{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "0e206e96-f280-4114-a214-2edfc45e48bb",
          "code": "4049-38-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=4049-38-1",
          "code_system": "CAS",
          "references": [
            "88b938a1-9194-4cb8-8f3f-04984210458a",
            "1ab1d35b-a7c6-435e-9b16-a1614e578195"
          ]
        },
        {
          "uuid": "7c4ba48a-ecd4-44e3-ad46-89b6cc20eea0",
          "code": "11095",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11095",
          "code_system": "PUBCHEM",
          "references": [
            "88b938a1-9194-4cb8-8f3f-04984210458a"
          ]
        },
        {
          "uuid": "8358e5bb-76bb-4601-9f37-284e8850bc48",
          "code": "CQT975GLYF",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e9fc04ff-d0a0-3d57-cb05-596849055e87",
          "code": "2146",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/2146/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "bd40576b-0a78-1b00-5d74-8b77bec594bb"
          ]
        },
        {
          "uuid": "50a9afec-5575-c3e3-f681-9c1d00c0c570",
          "code": "DTXSID30862178",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30862178",
          "code_system": "EPA CompTox",
          "references": [
            "a5bad71c-d787-7162-bfad-7fc61f34f354"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "6cf713af-46c7-471f-8af0-a32da60da3e2",
          "name": "(±)-3',4',5,7-TETRAHYDROXYFLAVANONE",
          "stdName": "(+/-)-3',4',5,7-TETRAHYDROXYFLAVANONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "90508aa9-3f81-4408-9962-bff02c2d9a87",
            "c799e7e6-e3ea-4acc-ac08-d6da394b6542"
          ],
          "display_name": false
        },
        {
          "uuid": "d43d8e2e-503e-4617-8084-902f2d3b6be2",
          "name": "(±)-5,7,3',4'-TETRAHYDROXYFLAVANONE",
          "stdName": "(+/-)-5,7,3',4'-TETRAHYDROXYFLAVANONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "90508aa9-3f81-4408-9962-bff02c2d9a87",
            "c799e7e6-e3ea-4acc-ac08-d6da394b6542"
          ],
          "display_name": false
        },
        {
          "uuid": "658accfc-4988-4635-b976-61685ec16718",
          "name": "(±)-ERIODICTYOL",
          "stdName": "(+/-)-ERIODICTYOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "90508aa9-3f81-4408-9962-bff02c2d9a87",
            "c799e7e6-e3ea-4acc-ac08-d6da394b6542"
          ],
          "display_name": false
        },
        {
          "uuid": "6b65222c-ecec-e8e8-17dc-244c4faa8240",
          "name": "2-(3,4-DIHYDROXYPHENYL)-5,7-DIHYDROXY-4-CHROMANON",
          "stdName": "2-(3,4-DIHYDROXYPHENYL)-5,7-DIHYDROXY-4-CHROMANON",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ae43e2e5-8cb9-e60a-a0d2-f84e37568e30"
          ],
          "display_name": false
        },
        {
          "uuid": "4f2dad47-ea32-407d-8f67-ea3887d18bff",
          "name": "4H-1-BENZOPYRAN-4-ONE, 2-(3,4-DIHYDROXYPHENYL)-2,3-DIHYDRO-5,7-DIHYDROXY-",
          "stdName": "4H-1-BENZOPYRAN-4-ONE, 2-(3,4-DIHYDROXYPHENYL)-2,3-DIHYDRO-5,7-DIHYDROXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "90508aa9-3f81-4408-9962-bff02c2d9a87",
            "c799e7e6-e3ea-4acc-ac08-d6da394b6542"
          ],
          "display_name": false
        },
        {
          "uuid": "a7cfb3b0-c08a-4315-af18-ce2a6b74b6d4",
          "name": "ERIODICTYOL, (±)-",
          "stdName": "ERIODICTYOL, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "90508aa9-3f81-4408-9962-bff02c2d9a87",
            "c799e7e6-e3ea-4acc-ac08-d6da394b6542"
          ],
          "display_name": true
        },
        {
          "uuid": "89788abf-fc33-94f4-7914-33407f7401f9",
          "name": "FEMA NO. 4715",
          "stdName": "FEMA NO. 4715",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ae43e2e5-8cb9-e60a-a0d2-f84e37568e30"
          ],
          "display_name": false
        },
        {
          "uuid": "d78eca77-d324-4673-aa71-1ba57dd29755",
          "name": "FLAVANONE, 3',4',5,7-TETRAHYDROXY-",
          "stdName": "FLAVANONE, 3',4',5,7-TETRAHYDROXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "90508aa9-3f81-4408-9962-bff02c2d9a87",
            "c799e7e6-e3ea-4acc-ac08-d6da394b6542"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c799e7e6-e3ea-4acc-ac08-d6da394b6542",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "90508aa9-3f81-4408-9962-bff02c2d9a87",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "88b938a1-9194-4cb8-8f3f-04984210458a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392256000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8f937183-9902-4d5c-8eaa-4df8c78e388f",
          "citation": "SRS import [CQT975GLYF]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=CQT975GLYF",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392256000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ae43e2e5-8cb9-e60a-a0d2-f84e37568e30",
          "citation": "FHFI",
