{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "46b56c57-956d-49b8-a1e1-2a38b708d2bd",
          "code": "87857-41-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=87857-41-8",
          "code_system": "CAS",
          "references": [
            "22c1fadc-d2e3-43cc-81d8-4a8c55d77a1f",
            "de305d4b-0ecd-4c39-9aea-c3304adc7ad7"
          ]
        },
        {
          "uuid": "104da0d8-5536-488c-b354-3e56fd9841c2",
          "code": "SUB112492",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "22c1fadc-d2e3-43cc-81d8-4a8c55d77a1f"
          ]
        },
        {
          "uuid": "04b681a7-44ac-46a2-8647-1128cc866a74",
          "code": "114743",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/114743",
          "code_system": "PUBCHEM",
          "references": [
            "22c1fadc-d2e3-43cc-81d8-4a8c55d77a1f"
          ]
        },
        {
          "uuid": "14e917d3-c40d-a919-17c7-21c65cae064c",
          "code": "Desmethylsertraline",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Desmethylsertraline",
          "code_system": "WIKIPEDIA",
          "references": [
            "cb2229d1-3b73-afc5-aa64-1adf60f2ac51"
          ]
        },
        {
          "uuid": "d72db426-e49d-9fc8-e423-6cf8dad584b9",
          "code": "DTXSID60236666",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60236666",
          "code_system": "EPA CompTox",
          "references": [
            "7d27666f-2d18-1ded-d1fa-87b9174d45cb"
          ]
        },
        {
          "uuid": "14477e15-3636-ec74-e610-3d8210e8f5ad",
          "code": "DB14071",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB14071",
          "code_system": "DRUG BANK",
          "references": [
            "ac39f9ef-b8cd-c82c-2496-29041ddf7fd6"
          ]
        },
        {
          "uuid": "071040bb-d3c2-4ffe-9343-834c0a3ca4b5",
          "code": "CJJ71O9BE8",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "dc050e5c-1d09-23b8-602c-1da0ec30a9c9",
          "code": "100000142067",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "f5bc887e-6c03-2bc3-f02c-ba8a43ca7288"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "15d534e8-6ca4-4cfd-ae1d-4f1fa1d65947",
          "amount": {
            "uuid": "85c05a7c-d9e0-4e6b-a378-ab0add044b18"
          },
          "type": "PARENT->METABOLITE LESS ACTIVE",
          "interaction_type": "MAJOR",
          "mediator_substance": {
            "uuid": "6fa39ea1-216a-4708-b20a-1a753fcd0b28",
            "refuuid": "4275827d-e329-4907-95b5-7d690692872a",
            "name": "CYTOCHROME P450 3A4",
            "unii": "PUO0521HZV",
            "linking_id": "PUO0521HZV",
            "ref_pname": "CYTOCHROME P450 3A4",
            "substance_class": "reference"
          },
          "references": [
            "c4bd9ea0-b81b-413e-a30a-bb26ade32ce9"
          ],
          "related_substance": {
            "uuid": "cb88a506-a9c4-4996-8262-e8a5e035fc12",
            "refuuid": "6895c1d6-8f30-4484-aed3-85bb17351e85",
            "name": "SERTRALINE",
            "unii": "QUC7NX6WMB",
            "linking_id": "QUC7NX6WMB",
            "ref_pname": "SERTRALINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "be873938-feda-4c0b-b93f-3b4f6eeae893",
          "amount": {
            "uuid": "bb4c80b8-8d58-43cd-a4a9-d37d7c891c25"
          },
          "type": "PARENT->METABOLITE LESS ACTIVE",
          "mediator_substance": {
            "uuid": "1ade4d72-8ca5-4627-9c4f-1e76e5014105",
            "refuuid": "4f746c19-0e0a-447a-beda-d28b91d6f23e",
            "name": "CYTOCHROME P450 2C19",
            "unii": "081I12ZA58",
            "linking_id": "081I12ZA58",
            "ref_pname": "CYTOCHROME P450 2C19",
            "substance_class": "reference"
          },
          "references": [
            "e6d0f6ed-0843-4d22-9463-665bc786166b"
          ],
          "related_substance": {
            "uuid": "2a4f3681-f4b3-4456-b652-ca6f23ba1cdb",
            "refuuid": "6895c1d6-8f30-4484-aed3-85bb17351e85",
            "name": "SERTRALINE",
            "unii": "QUC7NX6WMB",
            "linking_id": "QUC7NX6WMB",
            "ref_pname": "SERTRALINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "1cc090be-b4d6-4804-8d47-6567d21ac41c",
          "amount": {
            "uuid": "b937237a-db2f-41bc-90ec-b510bc98e0d4"
          },
          "type": "PARENT->METABOLITE LESS ACTIVE",
          "mediator_substance": {
            "uuid": "8aa5f0f3-d4e0-45e7-90d6-0a790b810269",
