{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "2f39b6bb-dbaf-4626-bf1d-61bc31e2032b", "code": "34540-22-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=34540-22-2", "code_system": "CAS", "references": [ "47b24dbe-c346-4d86-90ce-760355a4eb10", "5de9ac65-7894-4904-8b69-b16bc1fc6576" ] }, { "uuid": "9d5b94b4-92cc-402f-9bbc-9dd398811c95", "code": "87855", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/87855/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "47b24dbe-c346-4d86-90ce-760355a4eb10" ] }, { "uuid": "ba8c845c-23f0-4d56-b96b-4d8c8f84aa79", "code": "SUB125894", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "47b24dbe-c346-4d86-90ce-760355a4eb10" ] }, { "uuid": "07fe4d94-9343-4624-beaa-59f42b278be1", "code": "252-076-1", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.047.327", "code_system": "ECHA (EC/EINECS)", "references": [ "47b24dbe-c346-4d86-90ce-760355a4eb10" ] }, { "uuid": "b31699de-bedc-40ca-ae68-751dd1225b21", "code": "24825675", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/24825675", "code_system": "PUBCHEM", "references": [ "47b24dbe-c346-4d86-90ce-760355a4eb10" ] }, { "uuid": "8d671867-6da3-4952-1318-90a1bc11300c", "code": "DTXSID40956057", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40956057", "code_system": "EPA CompTox", "references": [ "c8da998d-fdc6-b4b2-825f-3a8564c3945b" ] }, { "uuid": "8fc67098-5f8a-72ad-5b17-1c67ba5f9d04", "code": "DB15532", "type": "PRIMARY", "url": "https://go.drugbank.com/drugs/DB15532", "code_system": "DRUG BANK", "references": [ "2a59477d-09cb-6e9f-caa6-56ba16b9a8be" ] }, { "uuid": "a42fdf2f-bac4-4eb9-97ad-26f1508cbadb", "code": "CQ2F5O6YIY", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "ebcf81c4-f336-c857-9cae-9464f7e7caff", "code": "66651", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:66651", "code_system": "CHEBI", "references": [ "2a59477d-09cb-6e9f-caa6-56ba16b9a8be" ] }, { "uuid": "69f85923-d86f-a308-635d-b261aaa9fb51", "code": "CQ2F5O6YIY", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=CQ2F5O6YIY", "code_system": "DAILYMED", "references": [ "bb439ea9-b547-2f4f-6a43-4265edb3bbce" ] }, { "uuid": "68252b0c-a812-36af-0672-62ee2e952a47", "code": "100000151623", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "8961f625-3b00-d4f0-c278-de4134ce4b68" ] } ], "relationships": [ { "uuid": "8264723c-8120-489d-82bc-3eaacee50494", "amount": { "uuid": "0ce7f0d8-a31c-426e-9546-63f29634d004" }, "comments": "Constituent of Centella asiatica aerial parts.", "type": "PARENT->CONSTITUENT ALWAYS PRESENT", "references": [ "7c9557a4-0346-4907-bdcb-98df327636c3" ], "related_substance": { "uuid": "7fd2e54e-e6dd-486d-bcc5-3b5d1cca09d8", "refuuid": "21e8a16f-ddef-4075-8901-adc68ecfe3f2", "name": "CENTELLA ASIATICA FLOWERING TOP", "unii": "J02K2IV2PB", "linking_id": "J02K2IV2PB", "ref_pname": "CENTELLA ASIATICA FLOWERING TOP", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "46d67e26-f447-464b-9fed-fdb30ba9c0d0", "name": "ASIATICOSIDE A", "stdName": "ASIATICOSIDE A", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "82219e20-44ca-4a4b-89af-851f691642f3", "7f8780a6-8f7e-4748-b29e-a6920a0833d1" ], "display_name": false }, { "uuid": "99f3d6c1-e6bf-47c2-80ac-f6fc5687b2ba", "name": "MADECASSOSIDE", "stdName": "MADECASSOSIDE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "4288ef98-5aa9-4d7c-9d35-4328041a5b4f", "82219e20-44ca-4a4b-89af-851f691642f3", "3c04ba02-55dd-4d5b-9c88-084707f6dfdb", "7f8780a6-8f7e-4748-b29e-a6920a0833d1", "cca68477-2297-4d87-ab10-f3f22fc33bff", "06accc1b-64b9-4848-82f3-56ddf82d84c4" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "bd331809-72ee-4547-a3d2-8b1e51bf7dc9", "name_org": "INCI" } ] }, { "uuid": "3ff1e0d1-9ec4-4a44-b9fe-4b8165388dff", "name": "MADECASSOSIDE (CONSTITUENT OF CENTELLA ASIATICA) [DSC]", "stdName": "MADECASSOSIDE (CONSTITUENT OF CENTELLA ASIATICA) [DSC]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "82219e20-44ca-4a4b-89af-851f691642f3", "cc2c942f-452e-4918-ae57-be9278e24446" ], "display_name": false }, { "uuid": "1beb263e-388a-ebd9-c0cb-50a20437e467", "name": "Madecassoside [WHO-DD]", "stdName": "MADECASSOSIDE [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "36b13cdf-e05c-3ec8-0e48-3d14f03636c2" ], "display_name": false }, { "uuid": "f5485d6b-c162-445d-bbd1-cab37975067c", "name": "REDERMIC", "stdName": "REDERMIC", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "82219e20-44ca-4a4b-89af-851f691642f3", "7f8780a6-8f7e-4748-b29e-a6920a0833d1" ], "display_name": false }, { "uuid": "2af5b2ec-97b6-487b-baaf-022e2a08bb96", "name": "Urs-12-en-28-oic acid, 2,3,6,23-tetrahydroxy-, O-6-deoxy-α-L-mannopyranosyl-(1→4)-O-β-D-glucopyranosyl-(1→6)-β-D-glucopyranosyl ester, (2α,3β,4α,6β)-", "stdName": "URS-12-EN-28-OIC ACID, 2,3,6,23-TETRAHYDROXY-, O-6-DEOXY-.ALPHA.