{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "10c6c827-58ce-4515-9299-2000a64382b0", "code": "N02AA05", "comments": "ATC|NERVOUS SYSTEM|ANALGESICS|OPIOIDS|Natural opium alkaloids|oxycodone", "type": "PRIMARY", "url": "http://www.whocc.no/atc_ddd_index/?code=N02AA05&showdescription=yes", "code_system": "WHO-ATC", "references": [ "c2f84149-a2ae-4843-8d59-96aa3abccd82" ] }, { "uuid": "bbb67973-491b-4216-9ced-898deac8c56f", "code": "N0000175684", "comments": "Cellular or Molecular Interactions [MoA]|Receptor Interactions [MoA]|G-Protein-linked Receptor Interactions [MoA]|Opioid Receptor Interactions [MoA]|Opioid Agonists [MoA]|Full Opioid Agonists [MoA]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175684", "code_system": "NDF-RT", "references": [ "c2f84149-a2ae-4843-8d59-96aa3abccd82" ] }, { "uuid": "7d91cff8-2aa2-4c50-9981-435fc05ef262", "code": "N0000175690", "comments": "Established Pharmacologic Class [EPC]|Opioid Agonist [EPC]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175690", "code_system": "NDF-RT", "references": [ "c2f84149-a2ae-4843-8d59-96aa3abccd82" ] }, { "uuid": "30db4684-729b-43e6-ae21-33b847d0ec50", "code": "QN02AA05", "comments": "VATC|ANALGESICS|OPIOIDS|Natural opium alkaloids|oxycodone", "type": "PRIMARY", "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN02AA05&showdescription=yes", "code_system": "WHO-VATC", "references": [ "c2f84149-a2ae-4843-8d59-96aa3abccd82" ] }, { "uuid": "8fa1109e-25e4-4a0c-b787-ce40ea8a79a1", "code": "QN02AA55", "comments": "VATC|ANALGESICS|OPIOIDS|Natural opium alkaloids|oxycodone, combinations", "type": "PRIMARY", "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN02AA55&showdescription=yes", "code_system": "WHO-VATC", "references": [ "c2f84149-a2ae-4843-8d59-96aa3abccd82" ] }, { "uuid": "89c15ed5-dde8-469f-afc8-2160dfcd98ff", "code": "76-42-6", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=76-42-6", "code_system": "CAS", "references": [ "c2f84149-a2ae-4843-8d59-96aa3abccd82", "c14ecd69-19a6-45b5-ab3b-4fafcfa6e9f1" ] }, { "uuid": "7dbd5488-54a9-4274-a6b7-49f0b8cc84d3", "code": "D010098", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/68010098", "code_system": "MESH", "references": [ "c2f84149-a2ae-4843-8d59-96aa3abccd82" ] }, { "uuid": "6724661e-bb3f-44fc-87d1-33d7ae80d823", "code": "NBK547955", "comments": "LiverTox|Analgesic|Moderate pain|Opiate", "type": "PRIMARY", "url": "https://www.ncbi.nlm.nih.gov/books/NBK547955/", "code_system": "LIVERTOX", "references": [ "ecbcc281-92be-945e-2446-8e7b4809db3a" ] }, { "uuid": "9795bf6a-cf65-458f-9d6a-0c7609a9a921", "code": "OXYCODONE", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Oxycodone", "code_system": "WIKIPEDIA", "references": [ "c2f84149-a2ae-4843-8d59-96aa3abccd82" ] }, { "uuid": "ebc442f4-d962-45f6-afb9-78ae3e248e24", "code": "N02AA55", "comments": "ATC|NERVOUS SYSTEM|ANALGESICS|OPIOIDS|Natural opium alkaloids|oxycodone, combinations", "type": "PRIMARY", "url": "http://www.whocc.no/atc_ddd_index/?code=N02AA55&showdescription=yes", "code_system": "WHO-ATC", "references": [ "c2f84149-a2ae-4843-8d59-96aa3abccd82" ] }, { "uuid": "e54643ec-b90f-4a2a-8569-03252a9958e6", "code": "SUB09562MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "c2f84149-a2ae-4843-8d59-96aa3abccd82" ] }, { "uuid": "fbc0770f-6475-4364-a6d2-51dfccd8f4c3", "code": "1701", "type": "PRIMARY", "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1701", "code_system": "INN", "references": [ "c2f84149-a2ae-4843-8d59-96aa3abccd82" ] }, { "uuid": "75c14db4-3b5b-46cb-8288-d42364337688", "code": "9143", "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.12 Schedule II.|Substances, vegetable origin or chemical synthesis", "type": "PRIMARY", "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111", "code_system": "DEA NO.", "references": [ "c2f84149-a2ae-4843-8d59-96aa3abccd82" ] }, { "uuid": "53157ae7-0fd4-4c9a-9468-a32fd9995679", "code": "200-960-2", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.874", "code_system": "ECHA (EC/EINECS)", "references": [ "c2f84149-a2ae-4843-8d59-96aa3abccd82" ] }, { "uuid": "3460d56f-fa80-444e-a2d2-7836d417612a", "code": "7093", "type": "PRIMARY", "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=7093", "code_system": "IUPHAR", "references": [ "c2f84149-a2ae-4843-8d59-96aa3abccd82" ] }, { "uuid": "c87b4df7-61eb-4335-8803-8c562aef4f76", "code": "C29309", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29309", "code_system": "NCI_THESAURUS", "references": [ "c2f84149-a2ae-4843-8d59-96aa3abccd82" ] }, { "uuid": "eff61a46-a502-4eb4-87bd-9b50b4428b44", "code": "7804", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/7804/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "c2f84149-a2ae-4843-8d59-96aa3abccd82" ] }, { "uuid": "92b693d8-c23c-41d0-a958-194f60edbf59", "code": "m8328", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m8328?q=authorize", "code_system": "MERCK INDEX", "references": [ "c2f84149-a2ae-4843-8d59-96aa3abccd82" ] }, { "uuid": "98c58b75-0348-470a-9b40-6878f9eee26a", "code": "DB00497", "type": "PRIMARY", "url": "http://www.drugbank.ca/drugs/DB00497", "code_system": "DRUG BANK", "references": [ "c2f84149-a2ae-4843-8d59-96aa3abccd82" ] }, { "uuid": "4a46db98-71a6-4ceb-8049-cbcf19da4a40", "code": "CHEMBL656", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL656", "code_system": "ChEMBL", "references": [ "c2f84149-a2ae-4843-8d59-96aa3abccd82" ] }, { "uuid": "370e2606-9aab-4af6-a377-1e577e83842e", "code": "5284603", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5284603", "code_system": "PUBCHEM", "references": [ "c2f84149-a2ae-4843-8d59-96aa3abccd82" ] }, { "uuid": "7194dc0c-c1b3-9cfa-8662-bad6f12265d0", "code": "3142", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3142", "code_system": "HSDB", "references": [ "03725aaa-69b3-2997-4722-a10583480880" ] }, { "uuid": "1a346054-2452-c015-f488-9c90341ca172", "code": "DTXSID5023407", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5023407", "code_system": "EPA CompTox", "references": [ "8cbe9a6d-9df2-11a0-be18-7cc5e89c06f7" ] }, { "uuid": "0598ecc9-4fa6-05ea-7661-766269ca7413", "code": "N02AA56", "comments": "ATC|NERVOUS SYSTEM|ANALGESICS|OPIOIDS|Natural opium alkaloids|oxycodone and naltrexone", "type": "PRIMARY", "url": "http://www.whocc.no/atc_ddd_index/?code=N02AA56&showdescription=yes", "code_system": "WHO-ATC" }, { "uuid": "d629d5b6-fd6a-c9e1-cd9f-f2a5b311c4a1", "code": "N02AJ17", "comments": "ATC|NERVOUS SYSTEM|ANALGESICS|OPIOIDS|Opioids in combination with non-opioid analgesics|oxycodone and paracetamol", "type": "PRIMARY", "url": "http://www.whocc.no/atc_ddd_index/?code=N02AJ17&showdescription=yes", "code_system": "WHO-ATC" }, { "uuid": "a534519a-4164-e02b-def8-2b14c7481be6", "code": "N02AJ19", "comments": "ATC|NERVOUS SYSTEM|ANALGESICS|OPIOIDS|Opioids in combination with non-opioid analgesics|oxycodone and ibuprofen", "type": "PRIMARY", "url": "http://www.whocc.no/atc_ddd_index/?code=N02AJ19&showdescription=yes", "code_system": "WHO-ATC" }, { "uuid": "875dee12-0350-182d-c2f8-2573065faf4a", "code": "N02AJ18", "comments": "ATC|NERVOUS SYSTEM|ANALGESICS|OPIOIDS|Opioids in combination with non-opioid analgesics|oxycodone and acetylsalicylic acid", "type": "PRIMARY", "url": "http://www.whocc.no/atc_ddd_index/?code=N02AJ18&showdescription=yes", "code_system": "WHO-ATC" }, { "uuid": "51dd1f47-ba0f-83e5-c971-c44653304238", "code": "C67413", "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Opioid Receptor Agonist", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C67413", "code_system": "NCI_THESAURUS", "references": [ "ecbcc281-92be-945e-2446-8e7b4809db3a" ] }, { "uuid": "8ea211e7-af71-61f2-f5e3-0b20fdcfffda", "code": "C1506", "comments": "Drug or Chemical by Structure[C1913]|Organic Chemical[C718]|Alkaloid[C221]|Opioid", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1506", "code_system": "NCI_THESAURUS", "references": [ "ecbcc281-92be-945e-2446-8e7b4809db3a" ] }, { "uuid": "5239b4e0-05ca-4672-846c-a6224044c632", "code": "CD35PMG570", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "a6f33f9d-7743-4382-9ef2-fd894fdc11b7", "code": "Oxycodone", "type": "PRIMARY", "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM378/", "code_system": "LACTMED", "references": [ "ecbcc281-92be-945e-2446-8e7b4809db3a" ] }, { "uuid": "f3a5488e-7490-772d-cd0f-4b876b6f0560", "code": "2029", "type": "PRIMARY", "url": "https://drugcentral.org/drugcard/2029", "code_system": "DRUG CENTRAL", "references": [ "ecbcc281-92be-945e-2446-8e7b4809db3a" ] }, { "uuid": "db90af9f-99bb-d541-3952-a95c3f05cbd1", "code": "7852", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:7852", "code_system": "CHEBI", "references": [ "ecbcc281-92be-945e-2446-8e7b4809db3a" ] }, { "uuid": "72389f02-b028-0e36-897d-faea21f1d58d", "code": "1485191", "type": "PRIMARY", "url": "https://store.usp.org/product/1485191", "code_system": "RS_ITEM_NUM", "references": [ "ecbcc281-92be-945e-2446-8e7b4809db3a" ] }, { "uuid": "5eea5d1e-2f69-cac0-88e8-d1002feada0c", "code": "CD35PMG570", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=CD35PMG570", "code_system": "DAILYMED", "references": [ "f97b00a6-662e-d76c-5980-4cb775f9e8e4" ] }, { "uuid": "38adc64c-2255-24b6-3a75-9cbac07e9d5e", "code": "100000083302", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "e58346c3-b445-c700-5969-c13b421458a7" ] }, { "uuid": "99e44e1b-0741-71f3-2c9a-c954d2abefae", "code": "19043", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=19043", "code_system": "NSC", "references": [ "e421fc4d-86b7-768b-5602-50c9885bbcf8" ] } ], "substance_class": "chemical", "references": [ { "uuid": "391007dc-7c51-3788-bfe3-3106b35dd409", "citation": "orange book", "doc_type": "ORANGE BOOK", "public_domain": true }, { "uuid": "705adcdf-5cce-49c4-a182-a017f097af97", "citation": "USP Dictionary 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "579b570b-9b0e-4e1d-a113-f80b02c1245b", "citation": "USP DICTIONARY 2009", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "fa78ded3-f48b-45b1-a015-8482558441a2", "citation": "ATC CODE 2009", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "109a5c97-7989-4ddc-8b33-4a2a947bf6ed", "citation": "WHO 2009", "doc_type": "INN", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4f22020c-a86c-4fcd-a247-1d6a5e78d088", "citation": "INN 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b82b98de-8dea-47b8-b1d0-5bfe8d1f51dd", "citation": "USP DICTIONARY 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b3ef8f53-ba76-456b-a265-8b27ec2fddaa", "citation": "MARTINDALE 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "fe852a8f-ae26-4f06-9291-a9e9cebe82c5", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9faf2a97-f635-4953-805a-6ef64046d742", "citation": "HSDB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d339fb6f-3dee-4777-88c1-287bf9774455", "citation": "SCIFINDER", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b41bec2a-35a8-4814-8b86-4778870a7217", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "8c036d08-2a2d-40c6-830e-e61682eea97c", "citation": "NDF-RT", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "68791000-e985-42db-9437-2ba272965fff", "citation": "EP", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "99d6233e-5d10-48c2-8e49-8cc8d69e20fc", "citation": "INCB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "7e52e309-1c66-4661-94ac-7ebe2e040486", "citation": "http://www.fda.gov/ohrms/dockets/ac/08/briefing/2008-4395b1-02-PAIN.pdf", "url": "http://www.fda.gov/ohrms/dockets/ac/08/briefing/2008-4395b1-02-PAIN.pdf", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "95ecfb8a-b7cd-47ae-adc8-e21ec2c529a7", "citation": "FDA", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "413be787-140b-4be8-81f6-a78d5deae0d7", "citation": "USP-RS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "549018c6-38af-410c-92a0-eb454c7d979c", "citation": "NCT01559701", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c2f84149-a2ae-4843-8d59-96aa3abccd82", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493389665000, "tags": [ "NOMEN" ] }, { "uuid": "d8e02f8d-d3a9-4e6f-bade-00028f3a040e", "citation": "INTERNATIONAL NARCOTICS CONTROL BOARD - YELLOW LIST; ANNEX TO FORMS A, B AND C; 52ND EDITION, DECEMBER 2013; HTTP://WWW.INCB.ORG/", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "1d8158da-ee4d-4162-bc40-387fc94b710d", "citation": "BRITISH JOURNAL OF PHARMACOLOGY\\\\nVOLUME 160, ISSUE 4, ARTICLE FIRST PUBLISHED ONLINE: 24 MAY 2010", "url": "http://onlinelibrary.wiley.com/doi/10.1111/j.1476-5381.2010.00673.x/pdf", "doc_type": "JOURNAL ARTICLE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "3f0782ec-4cbf-4fc6-8d1d-13408773d2c6", "citation": "SRS import [CD35PMG570]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=CD35PMG570", "doc_type": "SRS", "public_domain": true, "document_date": 1493389665000, "tags": [ "NOMEN" ] }, { "uuid": "4e5243a9-a5e5-4e8f-af1e-87acef6106ec", "citation": "OXYCODONE [INN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "1163d2cd-035f-42cc-8a7f-037a90b0c1ff", "citation": "OXYCODONE [USAN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "a0063ec4-10e5-48aa-836c-cdedb3fc90a9", "citation": "OXYCODONE [MART.]