{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2288b256-0788-4d87-93e6-d05c102f355c",
          "code": "846-50-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=846-50-4",
          "code_system": "CAS",
          "references": [
            "e926818d-71e6-472d-84b5-8af0d125cf32",
            "1282e449-cf8b-47a3-a13f-e3a1b9c93031"
          ]
        },
        {
          "uuid": "07237c63-5785-496a-9a8b-9e7eb949afb7",
          "code": "C29488",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29488",
          "code_system": "NCI_THESAURUS",
          "references": [
            "e926818d-71e6-472d-84b5-8af0d125cf32"
          ]
        },
        {
          "uuid": "657490ff-07e2-4fbd-abb6-8fd182497ac3",
          "code": "NBK548556",
          "comments": "LiverTox|CNS|Sedative/Hypnotic|Benzodiazepine",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/NBK548556/",
          "code_system": "LIVERTOX",
          "references": [
            "c048fb9b-1daa-670e-1ed9-fd5781cdbdb8"
          ]
        },
        {
          "uuid": "7da2f342-6d79-431a-8910-e16cf3f1dd10",
          "code": "D013693",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68013693",
          "code_system": "MESH",
          "references": [
            "e926818d-71e6-472d-84b5-8af0d125cf32"
          ]
        },
        {
          "uuid": "9237ed84-c4f3-45fd-9890-2223420c82eb",
          "code": "TEMAZEPAM",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Temazepam",
          "code_system": "WIKIPEDIA",
          "references": [
            "e926818d-71e6-472d-84b5-8af0d125cf32"
          ]
        },
        {
          "uuid": "f8f9dd65-d2cb-425f-8769-8e69dec13982",
          "code": "SUB10880MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "e926818d-71e6-472d-84b5-8af0d125cf32"
          ]
        },
        {
          "uuid": "b0f6f0ac-24c5-4c6f-927a-944adc5f3000",
          "code": "2753",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=2753",
          "code_system": "INN",
          "references": [
            "e926818d-71e6-472d-84b5-8af0d125cf32"
          ]
        },
        {
          "uuid": "bff4bd44-ff88-454a-bb58-ffa133904453",
          "code": "2925",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule IV.|Depressants",
          "type": "PRIMARY",
          "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "e926818d-71e6-472d-84b5-8af0d125cf32"
          ]
        },
        {
          "uuid": "f5a2ae1a-0991-4bfc-8b8f-db2679d3b70b",
          "code": "7300",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=7300",
          "code_system": "IUPHAR",
          "references": [
            "e926818d-71e6-472d-84b5-8af0d125cf32"
          ]
        },
        {
          "uuid": "0d85aa4e-a8f0-4dd2-994e-c798d81650eb",
          "code": "10355",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/10355/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "e926818d-71e6-472d-84b5-8af0d125cf32"
          ]
        },
        {
          "uuid": "db8ed288-041d-495f-ae48-0c98f0f180a1",
          "code": "m10545",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10545?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "e926818d-71e6-472d-84b5-8af0d125cf32"
          ]
        },
        {
          "uuid": "36855de4-3fa8-4a38-b47b-5aa624a335d0",
          "code": "DB00231",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00231",
          "code_system": "DRUG BANK",
          "references": [
            "e926818d-71e6-472d-84b5-8af0d125cf32"
          ]
        },
        {
          "uuid": "df3788e3-5b87-4a17-99e6-4128649ab706",
          "code": "CHEMBL967",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL967",
          "code_system": "ChEMBL",
          "references": [
            "e926818d-71e6-472d-84b5-8af0d125cf32"
          ]
        },
        {
          "uuid": "302fc3c6-3ef5-4573-8a46-339276838f8b",
          "code": "5391",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5391",
          "code_system": "PUBCHEM",
          "references": [
            "e926818d-71e6-472d-84b5-8af0d125cf32"
          ]
        },
        {
          "uuid": "3547433b-a99c-4463-8a14-757f58c7b2fc",
          "code": "212-688-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.011.535",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "e926818d-71e6-472d-84b5-8af0d125cf32"
          ]
        },
        {
          "uuid": "1ae52a28-727b-4b32-8a2c-ef555e44fbf6",
          "code": "N05CD07",
          "comments": "ATC|NERVOUS SYSTEM|PSYCHOLEPTICS|HYPNOTICS AND SEDATIVES|Benzodiazepine derivatives|temazepam",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N05CD07&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "e926818d-71e6-472d-84b5-8af0d125cf32"
          ]
        },
        {
          "uuid": "d6d9bb08-f059-4c94-b3c4-1aa3cfd74893",
          "code": "N0000007542",
          "comments": "Chemical Ingredients [Chemical/Ingredient]|Heterocyclic Compounds [Chemical/Ingredient]|Heterocyclic Compounds, 2-Ring [Chemical/Ingredient]|Benzazepines [Chemical/Ingredient]|Benzodiazepines [Chemical/Ingredient]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000007542",
          "code_system": "NDF-RT",
          "references": [
