{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a51d6cb0-bd76-4472-a088-52cbfa83fca9",
          "code": "C036042",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67036042",
          "code_system": "MESH",
          "references": [
            "0527968d-9ee0-493f-aa6d-f55ef69be3f8"
          ]
        },
        {
          "uuid": "605531f3-0fd7-40f3-9cca-22d666a347c4",
          "code": "21 CFR 176.170",
          "comments": "PART 176 -- INDIRECT FOOD ADDITIVES: PAPER AND PAPERBOARD COMPONENTS|Subpart B--Substances for Use Only as Components of Paper and Paperboard|Sec. 176.170 Components of paper and paperboard in contact with aqueous and fatty foods.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=176.170",
          "code_system": "CFR",
          "references": [
            "0527968d-9ee0-493f-aa6d-f55ef69be3f8"
          ]
        },
        {
          "uuid": "95685e4d-e6b5-41bd-8754-f4e5be6d206f",
          "code": "201-545-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.405",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "0527968d-9ee0-493f-aa6d-f55ef69be3f8"
          ]
        },
        {
          "uuid": "5dab9d01-1279-4031-8b0b-e33cee831078",
          "code": "6777",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6777",
          "code_system": "PUBCHEM",
          "references": [
            "0527968d-9ee0-493f-aa6d-f55ef69be3f8"
          ]
        },
        {
          "uuid": "316a0330-0a8a-4a2e-9b28-a5606114b542",
          "code": "84-61-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=84-61-7",
          "code_system": "CAS",
          "references": [
            "0527968d-9ee0-493f-aa6d-f55ef69be3f8",
            "d0490fe1-716b-4e3f-a5b7-d6050bd04379"
          ]
        },
        {
          "uuid": "0f18cb16-4a33-a521-5874-886a6cc41643",
          "code": "5246",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/5246",
          "code_system": "HSDB",
          "references": [
            "3fe95130-b7f9-823f-2188-cffd16650314"
          ]
        },
        {
          "uuid": "37da8a69-faa4-b9ed-4ed4-c194fef903a2",
          "code": "DTXSID5025021",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5025021",
          "code_system": "EPA CompTox",
          "references": [
            "4d2f0be4-0f86-b058-d2e6-ecdcb24e0973"
          ]
        },
        {
          "uuid": "4f3489e5-1140-4008-92b2-fb6974aceca0",
          "code": "CGD15M7H2N",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "37424d80-a853-0638-57b5-46f112648856",
          "code": "6101",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=6101",
          "code_system": "NSC",
          "references": [
            "e1c12512-7c7a-f011-5009-f6fc6c464f9f"
          ]
        },
        {
          "uuid": "5f72bb5a-0560-5cc3-d014-c630ebbc2723",
          "code": "300000053249",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "27d5d140-6741-10b3-a87e-79615ee367ae"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "913b50a5-5368-4dfa-83a3-8536ca89f047",
          "name": "1,2-BENZENEDICARBOXYLIC ACID, DICYCLOHEXYL ESTER",
          "stdName": "1,2-BENZENEDICARBOXYLIC ACID, DICYCLOHEXYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cbbe6db9-ff5c-4133-bc3a-4135f46ab8c4",
            "8dce996b-d1cc-43e9-be58-8a222e15f2c1"
          ],
          "display_name": false
        },
        {
          "uuid": "00499933-7fdc-4c13-a83f-dc93e45e61ae",
          "name": "CYCLOHEXYL 2-(CYCLOHEXYLOXYCARBONYL)BENZOATE",
          "stdName": "CYCLOHEXYL 2-(CYCLOHEXYLOXYCARBONYL)BENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cbbe6db9-ff5c-4133-bc3a-4135f46ab8c4",
            "8dce996b-d1cc-43e9-be58-8a222e15f2c1"
          ],
          "display_name": false
        },
        {
          "uuid": "d1185a8f-4771-43a0-adc3-4424a2fa0fd2",
          "name": "DICYCLOHEXYL BENZENE-1,2-DICARBOXYLATE",
          "stdName": "DICYCLOHEXYL BENZENE-1,2-DICARBOXYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cbbe6db9-ff5c-4133-bc3a-4135f46ab8c4",
            "8dce996b-d1cc-43e9-be58-8a222e15f2c1"
          ],
          "display_name": false
        },
        {
          "uuid": "bf672ac4-cc5c-43f5-92a7-ba6966c512c9",
          "name": "DICYCLOHEXYL PHTHALATE",
          "stdName": "DICYCLOHEXYL PHTHALATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a412ecaa-60fc-4559-8ffd-2c6296cc5e03",
            "30d0de9a-e997-4047-9884-6c2d6dc9142c",
            "cbbe6db9-ff5c-4133-bc3a-4135f46ab8c4",
            "436d7b4c-2712-4ba8-b798-ff42a641a4a7"
          ],
          "display_name": true
        },
        {
          "uuid": "440ff3ed-35e6-4eb2-863e-1ea3bfa9cf72",
          "name": "DICYCLOHEXYL PHTHALATE [HSDB]",
          "stdName": "DICYCLOHEXYL PHTHALATE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30d0de9a-e997-4047-9884-6c2d6dc9142c",
            "cbbe6db9-ff5c-4133-bc3a-4135f46ab8c4"
          ],
          "display_name": false
        },
        {
          "uuid": "bab6a589-3004-43b7-ac3e-bb01b1b00b66",
          "name": "ERGOPLAST FDC",
          "stdName": "ERGOPLAST FDC",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cbbe6db9-ff5c-4133-bc3a-4135f46ab8c4",
            "8dce996b-d1cc-43e9-be58-8a222e15f2c1"
          ],
          "display_name": false
        },
        {
          "uuid": "9bcef82a-44e7-4077-84c1-1487e9c1058f",
          "name": "NSC-6101",
          "stdName": "NSC-6101",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dcb43b91-f79b-40d8-84f7-2584e3ea7d4d",
            "cbbe6db9-ff5c-4133-bc3a-4135f46ab8c4"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a412ecaa-60fc-4559-8ffd-2c6296cc5e03",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "8dce996b-d1cc-43e9-be58-8a222e15f2c1",
          "citation": "CHEMSPIDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cbbe6db9-ff5c-4133-bc3a-4135f46ab8c4",
          "citation": "CHEMSPIDER",
          "doc_type": "CHEMSPIDER",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dcb43b91-f79b-40d8-84f7-2584e3ea7d4d",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "30d0de9a-e997-4047-9884-6c2d6dc9142c",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0527968d-9ee0-493f-aa6d-f55ef69be3f8",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390936000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ef60a9c3-b7ee-4416-9846-0b06dfbe12bf",
