{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9bf7d403-7f7b-452e-b3d9-0414ae952831",
          "code": "126-45-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=126-45-4",
          "code_system": "CAS",
          "references": [
            "34665eee-2470-45ae-809b-caf425fb1786",
            "a9bbf43b-24d9-45d7-a584-e43f4e1fa546"
          ]
        },
        {
          "uuid": "7da956c9-990a-45f4-916a-0fe075c0d9a9",
          "code": "21 CFR 310.548",
          "comments": "PART 310 -- NEW DRUGS|Subpart E--Requirements for Specific New Drugs or Devices|Sec. 310.548 Drug products containing colloidal silver ingredients or silver salts offered over-the-counter (OTC) for the treatment and/or prevention of disease.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=310.548",
          "code_system": "CFR",
          "references": [
            "34665eee-2470-45ae-809b-caf425fb1786"
          ]
        },
        {
          "uuid": "1f412db6-094b-43f1-b8ca-7f415ce5478b",
          "code": "204-786-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.004.352",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "34665eee-2470-45ae-809b-caf425fb1786"
          ]
        },
        {
          "uuid": "310e8fdd-63e4-4182-b0ae-e0a900fdba1c",
          "code": "1306066",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1306066/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "34665eee-2470-45ae-809b-caf425fb1786"
          ]
        },
        {
          "uuid": "b911fb34-8bd5-4d79-b2d4-c7eb2c29414c",
          "code": "m9920",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9920?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "34665eee-2470-45ae-809b-caf425fb1786"
          ]
        },
        {
          "uuid": "7e642239-085b-4e60-8acf-46018ab048cb",
          "code": "101599",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/101599",
          "code_system": "PUBCHEM",
          "references": [
            "34665eee-2470-45ae-809b-caf425fb1786"
          ]
        },
        {
          "uuid": "b6a773c8-e036-f45d-b8c5-8560a7c96376",
          "code": "DB11233",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB11233",
          "code_system": "DRUG BANK",
          "references": [
            "c8ed2522-9b74-dde5-99e3-717749eb8f4a"
          ]
        },
        {
          "uuid": "8ba1d37b-618b-446b-a1e8-f7f88f1a3b31",
          "code": "CKA421A1J7",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "54ef3d97-e8a7-f9bf-4317-c9d313a0641f",
          "code": "DTXSID70889420",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70889420",
          "code_system": "EPA CompTox",
          "references": [
            "c8ed2522-9b74-dde5-99e3-717749eb8f4a"
          ]
        },
        {
          "uuid": "354d4052-b92d-7f03-f957-10d500caede6",
          "code": "CKA421A1J7",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=CKA421A1J7",
          "code_system": "DAILYMED",
          "references": [
            "f39afe01-f4c1-bcf1-6e73-7b28b8a85a8e"
          ]
        },
        {
          "uuid": "cd16e609-5f16-a903-61ff-fa46c971c12c",
          "code": "100000182572",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "063eab64-6b37-9d3e-8bea-5157ac9855bc"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "9229b599-8a08-4666-a0ca-0a9e6955991e",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "3ee57b18-a8b5-45b2-8db4-cbdf1e159bff",
            "refuuid": "9fd85cb2-08ca-4599-84b6-eac7dd33199c",
            "name": "SILVER CATION",
            "unii": "57N7B0K90A",
            "linking_id": "57N7B0K90A",
            "ref_pname": "SILVER CATION",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c9fe7cd8-36b4-4a4d-af78-92e4d1e6a500",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "11b23e91-a666-48ab-8432-e13de65b7db8",
            "refuuid": "7495c063-0afe-4404-b6dc-1327ce06fa4e",
            "name": "Anhydrous citric acid",
            "unii": "XF417D3PSL",
            "linking_id": "XF417D3PSL",
            "ref_pname": "Anhydrous citric acid",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "69aaa545-c72f-4f3e-a3d9-458be6d2f110",
          "name": "1,2,3-PROPANETRICARBOXYLIC ACID, 2-HYDROXY-, SILVER(1+) SALT (1:3)",
          "stdName": "1,2,3-PROPANETRICARBOXYLIC ACID, 2-HYDROXY-, SILVER(1+) SALT (1:3)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "31c622a4-10a7-421c-a09d-1eb908fba7c4",