            "e926818d-71e6-472d-84b5-8af0d125cf32"
          ]
        },
        {
          "uuid": "a0e3bafb-89c4-45dc-ae9b-c6fdadcdc8f6",
          "code": "N0000175694",
          "comments": "Established Pharmacologic Class [EPC]|Benzodiazepine [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175694",
          "code_system": "NDF-RT",
          "references": [
            "e926818d-71e6-472d-84b5-8af0d125cf32"
          ]
        },
        {
          "uuid": "e7831c27-88f8-42ff-8031-271dca9b5a61",
          "code": "QN05CD07",
          "comments": "VATC|PSYCHOLEPTICS|HYPNOTICS AND SEDATIVES|Benzodiazepine derivatives|temazepam",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN05CD07&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "e926818d-71e6-472d-84b5-8af0d125cf32"
          ]
        },
        {
          "uuid": "85c723aa-d5f8-7cab-5b7b-d548ccc04416",
          "code": "DTXSID8021309",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8021309",
          "code_system": "EPA CompTox",
          "references": [
            "9812b5b1-6f89-62a5-9c6d-17da1e143d8a"
          ]
        },
        {
          "uuid": "e558feee-bc08-46a9-c34f-f499963d72fa",
          "code": "C1012",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Antianxiety Agent[C28197]|Benzodiazepine",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1012",
          "code_system": "NCI_THESAURUS",
          "references": [
            "c048fb9b-1daa-670e-1ed9-fd5781cdbdb8"
          ]
        },
        {
          "uuid": "de73f0ba-dd57-4e48-8e78-e782cd4eec3f",
          "code": "CHB1QD2QSS",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "cc5f2c1e-2b3c-361d-b684-029b4d93a114",
          "code": "Temazepam",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM388/",
          "code_system": "LACTMED",
          "references": [
            "c048fb9b-1daa-670e-1ed9-fd5781cdbdb8"
          ]
        },
        {
          "uuid": "99249066-3aa1-266e-45e3-b7bb1d52e982",
          "code": "2585",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/2585",
          "code_system": "DRUG CENTRAL",
          "references": [
            "c048fb9b-1daa-670e-1ed9-fd5781cdbdb8"
          ]
        },
        {
          "uuid": "ef2a1633-c1de-13bc-60b9-4ea0bd084899",
          "code": "1643408",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1643408",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "c048fb9b-1daa-670e-1ed9-fd5781cdbdb8"
          ]
        },
        {
          "uuid": "b5abd282-09f8-c277-c9b9-c53e01a8a5f2",
          "code": "CHB1QD2QSS",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=CHB1QD2QSS",
          "code_system": "DAILYMED",
          "references": [
            "29f824b1-368a-6db8-d314-19234fa1ebce"
          ]
        },
        {
          "uuid": "4f772bf1-99a6-80cb-f7d6-b04b54ffb7fe",
          "code": "100000092289",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "3346f093-0122-fd22-5ca7-9034cc4b9c6f"
          ]
        },
        {
          "uuid": "82168203-df3c-7895-13ca-9260744884b4",
          "code": "246303",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=246303",
          "code_system": "NSC",
          "references": [
            "4926f963-c221-f4e0-94ec-4e74aa050688"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "513591cf-2b24-45ec-afb8-fe8b1f53b8cc",
          "amount": {
            "uuid": "a122df95-2aa1-4774-9753-4b1aa6a4bb27",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 0.2
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "3a940afd-530e-414a-a16b-546cb063530e"
          ],
          "related_substance": {
            "uuid": "eb61af07-3ac7-4f37-bb41-c9227ec46878",
            "refuuid": "f1e509b5-85de-4e34-80c8-029dbaaf1f9f",
            "name": "Oxazepam",
            "unii": "6GOW6DWN2A",
            "linking_id": "6GOW6DWN2A",
            "ref_pname": "Oxazepam",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f57bb7f7-d200-47a3-8ad8-265dbf3312ed",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "103a9520-6905-482e-97b3-a86455071b86",
            "refuuid": "39455e00-b599-4529-9e1e-f007fa4ebe3f",
            "name": "TEMAZEPAM SULFATE",
            "unii": "I1HX8463I0",
            "linking_id": "I1HX8463I0",
            "ref_pname": "TEMAZEPAM SULFATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "29516926-d868-4aa5-9faa-b465543c6967",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "de9c2381-6e33-47bf-b50d-4bf1b01170b2",
            "refuuid": "7dfb1ee3-a621-4cad-857e-88d786ac5960",
            "name": "TEMAZEPAM HYDROCHLORIDE",
            "unii": "IA4EP07006",
            "linking_id": "IA4EP07006",
            "ref_pname": "TEMAZEPAM HYDROCHLORIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "1b08888b-93e7-4113-8e76-a1b5649a1fd5",
          "type": "METABOLITE INACTIVE->PARENT",
          "references": [
            "919e8a13-27b1-434d-bfba-8697ffb665d9"
          ],
          "related_substance": {
            "uuid": "3e0e23b2-b1cc-418c-a7e9-a04bc172df65",
            "refuuid": "02227d39-4f19-45e0-bcee-f948e92e4cd1",
            "name": "TEMAZEPAM GLUCURONIDE",
            "unii": "Y1E98AMN1E",
            "linking_id": "Y1E98AMN1E",
