{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "4d9f80c4-2e29-4503-a8f3-08f32adfe305", "code": "187951-30-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=187951-30-0", "code_system": "CAS", "references": [ "478a82ea-970e-4b07-a186-e043538b182a", "a064f6c4-13e7-407a-b3e5-4255ab09925d" ] }, { "uuid": "36901e96-476d-425b-80f5-f45ff36c2e42", "code": "72941748", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/72941748", "code_system": "PUBCHEM", "references": [ "478a82ea-970e-4b07-a186-e043538b182a" ] }, { "uuid": "d85243d9-3765-436e-97a7-88007064d9b0", "code": "CN772MJ74V", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "822adec6-0f12-cdab-c223-92f26c8ac7d0", "code": "DTXSID001021390", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID001021390", "code_system": "EPA CompTox" } ], "substance_class": "chemical", "names": [ { "uuid": "40d4b470-d5c2-42c7-a896-df02878fe547", "name": "(±)-ISOTETRADECYL IPDI", "stdName": "(+/-)-ISOTETRADECYL IPDI", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4e6791d0-b71b-4c74-ba8b-cd19da57cacd", "8855b010-5605-4267-8854-36c0311ff706" ], "display_name": false }, { "uuid": "39d91ecc-abc7-49ac-b148-6c0c0adb0d59", "name": "CARBAMIC ACID, (3-((((ISOTETRADECYLOXYL)CARBONYL)AMINO)METHYL)-3,5,5-TRIMETHYLCYCLOHEXYL)- ISOTETRADECYL ESTER", "stdName": "CARBAMIC ACID, (3-((((ISOTETRADECYLOXYL)CARBONYL)AMINO)METHYL)-3,5,5-TRIMETHYLCYCLOHEXYL)- ISOTETRADECYL ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8855b010-5605-4267-8854-36c0311ff706", "fa8bcc37-6e39-4064-95d0-a1f14cb8cbcb" ], "display_name": false }, { "uuid": "abf148c5-987b-496e-9233-a703ea41fcb9", "name": "DIBUTYLDECYL IPDI", "stdName": "DIBUTYLDECYL IPDI", "type": "of", "languages": [ "en" ], "preferred": true, "references": [ "8855b010-5605-4267-8854-36c0311ff706", "82bf8d09-25ad-4da9-8c2c-429786dd9ede", "fa8bcc37-6e39-4064-95d0-a1f14cb8cbcb" ], "display_name": false, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "518206e0-2787-4b2b-a269-7f0ddf8f8cf4", "name_org": "INCI" } ] }, { "uuid": "7b6fbabd-139c-4fe9-853f-24882c2e108b", "name": "DIBUTYLDECYL ISOPHORONE DIISOCYANATE", "stdName": "DIBUTYLDECYL ISOPHORONE DIISOCYANATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4e6791d0-b71b-4c74-ba8b-cd19da57cacd", "8855b010-5605-4267-8854-36c0311ff706" ], "display_name": true }, { "uuid": "aa179b3e-24d1-403f-89a7-63881893ae5b", "name": "ISOTETRADECYL IPDI", "stdName": "ISOTETRADECYL IPDI", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4e6791d0-b71b-4c74-ba8b-cd19da57cacd", "8855b010-5605-4267-8854-36c0311ff706" ], "display_name": false }, { "uuid": "df12a61c-e72e-4add-a6ec-6f514e960bdc", "name": "ISOTETRADECYL IPDI, (±)-", "stdName": "ISOTETRADECYL IPDI, (+/-)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4e6791d0-b71b-4c74-ba8b-cd19da57cacd", "8855b010-5605-4267-8854-36c0311ff706" ], "display_name": false }, { "uuid": "1d44b107-07d1-40f4-8027-228baef2f849", "name": "MONODERM I-14", "stdName": "MONODERM I-14", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "8855b010-5605-4267-8854-36c0311ff706", "fa8bcc37-6e39-4064-95d0-a1f14cb8cbcb" ], "display_name": false } ], "references": [ { "uuid": "fa8bcc37-6e39-4064-95d0-a1f14cb8cbcb", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "8855b010-5605-4267-8854-36c0311ff706", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4e6791d0-b71b-4c74-ba8b-cd19da57cacd", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "478a82ea-970e-4b07-a186-e043538b182a", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391635000, "tags": [ "NOMEN" ] }, { "uuid": "8864417b-5107-4596-82b2-a3cab75bb040", "citation": "SRS import [CN772MJ74V]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=CN772MJ74V", "doc_type": "SRS", "public_domain": true, "document_date": 1493391635000, "tags": [ "NOMEN" ] }, { "uuid": "30c345e4-fdec-4950-a0bc-c7da14fa1bed", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "82bf8d09-25ad-4da9-8c2c-429786dd9ede", "citation": "DIBUTYLDECYL IPDI [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "a064f6c4-13e7-407a-b3e5-4255ab09925d", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "6cb97bc6-a615-409c-8a9a-be9a32051000", "id": "6cb97bc6-a615-409c-8a9a-be9a32051000", "molfile": "\n Marvin 01132105392D \n\n 46 46 0 0 0 0 999 V2000\n 6.6313 -14.9835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4281 -14.7699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0115 -15.3533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8084 -15.1397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3917 -15.7231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2167 -15.7231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6292 -16.4376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4542 -16.4376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8668 -17.1521 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 11.4542 -17.8665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6292 -17.8665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2167 -18.5810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3917 -18.5810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6918 -17.1521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1042 -17.8665 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9292 -17.8665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3418 -17.1520 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3418 -18.5810 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9292 -19.2954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3418 -20.0099 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 13.5665 -20.2921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9738 -19.4796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7490 -19.7618 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 15.8922 -20.5742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2603 -21.1045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8477 -21.8190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8922 -21.6348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4850 -20.8224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3810 -19.2315 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1562 -19.5136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.2995 -20.3261 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.7882 -18.9833 