{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "329a016d-3c55-43a1-831b-eab84aa858e4",
          "code": "N0000175864",
          "comments": "Established Pharmacologic Class [EPC]|Contrast Agent for Ultrasound Imaging [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175864",
          "code_system": "NDF-RT",
          "references": [
            "60c3c1e9-c673-4f88-83a5-f600d7e58373"
          ]
        },
        {
          "uuid": "eafce2e7-7c67-4c1a-8f71-a544aea72e9c",
          "code": "N0000010259",
          "comments": "Cellular or Molecular Interactions [MoA]|Physiochemical Activity [MoA]|Imaging Contrast Activity [MoA]|Ultrasound Contrast Activity [MoA]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000010259",
          "code_system": "NDF-RT",
          "references": [
            "60c3c1e9-c673-4f88-83a5-f600d7e58373"
          ]
        },
        {
          "uuid": "92a55b74-c546-46a9-8ca2-ed9e9878a914",
          "code": "76-19-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=76-19-7",
          "code_system": "CAS",
          "references": [
            "60c3c1e9-c673-4f88-83a5-f600d7e58373",
            "7aaa179a-829b-412b-8655-e530e33abe72"
          ]
        },
        {
          "uuid": "09ea9c81-0373-4d5c-be3d-a4f698e9478e",
          "code": "C47664",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C47664",
          "code_system": "NCI_THESAURUS",
          "references": [
            "60c3c1e9-c673-4f88-83a5-f600d7e58373"
          ]
        },
        {
          "uuid": "810c6d75-7522-477b-9b2b-fdaa535b9030",
          "code": "C042852",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67042852",
          "code_system": "MESH",
          "references": [
            "60c3c1e9-c673-4f88-83a5-f600d7e58373"
          ]
        },
        {
          "uuid": "176b2f3f-54ee-467f-ac74-cfbdaf1ebaca",
          "code": "C418027",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67418027",
          "code_system": "MESH",
          "references": [
            "60c3c1e9-c673-4f88-83a5-f600d7e58373"
          ]
        },
        {
          "uuid": "32a62184-98c1-4948-869f-77ac55b59c17",
          "code": "OCTAFLUOROPROPANE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Octafluoropropane",
          "code_system": "WIKIPEDIA",
          "references": [
            "60c3c1e9-c673-4f88-83a5-f600d7e58373"
          ]
        },
        {
          "uuid": "ce8f6ca8-16b0-43a5-b607-7be1eb8bac26",
          "code": "SUB20657",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "60c3c1e9-c673-4f88-83a5-f600d7e58373"
          ]
        },
        {
          "uuid": "56dfdfe0-9516-4366-a9b7-783756cadc2c",
          "code": "OPTISON (AUTHORIZED: ECHOCARDIOGRAPHY)",
          "comments": "EMA EPAR|ANALYTICAL, DIAGNOSTIC AND THERAPEUTIC TECHNIQUES AND EQUIPMENT|DIAGNOSIS|DIAGNOSIS TECHNIQUES AND PROCEDURES|DIAGNOSTIC IMAGING|ULTRASONOGRAPHY|ECHOCARDIOGRAPHY",
          "type": "PRIMARY",
          "url": "http://www.ema.europa.eu/ema/index.jsp?curl=pages/medicines/human/medicines/000166/human_med_000954.jsp&mid=WC0b01ac058001d124",
          "code_system": "EMA ASSESSMENT REPORTS",
          "references": [
            "60c3c1e9-c673-4f88-83a5-f600d7e58373"
          ]
        },
        {
          "uuid": "15034bc3-4f16-4faf-8db8-f54783460261",
          "code": "LUMINITY (AUTHORIZED: ECHOCARDIOGRAPHY)",
          "comments": "EMA EPAR|ANALYTICAL, DIAGNOSTIC AND THERAPEUTIC TECHNIQUES AND EQUIPMENT|DIAGNOSIS|DIAGNOSIS TECHNIQUES AND PROCEDURES|DIAGNOSTIC IMAGING|ULTRASONOGRAPHY|ECHOCARDIOGRAPHY",
          "type": "PRIMARY",
          "url": "http://www.ema.europa.eu/ema/index.jsp?curl=pages/medicines/human/medicines/000654/human_med_000892.jsp&mid=WC0b01ac058001d124",
          "code_system": "EMA ASSESSMENT REPORTS",
          "references": [
            "60c3c1e9-c673-4f88-83a5-f600d7e58373"
          ]
        },
        {
          "uuid": "17dcd7bf-9a3b-4a2d-bf33-a841089fc2e5",
          "code": "7932",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=7932",
          "code_system": "INN",
          "references": [
            "60c3c1e9-c673-4f88-83a5-f600d7e58373"
          ]
        },
        {
          "uuid": "a6d92adf-7868-4f09-902c-cc2664f42c36",
