{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "83a3ae0c-20cd-4f2f-bb4a-df296d82d51c",
          "code": "M01AE10",
          "comments": "ATC|MUSCULO-SKELETAL SYSTEM|ANTIINFLAMMATORY AND ANTIRHEUMATIC PRODUCTS|ANTIINFLAMMATORY AND ANTIRHEUMATIC PRODUCTS, NON-STEROIDS|Propionic acid derivatives|indoprofen",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=M01AE10&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "4e231a0f-d45c-45a3-b472-c4ae6d337592"
          ]
        },
        {
          "uuid": "4aa0b39c-43cc-429a-a0de-48e49b7edf20",
          "code": "QM01AE10",
          "comments": "VATC|ANTIINFLAMMATORY AND ANTIRHEUMATIC PRODUCTS|ANTIINFLAMMATORY AND ANTIRHEUMATIC PRODUCTS, NON-STEROIDS|Propionic acid derivatives|indoprofen",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QM01AE10&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "4e231a0f-d45c-45a3-b472-c4ae6d337592"
          ]
        },
        {
          "uuid": "5202f25c-bacc-4e3b-99d5-0590e52855d1",
          "code": "31842-01-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=31842-01-0",
          "code_system": "CAS",
          "references": [
            "4e231a0f-d45c-45a3-b472-c4ae6d337592",
            "1e0632c6-bedc-42e9-b790-83a5efe043d4"
          ]
        },
        {
          "uuid": "7457e95f-a2bc-40c3-9948-f834ef84a5b6",
          "code": "C83801",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C83801",
          "code_system": "NCI_THESAURUS",
          "references": [
            "4e231a0f-d45c-45a3-b472-c4ae6d337592"
          ]
        },
        {
          "uuid": "df259b7a-e2be-41e9-9b11-0054a4bd2fa5",
          "code": "D007216",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68007216",
          "code_system": "MESH",
          "references": [
            "4e231a0f-d45c-45a3-b472-c4ae6d337592"
          ]
        },
        {
          "uuid": "eae00482-8b39-4a47-b3ad-159bda464389",
          "code": "INDOPROFEN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Indoprofen",
          "code_system": "WIKIPEDIA",
          "references": [
            "4e231a0f-d45c-45a3-b472-c4ae6d337592"
          ]
        },
        {
          "uuid": "2e3626a6-43df-4ab9-8f69-3096c2973185",
          "code": "SUB08183MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "4e231a0f-d45c-45a3-b472-c4ae6d337592"
          ]
        },
        {
          "uuid": "27cd1a6e-7312-48bd-85a7-6388d4561cb4",
          "code": "3689",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=3689",
          "code_system": "INN",
          "references": [
            "4e231a0f-d45c-45a3-b472-c4ae6d337592"
          ]
        },
        {
          "uuid": "aad1b9b4-789a-4dc1-b0aa-55d0cfd6aa7d",
          "code": "250-833-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.046.197",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "4e231a0f-d45c-45a3-b472-c4ae6d337592"
          ]
        },
        {
          "uuid": "4e39ff11-8315-46ad-a1d0-ead4b852da4f",
          "code": "m771",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m771?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "4e231a0f-d45c-45a3-b472-c4ae6d337592"
          ]
        },
        {
          "uuid": "868a9d02-eaf0-46db-883a-1883cc2ec377",
          "code": "53022-60-9",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=53022-60-9",
          "code_system": "CAS",
          "references": [
            "4e231a0f-d45c-45a3-b472-c4ae6d337592",
            "cb1eb767-ac0e-4bd4-85f7-731c68cf42d8"
          ]
        },
        {
          "uuid": "dd079d57-0779-4cfd-b18d-7c1ceae8836e",
          "code": "CHEMBL15870",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL15870",
          "code_system": "ChEMBL",
          "references": [
            "4e231a0f-d45c-45a3-b472-c4ae6d337592"
          ]
        },
        {
          "uuid": "a2a39d03-e502-4c95-9c50-7397a8fe7361",
          "code": "3718",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3718",
          "code_system": "PUBCHEM",
          "references": [
            "4e231a0f-d45c-45a3-b472-c4ae6d337592"
          ]
        },
        {
          "uuid": "2b80829b-cc45-5be3-a67a-f21b93d23600",
          "code": "DTXSID5045831",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5045831",
          "code_system": "EPA CompTox",
          "references": [
            "d2509b8e-e32f-294c-d49a-05592efe7011"
          ]
        },
        {
          "uuid": "d37bff92-837a-96c9-9dd7-0a4d747dfc73",