            "851a83c5-88b1-43a9-a330-6e8fc8d20afb"
          ],
          "display_name": false
        },
        {
          "uuid": "6590c15b-f5b1-4a2f-9c6f-cbad3e48ccfb",
          "name": "2-HYDROXY-1,2,3-PROPANETRICARBOXYLIC ACID SILVER SALT",
          "stdName": "2-HYDROXY-1,2,3-PROPANETRICARBOXYLIC ACID SILVER SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "851a83c5-88b1-43a9-a330-6e8fc8d20afb",
            "f2d33f45-bddf-4bc9-8d71-3fbf395ea4da"
          ],
          "display_name": false
        },
        {
          "uuid": "df38b45a-757a-4d57-96fe-a6c2e87a8452",
          "name": "SILVER CITRATE",
          "stdName": "SILVER CITRATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "555f17db-93bf-4419-ac3a-982ad1884311",
            "4868240d-d95d-4d3d-94af-a38f60b298f3",
            "5e672ed2-558a-47f1-8e69-54313a0831d4",
            "b556bb5d-7425-4a2e-9add-b8b78194f9d5",
            "0c4bab0d-785a-460c-80db-2c0aa477abfd",
            "a7ea517c-3262-49ca-a8bd-45669d613509",
            "851a83c5-88b1-43a9-a330-6e8fc8d20afb",
            "f2d33f45-bddf-4bc9-8d71-3fbf395ea4da"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "6a8e4061-0278-4713-92bc-4d75a200e5af",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "df8aab3e-33a3-4c97-b250-2e9cce51fa9e",
          "name": "SILVER CITRATE [MI]",
          "stdName": "SILVER CITRATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b556bb5d-7425-4a2e-9add-b8b78194f9d5",
            "851a83c5-88b1-43a9-a330-6e8fc8d20afb"
          ],
          "display_name": false
        },
        {
          "uuid": "8a453a10-23dd-1840-fad1-dca82abd805b",
          "name": "Silver citrate [WHO-DD]",
          "stdName": "SILVER CITRATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c0ee89fc-fa76-23b0-bf72-236aa21bf72f"
          ],
          "display_name": false
        },
        {
          "uuid": "ae922df2-caef-4ae8-9ee0-8a9d7188c660",
          "name": "TRISILVER CITRATE",
          "stdName": "TRISILVER CITRATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "31c622a4-10a7-421c-a09d-1eb908fba7c4",
            "851a83c5-88b1-43a9-a330-6e8fc8d20afb"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f2d33f45-bddf-4bc9-8d71-3fbf395ea4da",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "851a83c5-88b1-43a9-a330-6e8fc8d20afb",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "31c622a4-10a7-421c-a09d-1eb908fba7c4",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b556bb5d-7425-4a2e-9add-b8b78194f9d5",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a7ea517c-3262-49ca-a8bd-45669d613509",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0c4bab0d-785a-460c-80db-2c0aa477abfd",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "34665eee-2470-45ae-809b-caf425fb1786",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390843000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0b50b4e4-ced4-49c9-be00-87e43e531c79",
          "citation": "SRS import [CKA421A1J7]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=CKA421A1J7",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390843000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4868240d-d95d-4d3d-94af-a38f60b298f3",
          "citation": "SILVER CITRATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5e672ed2-558a-47f1-8e69-54313a0831d4",
          "citation": "SILVER CITRATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "555f17db-93bf-4419-ac3a-982ad1884311",
          "citation": "SILVER CITRATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c8ed2522-9b74-dde5-99e3-717749eb8f4a",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "a9bbf43b-24d9-45d7-a584-e43f4e1fa546",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "c0ee89fc-fa76-23b0-bf72-236aa21bf72f",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "f39afe01-f4c1-bcf1-6e73-7b28b8a85a8e",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "063eab64-6b37-9d3e-8bea-5157ac9855bc",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a00f48f9-5c33-4e91-9d9c-1f457d847a2d",
          "id": "a00f48f9-5c33-4e91-9d9c-1f457d847a2d",
          "molfile": "\n  Marvin  01132108192D          \n\n  1  0  0  0  0  0            999 V2000\n    6.9436   -1.8219    0.0000 Ag  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Ag+]",