            "ref_pname": "TEMAZEPAM GLUCURONIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "33539c98-16ff-4c9d-bbc7-f5be98c7bab8",
          "qualification": "PLASMA; URINE",
          "type": "METABOLITE INACTIVE->PARENT",
          "interaction_type": "MAJOR",
          "references": [
            "19ac39e3-a878-43ee-92da-bd468f5ef0af"
          ],
          "related_substance": {
            "uuid": "19add953-8b1e-4997-84b3-dc68043fad0d",
            "refuuid": "02227d39-4f19-45e0-bcee-f948e92e4cd1",
            "name": "TEMAZEPAM GLUCURONIDE",
            "unii": "Y1E98AMN1E",
            "linking_id": "Y1E98AMN1E",
            "ref_pname": "TEMAZEPAM GLUCURONIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "352ef810-dbb7-4e0b-b396-d3a3fb7dd1b0",
          "comments": "TRACE IN URINE; NOT IN PLASMA",
          "qualification": "URINE",
          "type": "METABOLITE->PARENT",
          "interaction_type": "MINOR",
          "references": [
            "65026921-1728-4156-afed-920ab4ee06e5"
          ],
          "related_substance": {
            "uuid": "74f978a9-6718-4a2d-9ed3-161a45ad7231",
            "refuuid": "f1e509b5-85de-4e34-80c8-029dbaaf1f9f",
            "name": "Oxazepam",
            "unii": "6GOW6DWN2A",
            "linking_id": "6GOW6DWN2A",
            "ref_pname": "Oxazepam",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "483fc009-7113-4fcd-8694-0d47f39bbb1e",
          "qualification": "PLASMA; URINE",
          "type": "METABOLITE INACTIVE->PARENT",
          "interaction_type": "MAJOR",
          "references": [
            "65026921-1728-4156-afed-920ab4ee06e5"
          ],
          "related_substance": {
            "uuid": "e4be2498-7938-4819-9c28-222e83ed9fee",
            "refuuid": "92380fac-685f-4ea4-b806-96cf4301387e",
            "name": "OXAZEPAM GLUCURONIDE",
            "unii": "26IK2C76NO",
            "linking_id": "26IK2C76NO",
            "ref_pname": "OXAZEPAM GLUCURONIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "1165a476-1c40-4ef6-a186-a6c44ae183d1",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "dd6062f4-bf28-4e97-be11-0353a224dd00",
            "refuuid": "f8cc435c-f927-49b3-8ca9-ff9edcb951a6",
            "name": "TEMAZEPAM",
            "unii": "CHB1QD2QSS",
            "linking_id": "CHB1QD2QSS",
            "ref_pname": "TEMAZEPAM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "3ab464da-d8c0-4870-8651-bd5b43da587e",
          "amount": {
            "uuid": "af1a2690-b1a3-452b-afec-4feef84dbadc",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 101,
            "low_limit": 99
          },
          "qualification": "EP",
          "type": "BASIS OF STRENGTH->SUBSTANCE",
          "interaction_type": "ASSAY (HPLC)",
          "references": [
            "59f494df-0499-4129-a37a-0510b11d922e"
          ],
          "related_substance": {
            "uuid": "5c8ecfec-7df9-427a-9275-9d3ea31cbcc6",
            "refuuid": "f8cc435c-f927-49b3-8ca9-ff9edcb951a6",
            "name": "TEMAZEPAM",
            "unii": "CHB1QD2QSS",
            "linking_id": "CHB1QD2QSS",
            "ref_pname": "TEMAZEPAM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "5e3ae1ef-7be7-4ac3-a893-fef6bccb2465",
          "amount": {
            "uuid": "a0b821b2-81d3-44a2-bb65-d2b699aa2b77",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 102,
            "low_limit": 98
          },
          "qualification": "USP",
          "type": "BASIS OF STRENGTH->SUBSTANCE",
          "interaction_type": "ASSAY (HPLC)",
          "references": [
            "3a940afd-530e-414a-a16b-546cb063530e"
          ],
          "related_substance": {
            "uuid": "ab619237-d2aa-4651-b606-17632df48103",
            "refuuid": "f8cc435c-f927-49b3-8ca9-ff9edcb951a6",
            "name": "TEMAZEPAM",
            "unii": "CHB1QD2QSS",
            "linking_id": "CHB1QD2QSS",
            "ref_pname": "TEMAZEPAM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "fa693020-dd71-4557-b6d8-38b279f6f190",
          "amount": {
            "uuid": "6168c58f-95da-4b26-a34d-a8c3dcff793d",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.2
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "59f494df-0499-4129-a37a-0510b11d922e"
          ],
          "related_substance": {
            "uuid": "c6ce6a1a-d17d-4e73-8f53-db3414526504",
            "refuuid": "0273eae2-470c-48a6-bc87-5eef3914ec22",
            "name": "DIAZEPAM N-OXIDE",
            "unii": "H00DZV8M7P",
            "linking_id": "H00DZV8M7P",
            "ref_pname": "DIAZEPAM N-OXIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "46f8edd9-8724-4fa7-9220-a36f33d0be3d",
          "amount": {
            "uuid": "ca6fe094-0421-4e5f-848d-b1101378b4a7",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 0.2
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "3a940afd-530e-414a-a16b-546cb063530e"
          ],
          "related_substance": {
            "uuid": "cb31655b-b423-480b-b59c-2ecf01f1904f",
            "refuuid": "0273eae2-470c-48a6-bc87-5eef3914ec22",
            "name": "DIAZEPAM N-OXIDE",
            "unii": "H00DZV8M7P",
            "linking_id": "H00DZV8M7P",
            "ref_pname": "DIAZEPAM N-OXIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "5d8af5e5-45ce-4a5a-a311-7707368fff61",
