
            "ad457274-8ae2-4f41-bfa7-9f85f086b930",
            "855ae1d9-0734-4b71-ae55-1ceb4c3e3938"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "68693b7e-7e4e-4951-b212-181bcba37021",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "824b20ce-8680-4ed6-827d-4021a09539c9",
          "name": "SOLBROL M SODIUM SALT",
          "stdName": "SOLBROL M SODIUM SALT",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c6903c81-6840-45f2-9f78-8e9c2f4b2de2",
            "855ae1d9-0734-4b71-ae55-1ceb4c3e3938"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "855ae1d9-0734-4b71-ae55-1ceb4c3e3938",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "296615f9-f076-45a0-842e-85cf74a1423d",
          "citation": "CTFA",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c2efbd8c-e79d-4332-94e3-f0b6084d93d2",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "255fe339-323d-475c-9861-36a6093c924d",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8d030d51-f42d-4ab5-ac6c-e99f85c05593",
          "citation": "STN 2007",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0a631d7b-0aa9-47b2-99cb-7ce10614c7c8",
          "citation": "LILLY REQUEST",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c6903c81-6840-45f2-9f78-8e9c2f4b2de2",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f6c64261-ad5c-4fac-823d-14eee7966ca3",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e42956c0-ee90-4054-a54a-9829204220ff",
          "citation": "EP",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "caa28d94-4143-4176-908f-319b7b2ae65b",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9d79f9d8-ba3f-4e52-9e60-37667f0309c4",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "74d9bba2-7aaf-4ba3-bfe8-dec3d03063d0",
          "citation": "SWISS MEDIC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bd3fb7b4-1328-4916-a837-a7c6497609c7",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b145c08a-e2bd-4e4a-b072-477276411efb",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391891000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c7f4cd3b-f559-4531-81b5-846cb4cf431a",
          "citation": "SRS import [CR6K9C2NHK]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=CR6K9C2NHK",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391891000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6b17c700-46bb-4d1a-a886-3ac26eefaf9d",
          "citation": "ChemIDplus 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "48f77060-67b3-4823-a812-f096c4e1abf8",
          "citation": "METHYLPARABEN SODIUM [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0f105956-83bf-4d0e-bd74-7a254378b5ac",
          "citation": "SODIUM METHYL PARAHYDROXYBENZOATE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "33addfa8-b526-46fc-bdc9-d9e955cb3fed",
          "citation": "SODIUM METHYL HYDROXYBENZOATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e703ba26-7645-4738-a3e1-fcda9ccbafcc",
          "citation": "METHYLPARABEN SODIUM [II]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ad457274-8ae2-4f41-bfa7-9f85f086b930",
          "citation": "SODIUM METHYLPARABEN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f549c262-d26e-e51f-a715-4fe0e52a816c",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=5026-62-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fac55777-7ae4-b7ac-378a-63514789af33",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "6b5d5726-9e28-4f81-e835-4042f10bffa6",
          "citation": "USAD COUN",
          "doc_type": "USANCOUN",
          "public_domain": true
        },
        {
          "uuid": "7dd71610-151b-4cf0-b4af-217ad2515dc2",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "af9f2bfb-46a1-f20e-3ed1-d8a3509691ba",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "956be265-592f-bb9c-64b3-1669281d5b13",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "46fb6026-766c-d321-6dab-df71e7d0d726",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "fc3f11c4-bf37-4695-b7a6-368e20b427da",
          "id": "fc3f11c4-bf37-4695-b7a6-368e20b427da",
          "molfile": "\n  Marvin  01132113042D          \n\n  1  0  0  0  0  0            999 V2000\n    4.1998  -10.5234    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "202fac73-4132-42f6-8a4c-1e6eefdbb231"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "1b02cc94-aab0-4470-8b13-2ea0eb6b1f0f",
          "id": "1b02cc94-aab0-4470-8b13-2ea0eb6b1f0f",
          "molfile": "\n  Marvin  01132101352D          \n\n 11 11  0  0  0  0            999 V2000\n   10.1501  -10.5995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4393  -11.0195    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7286  -10.6087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7286   -9.7871    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0177  -11.0241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0177  -11.8502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3022  -12.2610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5915  -11.8502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8715  -12.2565    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.5915  -11.0241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3022  -10.6134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  3  1  0  0  0  0\n  6  5  1  0  0  0  0\n 11  5  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 10  2  0  0  0  0\n 10 11  1  0  0  0  0\nM  CHG  1   9  -1\nM  END",
          "smiles": "COC(=O)c1ccc(cc1)[O-]",
          "formula": "C8H7O3",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ef3af4ea-9b7f-41fc-8cf4-48c012ee30e9"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "151.1397",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9484fa0d-ca03-4ae3-a98f-465d412288e7",
      "version": "15",
      "structure": {
        "id": "40444553-0b08-483f-989a-823e0df61656",
        "molfile": "\n  Marvin  01132103242D          \n\n 12 11  0  0  0  0            999 V2000\n    8.7286  -10.6087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0177  -11.0241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0177  -11.8502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3022  -12.2610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5915  -11.8502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8715  -12.2565    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.5915  -11.0241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3022  -10.6134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7286   -9.7871    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4393  -11.0195    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1501  -10.5995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1998  -10.5234    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  2  2  0  0  0  0\n  9  1  2  0  0  0  0\n 10  1  1  0  0  0  0\n 11 10  1  0  0  0  0\nM  CHG  2   6  -1  12   1\nM  END",
        "smiles": "COC(=O)c1ccc(cc1)[O-].[Na+]",
        "formula": "C8H7O3.Na",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "174.1295",
        "optical_activity": "NONE",
        "references": [
          "6b17c700-46bb-4d1a-a886-3ac26eefaf9d",
          "c7f4cd3b-f559-4531-81b5-846cb4cf431a"
        ],
        "stereo_centers": 0
      },
      "unii": "CR6K9C2NHK"
    }
  ]
}