-L-MANNOPYRANOSYL-(1->4)-O-.BETA.-D-GLUCOPYRANOSYL-(1->6)-.BETA.-D-GLUCOPYRANOSYL ESTER, (2.ALPHA.,3.BETA.,4.ALPHA.,6.BETA.)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "82219e20-44ca-4a4b-89af-851f691642f3" ], "display_name": false } ], "references": [ { "uuid": "7f8780a6-8f7e-4748-b29e-a6920a0833d1", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "82219e20-44ca-4a4b-89af-851f691642f3", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "06accc1b-64b9-4848-82f3-56ddf82d84c4", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "3c04ba02-55dd-4d5b-9c88-084707f6dfdb", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "cc2c942f-452e-4918-ae57-be9278e24446", "citation": "USP-DSC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "47b24dbe-c346-4d86-90ce-760355a4eb10", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391316000, "tags": [ "NOMEN" ] }, { "uuid": "7c9557a4-0346-4907-bdcb-98df327636c3", "citation": "2015 USP DIETARY SUPPLEMENTS COMPENDIUM", "doc_type": "USP", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f30897e8-9bcf-4b28-aa0c-5290aadbf69b", "citation": "SRS import [CQ2F5O6YIY]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=CQ2F5O6YIY", "doc_type": "SRS", "public_domain": true, "document_date": 1493391316000, "tags": [ "NOMEN" ] }, { "uuid": "f4e5569d-caca-4424-854e-08afa7139ed1", "citation": "http://www.wilshiretechnologies.com/master_pdf/Madecassoside,%20CAS%2034540-22-2.pdf", "url": "http://www.wilshiretechnologies.com/master_pdf/Madecassoside,%20CAS%2034540-22-2.pdf", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4288ef98-5aa9-4d7c-9d35-4328041a5b4f", "citation": "MADECASSOSIDE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "cca68477-2297-4d87-ab10-f3f22fc33bff", "citation": "MADECASSOSIDE [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "2a59477d-09cb-6e9f-caa6-56ba16b9a8be", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "5de9ac65-7894-4904-8b69-b16bc1fc6576", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "bb439ea9-b547-2f4f-6a43-4265edb3bbce", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "36b13cdf-e05c-3ec8-0e48-3d14f03636c2", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "c8da998d-fdc6-b4b2-825f-3a8564c3945b", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true }, { "uuid": "8961f625-3b00-d4f0-c278-de4134ce4b68", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "40ec7275-2c7a-4b2b-a5df-a07ad077ae1b", "id": "40ec7275-2c7a-4b2b-a5df-a07ad077ae1b", "molfile": "\n Marvin 05062208122D \n\n 71 78 0 0 1 0 999 V2000\n 6.4302 3.4914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1446 3.9039 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4302 2.6664 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2868 5.5539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2868 2.2539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7157 6.3789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5723 3.4914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1446 2.2539 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0025 3.9039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7169 3.4914 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5735 1.4289 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 3.4914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8578 0.6040 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0025 2.2539 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8414 0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4289 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0165 