          "amount": {
            "uuid": "019022f7-26b2-4444-93c6-c268a00811a9",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT PEAK AREA (CORRECTION FACTOR)",
            "high_limit": 0.2
          },
          "comments": "For the calculation of contents, multiply the peak areas by 3.2",
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "59f494df-0499-4129-a37a-0510b11d922e"
          ],
          "related_substance": {
            "uuid": "9a5c6297-913a-4ca8-a04d-3452643600de",
            "refuuid": "672ebc6a-dfa0-4a7e-962c-ff97d56a573f",
            "name": "3-OXO-4,5-DIHYDRO TEMAZEPAM",
            "unii": "4M6LF65V57",
            "linking_id": "4M6LF65V57",
            "ref_pname": "3-OXO-4,5-DIHYDRO TEMAZEPAM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "86076910-0a01-4130-a82f-1e4505f2248e",
          "amount": {
            "uuid": "a63c0ada-35ed-4494-a970-da6afb09d45a",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 0.2
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "3a940afd-530e-414a-a16b-546cb063530e"
          ],
          "related_substance": {
            "uuid": "8b9ccb63-a6ff-4299-8fe6-a6f2b0bd1002",
            "refuuid": "672ebc6a-dfa0-4a7e-962c-ff97d56a573f",
            "name": "3-OXO-4,5-DIHYDRO TEMAZEPAM",
            "unii": "4M6LF65V57",
            "linking_id": "4M6LF65V57",
            "ref_pname": "3-OXO-4,5-DIHYDRO TEMAZEPAM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "5493059b-dc08-4373-8bad-d8e18c2e7fee",
          "amount": {
            "uuid": "05ab8715-fb42-4d37-8a93-feac5fc9e24e",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT PEAK AREA (CORRECTION FACTOR)",
            "high_limit": 0.2
          },
          "comments": "For the calculation of contents, multiply the peak areas by 3.1",
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "59f494df-0499-4129-a37a-0510b11d922e"
          ],
          "related_substance": {
            "uuid": "427e269c-bb54-413c-9757-ac3310226bab",
            "refuuid": "2952ec83-c83c-49b2-80de-628bad35ba55",
            "name": "3-OXO-4,5-DIHYDRO-4-METHYL TEMAZEPAM",
            "unii": "1AFC80AP6F",
            "linking_id": "1AFC80AP6F",
            "ref_pname": "3-OXO-4,5-DIHYDRO-4-METHYL TEMAZEPAM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "59e4975e-5354-47a7-9675-c0628f92a55f",
          "amount": {
            "uuid": "504ccba9-4e9b-4b88-913d-d3fc096ad5a3",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 0.2
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "3a940afd-530e-414a-a16b-546cb063530e"
          ],
          "related_substance": {
            "uuid": "f24bef66-fc56-4b0f-8349-7b76b5266578",
            "refuuid": "2952ec83-c83c-49b2-80de-628bad35ba55",
            "name": "3-OXO-4,5-DIHYDRO-4-METHYL TEMAZEPAM",
            "unii": "1AFC80AP6F",
            "linking_id": "1AFC80AP6F",
            "ref_pname": "3-OXO-4,5-DIHYDRO-4-METHYL TEMAZEPAM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "1139da61-d9bb-443c-ad64-3a13bcb99fbd",
          "amount": {
            "uuid": "ba4a2fce-a3ea-4d7b-8b81-60b61fe854a4",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.2
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "59f494df-0499-4129-a37a-0510b11d922e"
          ],
          "related_substance": {
            "uuid": "0b186435-6972-4712-b82b-f2dd70fdc698",
            "refuuid": "5cfbcc1b-e7b6-49c8-bba9-7e3070992e12",
            "name": "O-METHYL TEMAZEPAM",
            "unii": "ULA1137YSR",
            "linking_id": "ULA1137YSR",
            "ref_pname": "O-METHYL TEMAZEPAM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "ea6b8b74-6cf0-40f4-ba23-ece34fef42e9",
          "amount": {
            "uuid": "107f5ac3-3fd2-48c9-b4d3-13eb4f4ae5ed",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 0.2
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "3a940afd-530e-414a-a16b-546cb063530e"
          ],
          "related_substance": {
            "uuid": "f845a1f0-9ef2-42fb-ba56-312c407f4550",
            "refuuid": "5cfbcc1b-e7b6-49c8-bba9-7e3070992e12",
            "name": "O-METHYL TEMAZEPAM",
            "unii": "ULA1137YSR",
            "linking_id": "ULA1137YSR",
            "ref_pname": "O-METHYL TEMAZEPAM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "67f76ab5-dd4f-4155-8d38-0cdebb9912a6",
          "amount": {
            "uuid": "192e063d-3f2f-4b6b-8a9c-00fc67048fa3",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.2
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "59f494df-0499-4129-a37a-0510b11d922e"
          ],
          "related_substance": {
            "uuid": "80327013-71fe-48cf-90fd-03bbb1477349",
            "refuuid": "3dbe9f1e-15c5-477b-9b44-cdc2c2edda14",
            "name": "TEMAZEPAM ACETATE",
            "unii": "9F3H3E4BIM",
            "linking_id": "9F3H3E4BIM",
            "ref_pname": "TEMAZEPAM ACETATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "9db6a960-53a6-42af-88bc-f377f66557aa",
          "amount": {
            "uuid": "22e4c9d5-1b4f-48e0-93da-adb0f6e7abfa",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 0.2
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "3a940afd-530e-414a-a16b-546cb063530e"
          ],
          "related_substance": {