          "doc_type": "HANDBOOK OF FLAVOR INGREDIENTS",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "1ab1d35b-a7c6-435e-9b16-a1614e578195",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a5bad71c-d787-7162-bfad-7fc61f34f354",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "bd40576b-0a78-1b00-5d74-8b77bec594bb",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4ff95756-8ba7-45db-a08e-f2e35e7d3553",
          "id": "4ff95756-8ba7-45db-a08e-f2e35e7d3553",
          "molfile": "\n  Marvin  01132104102D          \n\n 21 23  0  0  0  0            999 V2000\n    8.4740   -2.8440    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7627   -3.2505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7627   -4.0726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0283   -4.4837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0283   -5.3196    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3217   -4.0726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5919   -4.4745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5919   -5.3104    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9083   -4.0633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9083   -3.2227    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    5.6011   -2.8394    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3217   -3.2413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0422   -2.8394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1878   -2.8209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4673   -3.2227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7560   -2.8116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7560   -1.9987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0447   -1.5738    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4858   -1.5784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4858   -0.7425    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1878   -2.0079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n 13  2  2  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n  4  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n 12  6  2  0  0  0  0\n  8  7  2  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 14  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 15 14  1  0  0  0  0\n 21 14  2  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 17  2  0  0  0  0\n 20 19  1  0  0  0  0\n 19 21  1  0  0  0  0\nM  END",
          "smiles": "c1cc(c(cc1C2CC(=O)c3c(cc(cc3O2)O)O)O)O",
          "formula": "C15H12O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "59d9f692-0ce8-4ad8-84f6-0a4a79a27a7f"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "288.2528",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "980239a8-b7f7-4e55-94aa-fd60f3250010",
      "version": "5",
      "structure": {
        "id": "1d97b395-e01f-499f-a90e-efbe155855a1",
        "molfile": "\n  Marvin  01132101422D          \n\n 21 23  0  0  0  0            999 V2000\n    6.3217   -4.0726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5919   -4.4745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9083   -4.0633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9083   -3.2227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6011   -2.8394    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3217   -3.2413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0422   -2.8394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7627   -3.2505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7627   -4.0726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0283   -4.4837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0283   -5.3196    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4740   -2.8440    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1878   -2.8209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1878   -2.0079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4858   -1.5784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4858   -0.7425    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7560   -1.9987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7560   -2.8116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4673   -3.2227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0447   -1.5738    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5919   -5.3104    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  1  2  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10  1  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12  8  1  0  0  0  0\n  4 13  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 15 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 13  1  0  0  0  0\n 20 17  1  0  0  0  0\n 21  2  2  0  0  0  0\nM  END",
        "smiles": "c1cc(c(cc1C2CC(=O)c3c(cc(cc3O2)O)O)O)O",
        "formula": "C15H12O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "288.2528",
        "optical_activity": "( + / - )",
        "references": [
          "8f937183-9902-4d5c-8eaa-4df8c78e388f",
          "c799e7e6-e3ea-4acc-ac08-d6da394b6542"
        ],
        "stereo_centers": 1
      },
      "unii": "CQT975GLYF"
    }
  ]
}