{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9a8a43ec-2f18-41be-bc41-1816b9fd8415",
          "code": "6294-16-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=6294-16-2",
          "code_system": "CAS",
          "references": [
            "044ad58e-10f9-45ed-8b39-e25401c9d278",
            "e555148b-3d1a-4750-b7a8-7abf87e07d38"
          ]
        },
        {
          "uuid": "ce7f389d-c7d0-4c13-8d13-6a209f21227d",
          "code": "m5637",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5637?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "044ad58e-10f9-45ed-8b39-e25401c9d278"
          ]
        },
        {
          "uuid": "51230be3-bb39-49c0-84c4-125c91ac8b4f",
          "code": "445929",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/445929",
          "code_system": "PUBCHEM",
          "references": [
            "044ad58e-10f9-45ed-8b39-e25401c9d278"
          ]
        },
        {
          "uuid": "c5c52ef5-62eb-d54f-0f88-8d17e5e987ae",
          "code": "DB03511",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB03511",
          "code_system": "DRUG BANK",
          "references": [
            "b7bf3923-89db-8858-0b43-b5b0f9857094"
          ]
        },
        {
          "uuid": "9bf802c3-1458-4239-9236-5fbcfa2b4873",
          "code": "CEP8I6411H",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "92b38086-0613-05d5-8026-62fc9f56bc9e",
          "code": "DTXSID60873878",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60873878",
          "code_system": "EPA CompTox",
          "references": [
            "b7bf3923-89db-8858-0b43-b5b0f9857094"
          ]
        },
        {
          "uuid": "f2778136-12d6-2e9c-c348-35ba8006befd",
          "code": "9248",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=9248",
          "code_system": "NSC",
          "references": [
            "198d065e-9d5b-de2d-4971-f49dd223972e"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "6b0fc1d0-6d5e-42ed-9761-8dc997cfb66f",
          "type": "SOLVATE->ANHYDROUS",
          "references": [
            "36ba0a10-d1fa-4ef8-8ee6-c4780c27c8a6"
          ],
          "related_substance": {
            "uuid": "83d5204b-a368-4b97-8018-8241528e6bc8",
            "refuuid": "3bfad7cd-80c8-42d1-bba6-65a2a2ac99fc",
            "name": ".ALPHA.-D-GALACTURONIC ACID MONOHYDRATE",
            "unii": "HU26LP8S4X",
            "linking_id": "HU26LP8S4X",
            "ref_pname": ".ALPHA.-D-GALACTURONIC ACID MONOHYDRATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1214a63e-8c66-470a-b762-db61cb420c47",
          "name": ".ALPHA.-D-GALACTOPYRANURONIC ACID",
          "stdName": ".ALPHA.-D-GALACTOPYRANURONIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "966aeac9-44ae-4cfb-9b8d-ce8f9a63ffb5"
          ],
          "display_name": false
        },
        {
          "uuid": "440b4c7b-5548-400d-9ebb-39889805862a",
          "name": ".ALPHA.-D-GALACTURONIC ACID",
          "stdName": ".ALPHA.-D-GALACTURONIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "029879a9-6289-41cf-9a44-72474cda92a7"
          ],
          "display_name": true
        },
        {
          "uuid": "e5ff9561-1913-406f-ab9a-cd0c98987916",
          "name": ".ALPHA.-D-GALACTURONIC ACID (CONSTITUENT OF CRANBERRY LIQUID PREPARATION) [DSC]",
          "stdName": ".ALPHA.-D-GALACTURONIC ACID (CONSTITUENT OF CRANBERRY LIQUID PREPARATION) [DSC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cb5c5fe2-2790-4c8a-8def-3d48492c7de2"
          ],
          "display_name": false
        },
        {
          "uuid": "0bd93be3-2b64-4583-be78-54ee9cec1a30",
          "name": "ALPHA-D-GALACTURONIC ACID",
          "stdName": "ALPHA-D-GALACTURONIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "029879a9-6289-41cf-9a44-72474cda92a7"
          ],
          "display_name": false
        },
        {
          "uuid": "4c9ce648-daa9-4ddd-a142-680bca8c6676",
          "name": "D-GALACTURONIC ACID .ALPHA.-FORM",
          "stdName": "D-GALACTURONIC ACID .ALPHA.-FORM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c93e90fa-0315-4a13-90f8-50f3a93d0b0a",
            "2759fa8b-bce7-41bc-9ba5-d88b97fde642"
          ],
          "display_name": false
        },
        {
          "uuid": "6d4530c3-2b0e-4331-86c2-74246683760f",
          "name": "D-GALACTURONIC ACID .ALPHA.-FORM [MI]",
          "stdName": "D-GALACTURONIC ACID .ALPHA.-FORM [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2759fa8b-bce7-41bc-9ba5-d88b97fde642"
          ],
          "display_name": false
        },
        {
          "uuid": "ae4a74c0-47e9-4df2-915b-79f8b1aa2ac9",
          "name": "GALACTOPYRANURONIC ACID, .ALPHA.-D-",
          "stdName": "GALACTOPYRANURONIC ACID, .ALPHA.-D-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "966aeac9-44ae-4cfb-9b8d-ce8f9a63ffb5"
          ],
          "display_name": false
        },
        {
          "uuid": "6425b136-5968-405e-88ca-0f23aa915ae1",
          "name": "NSC-9248",
          "stdName": "NSC-9248",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "966aeac9-44ae-4cfb-9b8d-ce8f9a63ffb5"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "029879a9-6289-41cf-9a44-72474cda92a7",