            "uuid": "926e9760-a776-49a7-9627-8293626c641f",
            "refuuid": "3dbe9f1e-15c5-477b-9b44-cdc2c2edda14",
            "name": "TEMAZEPAM ACETATE",
            "unii": "9F3H3E4BIM",
            "linking_id": "9F3H3E4BIM",
            "ref_pname": "TEMAZEPAM ACETATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "838b6f38-5d9f-4448-852f-f9cfc0db06d4",
          "amount": {
            "uuid": "cd889f3d-a456-4365-b1f2-7234cbc032b4",
            "type": "RELATIONSHIP_AMOUNT",
            "high_limit": 0.05
          },
          "comments": "Dissolve 0.400 g in methylene chloride R and dilute to 20.0 mL with the same solvent. The absorbance (2.2.25) is not greater than 0.30 at 409 nm",
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "IMPURITY (UV)",
          "references": [
            "59f494df-0499-4129-a37a-0510b11d922e"
          ],
          "related_substance": {
            "uuid": "4b0d2711-8dd1-4b60-a490-e1b73b5ce9e7",
            "refuuid": "3de2e397-12ab-4ea2-aebc-56d74dea3587",
            "name": "5-Chloro-2-methylaminobenzophenone",
            "unii": "D4GD5770PI",
            "linking_id": "D4GD5770PI",
            "ref_pname": "5-Chloro-2-methylaminobenzophenone",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "6f54a287-f500-49ed-96aa-be1dbc181260",
          "amount": {
            "uuid": "5301f275-e210-4004-b345-02235ced0e3e",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 0.05
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "3a940afd-530e-414a-a16b-546cb063530e"
          ],
          "related_substance": {
            "uuid": "dd054be1-969a-4964-b685-87d5242ac202",
            "refuuid": "3de2e397-12ab-4ea2-aebc-56d74dea3587",
            "name": "5-Chloro-2-methylaminobenzophenone",
            "unii": "D4GD5770PI",
            "linking_id": "D4GD5770PI",
            "ref_pname": "5-Chloro-2-methylaminobenzophenone",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "84ec63d8-43fa-4b1d-95b2-5f6c23a23e82",
          "amount": {
            "uuid": "bfedf76d-8b9e-404b-b36c-30b5b9be281f",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT AREA",
            "high_limit": 0.2
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "59f494df-0499-4129-a37a-0510b11d922e"
          ],
          "related_substance": {
            "uuid": "528a4cf0-a834-4a35-8642-048aa9ba7ab7",
            "refuuid": "f1e509b5-85de-4e34-80c8-029dbaaf1f9f",
            "name": "Oxazepam",
            "unii": "6GOW6DWN2A",
            "linking_id": "6GOW6DWN2A",
            "ref_pname": "Oxazepam",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "41093413-82e3-445e-87e8-65bb781682db",
          "amount": {
            "uuid": "50696d97-b2b2-41f5-bfaa-b7d70f28ef94",
            "average": 96.2,
            "units": "%"
          },
          "type": "BINDER->LIGAND",
          "references": [
            "41b3048a-ddad-6f7e-ee58-497e88fa505e"
          ],
          "related_substance": {
            "uuid": "e9b22e4a-70ca-47bf-a25e-18ea2145e4b5",
            "refuuid": "e95d330b-4c2d-44bb-a61b-860afeb4aa30",
            "name": "PLASMA PROTEIN FRACTION (HUMAN)",
            "unii": "6D53G0FD0Z",
            "linking_id": "6D53G0FD0Z",
            "ref_pname": "PLASMA PROTEIN FRACTION (HUMAN)",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "44b3af85-bdd2-48e4-849f-bdbc0d53858b",
          "name": "(RS)-TEMAZEPAM",
          "stdName": "(RS)-TEMAZEPAM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "15c57af9-2bf9-4858-8acb-543b6542c759"
          ],
          "display_name": false
        },
        {
          "uuid": "59785d33-4eab-4317-92ee-f28a4e9908c0",
          "name": "(±)-TEMAZEPAM",
          "stdName": "(+/-)-TEMAZEPAM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "15c57af9-2bf9-4858-8acb-543b6542c759"
          ],
          "display_name": false
        },
        {
          "uuid": "cb5f343c-97a1-4748-9b08-42323daf8924",
          "name": "2H-1,4-BENZODIAZEPIN-2-ONE, 7-CHLORO-1,3-DIHYDRO-3-HYDROXY-1-METHYL-5-PHENYL-",
          "stdName": "2H-1,4-BENZODIAZEPIN-2-ONE, 7-CHLORO-1,3-DIHYDRO-3-HYDROXY-1-METHYL-5-PHENYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7e1d8b57-6f4b-4dfe-ba2b-085a798141da"
          ],
          "display_name": false
        },
        {
          "uuid": "5bae5dd2-119b-4e20-908b-431d877efbb0",
          "name": "7-Chloro-1,3-dihydro-3-hydroxy-1-methyl-5-phenyl-2H-1,4-benzodiazepin-2-one",
          "stdName": "7-CHLORO-1,3-DIHYDRO-3-HYDROXY-1-METHYL-5-PHENYL-2H-1,4-BENZODIAZEPIN-2-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7e1d8b57-6f4b-4dfe-ba2b-085a798141da"
          ],
          "display_name": false
        },
        {
          "uuid": "23c8cf63-9bb0-4879-8721-30aeae66404e",
          "name": "NSC-246303",
          "stdName": "NSC-246303",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0365b58b-c910-4989-8f3f-d6b770fd7662"
          ],
          "display_name": false
        },
        {
          "uuid": "7d20fb52-76a7-4e51-a98c-34eda02a25da",
          "name": "RESTORIL",
          "stdName": "RESTORIL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7e1d8b57-6f4b-4dfe-ba2b-085a798141da"
          ],
          "display_name": false
        },
        {
          "uuid": "12398d2a-8841-45df-ba04-96a691a9de96",
