{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "1b709379-24e5-45b3-9288-51537a87180f", "code": "1325-86-6", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1325-86-6", "code_system": "CAS", "references": [ "22e48611-c462-4896-a503-85244fb8fcb3", "ec652a45-e563-4d6e-ae30-d4375f5b8183" ] }, { "uuid": "8f8e3fcd-be7e-45b8-8bf0-a414d815722a", "code": "215-409-1", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.014.009", "code_system": "ECHA (EC/EINECS)", "references": [ "22e48611-c462-4896-a503-85244fb8fcb3" ] }, { "uuid": "e2a6dbfc-cdf6-436e-bcac-0b1bb5835dfb", "code": "73994", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/73994", "code_system": "PUBCHEM", "references": [ "22e48611-c462-4896-a503-85244fb8fcb3" ] }, { "uuid": "a126d578-10cb-ab15-830f-e29cb924c1b5", "code": "DTXSID9061673", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9061673", "code_system": "EPA CompTox", "references": [ "a26bcce1-5c38-c37e-6602-cf43353284e9" ] }, { "uuid": "2853ea03-3b46-4407-960f-70aa6ded5fab", "code": "CPV85PH4AT", "type": "PRIMARY", "code_system": "FDA UNII", "references": [ "ec652a45-e563-4d6e-ae30-d4375f5b8183" ] } ], "substance_class": "chemical", "names": [ { "uuid": "1d31b92d-ee40-4d32-b892-6ba1a6e4b461", "name": "1-Naphthalenemethanol, α,α-bis[4-(diethylamino)phenyl]-4-(ethylamino)-", "stdName": "1-NAPHTHALENEMETHANOL, .ALPHA.,.ALPHA.-BIS(4-(DIETHYLAMINO)PHENYL)-4-(ETHYLAMINO)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "a720057b-ae85-48ed-9074-5ee5c4621931", "84147cf7-2d03-4af7-a1e8-ea8c6164982b" ], "display_name": false }, { "uuid": "bd175bdf-03f1-4609-b2c3-2dd6736f662f", "name": "Solvent Blue 5", "stdName": "SOLVENT BLUE 5", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ec652a45-e563-4d6e-ae30-d4375f5b8183" ], "display_name": true }, { "uuid": "e88cb2e3-80d6-46cd-8a83-3dd32e6cb97a", "name": "α,α-Bis[4-(diethylamino)phenyl]-4-(ethylamino)-1-naphthalenemethanol", "stdName": ".ALPHA.,.ALPHA.-BIS(4-(DIETHYLAMINO)PHENYL)-4-(ETHYLAMINO)-1-NAPHTHALENEMETHANOL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ec652a45-e563-4d6e-ae30-d4375f5b8183" ], "display_name": false } ], "references": [ { "uuid": "84147cf7-2d03-4af7-a1e8-ea8c6164982b", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a720057b-ae85-48ed-9074-5ee5c4621931", "citation": "EPA", "doc_type": "EPA", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "22e48611-c462-4896-a503-85244fb8fcb3", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393738000, "tags": [ "NOMEN" ] }, { "uuid": "a26bcce1-5c38-c37e-6602-cf43353284e9", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1325-86-6", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "ec652a45-e563-4d6e-ae30-d4375f5b8183", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "7f02bbd0-a7c6-4e1b-9e6f-4b072cda5dc7", "id": "7f02bbd0-a7c6-4e1b-9e6f-4b072cda5dc7", "molfile": "\n Marvin 01132106362D \n\n 37 40 0 0 0 0 999 V2000\n 0.4390 3.4414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8475 2.7296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6754 2.7284 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0868 2.0132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6743 1.3037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0868 0.5860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9118 0.5860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3243 1.3037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1493 1.3037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5618 2.0132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1493 2.7310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3243 2.7310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9118 2.0132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5729 -0.5565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9862 -1.2705 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8589 -0.9697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1411 -0.5572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4316 -0.9697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4316 -1.7947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1411 -2.2072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8589 -1.7947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7165 -2.2061 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7149 -3.0268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4314 -3.4414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.7915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0017 -0.9708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4298 -0.0606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1476 -0.4731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8571 -0.0606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8571 0.7644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1476 1.1769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4298 