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "42210e5c-8f0d-4924-b85e-11026aabafec", "citation": "OXYCODONE [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "f12e88bd-934b-4a8d-bab7-7c414a0f5577", "citation": "OXYCODONE [HSDB]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "ad00b975-a48a-4c21-ade7-ecdbedd1588b", "citation": "OXYCODONE [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "07faf2bb-df06-4364-b456-18f14f98e0f2", "citation": "OXYCODONE [VANDF]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "5cac7fba-b10a-412e-8792-6f26f077fd35", "citation": "OXYCODONE CII [USP-RS]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "25aba354-55d3-4ba5-ac2f-ac832a6ba7a9", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "03725aaa-69b3-2997-4722-a10583480880", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+76-42-6", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "fed1ea7c-2ecf-57b0-18df-4a3caf19cb7c", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+76-42-6", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "8cbe9a6d-9df2-11a0-be18-7cc5e89c06f7", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=76-42-6", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "901b62e8-68b0-3535-2338-d64cc9d35e02", "citation": "https://www.drugbank.ca/drugs/DB00497", "doc_type": "WEBSITE", "public_domain": true }, { "uuid": "fb276346-59a8-c356-9ca5-e03cd8d982f3", "citation": "https://www.clinicalkey.com/pharmacology/monograph/457?sec=monphar", "doc_type": "LEPINDEX", "public_domain": true }, { "uuid": "037d2eb9-7a49-2086-d9ee-669bb23503df", "citation": "OXYCODONE", "doc_type": "MICROMEDEX", "public_domain": true }, { "uuid": "ecbcc281-92be-945e-2446-8e7b4809db3a", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "c14ecd69-19a6-45b5-ab3b-4fafcfa6e9f1", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "9fc3231f-d157-d7f4-3652-6fd708c16f7a", "citation": "OB", "doc_type": "ORANGE BOOK", "public_domain": true }, { "uuid": "3255e67b-87b3-4e89-ad1a-c39eb1b30fb6", "citation": "INN Proposed List 1", "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL01.pdf", "doc_type": "INN_LIST", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "29ca7d32-f097-4e46-82c5-ae9451eaeeab", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true }, { "uuid": "c74ce66a-166e-4104-a54e-48fa674e0393", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "5e17d6be-98e4-40ec-b202-4fbf13e62626", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "67181369-389c-4c66-8841-20e3ce7b397d", "citation": "Br J Clin Pharmacol 1992 Jun;33(6):617-21", "doc_type": "JA", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "b1191c63-e9eb-c0fa-d1ac-dab53ea5d9ea", "citation": "EP 10.6", "doc_type": "EP", "public_domain": true }, { "uuid": "e421fc4d-86b7-768b-5602-50c9885bbcf8", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true }, { "uuid": "f97b00a6-662e-d76c-5980-4cb775f9e8e4", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "6da9f569-56bc-f9c9-8f83-567770331150", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "e58346c3-b445-c700-5969-c13b421458a7", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "4dc58669-7c06-428c-9714-4c0d1eab4fe9", "id": "4dc58669-7c06-428c-9714-4c0d1eab4fe9", "molfile": "\n Marvin 01132104032D \n\n 23 27 0 0 1 0 999 V2000\n 10.9491 -6.9037 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 10.0415 -7.2338 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2577 -6.5738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7115 -5.9136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2989 -5.2536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7115 -4.5936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5365 -4.5936 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 11.1141 -3.9334 0.0000 N 0 0 2 0 0 0 0 0 0 0 0 0\n 11.1141 -3.2734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3517 -3.9334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2379 -5.9136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5365 -5.9136 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 10.9491 -5.2536 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 10.3303 -5.2536 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9392 -5.2536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4343 -5.9136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9392 -6.9037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4755 -7.5639 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4739 -5.2536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0200 -5.9136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4739 -6.5738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0200 -7.2338 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1949 -7.2338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 6 0 0 0\n 1 12 1 0 0 0 0\n 1 17 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 21 3 2 0 0 0 0\n 5 4 2 0 0 0 0\n 12 4 1 1 0 0 0\n 6 5 1 0 0 0 0\n 19 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 7 8 1 1 0 0 0\n 13 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 8 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 12 11 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 1 0 0 0\n 13 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 18 17 2 0 0 0 0\n 20 19 2 0 0 0 0\n 21 20 1 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 1 0 0 0 0\nM END", "smiles": "CN1CC[C@@]23c4c5ccc(c4O[C@H]3C(=O)CC[C@]2([C@H]1C5)O)OC", "formula": "C18H21NO4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "48e1c174-00c1-4011-8a28-9743a6098031" }, "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "315.3643", "optical_activity": "UNSPECIFIED", "stereo_centers": 4 } ], "definition_level": "COMPLETE", "uuid": "00ad9393-0ca6-4553-a6a3-2832f8f26dea", "version": "59", "structure": { "id": "fb1012b2-a696-409b-a489-d48312dfe19a", "molfile": "\n JSDraw202272517092D\n\n 25 29 0 0 1 0 0 V2000\n 26.3920 -4.4529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.9610 -5.0741 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 23.4113 -5.0495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.4229 -7.7847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.2087 -9.1333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.6487 -9.1400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.8526 -7.7914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.3030 -7.7980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.5287 -9.1533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.3144 -10.4916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.8640 -10.4850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.3555 -11.4874 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 24.9840 -10.4717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.4166 -11.9704 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 26.5544 -10.4650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.3381 -11.8137 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.3287 -9.1201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.5429 -7.7714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.9725 -7.7781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.1972 -6.4294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.1545 -4.6536 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 22.6372 -6.4360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.7508 -6.4261 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 19.5422 -11.8470 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.9822 -11.8560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 5 4 1 1 0 0 0\n 5 6 1 6 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 6 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 5 13 1 0 0 0 0\n 13 14 1 1 0 0 0\n 13 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 15 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 5 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 2 20 1 0 0 0 0\n 20 21 1 6 0 0 0\n 20 22 1 0 0 0 0\n 7 22 1 0 0 0 0\n 19 23 1 1 0 0 0\n 10 24 1 0 0 0 0\n 24 25 1 0 0 0 0\nM END", "smiles": "CN1CC[C@@]23c4c5ccc(c4O[C@@]3([H])C(=O)CC[C@]2([C@@]1([H])C5)O)OC", "formula": "C18H21NO4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "315.3643", "optical_activity": "UNSPECIFIED", "references": [ "705adcdf-5cce-49c4-a182-a017f097af97", "3f0782ec-4cbf-4fc6-8d1d-13408773d2c6", "3255e67b-87b3-4e89-ad1a-c39eb1b30fb6" ], "stereo_centers": 4 }, "unii": "CD35PMG570", "relationships": [ { "uuid": "70324c12-66d6-4044-9910-3bf83f003e91", "amount": { "uuid": "0bc2fbda-c753-46c1-a17a-cbaab7eba957" }, "type": "ACTIVE MOIETY", "related_substance": { "uuid": "ee4ac265-c676-43bd-9430-6c15cf80f10e", "refuuid": "00ad9393-0ca6-4553-a6a3-2832f8f26dea", "name": "Oxycodone", "unii": "CD35PMG570", "linking_id": "CD35PMG570", "ref_pname": "Oxycodone", "substance_class": "reference" } }, { "uuid": "c2f57dc9-0c9b-488c-952d-f8214b73a922", "amount": { "uuid": "5393df45-45bd-4104-9ffc-146317dfcb8d", "type": "RELATIONSHIP_AMOUNT", "average": 90 }, "comments": "APPROXIMATE PURE ANHYDROUS