          "name": "TEMAZEPAM",
          "stdName": "TEMAZEPAM",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "00b03a3f-5b17-42d0-8d4b-65443ccd8e3f",
            "aac047fe-4940-4cde-8ccf-75ab9a701529",
            "8f926293-7f6e-440a-9d70-eca52f0c4445",
            "ed9ebd5b-56a5-4f5c-95db-04a461740022",
            "7b0f545a-86a8-4780-b7cb-266b8ff17419",
            "6fa25f6e-0b66-4cc7-8f39-2d1557c843f3",
            "8baa43eb-6307-48f2-bcae-9713ac2142ee",
            "1c50963a-b715-4879-a069-a65e6346e81d",
            "2db82d7d-3add-4353-b063-43b07311c116",
            "6fe30b2a-0abe-4ebb-b385-11e6b9f9b521",
            "06651a55-088e-461c-9787-1d47e4554729",
            "fe33b76a-1f65-401c-9d9b-3fbff73d0172",
            "f82a46f7-f579-4c80-858a-eb49caaac3ed",
            "433c9d69-a7f6-472e-a369-fe98c33ce294",
            "2f612885-7599-43eb-a34f-12f7acee0207",
            "75290661-ba34-475c-a0df-3ad090ddf7b1",
            "4395cefa-f4db-46b2-8a79-0751506d7550",
            "91ad7518-191e-45dd-bc97-d72645d1d4ce",
            "e2b037bc-d274-4601-9d88-4f2e15f1941b"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "f7ac8245-82ae-414c-b31f-f588a0730244",
              "name_org": "INN"
            },
            {
              "uuid": "34133e74-6030-4e14-a90c-a9457434e54c",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "c0c8a893-ea16-4d80-8a87-f24597a9eabb",
          "name": "TEMAZEPAM CIV",
          "stdName": "TEMAZEPAM CIV",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9af491df-4d06-4e0b-b741-e805ebd1788f",
            "703cbc1e-61ef-4ff2-87d6-f7f6ee35b0d2"
          ],
          "display_name": false
        },
        {
          "uuid": "bf4231d1-174f-4f69-a641-8b8bd0128a3b",
          "name": "TEMAZEPAM CIV [USP-RS]",
          "stdName": "TEMAZEPAM CIV [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9af491df-4d06-4e0b-b741-e805ebd1788f"
          ],
          "display_name": false
        },
        {
          "uuid": "c26a4c2c-ed7c-2bcd-3241-bdcb02612248",
          "name": "TEMAZEPAM [EP MONOGRAPH]",
          "stdName": "TEMAZEPAM [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d6fe97e-9615-334b-3cbc-deb9737533e2"
          ],
          "display_name": false
        },
        {
          "uuid": "e7049e7a-495e-9478-f247-1cfc2dc7a2ab",
          "name": "TEMAZEPAM [IARC]",
          "stdName": "TEMAZEPAM [IARC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6a903b80-bdfd-439f-cb3c-b5c8a4f79ad5"
          ],
          "display_name": false
        },
        {
          "uuid": "b2e35bfe-d78b-469b-be4c-00511e6c8a0a",
          "name": "TEMAZEPAM [MART.]",
          "stdName": "TEMAZEPAM [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "00b03a3f-5b17-42d0-8d4b-65443ccd8e3f"
          ],
          "display_name": false
        },
        {
          "uuid": "80e3e6fc-aa2e-4b56-8552-657476a36c46",
          "name": "TEMAZEPAM [MI]",
          "stdName": "TEMAZEPAM [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "06651a55-088e-461c-9787-1d47e4554729"
          ],
          "display_name": false
        },
        {
          "uuid": "584402da-8bc0-4d87-bcf1-acd58c2b36b9",
          "name": "TEMAZEPAM [ORANGE BOOK]",
          "stdName": "TEMAZEPAM [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2f612885-7599-43eb-a34f-12f7acee0207"
          ],
          "display_name": false
        },
        {
          "uuid": "3cecbbe6-c7c0-489d-97b5-57e3693b26a7",
          "name": "TEMAZEPAM [USAN]",
          "stdName": "TEMAZEPAM [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6fe30b2a-0abe-4ebb-b385-11e6b9f9b521"
          ],
          "display_name": false
        },
        {
          "uuid": "77cae85d-8517-7359-bb0c-b8cb6f6b36e2",
          "name": "TEMAZEPAM [USP MONOGRAPH]",
          "stdName": "TEMAZEPAM [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "04634116-ae0d-e30a-48d0-c5423b2492d8"
          ],
          "display_name": false
        },
        {
          "uuid": "b5587a5f-f193-4791-a4c6-f110a3fb8a81",
          "name": "TEMAZEPAM [VANDF]",
          "stdName": "TEMAZEPAM [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4395cefa-f4db-46b2-8a79-0751506d7550"
          ],
          "display_name": false
        },
        {
          "uuid": "7d03e973-ea9b-44b4-1b9d-ee2c2f1a345d",
          "name": "Temazepam [WHO-DD]",
          "stdName": "TEMAZEPAM [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "46f667f0-b49e-a456-ac68-d60282a75c7a"
          ],
          "display_name": false
        },
        {
          "uuid": "54b5574a-5f61-4a76-8b6b-e43d944a28db",
          "name": "WY-3917",
          "stdName": "WY-3917",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7e1d8b57-6f4b-4dfe-ba2b-085a798141da"
          ],
          "display_name": false
        },
        {
          "uuid": "83a6de02-ccc4-4c5a-a07a-e44621f9f134",
          "name": "temazepam [INN]",
          "stdName": "TEMAZEPAM [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e2b037bc-d274-4601-9d88-4f2e15f1941b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "91ad7518-191e-45dd-bc97-d72645d1d4ce",
