{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "4114067e-8779-404d-8180-4eabd9bf10ab",
          "code": "145-39-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=145-39-1",
          "code_system": "CAS",
          "references": [
            "fd6c9f84-b1d8-460c-bf5b-40b5d8016f7d",
            "f3022483-6882-40c7-bebb-038d66434186"
          ]
        },
        {
          "uuid": "f938f208-0a18-417a-8f13-0e41cb9da3fa",
          "code": "205-651-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.005.138",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "fd6c9f84-b1d8-460c-bf5b-40b5d8016f7d"
          ]
        },
        {
          "uuid": "d0c1a863-43b5-47d1-8c8c-7a188660abfd",
          "code": "67350",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/67350",
          "code_system": "PUBCHEM",
          "references": [
            "fd6c9f84-b1d8-460c-bf5b-40b5d8016f7d"
          ]
        },
        {
          "uuid": "5d710cc7-03ab-cb8e-56db-c655678521c7",
          "code": "DTXSID9044582",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9044582",
          "code_system": "EPA CompTox",
          "references": [
            "d4e28330-36d4-cf65-cdd9-1e6428eb957c"
          ]
        },
        {
          "uuid": "1a2c2ec1-89b6-403d-ba2e-c96a769f91ad",
          "code": "CMN65165X5",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "074dce5e-cbc9-2d4e-8d25-50c22c17b6cf",
          "code": "78470",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=78470",
          "code_system": "NSC",
          "references": [
            "4a153082-c2b0-66f5-780c-b7fc0caaa25f"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "366d0069-ed6c-47e0-8599-1302461fe188",
          "name": "1-TERT-BUTYL-2,6-DINITRO-3,4,5-TRIMETHYLBENZENE",
          "stdName": "1-TERT-BUTYL-2,6-DINITRO-3,4,5-TRIMETHYLBENZENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3d267d94-5cee-440f-a99d-eac8c55e8723",
            "e9b50766-d792-4922-bcc5-b45568111ab3"
          ],
          "display_name": true
        },
        {
          "uuid": "ca923da3-8209-4d99-8396-ec656a09fbf7",
          "name": "1-TERT-BUTYL-3,4,5-TRIMETHYL-2,6-DINITROBENZENE",
          "stdName": "1-TERT-BUTYL-3,4,5-TRIMETHYL-2,6-DINITROBENZENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3d267d94-5cee-440f-a99d-eac8c55e8723",
            "e9b50766-d792-4922-bcc5-b45568111ab3"
          ],
          "display_name": false
        },
        {
          "uuid": "a066bbe8-089d-4fda-9ed6-df9f799cdd07",
          "name": "2,6-DINITRO-3,4,5-TRIMETHYL-TERT-BUTYLBENZENE",
          "stdName": "2,6-DINITRO-3,4,5-TRIMETHYL-TERT-BUTYLBENZENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3d267d94-5cee-440f-a99d-eac8c55e8723",
            "e9b50766-d792-4922-bcc5-b45568111ab3"
          ],
          "display_name": false
        },
        {
          "uuid": "634a22f9-a03b-4a3e-95b8-28280658d91e",
          "name": "5-TERT-BUTYL-1,2,3-TRIMETHYL-4,6-DINITROBENZENE",
          "stdName": "5-TERT-BUTYL-1,2,3-TRIMETHYL-4,6-DINITROBENZENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6a2eba9f-b9fc-4a92-8933-3f5fff82a5d3",
            "e9b50766-d792-4922-bcc5-b45568111ab3"
          ],
          "display_name": false
        },
        {
          "uuid": "3516c8e5-de8a-4e47-b527-9b2845384062",
          "name": "BENZENE, 1-(1,1-DIMETHYLETHYL)-3,4,5-TRIMETHYL-2,6-DINITRO-",
          "stdName": "BENZENE, 1-(1,1-DIMETHYLETHYL)-3,4,5-TRIMETHYL-2,6-DINITRO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3d267d94-5cee-440f-a99d-eac8c55e8723",
            "e9b50766-d792-4922-bcc5-b45568111ab3"
          ],
          "display_name": false
        },
        {
          "uuid": "30c21d1e-c0de-43ea-bd87-cdf144a7622c",
          "name": "BENZENE, 1-TERT-BUTYL-3,4,5-TRIMETHYL-2,6-DINITRO-",
          "stdName": "BENZENE, 1-TERT-BUTYL-3,4,5-TRIMETHYL-2,6-DINITRO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3d267d94-5cee-440f-a99d-eac8c55e8723",
            "e9b50766-d792-4922-bcc5-b45568111ab3"
          ],
          "display_name": false
        },
        {
          "uuid": "cafe1444-5d07-43fc-999b-ff72d0f0fb05",
          "name": "NSC-78470",
          "stdName": "NSC-78470",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3d267d94-5cee-440f-a99d-eac8c55e8723",
            "e9b50766-d792-4922-bcc5-b45568111ab3"
          ],
          "display_name": false
        },
        {
          "uuid": "0e1b786a-4138-4827-afe0-f27db8ea110b",
          "name": "TIBETENE MUSK",
          "stdName": "TIBETENE MUSK",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3d267d94-5cee-440f-a99d-eac8c55e8723",
            "e9b50766-d792-4922-bcc5-b45568111ab3"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "3d267d94-5cee-440f-a99d-eac8c55e8723",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e9b50766-d792-4922-bcc5-b45568111ab3",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6a2eba9f-b9fc-4a92-8933-3f5fff82a5d3",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fd6c9f84-b1d8-460c-bf5b-40b5d8016f7d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391027000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7cb8caa1-5cdb-4c81-bcc0-ba70fe6371f1",