DRUG CONTENT (IN PERCENT)", "type": "SALT/SOLVATE->PARENT", "references": [ "d8e02f8d-d3a9-4e6f-bade-00028f3a040e" ], "related_substance": { "uuid": "1ba79177-b2e9-4db2-9e8a-6193693481da", "refuuid": "52628736-13aa-434e-af86-5ead5f864eee", "name": "OXYCODONE HYDROCHLORIDE", "unii": "C1ENJ2TE6C", "linking_id": "C1ENJ2TE6C", "ref_pname": "OXYCODONE HYDROCHLORIDE", "substance_class": "reference" } }, { "uuid": "08e477f6-45b5-479b-b025-e7ec2479b294", "amount": { "uuid": "637a6cc0-c998-4c26-9b94-a196f8650b95", "type": "RELATIONSHIP_AMOUNT", "average": 79 }, "comments": "APPROXIMATE PURE ANHYDROUS DRUG CONTENT (IN PERCENT)", "type": "SALT/SOLVATE->PARENT", "references": [ "d8e02f8d-d3a9-4e6f-bade-00028f3a040e" ], "related_substance": { "uuid": "d946ea87-81a2-41bb-8ca2-84d43c2cd7af", "refuuid": "15abef50-374d-458a-9eb3-9faefc4dea8d", "name": "OXYCODONE TEREPHTHALATE", "unii": "M04XWV43UF", "linking_id": "M04XWV43UF", "ref_pname": "OXYCODONE TEREPHTHALATE", "substance_class": "reference" } }, { "uuid": "41905aae-8957-454f-bfe7-b82754e8a614", "amount": { "uuid": "420ab4ff-ceab-4493-adcd-7e3c7cd405f0", "type": "RELATIONSHIP_AMOUNT", "average": 78 }, "comments": "APPROXIMATE PURE ANHYDROUS DRUG CONTENT (IN PERCENT)", "type": "SALT/SOLVATE->PARENT", "references": [ "d8e02f8d-d3a9-4e6f-bade-00028f3a040e" ], "related_substance": { "uuid": "e1a79527-64e1-4949-9f77-2f8921ef7f18", "refuuid": "84155eb6-1d51-48d7-b5b8-341e4dbdad0e", "name": "OXYCODONE HYDROCHLORIDE TRIHYDRATE", "unii": "4P6424D07T", "linking_id": "4P6424D07T", "ref_pname": "OXYCODONE HYDROCHLORIDE TRIHYDRATE", "substance_class": "reference" } }, { "uuid": "8bf4589c-53d8-4f74-910a-a140d73b0de9", "amount": { "uuid": "34343931-6f88-4449-965c-ce9755312a3c" }, "qualification": "PLASMA; URINE", "type": "METABOLITE->PARENT", "interaction_type": "MAJOR", "mediator_substance": { "uuid": "c13ee23a-22ed-42de-91c4-f6668b976c36", "refuuid": "4275827d-e329-4907-95b5-7d690692872a", "name": "CYTOCHROME P450 3A4", "unii": "PUO0521HZV", "linking_id": "PUO0521HZV", "ref_pname": "CYTOCHROME P450 3A4", "substance_class": "reference" }, "references": [ "67181369-389c-4c66-8841-20e3ce7b397d" ], "related_substance": { "uuid": "4922e9fb-1dab-43eb-a261-b84e3f4296ae", "refuuid": "0d97e784-5454-4526-98e0-6af2a68149dc", "name": "NOROXYCODONE", "unii": "95Q949779D", "linking_id": "95Q949779D", "ref_pname": "NOROXYCODONE", "substance_class": "reference" } }, { "uuid": "edfd31e0-77ce-4ea6-9c62-4821550f528e", "amount": { "uuid": "a715deef-6f83-4a45-9e26-1437cccba8f1", "type": "RELATIONSHIP_AMOUNT", "average": 10, "units": "MOLE PERCENT" }, "comments": "Highly variable 40 fold higher potency than Oxycodone", "qualification": "PLASMA; URINE", "type": "METABOLITE ACTIVE->PARENT", "interaction_type": "MINOR", "mediator_substance": { "uuid": "7c360cba-541f-4402-bb78-7e9a889429f1", "refuuid": "cc92795c-ba54-4e71-a72b-1af36b57df6b", "name": "CYTOCHROME P450 2D6", "unii": "8E4LAA4357", "linking_id": "8E4LAA4357", "ref_pname": "CYTOCHROME P450 2D6", "substance_class": "reference" }, "references": [ "1d8158da-ee4d-4162-bc40-387fc94b710d" ], "related_substance": { "uuid": "4c9ef07d-c506-4399-b770-e5bc3291435e", "refuuid": "fa8eb88a-86e1-440a-b361-789acf3c305f", "name": "OXYMORPHONE", "unii": "9VXA968E0C", "linking_id": "9VXA968E0C", "ref_pname": "OXYMORPHONE", "substance_class": "reference" } }, { "uuid": "b5b39860-4843-4c34-8f83-1cd320e7505d", "amount": { "uuid": "de84a3ac-c8c5-4fd9-afd5-bbd7f0fb2e1e" }, "qualification": "PLASMA; URINE", "type": "METABOLITE ACTIVE->PARENT", "interaction_type": "MINOR", "mediator_substance": { "uuid": "c8916da1-2e37-43ab-85ff-995f6b47496d", "refuuid": "cc92795c-ba54-4e71-a72b-1af36b57df6b", "name": "CYTOCHROME P450 2D6", "unii": "8E4LAA4357", "linking_id": "8E4LAA4357", "ref_pname": "CYTOCHROME P450 2D6", "substance_class": "reference" }, "references": [ "1d8158da-ee4d-4162-bc40-387fc94b710d" ], "related_substance": { "uuid": "a0a20db4-165e-48f2-ad70-9ec0915fd44e", "refuuid": "b872b06c-a716-467b-a5e0-1b195d45978b", "name": "Noroxymorphone", "unii": "9NZ7111A9O", "linking_id": "9NZ7111A9O", "ref_pname": "Noroxymorphone", "substance_class": "reference" } }, { "uuid": "137f32e9-99c2-478b-a6b5-63f717baa7c7", "amount": { "uuid": "1b16ab58-183d-441b-a6f5-374ee268885f", "type": "RELATIONSHIP_AMOUNT", "average": 76 }, "comments": "APPROXIMATE PURE ANHYDROUS DRUG CONTENT (IN PERCENT)", "type": "SALT/SOLVATE->PARENT", "references": [ "d8e02f8d-d3a9-4e6f-bade-00028f3a040e" ], "related_substance": { "uuid": "334387ce-9866-4b6f-bbe1-a0211f5feedb", "refuuid": "c2c8bed1-3270-4e74-a792-f0899bfbf877", "name": "OXYCODONE PHOSPHATE", "unii": "GRM3MU4DWP", "linking_id": "GRM3MU4DWP", "ref_pname": "OXYCODONE PHOSPHATE", "substance_class": "reference" } }, { "uuid": "a3ab375d-35b3-4c36-802f-3702cc9c0eda", "amount": { "uuid": "85bedbdb-78d9-4430-95b6-ec9fa64794cb", "average": 45, "units": "%" }, "type": "BINDER->LIGAND", "interaction_type": "BINDING", "references": [ "fb276346-59a8-c356-9ca5-e03cd8d982f3" ], "related_substance": { "uuid": "4f56ed7f-3060-401e-9a15-86898add2574", "refuuid": "e95d330b-4c2d-44bb-a61b-860afeb4aa30", "name": "PLASMA PROTEIN FRACTION (HUMAN)", "unii": "6D53G0FD0Z", "linking_id": "6D53G0FD0Z", "ref_pname": "PLASMA PROTEIN FRACTION (HUMAN)", "substance_class": "reference" } }, { "uuid": "05671925-4b69-448d-a239-9763b793f69d", "amount": { "uuid": "d9992a9b-45a0-4383-b7d2-aac05c69bd3a" }, "type": "TARGET->AGONIST", "references": [ "901b62e8-68b0-3535-2338-d64cc9d35e02" ], "related_substance": { "uuid": "ebbc72d3-087e-4c9e-ba30-233e6a474c06", "refuuid": "39262e4f-d963-4b83-9b34-52fd55036f0e", "name": "MU-TYPE OPIOID RECEPTOR", "unii": "1PE72K8X46", "linking_id": "1PE72K8X46", "ref_pname": "MU-TYPE OPIOID RECEPTOR", "substance_class": "reference" } }, { "uuid": "b6e7357f-347a-4285-ace2-b6fd2055332d", "amount": { "uuid": "55ab3140-a9a5-461e-bc55-bc91b557c331" }, "type": "TARGET->AGONIST", "references": [ "901b62e8-68b0-3535-2338-d64cc9d35e02" ], "related_substance": { "uuid": "6af96988-e284-429a-b007-8b32c9fe1c70", "refuuid": "e30554c1-6304-468b-ad15-e72ab401a9d3", "name": "KAPPA-TYPE OPIOID RECEPTOR", "unii": "2BJ58BX78W", "linking_id": "2BJ58BX78W", "ref_pname": "KAPPA-TYPE OPIOID RECEPTOR", "substance_class": "reference" } }, { "uuid": "c94bb39b-8c18-472d-b4e3-4d3f4ad39b9f", "amount": { "uuid": "4c77b0a9-0bb0-4170-9394-b5fa7134de34" }, "type": "TARGET->AGONIST", "references": [ "901b62e8-68b0-3535-2338-d64cc9d35e02" ], "related_substance": { "uuid": "bbbd0e2c-af4e-4651-8a97-2585043906fa", "refuuid": "f7fdf82e-009b-4d48-8e86-35e9456cf4ef", "name": "DELTA-TYPE OPIOID RECEPTOR", "unii": "EV0PWK6TT6", "linking_id": "EV0PWK6TT6", "ref_pname": "DELTA-TYPE OPIOID RECEPTOR", "substance_class": "reference" } }, { "uuid": "b45695c2-3076-4c7f-be06-688e44deff48", "amount": { "uuid": "e55626fb-2bf3-4403-ab4e-d81e69a1ef10" }, "type": "SALT/SOLVATE->PARENT", "references": [ "c74ce66a-166e-4104-a54e-48fa674e0393" ], "related_substance": { "uuid": "8465c8e9-0346-4279-a143-febb9e657626", "refuuid": "09de3d5b-57cb-4982-9d47-5982f3669478", "name": "OXYCODONE N-OXIDE HYDROCHLORIDE", "unii": "WK87249P76", "linking_id": "WK87249P76", "ref_pname": "OXYCODONE N-OXIDE HYDROCHLORIDE" } }, { "uuid": "0009f7fb-adba-4995-8fdc-08ba97bafe98", "amount": { "uuid": "0122dcab-b2a4-483f-8bee-791594ace0b9" }, "type": "DERIVATIVE->PARENT", "references": [ "29ca7d32-f097-4e46-82c5-ae9451eaeeab" ], "related_substance": { "uuid": "e798261e-205c-4ddf-9e08-b559d724f0d2", "refuuid": "511aafab-f272-40c4-86f6-7be8371b9735", "name": "8.BETA.-HYDROXYOXYCODONE", "unii": "1BI24NT4VF", "linking_id": "1BI24NT4VF", "ref_pname": "8.BETA.-HYDROXYOXYCODONE" } }, { "uuid": "a7c8f384-0f14-4365-a428-8a9b031df0e0", "amount": { "uuid": "9ec4f322-6b56-4707-8210-c34db1b39069" }, "type": "SALT/SOLVATE->PARENT", "references": [ "25aba354-55d3-4ba5-ac2f-ac832a6ba7a9" ], "related_substance": { "uuid": "6713738b-c58b-419c-ba6e-07d46d3438f5", "refuuid": "5cb83991-992f-4d41-a1df-d2f2ad99e64d", "name": "OXYCODONE MYRISTATE", "unii": "96P3HS657Y", "linking_id": "96P3HS657Y", "ref_pname": "OXYCODONE MYRISTATE", "substance_class": "reference" } }, { "uuid": "75ccb05c-ce8b-49a2-9ae2-cbb3a20bc72b", "amount": { "uuid": "b893b4ad-6f73-4bf2-904e-80ed77254168" }, "type": "LABELED->NON-LABELED", "references": [ "5e17d6be-98e4-40ec-b202-4fbf13e62626" ], "related_substance": { "uuid": "d1e8d422-5885-4bb2-bcde-9cf946541794", "refuuid": "42131d12-b84f-4326-be75-253861f0abbe", "name": "OXYCODONE, (N-METHYL-D3)-", "unii": "PQ5NQM4AZW", "linking_id": "PQ5NQM4AZW", "ref_pname": "OXYCODONE, (N-METHYL-D3)-" } } ], "names": [ { "uuid": "abf54636-ab12-458b-bdae-bca298bb97d9", "name": "(-)-14-HYDROXYDIHYDROCODEINONE", "stdName": "(-)-14-HYDROXYDIHYDROCODEINONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "579b570b-9b0e-4e1d-a113-f80b02c1245b" ], "display_name": false }, { "uuid": "651045ab-6827-4339-a933-aebf669d2ccc", "name": "(5.ALPHA.)