          "formula": "Ag",
          "atropisomerism": "No",
          "charge": 1,
          "count": 3,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 3,
            "units": "MOL RATIO",
            "uuid": "8d0575b1-08d4-45c3-bd4a-bd617b4383c5"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "107.8682",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "f31a55b1-1262-4351-9292-fede6171ab50",
          "id": "f31a55b1-1262-4351-9292-fede6171ab50",
          "molfile": "\n  Marvin  01132112362D          \n\n 13 12  0  0  0  0            999 V2000\n    1.6297   -1.4450    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6389   -2.2700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3539   -2.6825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0642   -2.2700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0597   -1.4450    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    3.7792   -2.6825    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9284   -2.6825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2134   -2.2700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2043   -1.4450    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   -0.5016   -2.6825    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6297   -3.0859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9193   -3.4984    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.3447   -3.5075    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  7  2  1  0  0  0  0\n 11  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  4  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 11  2  0  0  0  0\nM  CHG  3   5  -1   9  -1  12  -1\nM  END",
          "smiles": "C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O",
          "formula": "C6H5O7",
          "atropisomerism": "No",
          "charge": -3,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "865e844b-2cf3-41a5-a9d1-07555bfe4c94"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "189.1",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "7b7aa858-5bd4-499e-95a3-0547f4590a52",
      "version": "9",
      "structure": {
        "id": "28e389ee-de9e-488f-9fbf-f2f1a668182e",
        "molfile": "\n  Marvin  01132102142D          \n\n 16 12  0  0  0  0            999 V2000\n    1.6297   -1.4450    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6389   -2.2700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6297   -3.0859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9193   -3.4984    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3447   -3.5075    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.3539   -2.6825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0642   -2.2700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0597   -1.4450    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7792   -2.6825    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    0.9284   -2.6825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2134   -2.2700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2043   -1.4450    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5016   -2.6825    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.9436   -1.8219    0.0000 Ag  0  3  0  0  0  0  0  0  0  0  0  0\n    6.9436   -1.8219    0.0000 Ag  0  3  0  0  0  0  0  0  0  0  0  0\n    6.9436   -1.8219    0.0000 Ag  0  3  0  0  0  0  0  0  0  0  0  0\n  4  3  2  0  0  0  0\n  5  3  1  0  0  0  0\n  6  2  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  7  1  0  0  0  0\n 10  2  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 11  1  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\nM  CHG  6   5  -1   9  -1  13  -1  14   1  15   1  16   1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1  3  14  15  16\nM  SPA   1  1  14\nM  SDI   1  4    6.5236   -2.2419    6.5236   -1.4019\nM  SDI   1  4    7.3636   -1.4019    7.3636   -2.2419\nM  SMT   1 3\nM  END",
        "smiles": "C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.[Ag+].[Ag+].[Ag+]",
        "formula": "C6H5O7.3Ag",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "512.7044",
        "optical_activity": "NONE",
        "references": [
          "0b50b4e4-ced4-49c9-be00-87e43e531c79",
          "f2d33f45-bddf-4bc9-8d71-3fbf395ea4da"
        ],
        "stereo_centers": 0
      },
      "unii": "CKA421A1J7"
    }
  ]
}