          "code": "200-941-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.857",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "60c3c1e9-c673-4f88-83a5-f600d7e58373"
          ]
        },
        {
          "uuid": "52051ad3-ef42-47db-a8bd-abbe22b029fe",
          "code": "283753",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/283753/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "60c3c1e9-c673-4f88-83a5-f600d7e58373"
          ]
        },
        {
          "uuid": "d60ae049-3f85-4e0d-9fc0-3eeb81068c20",
          "code": "m8543",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8543?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "60c3c1e9-c673-4f88-83a5-f600d7e58373"
          ]
        },
        {
          "uuid": "b05e431c-65cd-4a77-93b1-4e23ad0033b8",
          "code": "DB00556",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00556",
          "code_system": "DRUG BANK",
          "references": [
            "60c3c1e9-c673-4f88-83a5-f600d7e58373"
          ]
        },
        {
          "uuid": "6e752941-3b1a-46c8-88b9-8e9d2f9c3c15",
          "code": "CHEMBL1663",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1663",
          "code_system": "ChEMBL",
          "references": [
            "60c3c1e9-c673-4f88-83a5-f600d7e58373"
          ]
        },
        {
          "uuid": "7a421baa-ac7b-4968-a796-267c0a203cab",
          "code": "6432",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6432",
          "code_system": "PUBCHEM",
          "references": [
            "60c3c1e9-c673-4f88-83a5-f600d7e58373"
          ]
        },
        {
          "uuid": "1999135c-b210-ece0-1a8f-e9dceada3899",
          "code": "8074",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/8074",
          "code_system": "HSDB",
          "references": [
            "a9d604f9-a9d4-329d-f118-b6acd3fd2fb4"
          ]
        },
        {
          "uuid": "f622b6e0-787c-9bca-5267-7898b80e31ae",
          "code": "DTXSID9052503",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9052503",
          "code_system": "EPA CompTox",
          "references": [
            "147bc8fb-59f0-d74b-9568-d194b319086c"
          ]
        },
        {
          "uuid": "12787648-0511-48ec-316e-5313a6d569c9",
          "code": "Perflutren",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM1104/",
          "code_system": "LACTMED",
          "references": [
            "8dfcdee2-41d1-8d31-9199-0a72e042578a"
          ]
        },
        {
          "uuid": "a6b89001-bf03-4428-0a49-366ac28bf76d",
          "code": "C1937",
          "comments": "Industrial Aid[C45678]|Reagent[C802]|Diagnostic Reagent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1937",
          "code_system": "NCI_THESAURUS",
          "references": [
            "8dfcdee2-41d1-8d31-9199-0a72e042578a"
          ]
        },
        {
          "uuid": "74ed0bbb-0794-4df9-8a3e-ee04c91688bf",
          "code": "CK0N3WH0SR",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "87ffd2f2-81d2-13ca-130c-c5c595b43511",
          "code": "2104",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/2104",
          "code_system": "DRUG CENTRAL",
          "references": [
            "8dfcdee2-41d1-8d31-9199-0a72e042578a"
          ]
        },
        {
          "uuid": "1437e447-8f6b-cda6-8fb4-962c13438b90",
          "code": "31980",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:31980",
          "code_system": "CHEBI",
          "references": [
            "8dfcdee2-41d1-8d31-9199-0a72e042578a"
          ]
        },
        {
          "uuid": "640c784c-bf7b-4323-a208-36c9fe50b066",
          "code": "CK0N3WH0SR",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=CK0N3WH0SR",
          "code_system": "DAILYMED",
          "references": [
            "fc606515-6251-107e-cedc-6eaf5e1e3916"
          ]
        },
        {
          "uuid": "133a392b-31ab-6bd2-dad2-47acea2ff808",
          "code": "100000090070",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "bd36275f-f13e-a0e4-3255-6ae6257bca69"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "694904cc-b814-452b-8709-a8a8dc7afac6",
          "amount": {
            "uuid": "0743458a-047f-4d76-a23e-4297f494684f"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "f786ce5b-94df-4ee7-94a9-d6b324edb1f8",