          "code": "C257",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Analgesic Agent[C241]|Nonnarcotic Analgesic[C2198]|Analgesic and Antipyretic[C2356]|Nonsteroidal Antiinflammatory Drug",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C257",
          "code_system": "NCI_THESAURUS",
          "references": [
            "3a9fde4e-8ec5-915a-d321-3cc68cffe1f6"
          ]
        },
        {
          "uuid": "b44bcefa-a9fd-4ccd-a8bb-8b07877aa96b",
          "code": "CPE46ZU14N",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ff5fe6bc-0f4d-558f-be4f-3ef2f06f6746",
          "code": "DB08951",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB08951",
          "code_system": "DRUG BANK",
          "references": [
            "3a9fde4e-8ec5-915a-d321-3cc68cffe1f6"
          ]
        },
        {
          "uuid": "da70498d-989a-f09d-6933-6c304a32e84e",
          "code": "1442",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1442",
          "code_system": "DRUG CENTRAL",
          "references": [
            "3a9fde4e-8ec5-915a-d321-3cc68cffe1f6"
          ]
        },
        {
          "uuid": "df94b99f-c936-02c0-9032-47630e5bc443",
          "code": "76162",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:76162",
          "code_system": "CHEBI",
          "references": [
            "3a9fde4e-8ec5-915a-d321-3cc68cffe1f6"
          ]
        },
        {
          "uuid": "193a814f-e926-c85f-545b-2d323aee754f",
          "code": "100000083395",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "2cc8c9ec-e8e6-adf3-81eb-7f09a15cd074"
          ]
        },
        {
          "uuid": "8d72efc9-0697-aadc-e931-76d0c0f3acfa",
          "code": "757065",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=757065",
          "code_system": "NSC",
          "references": [
            "4e1881b5-32bf-f53f-76b5-cf3c0d28c911"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "706d2d8a-600a-4ad5-b452-957c502706f5",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "2e6a6a06-39cb-4f42-8c67-5bc5d35bef42",
            "refuuid": "f0701973-8020-443f-be27-02eb25f5e03a",
            "name": "INDOPROFEN",
            "unii": "CPE46ZU14N",
            "linking_id": "CPE46ZU14N",
            "ref_pname": "INDOPROFEN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "409f4952-2639-42d0-b736-31fb715d94e2",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "71153601-dd6e-41e3-accd-8e80394df560",
            "refuuid": "eaed2d22-9387-40b8-8197-523b60941f5e",
            "name": "DEXINDOPROFEN",
            "unii": "004T8726AU",
            "linking_id": "004T8726AU",
            "ref_pname": "DEXINDOPROFEN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "834a5ddb-d540-4c48-91de-4a0b5d1d7704",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "380b4bd4-2e0b-4c2e-8a75-af668a4aa5f0",
            "refuuid": "1d51fbc0-fa15-421c-9b43-2c532abbca8b",
            "name": "INDOPROFEN, (-)-",
            "unii": "B6NVN79HWF",
            "linking_id": "B6NVN79HWF",
            "ref_pname": "INDOPROFEN, (-)-",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ccc969bb-96d8-49a9-9a2c-0bb3213752c9",
          "name": "1-OXO-2-(P-((.ALPHA.-METHYL)CARBOXYMETHYL)PHENYL)ISOINDOLINE",
          "stdName": "1-OXO-2-(P-((.ALPHA.-METHYL)CARBOXYMETHYL)PHENYL)ISOINDOLINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "34491f6a-a4c2-451b-b90a-77e59f6455aa"
          ],
          "display_name": false
        },
        {
          "uuid": "cf482260-d1cb-4b84-85a1-18f0adf1fb68",
          "name": "2-(4-(1-CARBOXYETHYL)PHENYL)-1-ISOINDOLINONE",
          "stdName": "2-(4-(1-CARBOXYETHYL)PHENYL)-1-ISOINDOLINONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "34491f6a-a4c2-451b-b90a-77e59f6455aa"
          ],
          "display_name": false
        },
        {
          "uuid": "0294400c-be66-4908-9060-b16820e2b243",
          "name": "2-(4-(1-OXO-2-ISOINDOLINYL)PHENYL)PROPIONIC ACID",
          "stdName": "2-(4-(1-OXO-2-ISOINDOLINYL)PHENYL)PROPIONIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "34491f6a-a4c2-451b-b90a-77e59f6455aa"
          ],
          "display_name": false
        },
        {
          "uuid": "b63ce32c-e434-4874-b079-8af3c93fcbd1",
          "name": "4-(1,3-DIHYDRO-1-OXO-2H-ISOINDOL-2-YL)-.ALPHA.-METHYLBENZENEACETIC ACID",
          "stdName": "4-(1,3-DIHYDRO-1-OXO-2H-ISOINDOL-2-YL)-.ALPHA.-METHYLBENZENEACETIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "34491f6a-a4c2-451b-b90a-77e59f6455aa"
