{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "93f1e876-769c-48a0-8994-bf1629590e4f",
          "code": "A14AA03",
          "comments": "ATC|ALIMENTARY TRACT AND METABOLISM|ANABOLIC AGENTS FOR SYSTEMIC USE|ANABOLIC STEROIDS|Androstan derivatives|metandienone",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=A14AA03&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "b70d817c-07f0-4c44-a143-7ee07baa9e84"
          ]
        },
        {
          "uuid": "9621c097-8749-4375-b7e0-c630bec1e5f3",
          "code": "D11AE01",
          "comments": "ATC|DERMATOLOGICALS|OTHER DERMATOLOGICAL PREPARATIONS|OTHER DERMATOLOGICAL PREPARATIONS|Androgens for topical use|metandienone",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=D11AE01&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "b70d817c-07f0-4c44-a143-7ee07baa9e84"
          ]
        },
        {
          "uuid": "eb3c14cf-825b-4fb9-a64f-602f9e91a5f4",
          "code": "QD11AE01",
          "comments": "VATC|OTHER DERMATOLOGICAL PREPARATIONS|OTHER DERMATOLOGICAL PREPARATIONS|Androgens for topical use|metandienone",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QD11AE01&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "b70d817c-07f0-4c44-a143-7ee07baa9e84"
          ]
        },
        {
          "uuid": "3f8d25fa-79c8-4401-b549-01e8b71ac113",
          "code": "QA14AA03",
          "comments": "VATC|ANABOLIC AGENTS FOR SYSTEMIC USE|ANABOLIC STEROIDS|Androstan derivatives|metandienone",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QA14AA03&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "b70d817c-07f0-4c44-a143-7ee07baa9e84"
          ]
        },
        {
          "uuid": "a9b20c04-8669-447b-8b22-cd3d394a547d",
          "code": "C87589",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C87589",
          "code_system": "NCI_THESAURUS",
          "references": [
            "b70d817c-07f0-4c44-a143-7ee07baa9e84"
          ]
        },
        {
          "uuid": "76a2a20d-36b0-46f3-9235-5f5ded6e3a0d",
          "code": "D008696",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68008696",
          "code_system": "MESH",
          "references": [
            "b70d817c-07f0-4c44-a143-7ee07baa9e84"
          ]
        },
        {
          "uuid": "971f8895-a0cf-468a-af6f-a766cff9b551",
          "code": "613",
          "comments": "LiverTox|HDS: Anabolic steroid|Body building|Anabolic steroid",
          "type": "PRIMARY",
          "url": "https://livertox.nlm.nih.gov/AndrogenicSteroids.htm",
          "code_system": "LIVERTOX",
          "references": [
            "b70d817c-07f0-4c44-a143-7ee07baa9e84"
          ]
        },
        {
          "uuid": "68f7676e-e4d7-4972-ab4e-7005bf0dda12",
          "code": "METHANDROSTENOLONE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Methandrostenolone",
          "code_system": "WIKIPEDIA",
          "references": [
            "b70d817c-07f0-4c44-a143-7ee07baa9e84"
          ]
        },
        {
          "uuid": "d222dddb-2b3c-4b11-ac22-957b2b4dbbfe",
          "code": "SUB08812MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "b70d817c-07f0-4c44-a143-7ee07baa9e84"
          ]
        },
        {
          "uuid": "a4d0c598-2258-4ed6-9841-bc0c903b0865",
          "code": "983",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=983",
          "code_system": "INN",
          "references": [
            "b70d817c-07f0-4c44-a143-7ee07baa9e84"
          ]
        },
        {
          "uuid": "ee5e5025-3e56-41e6-b835-54dd1f14cb90",
          "code": "200-787-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.716",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "b70d817c-07f0-4c44-a143-7ee07baa9e84"
          ]
        },
        {
          "uuid": "8cf59b66-9a99-47a3-907a-905fa9250f15",
          "code": "4000",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule III.|Anabolic Steroids",
          "type": "PRIMARY",
          "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "b70d817c-07f0-4c44-a143-7ee07baa9e84"
          ]
        },
        {
          "uuid": "edf37bd6-b7ab-478b-98fc-5b43fad44347",
          "code": "6818",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/6818/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "b70d817c-07f0-4c44-a143-7ee07baa9e84"
          ]
        },
        {
          "uuid": "14ada4bc-5f2b-4392-9a2d-47ceda5b62c4",
          "code": "72-63-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=72-63-9",
          "code_system": "CAS",
          "references": [
            "b70d817c-07f0-4c44-a143-7ee07baa9e84",
            "73a8ff4f-6ed4-4564-a38b-14301273286f"
          ]
        },
        {
          "uuid": "296851dd-9946-42c4-b899-7ffc91b351e3",