0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 3.0789 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 1.4289 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7169 5.1414 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5748 3.4914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2893 3.9039 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1458 5.9664 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5748 5.1414 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0037 5.9664 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0037 7.6164 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1458 7.6164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5748 8.4414 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7157 3.9039 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 5.0013 4.3164 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 5.7157 3.0789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4302 4.3164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2868 3.9039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0013 5.1414 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 5.0013 2.6664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4302 5.1414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2868 3.0789 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 3.5723 4.3164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7157 5.5539 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 3.5723 2.6664 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 2.8578 3.9039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8578 3.0789 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 3.5723 1.8414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 2.6664 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 2.8578 1.4289 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 2.1434 1.8414 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 1.4289 3.0789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4289 1.4289 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 0.7145 2.6664 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 0.7145 1.8414 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 7.8591 3.4914 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 8.5735 3.9039 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8591 2.6664 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 9.2880 3.4914 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.5735 2.2539 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 9.2880 2.6664 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 11.4314 3.9039 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 12.1458 3.4914 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4314 4.7289 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 12.8603 3.9039 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 12.1458 5.1414 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 12.8603 4.7289 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 13.5748 5.9664 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 14.2893 6.3789 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 12.8603 6.3789 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2893 7.2039 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 12.8603 7.2039 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 13.5748 7.6164 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 5.0013 3.4914 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8578 2.2539 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 1.0165 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 3 2 0 0 0 0\n 29 1 1 1 0 0 0\n 51 2 1 6 0 0 0\n 34 4 1 1 0 0 0\n 37 5 1 6 0 0 0\n 39 6 1 6 0 0 0\n 40 7 1 1 0 0 0\n 53 8 1 1 0 0 0\n 9 10 1 0 0 0 0\n 54 9 1 6 0 0 0\n 57 10 1 1 0 0 0\n 55 11 1 6 0 0 0\n 44 12 1 1 0 0 0\n 45 13 1 1 0 0 0\n 56 14 1 1 0 0 0\n 15 16 1 0 0 0 0\n 48 15 1 6 0 0 0\n 48 17 1 1 0 0 0\n 49 18 1 6 0 0 0\n 50 19 1 1 0 0 0\n 59 20 1 6 0 0 0\n 21 22 1 0 0 0 0\n 60 21 1 1 0 0 0\n 61 23 1 1 0 0 0\n 62 24 1 6 0 0 0\n 63 24 1 6 0 0 0\n 64 25 1 1 0 0 0\n 66 26 1 1 0 0 0\n 67 27 1 1 0 0 0\n 68 28 1 6 0 0 0\n 29 30 1 0 0 0 0\n 29 31 1 0 0 0 0\n 29 32 1 0 0 0 0\n 