          ],
          "display_name": false
        },
        {
          "uuid": "a957a6c8-d1c2-4044-8e89-81c7a75758a0",
          "name": "BENZENEACETIC ACID, 4-(1,3-DIHYDRO-1-OXO-2H-ISOINDOL-2-YL)-.ALPHA.-METHYL-",
          "stdName": "BENZENEACETIC ACID, 4-(1,3-DIHYDRO-1-OXO-2H-ISOINDOL-2-YL)-.ALPHA.-METHYL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "75aae4d8-6a9d-40ce-a711-09a3e07b22ca"
          ],
          "display_name": false
        },
        {
          "uuid": "ab9ce573-6ee6-41bc-9847-6f3d9c82cfc5",
          "name": "BOR-IND",
          "stdName": "BOR-IND",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81641637-4b81-44b9-88cb-21774389bccd"
          ],
          "display_name": false
        },
        {
          "uuid": "b56a705b-d8d9-49ce-8ea5-644e2f542475",
          "name": "FLOSIN",
          "stdName": "FLOSIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81641637-4b81-44b9-88cb-21774389bccd"
          ],
          "display_name": false
        },
        {
          "uuid": "aad725f0-b825-4891-8e53-2b29f04f97c5",
          "name": "FLOSINT",
          "stdName": "FLOSINT",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81641637-4b81-44b9-88cb-21774389bccd"
          ],
          "display_name": false
        },
        {
          "uuid": "7bca2d9d-d13c-4dab-ab9d-4fae26245b94",
          "name": "INDOPROFEN",
          "stdName": "INDOPROFEN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d70cc4df-4e31-4286-b354-9814d518dbf9",
            "c9e89a58-16d6-4de7-b7e1-d531027e3e48",
            "75aae4d8-6a9d-40ce-a711-09a3e07b22ca",
            "7baff527-bccf-43c0-abe7-3ffd85edce26",
            "2d47fb31-4716-4664-a08b-f19b2cdebea2",
            "2a3c1806-7c95-443a-925c-63d153e3d457",
            "b5227761-cfb9-424c-acd4-dc1117c13f9e",
            "04817a18-ede3-4528-8822-fa7506d68efb",
            "2474100e-eb9f-4f40-9a3c-fd43e32c3d84",
            "37fa26df-a80f-41e3-955b-072e5274aa6a",
            "81641637-4b81-44b9-88cb-21774389bccd"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "efaffc1d-7c5d-4a7e-ac45-e2ccb180334d",
              "name_org": "INN"
            },
            {
              "uuid": "ac778c0e-1e6a-4017-a73d-0f4762187349",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "dde4aabf-8359-4072-a71f-bf645b32c1db",
          "name": "INDOPROFEN [MART.]",
          "stdName": "INDOPROFEN [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d70cc4df-4e31-4286-b354-9814d518dbf9"
          ],
          "display_name": false
        },
        {
          "uuid": "8ef81a2e-b8c1-4b51-9073-31b233632d8c",
          "name": "INDOPROFEN [MI]",
          "stdName": "INDOPROFEN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81641637-4b81-44b9-88cb-21774389bccd"
          ],
          "display_name": false
        },
        {
          "uuid": "37f1d02d-9b50-478c-b881-faed44cf59c9",
          "name": "INDOPROFEN [USAN]",
          "stdName": "INDOPROFEN [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7baff527-bccf-43c0-abe7-3ffd85edce26"
          ],
          "display_name": false
        },
        {
          "uuid": "07079b25-809b-498f-8f50-b35f16034699",
          "name": "IPP",
          "stdName": "IPP",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "34491f6a-a4c2-451b-b90a-77e59f6455aa"
          ],
          "display_name": false
        },
        {
          "uuid": "64e157e0-495b-42d6-9e4f-77c149521866",
          "name": "ISINDONE",
          "stdName": "ISINDONE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81641637-4b81-44b9-88cb-21774389bccd"
          ],
          "display_name": false
        },
        {
          "uuid": "3670be11-4c31-e17b-b644-b4cdb65aece8",
          "name": "Indoprofen [WHO-DD]",
          "stdName": "INDOPROFEN [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "784a5e23-eeec-4db0-127e-b03f280deeaa"
          ],
          "display_name": false
        },
        {
          "uuid": "afc0f80c-4a33-4c91-b83b-b3a8c54b79a4",
          "name": "K 4277",
          "stdName": "K 4277",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "75aae4d8-6a9d-40ce-a711-09a3e07b22ca"
          ],
          "display_name": false
        },
        {
          "uuid": "0dc80c62-37b4-4375-88ff-a0ace1a134e0",
          "name": "K-4277",
          "stdName": "K-4277",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "34491f6a-a4c2-451b-b90a-77e59f6455aa"