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.5634 -19.2655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.1954 -18.7352 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 19.0521 -17.9227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.2769 -17.6406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.1336 -16.8281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3584 -16.5460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.9707 -19.0174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.6027 -18.4871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.3779 -18.7693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.0099 -18.2390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.7243 -18.6514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.4388 -18.2390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.1533 -18.6514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.8677 -18.2390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 9 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 14 9 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 13 12 1 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 16 17 2 0 0 0 0\n 18 16 1 0 0 0 0\n 19 18 1 0 0 0 0\n 20 19 1 0 0 0 0\n 20 21 1 0 0 0 0\n 20 22 1 0 0 0 0\n 28 20 1 0 0 0 0\n 23 22 1 0 0 0 0\n 23 24 1 0 0 0 0\n 23 29 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 25 27 1 0 0 0 0\n 25 28 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 2 0 0 0 0\n 30 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 33 34 1 0 0 0 0\n 34 35 1 0 0 0 0\n 34 39 1 0 0 0 0\n 35 36 1 0 0 0 0\n 36 37 1 0 0 0 0\n 38 37 1 0 0 0 0\n 40 39 1 0 0 0 0\n 40 41 1 0 0 0 0\n 41 42 1 0 0 0 0\n 42 43 1 0 0 0 0\n 43 44 1 0 0 0 0\n 44 45 1 0 0 0 0\n 45 46 1 0 0 0 0\nM END", "smiles": "CCCCCCCCC(CCCC)COC(=O)NCC1(C)CC(CC(C)(C)C1)NC(=O)OCC(CCCC)CCCCCCCC", "formula": "C40H78N2O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "4e31582e-2332-4f19-ba31-473479aa68e1" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "651.0598", "optical_activity": "UNSPECIFIED", "stereo_centers": 4 } ], "definition_level": "REPRESENTATIVE", "uuid": "4f6f745c-be4e-4092-9cc1-0a109c1625ad", "version": "4", "structure": { "id": "218e4b09-fc4e-4268-8a35-6270b53abe4a", "molfile": "\n Marvin 01132101542D \n\n 46 46 0 0 0 0 999 V2000\n 10.6292 -16.4376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4542 -16.4376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8668 -17.1521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4542 -17.8665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6292 -17.8665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6918 -17.1521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1042 -17.8665 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9292 -17.8665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3418 -18.5810 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9292 -19.2954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3418 -20.0099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9738 -19.4796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7490 -19.7618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3810 -19.2315 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1562 -19.5136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.2995 -20.3261 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.7882 -18.9833 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.5634 -19.2655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.1954 -18.7352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.0521 -17.9227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.2769 -17.6406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.9707 -19.0174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.6027 -18.4871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.3779 -18.7693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.0099 -18.2390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8922 -20.5742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2603 -21.1045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8477 -21.8190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8922 -21.6348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4850 -20.8224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5665 -20.2921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3418 -17.1520 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2167 -15.7231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3917 -15.7231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3584 -16.5460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.1336 -16.8281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3917 -18.5810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2167 -18.5810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8084 -15.1397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0115 -15.3533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4281 -14.7699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6313 -14.9835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.7243 -18.6514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.4388 -18.2390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.1533 -18.6514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.8677 -18.2390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 6 3 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 13 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 15 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 19 22 1 0 0 0 0\n 23 22 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 13 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 27 29 1 0 0 0 0\n 27 30 1 0 0 0 0\n 30 11 1 0 0 0 0\n 11 31 1 0 0 0 0\n 8 32 2 0 0 0 0\n 1 33 1 0 0 0 0\n 33 34 1 0 0 0 0\n 35 36 1 0 0 0 0\n 21 36 1 0 0 0 0\n 37 38 1 0 0 0 0\n 5 38 1 0 0 0 0\n 34 39 1 0 0 0 0\n 39 40 1 0 0 0 0\n 40 41 1 0 0 0 0\n 41 42 1 0 0 0 0\n 25 43 1 0 0 0 0\n 43 44 1 0 0 0 0\n 44 45 1 0 0 0 0\n 45 46 1 0 0 0 0\nM END", "smiles": "CCCCCCCCC(CCCC)COC(=O)NCC1(C)CC(CC(C)(C)C1)NC(=O)OCC(CCCC)CCCCCCCC", "formula": "C40H78N2O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "651.0598", "optical_activity": "UNSPECIFIED", "references": [ "8864417b-5107-4596-82b2-a3cab75bb040", "30c345e4-fdec-4950-a0bc-c7da14fa1bed" ], "stereo_centers": 4 }, "unii": "CN772MJ74V" } ] }