            "refuuid": "cc92795c-ba54-4e71-a72b-1af36b57df6b",
            "name": "CYTOCHROME P450 2D6",
            "unii": "8E4LAA4357",
            "linking_id": "8E4LAA4357",
            "ref_pname": "CYTOCHROME P450 2D6",
            "substance_class": "reference"
          },
          "references": [
            "8b8d5229-664a-4b82-95c8-a1f765d846b9"
          ],
          "related_substance": {
            "uuid": "50c96c4b-cb01-43dd-953a-9c6a3a90791d",
            "refuuid": "6895c1d6-8f30-4484-aed3-85bb17351e85",
            "name": "SERTRALINE",
            "unii": "QUC7NX6WMB",
            "linking_id": "QUC7NX6WMB",
            "ref_pname": "SERTRALINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "4385c289-3219-445e-b905-88540ba494d4",
          "name": "1-NAPHTHALENAMINE, 4-(3,4-DICHLOROPHENYL)-1,2,3,4-TETRAHYDRO-, (1S,4S)-",
          "stdName": "1-NAPHTHALENAMINE, 4-(3,4-DICHLOROPHENYL)-1,2,3,4-TETRAHYDRO-, (1S,4S)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0fe45725-ee4f-4f4b-a635-a080a6e993c2"
          ],
          "display_name": false
        },
        {
          "uuid": "a928a639-7a14-4538-b319-0ff46b6a07fd",
          "name": "CP-53261",
          "stdName": "CP-53261",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0fe45725-ee4f-4f4b-a635-a080a6e993c2"
          ],
          "display_name": false
        },
        {
          "uuid": "0f39f5c8-aebe-456f-9870-3661d94c414b",
          "name": "DESMETHYLSERTRALINE",
          "stdName": "DESMETHYLSERTRALINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4ab759c7-22ec-4035-93cf-91bce138044d"
          ],
          "display_name": true
        },
        {
          "uuid": "e1dda960-af77-47f1-8d73-6a471916d034",
          "name": "N-DESMETHYLSERTRALINE",
          "stdName": "N-DESMETHYLSERTRALINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1876e4cf-5565-4c26-9d25-2799fc16a1d6"
          ],
          "display_name": false
        },
        {
          "uuid": "7f958a5d-618d-4388-846a-ffc7451603c8",
          "name": "NORSERTRALINE",
          "stdName": "NORSERTRALINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0fe45725-ee4f-4f4b-a635-a080a6e993c2"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "1876e4cf-5565-4c26-9d25-2799fc16a1d6",
          "citation": "Expert Opinion on Drug Metabolism and Toxicology [1742-5255] Mandrioli, Roberto yr:2013 pg:1 -11 ",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0fe45725-ee4f-4f4b-a635-a080a6e993c2",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4ab759c7-22ec-4035-93cf-91bce138044d",
          "citation": "ema",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "22c1fadc-d2e3-43cc-81d8-4a8c55d77a1f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392175000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1a1a0aa5-5137-41cc-abc3-969f80918dae",
          "citation": "SRS import [CJJ71O9BE8]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=CJJ71O9BE8",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392175000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "04fd2a6c-647b-4773-b651-8a9ec2264624",
          "citation": "Expert Opinion on Drug Metabolism and Toxicology [1742-5255] Mandrioli, Roberto yr:2013 pg:1-11",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cb2229d1-3b73-afc5-aa64-1adf60f2ac51",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Desmethylsertraline",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7d27666f-2d18-1ded-d1fa-87b9174d45cb",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=87857-41-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ac39f9ef-b8cd-c82c-2496-29041ddf7fd6",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "de305d4b-0ecd-4c39-9aea-c3304adc7ad7",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "94b8cd9e-cfc0-4dcc-a626-aacc20173955",
          "citation": "J Chromatogr 1990;527(2):467",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f5bc887e-6c03-2bc3-f02c-ba8a43ca7288",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "c4bd9ea0-b81b-413e-a30a-bb26ade32ce9",
          "citation": "J Chromatogr 1990;527(2):467",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e6d0f6ed-0843-4d22-9463-665bc786166b",
          "citation": "DMD FEBRUARY 2005 VOL. 33 NO. 2 262-270",
          "url": "http://dmd.aspetjournals.org/content/33/2/262.long",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8b8d5229-664a-4b82-95c8-a1f765d846b9",
          "citation": "DMD FEBRUARY 2005 VOL. 33 NO. 2 262-270",