          ],
          "display_name": false
        },
        {
          "uuid": "5ad748fb-d2b6-7d66-2540-8179a3bdda3a",
          "name": "NSC-757065",
          "stdName": "NSC-757065",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4e1881b5-32bf-f53f-76b5-cf3c0d28c911"
          ],
          "display_name": false
        },
        {
          "uuid": "0b420259-ff68-4771-85be-c7de45fecc7e",
          "name": "P-(1-OXO-2-ISOINDOLINYL)HYDRATROPIC ACID",
          "stdName": "P-(1-OXO-2-ISOINDOLINYL)HYDRATROPIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "75aae4d8-6a9d-40ce-a711-09a3e07b22ca"
          ],
          "display_name": false
        },
        {
          "uuid": "88d8428b-3c8a-4dc2-9a3a-fb2b7dfb3586",
          "name": "PRAXIS",
          "stdName": "PRAXIS",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81641637-4b81-44b9-88cb-21774389bccd"
          ],
          "display_name": false
        },
        {
          "uuid": "0b6c4661-d9e5-4df6-ac02-d05d9981aa2f",
          "name": "REUMOFENE",
          "stdName": "REUMOFENE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81641637-4b81-44b9-88cb-21774389bccd"
          ],
          "display_name": false
        },
        {
          "uuid": "7b43b25e-1437-4407-9d94-75f697e8f923",
          "name": "indoprofen [INN]",
          "stdName": "INDOPROFEN [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2474100e-eb9f-4f40-9a3c-fd43e32c3d84"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "75aae4d8-6a9d-40ce-a711-09a3e07b22ca",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "34491f6a-a4c2-451b-b90a-77e59f6455aa",
          "citation": "Merck 14.3",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2474100e-eb9f-4f40-9a3c-fd43e32c3d84",
          "citation": "INN Proposed List 32",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL32.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7baff527-bccf-43c0-abe7-3ffd85edce26",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d70cc4df-4e31-4286-b354-9814d518dbf9",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "37fa26df-a80f-41e3-955b-072e5274aa6a",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "81641637-4b81-44b9-88cb-21774389bccd",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4e231a0f-d45c-45a3-b472-c4ae6d337592",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389748000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4a36bfd9-31c2-4730-b789-ca45919bed3a",
          "citation": "SRS import [CPE46ZU14N]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=CPE46ZU14N",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389748000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b5227761-cfb9-424c-acd4-dc1117c13f9e",
          "citation": "INDOPROFEN [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2a3c1806-7c95-443a-925c-63d153e3d457",
          "citation": "INDOPROFEN [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2d47fb31-4716-4664-a08b-f19b2cdebea2",
          "citation": "INDOPROFEN [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c9e89a58-16d6-4de7-b7e1-d531027e3e48",
          "citation": "INDOPROFEN [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "04817a18-ede3-4528-8822-fa7506d68efb",
          "citation": "INDOPROFEN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d2509b8e-e32f-294c-d49a-05592efe7011",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=31842-01-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3a9fde4e-8ec5-915a-d321-3cc68cffe1f6",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "cb1eb767-ac0e-4bd4-85f7-731c68cf42d8",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "1e0632c6-bedc-42e9-b790-83a5efe043d4",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "4e1881b5-32bf-f53f-76b5-cf3c0d28c911",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "784a5e23-eeec-4db0-127e-b03f280deeaa",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "2cc8c9ec-e8e6-adf3-81eb-7f09a15cd074",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e0f8e520-09d8-4c72-8cac-96419d238039",
          "id": "e0f8e520-09d8-4c72-8cac-96419d238039",