0.7644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5721 1.1758 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5738 1.9965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8573 2.4111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2887 0.7611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2870 -0.0596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 1 0 0 0 0\n 13 4 2 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 14 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 8 13 1 0 0 0 0\n 10 9 2 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 2 0 0 0 0\n 13 12 1 0 0 0 0\n 15 14 1 0 0 0 0\n 14 16 1 0 0 0 0\n 14 27 1 0 0 0 0\n 16 17 1 0 0 0 0\n 21 16 2 0 0 0 0\n 17 18 2 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 2 0 0 0 0\n 19 22 1 0 0 0 0\n 20 21 1 0 0 0 0\n 22 23 1 0 0 0 0\n 22 25 1 0 0 0 0\n 23 24 1 0 0 0 0\n 25 26 1 0 0 0 0\n 27 28 1 0 0 0 0\n 32 27 2 0 0 0 0\n 28 29 2 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 2 0 0 0 0\n 30 33 1 0 0 0 0\n 31 32 1 0 0 0 0\n 33 34 1 0 0 0 0\n 33 36 1 0 0 0 0\n 34 35 1 0 0 0 0\n 36 37 1 0 0 0 0\nM END", "smiles": "CCNc1ccc(c2ccccc21)C(c3ccc(cc3)N(CC)CC)(c4ccc(cc4)N(CC)CC)O", "formula": "C33H41N3O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "d1416155-1f32-4e37-9849-1e7849ec2373" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "495.6994", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "0b45a06e-c3e9-4495-bb39-4fce1968648b", "version": "6", "structure": { "id": "6f5ea5fe-a0ba-4358-acab-9b3ed85ea49d", "molfile": "\n JSDraw211202314392D\n\n 37 40 0 0 0 0 0 V2000\n 22.7772 -10.4698 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 21.9957 -9.1197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.6456 -9.9010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.2883 -9.1210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.9467 -9.9010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.9467 -11.4610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5945 -12.2389 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5914 -13.7908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.9463 -14.5747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2396 -11.4549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2429 -9.9031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.2883 -12.2410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.6456 -11.4610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.6160 -8.1820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.9733 -8.9620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.3149 -8.1820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.3149 -6.6220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.6669 -5.8440 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.6701 -4.2922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.3153 -3.5082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0219 -6.6282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0187 -8.1801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.9733 -5.8420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.6160 -6.6220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.7456 -6.9593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.5256 -5.6022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.7456 -4.2606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.1856 -4.2606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.4077 -2.9082 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.8422 -2.9059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0697 -1.5600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.4056 -5.6022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.1856 -6.9593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.5256 -2.9033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.0856 -2.9033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.8656 -4.2606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.0856 -5.6022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 7 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 6 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 3 2 0 0 0 0\n 2 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 18 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 17 23 2 0 0 0 0\n 23 24 1 0 0 0 0\n 24 14 2 0 0 0 0\n 2 25 1 0 0 0 0\n 25 26 2 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 2 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 28 32 1 0 0 0 0\n 32 33 2 0 0 0 0\n 33 25 1 0 0 0 0\n 27 34 1 0 0 0 0\n 34 35 2 0 0 0 0\n 35 36 1 0 0 0 0\n 36 37 2 0 0 0 0\n 37 26 1 0 0 0 0\nM END", "smiles": "CCNc1ccc(c2ccccc21)C(c3ccc(cc3)N(CC)CC)(c4ccc(cc4)N(CC)CC)O", "formula": "C33H41N3O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "495.6994", "optical_activity": "NONE", "references": [ "84147cf7-2d03-4af7-a1e8-ea8c6164982b" ], "stereo_centers": 0 }, "unii": "CPV85PH4AT" } ] }