{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "01c9725a-1e47-4fc4-863b-ab63b028b304", "code": "512-61-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=512-61-8", "code_system": "CAS", "references": [ "5fcd23da-f63f-4724-8e5d-44ba3476e404", "f0116b33-2d3d-4c0b-b1a2-d7db05b369a5" ] }, { "uuid": "6652e00d-1f0f-46a2-be78-c416efd6113c", "code": "CG25XV7SXN", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "204d6fbc-8ac7-2168-f362-7c00bddc0735", "code": "DTXSID60862085", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60862085", "code_system": "EPA CompTox" } ], "substance_class": "chemical", "names": [ { "uuid": "012a8bf3-ca55-402c-898c-c1cef6253c11", "name": "(-)-.ALPHA.-SANTALENE", "stdName": "(-)-.ALPHA.-SANTALENE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "6b09af1d-6c65-4142-9a55-65883c40b2a8" ], "display_name": false }, { "uuid": "a844a90d-ee59-4c6d-bd37-e186cd4231ac", "name": ".ALPHA.-SANTALENE, (-)-", "stdName": ".ALPHA.-SANTALENE, (-)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e56f4ce2-6b29-4e2e-95c6-9fd56c78b03a" ], "display_name": true }, { "uuid": "eee01fd0-eef8-402c-89c9-f71efd41be85", "name": "1,7-DIMETHYL-7-(4-METHYL-3-PENTEN-1-YL)CYCLOHEPTENE", "stdName": "1,7-DIMETHYL-7-(4-METHYL-3-PENTEN-1-YL)CYCLOHEPTENE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "6b09af1d-6c65-4142-9a55-65883c40b2a8" ], "display_name": false }, { "uuid": "cd1f752c-12a1-44be-ba1b-01b6687c3ea9", "name": "CYCLOHEPTENE, 1,7-DIMETHYL-7-(4-METHYL-3-PENTEN-1-YL)-", "stdName": "CYCLOHEPTENE, 1,7-DIMETHYL-7-(4-METHYL-3-PENTEN-1-YL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "6b09af1d-6c65-4142-9a55-65883c40b2a8" ], "display_name": false }, { "uuid": "fd7553ad-0275-4bc3-99dc-f12984fbecfc", "name": "SANTALENE", "stdName": "SANTALENE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "f0116b33-2d3d-4c0b-b1a2-d7db05b369a5" ], "display_name": false }, { "uuid": "5ee7d16c-7ebc-4531-93ed-a5ad2877f625", "name": "TRICYCLO(2.2.1.02,6)HEPTANE, 1,7-DIMETHYL-7-(4-METHYL-3-PENTENYL)-, (-)-", "stdName": "TRICYCLO(2.2.1.02,6)HEPTANE, 1,7-DIMETHYL-7-(4-METHYL-3-PENTENYL)-, (-)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "6b09af1d-6c65-4142-9a55-65883c40b2a8" ], "display_name": false } ], "references": [ { "uuid": "e56f4ce2-6b29-4e2e-95c6-9fd56c78b03a", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "6b09af1d-6c65-4142-9a55-65883c40b2a8", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "5fcd23da-f63f-4724-8e5d-44ba3476e404", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393611000, "tags": [ "NOMEN" ] }, { "uuid": "d3304580-343b-45a0-af4a-bb2eedd0999d", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f0116b33-2d3d-4c0b-b1a2-d7db05b369a5", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "c7ea526f-797b-4a9b-83a1-4666a46d3e62", "id": "c7ea526f-797b-4a9b-83a1-4666a46d3e62", "molfile": "\n Marvin 02182116392D \n\n 18 20 0 0 1 0 999 V2000\n 8.7603 -3.0610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9232 -3.5633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4189 -3.5992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2143 -3.2980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8727 -3.8362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3510 -2.4585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0144 -3.3207 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 7.8274 -4.6912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2481 -4.1119 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 6.3998 -3.2079 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7944 -3.5114 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 6.8595 -2.2935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1121 -2.6378 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5346 -2.9799 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 6.0853 -3.3207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8878 -4.8214 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2974 -4.1119 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.5937 -2.7415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 3 1 0 0 0 0\n 7 2 1 6 0 0 0\n 3 4 2 0 0 0 0\n 5 4 1 0 0 0 0\n 6 4 1 0 0 0 0\n 7 14 1 0 0 0 0\n 9 7 1 0 0 0 0\n 7 18 1 1 0 0 0\n 9 8 1 1 0 0 0\n 17 9 1 0 0 0 0\n 9 11 1 0 0 0 0\n 11 10 1 1 0 0 0\n 17 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 14 12 1 0 0 0 0\n 14 13 1 6 0 0 0\n 15 14 1 0 0 0 0\n 17 15 1 0 0 0 0\n 17 16 1 1 0 0 0\nM END", "smiles": "CC(=CCC[C@@]1(C)[C@@]2([H])C[C@]3([H])[C@]([H])(C2)[C@@]31C)C", "formula": "C15H24", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "307afb8d-49cd-4fe2-9113-9e3c60d565e8" }, "defined_stereo": 3, "ez_centers": 0, "molecular_weight": "204.3516", "optical_activity": "UNSPECIFIED", "stereo_centers": 3 } ], "definition_level": "COMPLETE", "uuid": "2f0adc95-2485-4f8d-9c84-b8215c5e5593", "version": "11", "structure": { "id": "245c12f5-5dac-4a59-ac08-7a1459a5c014", "molfile": "\n JSDraw202182116392D\n\n 18 20 0 0 1 0 0 V2000\n 25.8652 -6.7855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.3296 -7.7068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.0731 -7.7726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5320 -7.2202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.7398 -8.2073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7829 -5.6804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.6627 -7.2618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.1538 -9.7756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.0913 -8.7131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.5353 -7.0550 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 22.2592 -7.6115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.3785 -5.3776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.0076 -6.0092 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 21.7825 -6.6367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.9585 -7.2618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.5962 -10.0144 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 21.3474 -8.7131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.7252 -6.1993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 5 4 1 0 0 0 0\n 6 4 1 0 0 0 0\n 17 9 1 0 0 0 0\n 7 14 1 0 0 0 0\n 9 7 1 0 0 0 0\n 9 8 1 1 0 0 0\n 9 11 1 0 0 0 0\n 17 11 1 0 0 0 0\n 11 10 1 1 0 0 0\n 11 12 1 0 0 0 0\n 14 12 1 0 0 0 0\n 14 13 1 6 0 0 0\n 15 14 1 0 0 0 0\n 17 15 1 0 0 0 0\n 17 16 1 1 0 0 0\n 7 2 1 6 0 0 0\n 7 18 1 1 0 0 0\nM END", "smiles": "CC(=CCC[C@@]1(C)[C@@]2([H])C[C@]3([H])[C@]([H])(C2)[C@@]31C)C", "formula": "C15H24", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "204.3516", "optical_activity": "( - )", "references": [ "d3304580-343b-45a0-af4a-bb2eedd0999d" ], "stereo_centers": 4 }, "unii": "CG25XV7SXN" } ] }