30 33 1 0 0 0 0\n 30 34 1 0 0 0 0\n 30 69 1 1 0 0 0\n 31 35 1 0 0 0 0\n 32 36 1 0 0 0 0\n 33 37 1 0 0 0 0\n 33 38 2 0 0 0 0\n 34 39 1 0 0 0 0\n 35 37 1 0 0 0 0\n 36 39 1 0 0 0 0\n 37 40 1 0 0 0 0\n 38 41 1 0 0 0 0\n 40 42 1 0 0 0 0\n 40 43 1 0 0 0 0\n 41 42 1 0 0 0 0\n 42 44 1 0 0 0 0\n 42 70 1 6 0 0 0\n 43 45 1 0 0 0 0\n 44 46 1 0 0 0 0\n 44 47 1 0 0 0 0\n 45 46 1 0 0 0 0\n 46 48 1 0 0 0 0\n 46 71 1 6 0 0 0\n 47 49 1 0 0 0 0\n 48 50 1 0 0 0 0\n 49 50 1 0 0 0 0\n 51 52 1 0 0 0 0\n 51 53 1 0 0 0 0\n 52 54 1 0 0 0 0\n 53 55 1 0 0 0 0\n 54 56 1 0 0 0 0\n 55 56 1 0 0 0 0\n 57 58 1 0 0 0 0\n 57 59 1 0 0 0 0\n 58 60 1 0 0 0 0\n 59 61 1 0 0 0 0\n 60 62 1 0 0 0 0\n 61 62 1 0 0 0 0\n 63 64 1 0 0 0 0\n 63 65 1 0 0 0 0\n 64 66 1 0 0 0 0\n 65 67 1 0 0 0 0\n 66 68 1 0 0 0 0\n 67 68 1 0 0 0 0\nM END", "smiles": "C[C@@H]1CC[C@@]2(CC[C@]3(C)C(=CC[C@]4([H])[C@@]5(C)C[C@H]([C@@H]([C@@](C)(CO)[C@]5([H])[C@@H](C[C@]43C)O)O)O)[C@]2([H])[C@H]1C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@@H](CO[C@H]7[C@@H]([C@H]([C@@H]([C@@H](CO)O7)O[C@H]8[C@@H]([C@@H]([C@H]([C@H](C)O8)O)O)O)O)O)O6)O)O)O", "formula": "C48H78O20", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "da26c369-c467-4bce-acc2-b8a0b100d425" }, "defined_stereo": 28, "ez_centers": 0, "molecular_weight": "975.1228", "optical_activity": "UNSPECIFIED", "stereo_centers": 28 } ], "definition_level": "COMPLETE", "uuid": "7c900c34-cf2e-4b08-8b05-7a25f6b05bd3", "version": "15", "structure": { "id": "ee7bd84d-dda7-47d8-99e6-aa8dde21dd21", "molfile": "Madecassoside\n JSDraw205062208122D\n\n 71 78 0 0 1 0 0 V2000\n 29.1749 -10.9199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.5259 -10.1399 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1749 -12.4799 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 25.1220 -7.0199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.1220 -13.2599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8239 -5.4600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.7710 -10.9199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.5259 -13.2599 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 35.9298 -10.1399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.2808 -10.9199 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 33.2278 -14.8198 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 21.0690 -10.9199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.4200 -16.3798 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 35.9298 -13.2599 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 20.4981 -16.1708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.7181 -17.5219 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.9381 -16.1708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0161 -11.6999 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0161 -14.8198 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 37.2808 -7.7999 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 42.6847 -10.9199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 44.0358 -10.1399 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 39.9827 -6.2399 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 42.6847 -7.7999 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 45.3868 -6.2399 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 45.3868 -3.1200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 39.9827 -3.1200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 42.6847 -1.5600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8239 -10.1399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.4730 -9.3599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8239 -11.6999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1749 -9.3599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.1220 -10.1399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.4730 -7.7999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.4730 -12.4799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1749 -7.7999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.1220 -11.6999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.7710 -9.3599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8239 -7.0199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.7710 -12.4799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.4200 -10.1399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.4200 -11.6999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.7710 -14.0399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.0690 -12.4799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.4200 -14.8198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.0690 -14.0399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.7181 -11.6999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.7181 -14.8198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.3671 -12.4799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.3671 -14.0399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.8769 -10.9199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.2278 -10.1399 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 31.8769 -12.4799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.5788 -10.9199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.2278 -13.2599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.5788 -12.4799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 38.6318 -10.1399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 39.9827 -10.9199 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 38.6318 -8.5799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 41.3337 -10.1399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 39.9827 -7.7999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 41.3337 -8.5799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 42.6847 -6.2399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 44.0358 -5.4600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 41.3337 -5.4600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 44.0358 -3.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 41.3337 -3.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 42.6847 -3.1200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.4730 -10.9199 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 22.4200 -13.2599 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 21.0690 -15.5998 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 3 2 0 0 0 0\n 29 1 1 1 0 0 0\n 51 2 1 6 0 0 0\n 34 4 1 1 0 0 0\n 37 5 1 6 0 0 0\n 39 6 1 6 0 0 0\n 40 7 1 1 0 0 0\n 53 8 1 1 0 0 0\n 9 10 1 0 0 0 0\n 54 9 1 6 0 0 0\n 57 10 1 1 0 0 0\n 55 11 1 6 0 0 0\n 44 12 1 1 0 0 0\n 45 13 1 1 0 0 0\n 56 14 1 1 0 0 0\n 15 16 1 0 0 0 0\n 48 15 1 6 0 0 0\n 48 17 1 1 0 0 0\n 49 18 1 6 0 0 0\n 50 19 1 1 0 0 0\n 59 20 1 6 0 0 0\n 21 22 1 0 0 0 0\n 60 21 1 1 0 0 0\n 61 23 1 1 0 0 0\n 62 24 1 6 0 0 0\n 63 24 1 6 0 0 0\n 64 25 1 1 0 0 0\n 66 26 1 1 0 0 0\n 67 27 1 1 0 0 0\n 68 28 1 6 0 0 0\n 29 30 1 0 0 0 0\n 29 31 1 0 0 0 0\n 29 32 1 0 0 0 0\n 30 33 1 0 0 0 0\n 30 34 1 0 0 0 0\n 30 69 1 1 0 0 0\n 31 35 1 0 0 0 0\n 32 36 1 0 0 0 0\n 33 37 1 0 0 0 0\n 33 38 2 0 0 0 0\n 34 39 1 0 0 0 0\n 35 37 1 0 0 0 0\n 36 39 1 0 0 0 0\n 37 40 1 0 0 0 0\n 38 41 1 0 0 0 0\n 40 42 1 0 0 0 0\n 40 43 1 0 0 0 0\n 41 42 1 0 0 0 0\n 42 44 1 0 0 0 0\n 42 70 1 6 0 0 0\n 43 45 1 0 0 0 0\n 44 46 1 0 0 0 0\n 44 47 1 0 0 0 0\n 45 46 1 0 0 0 0\n 46 48 1 0 0 0 0\n 46 71 1 6 0 0 0\n 47 49 1 0 0 0 0\n 48 50 1 0 0 0 0\n 49 50 1 0 0 0 0\n 51 52 1 0 0 0 0\n 51 53 1 0 0 0 0\n 52 54 1 0 0 0 0\n 53 55 1 0 0 0 0\n 54 56 1 0 0 0 0\n 55 56 1 0 0 0 0\n 57 58 1 0 0 0 0\n 57 59 1 0 0 0 0\n 58 60 1 0 0 0 0\n 59 61 1 0 0 0 0\n 60 62 1 0 0 0 0\n 61 62 1 0 0 0 0\n 63 64 1 0 0 0 0\n 63 65 1 0 0 0 0\n 64 66 1 0 0 0 0\n 65 67 1 0 0 0 0\n 66 68 1 0 0 0 0\n 67 68 1 0 0 0 0\nM END", "smiles": "C[C@@H]1CC[C@@]2(CC[C@]3(C)C(=CC[C@]4([H])[C@@]5(C)C[C@H]([C@@H]([C@@](C)(CO)[C@]5([H])[C@@H](C[C@]43C)O)O)O)[C@]2([H])[C@H]1C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@@H](CO[C@H]7[C@@H]([C@H]([C@@H]([C@@H](CO)O7)O[C@H]8[C@@H]([C@@H]([C@H]([C@H](C)O8)O)O)O)O)O)O6)O)O)O", "formula": "C48H78O20", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 28, "ez_centers": 0, "molecular_weight": "975.1228", "optical_activity": "UNSPECIFIED", "references": [ "f4e5569d-caca-4424-854e-08afa7139ed1", "f30897e8-9bcf-4b28-aa0c-5290aadbf69b" ], "stereo_centers": 28 }, "unii": "CQ2F5O6YIY" } ] }