          "citation": "USP dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "7e1d8b57-6f4b-4dfe-ba2b-085a798141da",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e2b037bc-d274-4601-9d88-4f2e15f1941b",
          "citation": "INN Proposed List 22",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL22.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6fe30b2a-0abe-4ebb-b385-11e6b9f9b521",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8f926293-7f6e-440a-9d70-eca52f0c4445",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8baa43eb-6307-48f2-bcae-9713ac2142ee",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2f612885-7599-43eb-a34f-12f7acee0207",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "00b03a3f-5b17-42d0-8d4b-65443ccd8e3f",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "06651a55-088e-461c-9787-1d47e4554729",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "15c57af9-2bf9-4858-8acb-543b6542c759",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f82a46f7-f579-4c80-858a-eb49caaac3ed",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4395cefa-f4db-46b2-8a79-0751506d7550",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9af491df-4d06-4e0b-b741-e805ebd1788f",
          "citation": "USP-RS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0365b58b-c910-4989-8f3f-d6b770fd7662",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e926818d-71e6-472d-84b5-8af0d125cf32",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390003000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "919e8a13-27b1-434d-bfba-8697ffb665d9",
          "citation": "HTTP://WWW.ACCESSDATA.FDA.GOV/SPL/DATA/73930ACB-C116-402A-87DB-F02222E3FF25/73930ACB-C116-402A-87DB-F02222E3FF25.XML",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "65026921-1728-4156-afed-920ab4ee06e5",
          "citation": "BIOPHARMACEUTICS & DRUG DISPOSITION, VOLUME 11, ISSUE 6, PAGES 499?506, AUGUST/SEPTEMBER 1990",
          "url": "http://onlinelibrary.wiley.com/doi/10.1002/bdd.2510110604/abstract",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "59f494df-0499-4129-a37a-0510b11d922e",
          "citation": "EP 7.8 TEMAZEPAM MONOGRAPH",
          "doc_type": "EUROPEAN PHARMACOPEIA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3a940afd-530e-414a-a16b-546cb063530e",
          "citation": "USP 36 TEMAZEPAM MONOGRAPH",
          "doc_type": "USP",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "28270f14-e7b3-4336-bef4-728973657a36",
          "citation": "SRS import [CHB1QD2QSS]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=CHB1QD2QSS",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390003000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "76561be0-adc8-4113-881e-87194f0a8fde",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ed9ebd5b-56a5-4f5c-95db-04a461740022",
          "citation": "TEMAZEPAM [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "433c9d69-a7f6-472e-a369-fe98c33ce294",
          "citation": "TEMAZEPAM [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "aac047fe-4940-4cde-8ccf-75ab9a701529",
          "citation": "TEMAZEPAM [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2db82d7d-3add-4353-b063-43b07311c116",
          "citation": "TEMAZEPAM [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7b0f545a-86a8-4780-b7cb-266b8ff17419",
          "citation": "TEMAZEPAM [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "75290661-ba34-475c-a0df-3ad090ddf7b1",
          "citation": "TEMAZEPAM [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6fa25f6e-0b66-4cc7-8f39-2d1557c843f3",
          "citation": "TEMAZEPAM [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fe33b76a-1f65-401c-9d9b-3fbff73d0172",
          "citation": "TEMAZEPAM [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1c50963a-b715-4879-a069-a65e6346e81d",
          "citation": "TEMAZEPAM [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "703cbc1e-61ef-4ff2-87d6-f7f6ee35b0d2",
          "citation": "TEMAZEPAM CIV [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "41b3048a-ddad-6f7e-ee58-497e88fa505e",
          "citation": "Pharmacol Rev 65:578–640, April 2013",
          "url": "http://dx.doi.org/10.1124/pr.111.005439",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "9812b5b1-6f89-62a5-9c6d-17da1e143d8a",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=846-50-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a69dc4fc-9810-2bb9-e563-ff128cde254b",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+846-50-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6a903b80-bdfd-439f-cb3c-b5c8a4f79ad5",
          "citation": "IARC",
          "doc_type": "IARC",
          "public_domain": true
        },
        {
          "uuid": "c048fb9b-1daa-670e-1ed9-fd5781cdbdb8",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "1282e449-cf8b-47a3-a13f-e3a1b9c93031",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "04634116-ae0d-e30a-48d0-c5423b2492d8",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "19ac39e3-a878-43ee-92da-bd468f5ef0af",
          "citation": "J Chromatogr 1991 Aug 23;568(2):427-36",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1d6fe97e-9615-334b-3cbc-deb9737533e2",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "4926f963-c221-f4e0-94ec-4e74aa050688",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "46f667f0-b49e-a456-ac68-d60282a75c7a",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "29f824b1-368a-6db8-d314-19234fa1ebce",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "3346f093-0122-fd22-5ca7-9034cc4b9c6f",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "af412e75-ea08-47b4-9421-22aa19159586",