          "molfile": "\n  Marvin  01132111392D          \n\n 21 23  0  0  0  0            999 V2000\n    0.8240   -0.7233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2347   -1.4413    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    0.8240   -2.1491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.1491    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2347   -2.8620    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0793   -1.4413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4745   -2.1646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3166   -2.1491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7066   -1.4336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3166   -0.7388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4745   -0.7388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5358   -1.4336    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0291   -2.1155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8117   -1.8546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5272   -2.2653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2453   -1.8469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2453   -1.0410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5272   -0.6303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8117   -1.0255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0213   -0.7826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7682    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  6  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  3  2  0  0  0  0\n  6  7  1  0  0  0  0\n 11  6  2  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n  9 12  1  0  0  0  0\n 11 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 20 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 14 19  2  0  0  0  0\n 16 15  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 21 20  2  0  0  0  0\nM  END",
          "smiles": "CC(c1ccc(cc1)N2Cc3ccccc3C2=O)C(=O)O",
          "formula": "C17H15NO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4d5c6f42-5274-43fc-ab80-e8b3946363f6"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "281.3065",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f0701973-8020-443f-be27-02eb25f5e03a",
      "version": "17",
      "structure": {
        "id": "a2d9a528-ae6f-4ea1-b440-f8524c80f060",
        "molfile": "\n  Marvin  01132108282D          \n\n 21 23  0  0  0  0            999 V2000\n    4.5358   -1.4336    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0213   -0.7826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0291   -2.1155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8117   -1.0255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8117   -1.8546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8240   -2.1491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7066   -1.4336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7682    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2347   -1.4413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0793   -1.4413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.1491    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3166   -0.7388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3166   -2.1491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4745   -2.1646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4745   -0.7388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2347   -2.8620    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5272   -0.6303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5272   -2.2653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8240   -0.7233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2453   -1.0410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2453   -1.8469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  3  1  0  0  0  0\n  6  9  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8  2  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 14  1  0  0  0  0\n 11  6  2  0  0  0  0\n 12  7  2  0  0  0  0\n 13  7  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 12  1  0  0  0  0\n 16  6  1  0  0  0  0\n 17  4  2  0  0  0  0\n 18  5  2  0  0  0  0\n 19  9  1  0  0  0  0\n 20 17  1  0  0  0  0\n 21 18  1  0  0  0  0\n  5  4  1  0  0  0  0\n 15 10  2  0  0  0  0\n 21 20  2  0  0  0  0\nM  END",
        "smiles": "CC(c1ccc(cc1)N2Cc3ccccc3C2=O)C(=O)O",
        "formula": "C17H15NO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "281.3065",
        "optical_activity": "( + / - )",
        "references": [
          "75aae4d8-6a9d-40ce-a711-09a3e07b22ca",
          "4a36bfd9-31c2-4730-b789-ca45919bed3a",
          "2474100e-eb9f-4f40-9a3c-fd43e32c3d84"
        ],
        "stereo_centers": 1
      },
      "unii": "CPE46ZU14N"
    }
  ]
}