            "refuuid": "37837cf6-0526-4d54-8e29-7147cfebf16f",
            "name": "PERFLUTREN",
            "unii": "CK0N3WH0SR",
            "linking_id": "CK0N3WH0SR",
            "ref_pname": "PERFLUTREN",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "7b7406e8-3e86-4694-8d10-f079f15bbcee",
          "name": "1,1,1,2,2,3,3,3-OCTAFLUOROPROPANE",
          "stdName": "1,1,1,2,2,3,3,3-OCTAFLUOROPROPANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "303bbb92-4c07-4abd-91d1-a519f43afd6a"
          ],
          "display_name": false
        },
        {
          "uuid": "d4efab2e-4871-4dad-9898-6d6d21efd005",
          "name": "DEFINITY",
          "stdName": "DEFINITY",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c6f5308c-278e-496f-81e4-464ff8455745"
          ],
          "display_name": false
        },
        {
          "uuid": "97ce01f1-cd6f-4f26-8fa4-a8c3a74e01ca",
          "name": "DMP-115",
          "stdName": "DMP-115",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b97a9a6-8b31-4838-9647-276535e33b65"
          ],
          "display_name": false
        },
        {
          "uuid": "05ecaf38-d920-44f9-bfeb-ebf2b494ceff",
          "name": "DMP115",
          "stdName": "DMP115",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "303bbb92-4c07-4abd-91d1-a519f43afd6a"
          ],
          "display_name": false
        },
        {
          "uuid": "b53f83a4-d44b-4910-bdb4-e009e2c39188",
          "name": "FS-069",
          "stdName": "FS-069",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "419a56b2-6095-4b56-88bb-17220acfb2f8"
          ],
          "display_name": false
        },
        {
          "uuid": "8873d6f4-8bfe-43b1-834e-5edc7ad02834",
          "name": "FS069",
          "stdName": "FS069",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "303bbb92-4c07-4abd-91d1-a519f43afd6a"
          ],
          "display_name": false
        },
        {
          "uuid": "0419d55f-7c21-4552-8897-abd6adb7690c",
          "name": "LUMINITY",
          "stdName": "LUMINITY",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "69bc8be0-d2f6-4ffe-803f-dd1fde92e247"
          ],
          "display_name": false
        },
        {
          "uuid": "be7b5627-5af3-49aa-9844-a4311cc4830d",
          "name": "MRX-115",
          "stdName": "MRX-115",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "303bbb92-4c07-4abd-91d1-a519f43afd6a"
          ],
          "display_name": false
        },
        {
          "uuid": "11b67482-84fa-451f-869d-25152ea60ad1",
          "name": "OCTAFLUORO-PROPANE",
          "stdName": "OCTAFLUORO-PROPANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d662e469-7c1e-4e47-ac36-d80b3a9d5b52"
          ],
          "display_name": false
        },
        {
          "uuid": "6cab34ed-90a8-4cd3-9bff-4d79dee507e9",
          "name": "OCTAFLUOROPROPANE [VANDF]",
          "stdName": "OCTAFLUOROPROPANE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8dd0613a-4189-4a43-b8a8-4c4fafd31433"
          ],
          "display_name": false
        },
        {
          "uuid": "7d3b967b-9e1c-45d5-bd53-56de4ef74017",
          "name": "OPTISON",
          "stdName": "OPTISON",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3daac33e-a332-4e48-bb38-74d9938c5fcc"
          ],
          "display_name": false
        },
        {
          "uuid": "8d748aab-48f5-41f3-8b37-ee3c8871bb9a",
          "name": "OXTAFLUOROPROPANE [VANDF]",
          "stdName": "OXTAFLUOROPROPANE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8dd0613a-4189-4a43-b8a8-4c4fafd31433"
          ],
          "display_name": false
        },
        {
          "uuid": "6a8ca5a4-0e42-42a1-b61e-8be561c74c78",
          "name": "Octafluoropropane",
          "stdName": "OCTAFLUOROPROPANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fe9c5363-ee69-4dcc-9e8b-a1c8d54920dc",
            "bc7fed73-87ba-4277-bfd6-2e634b7b17af",
            "8dd0613a-4189-4a43-b8a8-4c4fafd31433"
          ],
          "display_name": false
        },
        {
          "uuid": "5a34e653-32d5-470e-bc54-e92781273b8a",
          "name": "PERFLUOROPROPANE",
          "stdName": "PERFLUOROPROPANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d5f19033-685d-4505-81bf-86d3b95cd9f9",