          "id": "af412e75-ea08-47b4-9421-22aa19159586",
          "molfile": "\n  Marvin  01132109052D          \n\n 21 23  0  0  0  0            999 V2000\n    5.9174   -2.4490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1974   -2.1393    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5161   -2.6090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7716   -3.4064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1961   -4.0103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4090   -3.8245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8516   -4.4206    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.1768   -3.0322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7265   -2.4284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3858   -1.6877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7265   -0.9574    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5394   -0.7664    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.7303    0.0413    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1871   -1.2774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9252   -0.9290    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5574   -1.6877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1394   -2.3922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3084   -2.3922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8955   -1.6645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3187   -0.9574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1394   -0.9677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 14  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3  9  2  0  0  0  0\n  5  4  2  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  6  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 16 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 12  1  0  0  0  0\n 15 14  2  0  0  0  0\n 17 16  1  0  0  0  0\n 21 16  2  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\nM  END",
          "smiles": "CN1c2ccc(cc2C(=NC(C1=O)O)c3ccccc3)Cl",
          "formula": "C16H13ClN2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "58f7b2b7-f0f7-4314-9c94-770a9b4c8278"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "300.7402",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f8cc435c-f927-49b3-8ca9-ff9edcb951a6",
      "version": "36",
      "structure": {
        "id": "5f919571-f351-4daf-b22a-87657ed87fb7",
        "molfile": "\n  Marvin  01132104572D          \n\n 21 23  0  0  0  0            999 V2000\n    3.7265   -0.9574    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1974   -2.1393    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7265   -2.4284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3858   -1.6877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1871   -1.2774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5161   -2.6090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5394   -0.7664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7716   -3.4064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1768   -3.0322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9252   -0.9290    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5574   -1.6877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7303    0.0413    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4090   -3.8245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9174   -2.4490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1961   -4.0103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8516   -4.4206    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    2.1394   -0.9677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1394   -2.3922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3084   -2.3922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3187   -0.9574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8955   -1.6645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  5  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  1  2  0  0  0  0\n  5  7  1  0  0  0  0\n  6  3  2  0  0  0  0\n  7  1  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9  3  1  0  0  0  0\n 10  5  2  0  0  0  0\n 11  4  1  0  0  0  0\n  7 12  1  0  0  0  0\n 13  9  2  0  0  0  0\n 14  2  1  0  0  0  0\n 15 13  1  0  0  0  0\n 16 13  1  0  0  0  0\n 17 11  2  0  0  0  0\n 18 11  1  0  0  0  0\n 19 18  2  0  0  0  0\n 20 17  1  0  0  0  0\n 21 19  1  0  0  0  0\n  6  2  1  0  0  0  0\n 21 20  2  0  0  0  0\n 15  8  2  0  0  0  0\nM  END",
        "smiles": "CN1c2ccc(cc2C(=NC(C1=O)O)c3ccccc3)Cl",
        "formula": "C16H13ClN2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "300.7402",
        "optical_activity": "( + / - )",
        "references": [
          "76561be0-adc8-4113-881e-87194f0a8fde",
          "28270f14-e7b3-4336-bef4-728973657a36",
          "e2b037bc-d274-4601-9d88-4f2e15f1941b"
        ],
        "stereo_centers": 1
      },
      "unii": "CHB1QD2QSS"
    }
  ]
}