          "code": "CHEMBL1418176",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1418176",
          "code_system": "ChEMBL",
          "references": [
            "b70d817c-07f0-4c44-a143-7ee07baa9e84"
          ]
        },
        {
          "uuid": "d9ff1d62-d3fc-4eb9-9336-0737cc5250f4",
          "code": "6300",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6300",
          "code_system": "PUBCHEM",
          "references": [
            "b70d817c-07f0-4c44-a143-7ee07baa9e84"
          ]
        },
        {
          "uuid": "a76cf138-5c8d-4145-bfac-81a16b903676",
          "code": "m7293",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7293?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "b70d817c-07f0-4c44-a143-7ee07baa9e84"
          ]
        },
        {
          "uuid": "15941ad1-5a2f-c2ff-af1d-3eecaffb8da7",
          "code": "3360",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3360",
          "code_system": "HSDB",
          "references": [
            "7c4840fa-4f70-7bf7-a558-b43f8ecdeb96"
          ]
        },
        {
          "uuid": "c4d9f3fd-463d-78fc-c14e-2b6144448b52",
          "code": "DTXSID2023276",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2023276",
          "code_system": "EPA CompTox",
          "references": [
            "eb80d8d4-d1b1-0c37-f496-481fd37d5adf"
          ]
        },
        {
          "uuid": "da7dfd61-5031-9fc5-d62b-84b51370a98f",
          "code": "C2360",
          "comments": "Pharmacologic Substance[C1909]|Hormone Therapy Agent[C147908]|Therapeutic Hormone[C548]|Anabolic Steroid",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2360",
          "code_system": "NCI_THESAURUS",
          "references": [
            "e1a08056-51c0-e76f-e696-aee9348839af"
          ]
        },
        {
          "uuid": "3dcdfcf1-cbae-48c0-891e-dfd147fc62f6",
          "code": "COZ1R7EOCC",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "056bf01d-0c85-6577-1dd5-9e87716ec051",
          "code": "1734",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1734",
          "code_system": "DRUG CENTRAL",
          "references": [
            "e1a08056-51c0-e76f-e696-aee9348839af"
          ]
        },
        {
          "uuid": "a8f6eb48-d15a-7bb5-c42b-056fc63d325a",
          "code": "DB13586",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB13586",
          "code_system": "DRUG BANK",
          "references": [
            "e1a08056-51c0-e76f-e696-aee9348839af"
          ]
        },
        {
          "uuid": "acc2c19e-4c1e-7dbd-e8d8-28a07e5aa357",
          "code": "Designer-drugs-Methandrostenolone",
          "comments": "Wikipedia|List of designer drugs|Androgens|Testosterone based",
          "type": "CONCEPT",
          "url": "https://en.wikipedia.org/wiki/List_of_designer_drugs",
          "code_system": "WIKIPEDIA",
          "references": [
            "e1a08056-51c0-e76f-e696-aee9348839af"
          ]
        },
        {
          "uuid": "99437438-52d6-9269-a403-5810cad068fd",
          "code": "100000089098",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "22bc5081-7d7b-87d7-ec83-132529b73d16"
          ]
        },
        {
          "uuid": "da5c4a01-1304-4259-69df-2aaa579a2785",
          "code": "42722",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=42722",
          "code_system": "NSC",
          "references": [
            "b149bea5-a203-4665-b3db-08128f121b38"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "2af31bed-39e8-42b9-b639-a0eae83ec27f",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "c7ede13c-f79e-4380-a030-a32f8159589b",
            "refuuid": "e8e27bea-0ad9-4450-9a0f-f6c6760879b8",
            "name": "METHANDROSTENOLONE",
            "unii": "COZ1R7EOCC",
            "linking_id": "COZ1R7EOCC",
            "ref_pname": "METHANDROSTENOLONE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "6770770e-f1aa-4cd6-8dd3-9e5b83bbc58c",
          "name": "17β-Hydroxy-17-methylandrosta-1,4-dien-3-one",
          "stdName": "17.BETA.-HYDROXY-17-METHYLANDROSTA-1,4-DIEN-3-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "673983fb-eb8a-458a-9094-06aa6d91cce6",
            "6b2e32c3-eafd-42f4-88d1-12b0ffe70989"
          ],
          "display_name": false
        },
        {
          "uuid": "8096ee47-3cf4-4f58-b86b-bc1df7258e5f",
          "name": "ANDROSTA-1,4-DIENE-3-ONE, 17-HYDROXY-17-METHYL-, (17.BETA.)-",
          "stdName": "ANDROSTA-1,4-DIENE-3-ONE, 17-HYDROXY-17-METHYL-, (17.BETA.)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "673983fb-eb8a-458a-9094-06aa6d91cce6",
            "6b2e32c3-eafd-42f4-88d1-12b0ffe70989"
          ],
          "display_name": false
        },
        {