          "citation": "SRS import [CMN65165X5]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=CMN65165X5",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391027000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "284e0b14-0407-406d-95d9-eed2fd30ced9",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d4e28330-36d4-cf65-cdd9-1e6428eb957c",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=145-39-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f3022483-6882-40c7-bebb-038d66434186",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "4a153082-c2b0-66f5-780c-b7fc0caaa25f",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "6a663b90-7506-4225-8f73-69a858dc730c",
          "id": "6a663b90-7506-4225-8f73-69a858dc730c",
          "molfile": "\n  Marvin  01132105322D          \n\n 19 19  0  0  0  0            999 V2000\n    7.5954   -6.1622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5954   -5.3380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3088   -4.9237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0269   -5.3380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3088   -4.0995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5954   -3.6896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8819   -4.0995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8819   -4.9237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1685   -5.3380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1685   -3.6896    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    5.4550   -4.0995    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.1685   -2.8654    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5608   -2.3459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8473   -1.9315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5608   -1.5171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2741   -1.9315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0269   -3.6896    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    9.0269   -2.8654    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    9.7404   -4.0995    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  8  2  2  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n 17  5  1  0  0  0  0\n  6  7  2  0  0  0  0\n  6 13  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 10  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  2  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 13 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 17 19  2  0  0  0  0\nM  CHG  4  10   1  11  -1  17   1  18  -1\nM  END",
          "smiles": "Cc1c(C)c(c(c(c1C)[N+](=O)[O-])C(C)(C)C)[N+](=O)[O-]",
          "formula": "C13H18N2O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "80f186d3-52e6-44f5-be54-bd97dd41d1d4"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "266.2935",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "104f0b29-671e-4cca-80db-7f43078acea7",
      "version": "4",
      "structure": {
        "id": "6fa64dc9-973f-426c-b96f-6c907d9b4437",
        "molfile": "\n  Marvin  01132105482D          \n\n 19 19  0  0  0  0            999 V2000\n    9.0269   -2.8654    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    9.0269   -3.6896    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    9.7404   -4.0995    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3088   -4.0995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5954   -3.6896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8819   -4.0995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1685   -3.6896    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    5.4550   -4.0995    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.1685   -2.8654    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8819   -4.9237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5954   -5.3380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5954   -6.1622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3088   -4.9237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0269   -5.3380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1685   -5.3380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5608   -2.3459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8473   -1.9315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5608   -1.5171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2741   -1.9315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  2  0  0  0  0\n  6 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 13  4  2  0  0  0  0\n 13 14  1  0  0  0  0\n 10 15  1  0  0  0  0\n  5 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 16 19  1  0  0  0  0\nM  CHG  4   1  -1   2   1   7   1   8  -1\nM  END",
        "smiles": "Cc1c(C)c(c(c(c1C)[N+](=O)[O-])C(C)(C)C)[N+](=O)[O-]",
        "formula": "C13H18N2O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "266.2935",
        "optical_activity": "NONE",
        "references": [
          "284e0b14-0407-406d-95d9-eed2fd30ced9",
          "7cb8caa1-5cdb-4c81-bcc0-ba70fe6371f1"
        ],
        "stereo_centers": 0
      },
      "unii": "CMN65165X5"
    }
  ]
}