            "fc9344cf-a1c0-4324-876f-e69f0f885005",
            "3b97a9a6-8b31-4838-9647-276535e33b65"
          ],
          "display_name": false
        },
        {
          "uuid": "78b75177-0bb0-4f6b-889e-31ce50e79c98",
          "name": "PERFLUOROPROPANE [MI]",
          "stdName": "PERFLUOROPROPANE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fc9344cf-a1c0-4324-876f-e69f0f885005"
          ],
          "display_name": false
        },
        {
          "uuid": "4125bac0-97cc-4c6e-ac8e-c1432b22cec7",
          "name": "PERFLUTREN",
          "stdName": "PERFLUTREN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c59981a1-1ce6-4e93-9641-9929b20a4d8a",
            "ba5d5a49-23dc-4cbb-ad58-0838f5aed438",
            "73f51314-8ba9-406b-8029-f88adc3f8cb7",
            "bed0b24f-01a7-46a5-bcea-b8b757af184c",
            "417ccc26-8e7d-4ec3-9d3a-dcd27719b0a9",
            "b24a4adc-8020-4b83-b1f7-51cdbc441158",
            "74f70055-a7ba-4833-b2e5-83a130b98209",
            "3f1c5157-5709-45ae-ad87-4a4288e69adb",
            "b090b6ef-9e11-46d8-87c9-e8479aea7afa",
            "8dd0613a-4189-4a43-b8a8-4c4fafd31433",
            "e74b4522-5a9d-4bec-b9eb-78a530165402",
            "167191f5-3e26-4726-8349-09d38c37d2a7",
            "fd26d4ac-27af-47ee-bceb-f05946222b6c",
            "d556a697-a238-4d6a-af70-25a595bc4d73",
            "494514b0-c3b1-4a6f-9d32-6e197e413354",
            "8e637fd1-4aa5-48d2-8676-fd3678c6b581",
            "94d84c75-6387-4037-be01-46b365b7ccc8",
            "274b0879-9945-4aa0-8f70-f7975e66a552"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "6922d083-1610-4863-bdd7-3bcbea5647ad",
              "name_org": "USAN"
            },
            {
              "uuid": "6a2610ef-d581-44b3-9f92-b143012ef973",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "536de2c4-cf75-4d46-ac9b-7226fc58a00e",
          "name": "PERFLUTREN [EMA EPAR]",
          "stdName": "PERFLUTREN [EMA EPAR]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "167191f5-3e26-4726-8349-09d38c37d2a7"
          ],
          "display_name": false
        },
        {
          "uuid": "ea99f53c-47e5-4a27-a257-dcbce7ab3d8d",
          "name": "PERFLUTREN [II]",
          "stdName": "PERFLUTREN [II]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "73f51314-8ba9-406b-8029-f88adc3f8cb7"
          ],
          "display_name": false
        },
        {
          "uuid": "fff0d26c-60ef-4c43-a527-500e62126ddb",
          "name": "PERFLUTREN [JAN]",
          "stdName": "PERFLUTREN [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "74f70055-a7ba-4833-b2e5-83a130b98209"
          ],
          "display_name": false
        },
        {
          "uuid": "bd190d9f-c398-4d43-b057-4397c904c3fe",
          "name": "PERFLUTREN [MART.]",
          "stdName": "PERFLUTREN [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "94d84c75-6387-4037-be01-46b365b7ccc8"
          ],
          "display_name": false
        },
        {
          "uuid": "8e7f53ca-0ead-4864-b79d-1cb1421e501a",
          "name": "PERFLUTREN [ORANGE BOOK]",
          "stdName": "PERFLUTREN [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b090b6ef-9e11-46d8-87c9-e8479aea7afa"
          ],
          "display_name": false
        },
        {
          "uuid": "acf36d2b-d312-4233-b399-d849bceb2f1d",
          "name": "PERFLUTREN [USAN]",
          "stdName": "PERFLUTREN [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e74b4522-5a9d-4bec-b9eb-78a530165402"
          ],
          "display_name": false
        },
        {
          "uuid": "6a010d8c-eb9d-4d8e-b1f6-88909fbea40a",
          "name": "PERFLUTREN [VANDF]",
          "stdName": "PERFLUTREN [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8dd0613a-4189-4a43-b8a8-4c4fafd31433"
          ],
          "display_name": false
        },
        {
          "uuid": "9176b00f-250d-421c-8a2a-94654e156606",
          "name": "PROPANE, OCTAFLUORO-",
          "stdName": "PROPANE, OCTAFLUORO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "73f51314-8ba9-406b-8029-f88adc3f8cb7"
          ],
          "display_name": false
        },
        {
          "uuid": "ab5b88ac-d9cf-d823-9841-21f3fc2878de",
          "name": "Perflutren [WHO-DD]",
          "stdName": "PERFLUTREN [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3dbea5c5-6cc8-d595-2aaa-aa161c78339d"