          "url": "http://dmd.aspetjournals.org/content/33/2/262.long",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "2ac46a50-2a94-4960-ba78-c2e6ba1f5d0a",
          "id": "2ac46a50-2a94-4960-ba78-c2e6ba1f5d0a",
          "molfile": "\n  Marvin  01132102192D          \n\n 19 21  0  0  1  0            999 V2000\n    5.7980   -3.9223    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    4.9547   -3.9223    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2105   -4.6555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0355   -4.6555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4526   -3.9498    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.2547   -3.9498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6856   -3.3035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5242   -3.3035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9230   -4.0093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7801   -4.0093    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    9.4830   -4.6969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8772   -5.4210    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    8.6535   -4.6969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0676   -3.2760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4892   -2.5656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0814   -1.8460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2747   -1.8460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8347   -2.5335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2335   -3.2760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1 19  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 14  1  6  0  0  0\n  7  6  1  0  0  0  0\n 13  6  2  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n  9 11  2  0  0  0  0\n 12 11  1  0  0  0  0\n 11 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 19 14  2  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\nM  END",
          "smiles": "c1ccc2c(c1)[C@@H](CC[C@@H]2N)c3ccc(c(c3)Cl)Cl",
          "formula": "C16H15Cl2N",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "fbd3aa58-7569-435b-b6a4-3295a6ba6b8b"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "292.2035",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ef33a936-979c-42ce-ba06-b0ed061272e2",
      "version": "11",
      "structure": {
        "id": "a11f2aee-82a1-431e-8266-5e5891e59333",
        "molfile": "\n  Marvin  01132108222D          \n\n 19 21  0  0  1  0            999 V2000\n    7.0676   -3.2760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4526   -3.9498    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.2547   -3.9498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6535   -4.6969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4830   -4.6969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8772   -5.4210    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    9.9230   -4.0093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5242   -3.3035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6856   -3.3035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7801   -4.0093    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    7.0355   -4.6555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2105   -4.6555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7980   -3.9223    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.2335   -3.2760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8347   -2.5335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2747   -1.8460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0814   -1.8460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4892   -2.5656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9547   -3.9223    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  6  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  5  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9  3  1  0  0  0  0\n 10  7  1  0  0  0  0\n 11  2  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14  1  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18  1  1  0  0  0  0\n 13 19  1  6  0  0  0\nM  END",
        "smiles": "c1ccc2c(c1)[C@@H](CC[C@@H]2N)c3ccc(c(c3)Cl)Cl",
        "formula": "C16H15Cl2N",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "292.2035",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "04fd2a6c-647b-4773-b651-8a9ec2264624",
          "1a1a0aa5-5137-41cc-abc3-969f80918dae"
        ],
        "stereo_centers": 2
      },
      "unii": "CJJ71O9BE8"
    }
  ]
}