          "uuid": "c701c7f9-ca26-4795-a084-624ea866ff49",
          "name": "DIANABOL",
          "stdName": "DIANABOL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "411ba20a-84f8-4f99-b38a-1499222fc594",
            "e4b6bf06-33b1-4ca2-bfb1-e5d85411595a"
          ],
          "display_name": false
        },
        {
          "uuid": "34c9e099-7807-432a-8d42-1342ba0b7eb4",
          "name": "METANDIENONE",
          "stdName": "METANDIENONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "673983fb-eb8a-458a-9094-06aa6d91cce6",
            "fb6d074d-8998-4097-83af-72340ab91cdd",
            "00ee3903-65a9-4da9-9ada-eaa677e8f53d",
            "de9b7802-1d86-4d71-aef8-1dbd9e519fce",
            "6b2e32c3-eafd-42f4-88d1-12b0ffe70989",
            "b285e020-1b6d-4095-baa5-3281834fd2f0"
          ],
          "display_name": false,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "9ec8f302-a8a6-441c-9d5d-0285c315f1b1",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "f0c634c3-7a63-4840-96ce-817895de1184",
          "name": "METHANDIENONE",
          "stdName": "METHANDIENONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "673983fb-eb8a-458a-9094-06aa6d91cce6",
            "6b2e32c3-eafd-42f4-88d1-12b0ffe70989",
            "a5f90653-0d3b-4cd0-90fe-2a6c7cc1959c",
            "549957fc-7111-463b-9bb5-c164d2e90f5c"
          ],
          "display_name": false
        },
        {
          "uuid": "eb2c98dc-133c-436a-b00a-59c0842151be",
          "name": "METHANDIENONE [MART.]",
          "stdName": "METHANDIENONE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a5f90653-0d3b-4cd0-90fe-2a6c7cc1959c"
          ],
          "display_name": false
        },
        {
          "uuid": "9b3c1ffb-2354-4be2-bbea-fa3b647e992d",
          "name": "METHANDROSTENOLONE",
          "stdName": "METHANDROSTENOLONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "673983fb-eb8a-458a-9094-06aa6d91cce6",
            "056b9c0b-9dae-4f99-908c-edc5b59e920b",
            "40a43e3e-0c28-4f32-80b2-aab1fc5ec65b",
            "24675fd7-bd40-481b-8a51-a2213e700c6d",
            "67700e77-aebb-471b-8d30-a1347bbc5596",
            "89d81e22-71f4-471e-b082-06c5121036cb",
            "f6f197e8-0bfe-428f-a40c-11d46b9d7260",
            "908d374a-ba72-4279-81e4-8787b66cd52f"
          ],
          "display_name": true
        },
        {
          "uuid": "dbc52b8d-8e9c-43ee-b4a0-6f4fc93d74ec",
          "name": "METHANDROSTENOLONE [HSDB]",
          "stdName": "METHANDROSTENOLONE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "673983fb-eb8a-458a-9094-06aa6d91cce6",
            "89d81e22-71f4-471e-b082-06c5121036cb"
          ],
          "display_name": false
        },
        {
          "uuid": "e6b28d53-2c73-426a-a7b0-86b673e3e6db",
          "name": "METHANDROSTENOLONE [MI]",
          "stdName": "METHANDROSTENOLONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "673983fb-eb8a-458a-9094-06aa6d91cce6",
            "908d374a-ba72-4279-81e4-8787b66cd52f"
          ],
          "display_name": false
        },
        {
          "uuid": "c32c9785-11aa-42f6-9916-d47c41d5b740",
          "name": "METHANDROSTENOLONE [VANDF]",
          "stdName": "METHANDROSTENOLONE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "673983fb-eb8a-458a-9094-06aa6d91cce6",
            "24675fd7-bd40-481b-8a51-a2213e700c6d"
          ],
          "display_name": false
        },
        {
          "uuid": "604ad027-e395-32f4-fa66-cf79829dcad0",
          "name": "Metandienone [WHO-DD]",
          "stdName": "METANDIENONE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de9b706c-1fd5-68fd-c3e6-8d85eb44aa45"
          ],
          "display_name": false
        },
        {
          "uuid": "e52b4cd8-a60b-4b47-a609-daa1b0c888d2",
          "name": "NEROBOL",
          "stdName": "NEROBOL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "673983fb-eb8a-458a-9094-06aa6d91cce6",
            "d88f0dd3-7e3c-4309-b7ed-01cecd08e59e"
          ],
          "display_name": false
        },
        {
          "uuid": "613ec504-122c-487d-b237-a31a32130903",
          "name": "NSC-42722",
          "stdName": "NSC-42722",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "673983fb-eb8a-458a-9094-06aa6d91cce6",
            "6b2e32c3-eafd-42f4-88d1-12b0ffe70989"
          ],
          "display_name": false
        },
        {
          "uuid": "778585f7-c4f9-49ce-9923-0cc8a6260ec6",
          "name": "PERBOLIN",
          "stdName": "PERBOLIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "673983fb-eb8a-458a-9094-06aa6d91cce6",
            "d88f0dd3-7e3c-4309-b7ed-01cecd08e59e"
          ],
          "display_name": false
        },
        {
          "uuid": "226940ba-0934-4f41-8148-d3426c88cf6f",