          ],
          "display_name": false
        },
        {
          "uuid": "a58e51f4-721d-416e-b181-f032ca63ec1f",
          "name": "perflutren [INN]",
          "stdName": "PERFLUTREN [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "274b0879-9945-4aa0-8f70-f7975e66a552"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "3b97a9a6-8b31-4838-9647-276535e33b65",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d662e469-7c1e-4e47-ac36-d80b3a9d5b52",
          "citation": "fda_srs",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "73f51314-8ba9-406b-8029-f88adc3f8cb7",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "303bbb92-4c07-4abd-91d1-a519f43afd6a",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bc7fed73-87ba-4277-bfd6-2e634b7b17af",
          "citation": "EMA_LIST",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c6f5308c-278e-496f-81e4-464ff8455745",
          "citation": "ORANGE BOOK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e74b4522-5a9d-4bec-b9eb-78a530165402",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "274b0879-9945-4aa0-8f70-f7975e66a552",
          "citation": "INN Proposed List 82",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL82.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "74f70055-a7ba-4833-b2e5-83a130b98209",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b090b6ef-9e11-46d8-87c9-e8479aea7afa",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "94d84c75-6387-4037-be01-46b365b7ccc8",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fc9344cf-a1c0-4324-876f-e69f0f885005",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "167191f5-3e26-4726-8349-09d38c37d2a7",
          "citation": "EMA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "69bc8be0-d2f6-4ffe-803f-dd1fde92e247",
          "citation": "http://www.ema.europa.eu/ema/index.jsp?curl=pages/medicines/human/medicines/000654/human_med_000892.",
          "url": "http://www.ema.europa.eu/ema/index.jsp?curl=pages/medicines/human/medicines/000654/human_med_000892.",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fd26d4ac-27af-47ee-bceb-f05946222b6c",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8dd0613a-4189-4a43-b8a8-4c4fafd31433",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3daac33e-a332-4e48-bb38-74d9938c5fcc",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "419a56b2-6095-4b56-88bb-17220acfb2f8",
          "citation": "CHEMBL",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "60c3c1e9-c673-4f88-83a5-f600d7e58373",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390737000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e3aa3d08-7c17-4c57-9534-e07c43808fea",
          "citation": "SRS import [CK0N3WH0SR]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=CK0N3WH0SR",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390737000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c59981a1-1ce6-4e93-9641-9929b20a4d8a",
          "citation": "PERFLUTREN [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b24a4adc-8020-4b83-b1f7-51cdbc441158",
          "citation": "PERFLUTREN [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d556a697-a238-4d6a-af70-25a595bc4d73",
          "citation": "PERFLUTREN [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8e637fd1-4aa5-48d2-8676-fd3678c6b581",
          "citation": "PERFLUTREN [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bed0b24f-01a7-46a5-bcea-b8b757af184c",
          "citation": "PERFLUTREN [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d5f19033-685d-4505-81bf-86d3b95cd9f9",
          "citation": "PERFLUOROPROPANE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3f1c5157-5709-45ae-ad87-4a4288e69adb",
          "citation": "PERFLUTREN [EMA EPAR]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ba5d5a49-23dc-4cbb-ad58-0838f5aed438",
          "citation": "PERFLUTREN [II]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "417ccc26-8e7d-4ec3-9d3a-dcd27719b0a9",
          "citation": "PERFLUTREN [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fe9c5363-ee69-4dcc-9e8b-a1c8d54920dc",
          "citation": "OCTAFLUOROPROPANE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e80d692c-eb58-43d1-8fae-468ca7580418",