          "citation": "SRS import [CGD15M7H2N]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=CGD15M7H2N",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390936000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "415735c6-5c09-45c9-8ac5-2833a1d8f461",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "436d7b4c-2712-4ba8-b798-ff42a641a4a7",
          "citation": "DICYCLOHEXYL PHTHALATE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3fe95130-b7f9-823f-2188-cffd16650314",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+84-61-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4d2f0be4-0f86-b058-d2e6-ecdcb24e0973",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=84-61-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d0490fe1-716b-4e3f-a5b7-d6050bd04379",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "e1c12512-7c7a-f011-5009-f6fc6c464f9f",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "27d5d140-6741-10b3-a87e-79615ee367ae",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "81d08271-33ef-4931-ac2e-d03d69c7dc96",
          "id": "81d08271-33ef-4931-ac2e-d03d69c7dc96",
          "molfile": "\n  Marvin  01132106442D          \n\n 24 26  0  0  0  0            999 V2000\n    7.1405   -3.8214    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4106   -4.2361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6992   -3.8214    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9807   -4.2246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2737   -3.8067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5547   -4.2093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5547   -5.0327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2593   -5.4620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9807   -5.0558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4106   -5.0633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6992   -5.4889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6992   -6.2970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4106   -6.7104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1405   -6.2970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1405   -5.4889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8514   -5.0633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8514   -4.2361    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5620   -5.4889    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2767   -5.0633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9991   -5.4696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7022   -5.0558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7022   -4.2323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9837   -3.8214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2767   -4.2430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  2  3  1  0  0  0  0\n 10  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  9  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10 11  1  0  0  0  0\n 15 10  2  0  0  0  0\n 11 12  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 24  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\nM  END",
          "smiles": "C1CCC(CC1)OC(=O)c2ccccc2C(=O)OC3CCCCC3",
          "formula": "C20H26O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ab06d4c5-ddda-4244-9dc9-8d2fb33caba7"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "330.4188",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a9f4025a-9d88-43ba-adcc-bff78ac14e08",
      "version": "6",
      "structure": {
        "id": "06452312-570f-4b50-b185-3b117ea51114",
        "molfile": "\n  Marvin  01132100372D          \n\n 24 26  0  0  0  0            999 V2000\n    7.1412   -5.4894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4112   -5.0638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4112   -4.2365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6998   -3.8218    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9812   -4.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2741   -3.8071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5551   -4.2097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5551   -5.0332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2597   -5.4625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9812   -5.0563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1412   -3.8218    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6998   -5.4894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6998   -6.2976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4112   -6.7111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1412   -6.2976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8522   -5.0638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5628   -5.4894    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2776   -5.0638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0001   -5.4701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7033   -5.0563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7033   -4.2327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9847   -3.8218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2776   -4.2434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8522   -4.2365    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n  5 10  1  0  0  0  0\n  3 11  2  0  0  0  0\n  2 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n  1 15  2  0  0  0  0\n  1 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 18 23  1  0  0  0  0\n 16 24  2  0  0  0  0\nM  END",
        "smiles": "C1CCC(CC1)OC(=O)c2ccccc2C(=O)OC3CCCCC3",
        "formula": "C20H26O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "330.4188",
        "optical_activity": "NONE",
        "references": [
          "415735c6-5c09-45c9-8ac5-2833a1d8f461",
          "ef60a9c3-b7ee-4416-9846-0b06dfbe12bf"
        ],
        "stereo_centers": 0
      },
      "unii": "CGD15M7H2N"
    }
  ]
}