          "name": "metandienone [INN]",
          "stdName": "METANDIENONE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fb6d074d-8998-4097-83af-72340ab91cdd",
            "7006d486-79eb-4fda-82cb-38c29b16132c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "40a43e3e-0c28-4f32-80b2-aab1fc5ec65b",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "6b2e32c3-eafd-42f4-88d1-12b0ffe70989",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "673983fb-eb8a-458a-9094-06aa6d91cce6",
          "citation": "INN",
          "doc_type": "INN",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fb6d074d-8998-4097-83af-72340ab91cdd",
          "citation": "INN 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a5f90653-0d3b-4cd0-90fe-2a6c7cc1959c",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "908d374a-ba72-4279-81e4-8787b66cd52f",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "411ba20a-84f8-4f99-b38a-1499222fc594",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e4b6bf06-33b1-4ca2-bfb1-e5d85411595a",
          "citation": "D00389",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "89d81e22-71f4-471e-b082-06c5121036cb",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "de9b7802-1d86-4d71-aef8-1dbd9e519fce",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "24675fd7-bd40-481b-8a51-a2213e700c6d",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d88f0dd3-7e3c-4309-b7ed-01cecd08e59e",
          "citation": "dea list",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b70d817c-07f0-4c44-a143-7ee07baa9e84",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389662000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7d32c81d-1b2f-4172-9faf-8c447c72099a",
          "citation": "SRS import [COZ1R7EOCC]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=COZ1R7EOCC",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389662000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "549957fc-7111-463b-9bb5-c164d2e90f5c",
          "citation": "METHANDIENONE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f6f197e8-0bfe-428f-a40c-11d46b9d7260",
          "citation": "METHANDROSTENOLONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "056b9c0b-9dae-4f99-908c-edc5b59e920b",
          "citation": "METHANDROSTENOLONE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b285e020-1b6d-4095-baa5-3281834fd2f0",
          "citation": "METANDIENONE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "67700e77-aebb-471b-8d30-a1347bbc5596",
          "citation": "METHANDROSTENOLONE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "00ee3903-65a9-4da9-9ada-eaa677e8f53d",
          "citation": "METANDIENONE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7c4840fa-4f70-7bf7-a558-b43f8ecdeb96",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+72-63-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "eb80d8d4-d1b1-0c37-f496-481fd37d5adf",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=72-63-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e1a08056-51c0-e76f-e696-aee9348839af",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "73a8ff4f-6ed4-4564-a38b-14301273286f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "7006d486-79eb-4fda-82cb-38c29b16132c",
          "citation": "INN Proposed List 12",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL12.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "de9b706c-1fd5-68fd-c3e6-8d85eb44aa45",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "b149bea5-a203-4665-b3db-08128f121b38",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "22bc5081-7d7b-87d7-ec83-132529b73d16",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "2bc613fa-53bc-4052-93bc-60ed74dc58a1",
          "id": "2bc613fa-53bc-4052-93bc-60ed74dc58a1",
          "molfile": "\n  Marvin  01132102222D          \n\n 22 25  0  0  1  0            999 V2000\n    5.0653   -2.2793    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.8603   -2.5417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3387   -1.8857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8603   -1.2143    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.8525   -0.4193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8867   -1.2065    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0653   -1.4767    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.0653   -0.6637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3553   -1.0522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6504   -1.4767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6504   -2.2793    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    4.3553   -2.7038    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    4.3553   -3.5295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6504   -3.9386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9430   -3.5295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2150   -3.9386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4921   -3.5295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7821   -3.9386    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4921   -2.7038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2150   -2.2793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9430   -2.7038    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    2.9430   -1.8857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  7  1  0  0  0  0\n 12  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  1  0  0  0\n  7  4  1  0  0  0  0\n  7  8  1  1  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  1  1  0  0  0\n 12 11  1  0  0  0  0\n 11 21  1  0  0  0  0\n 12 13  1  6  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  2  0  0  0  0\n 21 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  2  0  0  0  0\n 17 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 21 20  1  0  0  0  0\n 21 22  1  1  0  0  0\nM  END",
          "smiles": "C[C@@]12C=CC(=O)C=C2CC[C@@H]3[C@@H]1CC[C@@]4(C)[C@H]3CC[C@]4(C)O",
          "formula": "C20H28O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "88365b90-492c-41bf-a23a-7bf328bfb99a"
          },
          "defined_stereo": 6,
          "ez_centers": 0,
          "molecular_weight": "300.4359",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 6
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e8e27bea-0ad9-4450-9a0f-f6c6760879b8",
      "version": "16",
      "structure": {
        "id": "0e91d44c-a861-45e4-bdb1-bf434f3c871d",
        "molfile": "\n  Marvin  01132101002D          \n\n 25 28  0  0  1  0            999 V2000\n    2.9430   -2.7038    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.0653   -1.4767    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.9430   -3.5295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6504   -2.2793    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.0653   -2.2793    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.3553   -2.7038    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.2150   -2.2793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2150   -3.9386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8603   -1.2143    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.3553   -1.0522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6504   -1.4767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3553   -3.5295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8603   -2.5417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4921   -2.7038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4921   -3.5295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6504   -3.9386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3387   -1.8857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7821   -3.9386    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8867   -1.2065    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9430   -1.8857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0653   -0.6637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8525   -0.4193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6504   -2.9739    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0653   -2.9970    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3553   -1.8754    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2 10  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  4  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8  3  2  0  0  0  0\n  9  2  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11  4  1  0  0  0  0\n 12  6  1  0  0  0  0\n 13  5  1  0  0  0  0\n 14  7  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16  3  1  0  0  0  0\n 17 13  1  0  0  0  0\n 18 15  2  0  0  0  0\n  9 19  1  1  0  0  0\n  1 20  1  1  0  0  0\n  2 21  1  1  0  0  0\n  9 22  1  6  0  0  0\n  4 23  1  6  0  0  0\n  5 24  1  6  0  0  0\n  6 25  1  1  0  0  0\n 16 12  1  0  0  0  0\n 15  8  1  0  0  0  0\n  5  2  1  0  0  0  0\n 17  9  1  0  0  0  0\nM  END",
        "smiles": "C[C@@]12C=CC(=O)C=C2CC[C@]3([H])[C@]1([H])CC[C@@]4(C)[C@@]3([H])CC[C@]4(C)O",
        "formula": "C20H28O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 6,
        "ez_centers": 0,
        "molecular_weight": "300.4359",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "40a43e3e-0c28-4f32-80b2-aab1fc5ec65b",
          "7d32c81d-1b2f-4172-9faf-8c447c72099a",
          "7006d486-79eb-4fda-82cb-38c29b16132c"
        ],
        "stereo_centers": 6
      },
      "unii": "COZ1R7EOCC"
    }
  ]
}