{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "24f3689e-a466-492c-a96e-6ea0f2c976f8",
          "code": "220604-16-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=220604-16-0",
          "code_system": "CAS",
          "references": [
            "cb249801-fd2f-47a5-95ad-de772bc1e0ba",
            "dfcc881a-a931-45a0-ac1c-99a01994f714"
          ]
        },
        {
          "uuid": "b88ba887-7c53-4419-8b6e-9855f680fee2",
          "code": "1651692",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1651692/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "cb249801-fd2f-47a5-95ad-de772bc1e0ba"
          ]
        },
        {
          "uuid": "e97d408f-824b-4f4d-83bc-5ba1214cb0b9",
          "code": "57508485",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/57508485",
          "code_system": "PUBCHEM",
          "references": [
            "cb249801-fd2f-47a5-95ad-de772bc1e0ba"
          ]
        },
        {
          "uuid": "db396b09-4fcd-4ac7-ac19-e18a3f995d69",
          "code": "CJ981S4H3T",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "3f410bbe-30ee-29ad-e7b4-773f53f377dc",
          "code": "DTXSID10944688",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10944688",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "0f59b280-dc8e-594a-652d-d7cb1c8f9a1b",
          "code": "CJ981S4H3T",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=CJ981S4H3T",
          "code_system": "DAILYMED",
          "references": [
            "47a896ae-3cd6-395b-ae87-5202afe27dc2"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "4bb30e58-8b3b-42d3-a999-e8707a2b1de6",
          "name": "DIPROPYLENE GLYCOL CAPRYLATE",
          "stdName": "DIPROPYLENE GLYCOL CAPRYLATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "58e11e27-82d2-4bec-820b-6c142a35cdcf",
            "bdb5365f-2f7a-4d9d-af60-853d2fbf604e",
            "69221f7a-d92c-4cc3-8f19-661ed37c4334",
            "c18263f7-1ecb-4927-a571-6088ef2a5d15"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "dee3ea08-21a1-4cf8-9b8b-76af48bc83aa",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "9a1070f5-d529-449b-b426-f0f49e15d707",
          "name": "DIPROPYLENE GLYCOL MONOCAPRYLATE",
          "stdName": "DIPROPYLENE GLYCOL MONOCAPRYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "58e11e27-82d2-4bec-820b-6c142a35cdcf",
            "69221f7a-d92c-4cc3-8f19-661ed37c4334"
          ],
          "display_name": false
        },
        {
          "uuid": "c223321c-6dcb-4d76-b52b-4d549a8932fc",
          "name": "OCTANOIC ACID, 2-(2-HYDROXYPROPOXY)-1-METHYLETHYL ESTER",
          "stdName": "OCTANOIC ACID, 2-(2-HYDROXYPROPOXY)-1-METHYLETHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "58e11e27-82d2-4bec-820b-6c142a35cdcf",
            "2a30b7db-c9ea-4671-b33f-263944513b98"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "2a30b7db-c9ea-4671-b33f-263944513b98",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "58e11e27-82d2-4bec-820b-6c142a35cdcf",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "69221f7a-d92c-4cc3-8f19-661ed37c4334",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bdb5365f-2f7a-4d9d-af60-853d2fbf604e",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cb249801-fd2f-47a5-95ad-de772bc1e0ba",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390918000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b3a2d440-e3e1-4af7-9447-a2b1c3b60179",
          "citation": "SRS import [CJ981S4H3T]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=CJ981S4H3T",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390918000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c18263f7-1ecb-4927-a571-6088ef2a5d15",
          "citation": "DIPROPYLENE GLYCOL CAPRYLATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "dfcc881a-a931-45a0-ac1c-99a01994f714",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "47a896ae-3cd6-395b-ae87-5202afe27dc2",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "00a43d15-3e7b-4e09-80be-add62c330072",
          "id": "00a43d15-3e7b-4e09-80be-add62c330072",
          "molfile": "\n  Marvin  01132100212D          \n\n 18 17  0  0  0  0            999 V2000\n   -5.1036   -0.4876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.3874   -0.8971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6747   -0.4815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9584   -0.8908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2457   -0.4752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5295   -0.8846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8167   -0.4690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1005   -0.8784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1005   -1.7034    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6122   -0.4628    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3284   -0.8722    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    1.3284   -1.6908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0448   -0.4628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7564   -0.8722    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4728   -0.4628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1798   -0.8722    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.1798   -1.6908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9008   -0.4628    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n 10  8  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 11 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 16 18  1  0  0  0  0\nM  END",
          "smiles": "CCCCCCCC(=O)OC(C)COCC(C)O",
          "formula": "C14H28O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "72421cc8-2892-4a65-a405-da0fa8fde907"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "260.3703",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d161e42c-c620-4099-acf9-19cf7591bede",
      "version": "5",
      "structure": {
        "id": "c79d42d4-8e4d-4e4e-874b-1433adb1501b",
        "molfile": "\n  Marvin  01132110192D          \n\n 18 17  0  0  0  0            999 V2000\n    1.3284   -1.6908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3284   -0.8722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0448   -0.4628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7564   -0.8722    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4728   -0.4628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1798   -0.8722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1798   -1.6908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9008   -0.4628    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6122   -0.4628    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1005   -0.8784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8167   -0.4690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5295   -0.8846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2457   -0.4752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9584   -0.8908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6747   -0.4815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.3874   -0.8971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.1036   -0.4876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1005   -1.7034    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  6  8  1  0  0  0  0\n  2  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 10 18  2  0  0  0  0\nM  END",
        "smiles": "CCCCCCCC(=O)OC(C)COCC(C)O",
        "formula": "C14H28O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "260.3703",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "2a30b7db-c9ea-4671-b33f-263944513b98",
          "b3a2d440-e3e1-4af7-9447-a2b1c3b60179"
        ],
        "stereo_centers": 2
      },
      "unii": "CJ981S4H3T"
    }
  ]
}