          "citation": "OXTAFLUOROPROPANE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "494514b0-c3b1-4a6f-9d32-6e197e413354",
          "citation": "PERFLUTREN [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a9d604f9-a9d4-329d-f118-b6acd3fd2fb4",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+76-19-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "147bc8fb-59f0-d74b-9568-d194b319086c",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=76-19-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "564df0c4-d8db-8b18-837c-ad4afb4bc11e",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+76-19-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8dfcdee2-41d1-8d31-9199-0a72e042578a",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "5966d32d-728a-1516-048e-c79c37c06863",
          "citation": "PCPC",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true
        },
        {
          "uuid": "7aaa179a-829b-412b-8655-e530e33abe72",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "3dbea5c5-6cc8-d595-2aaa-aa161c78339d",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "fc606515-6251-107e-cedc-6eaf5e1e3916",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "bd36275f-f13e-a0e4-3255-6ae6257bca69",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "2f305a50-9634-4f54-ad38-5d8604d79f57",
          "id": "2f305a50-9634-4f54-ad38-5d8604d79f57",
          "molfile": "\n  Marvin  01132102322D          \n\n 11 10  0  0  0  0            999 V2000\n    3.0381   -1.4073    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1859   -1.0601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1859   -1.8860    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8803   -0.4761    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4546   -0.6471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9649    0.0000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7918   -0.1684    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8128   -1.1311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9496   -1.8860    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1973   -1.6598    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.8128    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  2  1  0  0  0  0\n  2  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  5  1  0  0  0  0\n  8  5  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  1  0  0  0  0\n 11  8  1  0  0  0  0\nM  END",
          "smiles": "C(C(F)(F)F)(C(F)(F)F)(F)F",
          "formula": "C3F8",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "fe05e535-01ac-4a41-9af4-53ffd62a1ebf"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "188.0194",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "37837cf6-0526-4d54-8e29-7147cfebf16f",
      "version": "19",
      "structure": {
        "id": "76cd301d-3d4c-435f-8938-a198a2c20ea7",
        "molfile": "\n  Marvin  01132106102D          \n\n 11 10  0  0  0  0            999 V2000\n    1.4546   -0.6471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1859   -1.0601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8128   -1.1311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9649    0.0000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7918   -0.1684    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0381   -1.4073    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1859   -1.8860    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9496   -1.8860    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1973   -1.6598    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.8128    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8803   -0.4761    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6  2  1  0  0  0  0\n  7  2  1  0  0  0  0\n  8  3  1  0  0  0  0\n  9  3  1  0  0  0  0\n 10  3  1  0  0  0  0\n 11  2  1  0  0  0  0\nM  END",
        "smiles": "C(C(F)(F)F)(C(F)(F)F)(F)F",
        "formula": "C3F8",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "188.0194",
        "optical_activity": "NONE",
        "references": [
          "73f51314-8ba9-406b-8029-f88adc3f8cb7",
          "e3aa3d08-7c17-4c57-9534-e07c43808fea",
          "274b0879-9945-4aa0-8f70-f7975e66a552"
        ],
        "stereo_centers": 0
      },
      "unii": "CK0N3WH0SR"
    }
  ]
}