          "citation": "fda_srs",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "966aeac9-44ae-4cfb-9b8d-ce8f9a63ffb5",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2759fa8b-bce7-41bc-9ba5-d88b97fde642",
          "citation": "merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cb5c5fe2-2790-4c8a-8def-3d48492c7de2",
          "citation": "USP-DSC, VOL.2, 2015",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "044ad58e-10f9-45ed-8b39-e25401c9d278",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390882000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "01567af9-7179-4ac9-b56b-f490f0b0f1b1",
          "citation": "SRS import [CEP8I6411H]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=CEP8I6411H",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390882000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1993bedd-74d7-4cbb-9151-77054e50aa07",
          "citation": "fda_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c93e90fa-0315-4a13-90f8-50f3a93d0b0a",
          "citation": "D-GALACTURONIC ACID .ALPHA.-FORM [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "36ba0a10-d1fa-4ef8-8ee6-c4780c27c8a6",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "b7bf3923-89db-8858-0b43-b5b0f9857094",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "e555148b-3d1a-4750-b7a8-7abf87e07d38",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "198d065e-9d5b-de2d-4971-f49dd223972e",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1d7e1243-6b84-4526-a83e-c2b2f35995ac",
          "id": "1d7e1243-6b84-4526-a83e-c2b2f35995ac",
          "molfile": "\n  Marvin  01132101422D          \n\n 13 13  0  0  1  0            999 V2000\n    3.2861   -6.4530    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    3.9995   -6.0408    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5694   -6.0408    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8563   -6.4533    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    1.1475   -6.0411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1475   -5.2167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5174   -6.5741    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8563   -7.2783    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    1.1475   -7.6906    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5694   -7.6906    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    2.5694   -8.5156    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2861   -7.2781    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    3.9995   -7.6903    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n 12  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  1  0  0  0\n  8  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  5  2  0  0  0  0\n  8  9  1  1  0  0  0\n 10  8  1  0  0  0  0\n 10 11  1  1  0  0  0\n 12 10  1  0  0  0  0\n 12 13  1  6  0  0  0\nM  END",
          "smiles": "[C@@H]1([C@H]([C@@H](C(=O)O)O[C@@H]([C@@H]1O)O)O)O",
          "formula": "C6H10O7",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5e06903d-79a0-4e7a-8388-516269a0755c"
          },
          "defined_stereo": 5,
          "ez_centers": 0,
          "molecular_weight": "194.1397",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 5
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c2169c9b-7eba-4e74-8001-2b19cd011768",
      "version": "7",
      "structure": {
        "id": "faff6a8a-4be3-4012-9fbc-0f912d7d21de",
        "molfile": "\n  Marvin  01132113002D          \n\n 13 13  0  0  1  0            999 V2000\n    2.5694   -6.0408    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2861   -6.4530    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.2861   -7.2781    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.5694   -7.6906    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    1.8563   -7.2783    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    1.8563   -6.4533    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    1.1475   -6.0411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1475   -5.2167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5174   -6.5741    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1475   -7.6906    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5694   -8.5156    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9995   -7.6903    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9995   -6.0408    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  1  1  0  0  0  0\n  6  7  1  1  0  0  0\n  7  8  2  0  0  0  0\n  9  7  1  0  0  0  0\n  5 10  1  1  0  0  0\n  4 11  1  1  0  0  0\n  3 12  1  6  0  0  0\n  2 13  1  6  0  0  0\nM  END",
        "smiles": "[C@@H]1([C@H]([C@@H](C(=O)O)O[C@@H]([C@@H]1O)O)O)O",
        "formula": "C6H10O7",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 5,
        "ez_centers": 0,
        "molecular_weight": "194.1397",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "01567af9-7179-4ac9-b56b-f490f0b0f1b1",
          "1993bedd-74d7-4cbb-9151-77054e50aa07"
        ],
        "stereo_centers": 5
      },
      "unii": "CEP8I6411H"
    }
  ]
}