-4,5-EPOXY-14-HYDROXY-3-METHOXY-17-METHYLMORPHINAN-6-ONE", "stdName": "(5.ALPHA.)-4,5-EPOXY-14-HYDROXY-3-METHOXY-17-METHYLMORPHINAN-6-ONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "d339fb6f-3dee-4777-88c1-287bf9774455" ], "display_name": false }, { "uuid": "1bf4fd49-3cff-4e35-bbe7-9772ebe9a5d1", "name": "14-HYDROXYDIHYDROCODEINONE", "stdName": "14-HYDROXYDIHYDROCODEINONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "99d6233e-5d10-48c2-8e49-8cc8d69e20fc" ], "display_name": false }, { "uuid": "58fa5b17-66f5-4385-9d4f-394c7b124e13", "name": "4,5α-Epoxy-14-hydroxy-3-methoxy-17-methylmorphinan-6-one", "stdName": "4,5.ALPHA.-EPOXY-14-HYDROXY-3-METHOXY-17-METHYLMORPHINAN-6-ONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "579b570b-9b0e-4e1d-a113-f80b02c1245b" ], "display_name": false }, { "uuid": "f7548a5d-f05b-4592-abab-e3739d047ff3", "name": "DIHYDRONE", "stdName": "DIHYDRONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "d339fb6f-3dee-4777-88c1-287bf9774455" ], "display_name": false }, { "uuid": "d2654a37-39fd-fb2a-90bb-93e06ade8883", "name": "HYDROCODONE HYDROGEN TARTRATE 2.5-HYDRATE IMPURITY D [EP IMPURITY]", "stdName": "HYDROCODONE HYDROGEN TARTRATE 2.5-HYDRATE IMPURITY D [EP IMPURITY]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b1191c63-e9eb-c0fa-d1ac-dab53ea5d9ea" ], "display_name": false }, { "uuid": "0f6428ff-e44c-4dc5-9474-c59f2ba17ad8", "name": "IDS-NO-002", "stdName": "IDS-NO-002", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "99d6233e-5d10-48c2-8e49-8cc8d69e20fc" ], "display_name": false }, { "uuid": "dc000c63-1a8c-4d99-b72e-3b707a21089a", "name": "MORPHINAN-6-ONE, 4,5-EPOXY-14-HYDROXY-3-METHOXY-17-METHYL-, (5.ALPHA.)-", "stdName": "MORPHINAN-6-ONE, 4,5-EPOXY-14-HYDROXY-3-METHOXY-17-METHYL-, (5.ALPHA.)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "579b570b-9b0e-4e1d-a113-f80b02c1245b" ], "display_name": false }, { "uuid": "9ad442e1-6efa-495a-86ca-9d447be8f182", "name": "N02AA05", "stdName": "N02AA05", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "fa78ded3-f48b-45b1-a015-8482558441a2", "109a5c97-7989-4ddc-8b33-4a2a947bf6ed" ], "display_name": false }, { "uuid": "6c6af027-b229-4904-a3db-c826e3d60693", "name": "NSC-19043", "stdName": "NSC-19043", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "579b570b-9b0e-4e1d-a113-f80b02c1245b" ], "display_name": false }, { "uuid": "4ec69ec7-b5f8-48e4-ae37-044c1319a1b4", "name": "OXYCODONE CII", "stdName": "OXYCODONE CII", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "413be787-140b-4be8-81f6-a78d5deae0d7", "5cac7fba-b10a-412e-8792-6f26f077fd35" ], "display_name": false }, { "uuid": "be11b132-93e6-4714-bb75-eec2506ad680", "name": "OXYCODONE CII [USP-RS]", "stdName": "OXYCODONE CII [USP-RS]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "413be787-140b-4be8-81f6-a78d5deae0d7" ], "display_name": false }, { "uuid": "0459b81e-dbca-432b-a0cd-10509fb83c08", "name": "OXYCODONE [HSDB]", "stdName": "OXYCODONE [HSDB]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "9faf2a97-f635-4953-805a-6ef64046d742" ], "display_name": false }, { "uuid": "3728a09f-83dd-4e62-a90b-8f65257173b9", "name": "OXYCODONE [MART.]", "stdName": "OXYCODONE [MART.]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b3ef8f53-ba76-456b-a265-8b27ec2fddaa" ], "display_name": false }, { "uuid": "203e3e1c-dade-472d-8a27-86afdb92fea4", "name": "OXYCODONE [MI]", "stdName": "OXYCODONE [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "fe852a8f-ae26-4f06-9291-a9e9cebe82c5" ], "display_name": false }, { "uuid": "3fddd8db-a214-fbde-ae28-9374c9e3b2e7", "name": "OXYCODONE [ORANGE BOOK]", "stdName": "OXYCODONE [ORANGE BOOK]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "9fc3231f-d157-d7f4-3652-6fd708c16f7a" ], "display_name": false }, { "uuid": "4d1d5ec0-8a44-451d-84f3-af5b8364b27e", "name": "OXYCODONE [USAN]", "stdName": "OXYCODONE [USAN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b82b98de-8dea-47b8-b1d0-5bfe8d1f51dd" ], "display_name": false }, { "uuid": "265af74d-a1fc-422b-a0ea-a824a9daddf6", "name": "OXYCODONE [VANDF]", "stdName": "OXYCODONE [VANDF]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8c036d08-2a2d-40c6-830e-e61682eea97c" ], "display_name": false }, { "uuid": "ba2e8e5a-5219-4ff6-be30-90c55ef30123", "name": "OXYMORPHONE 3-METHYL ETHER", "stdName": "OXYMORPHONE 3-METHYL ETHER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "d339fb6f-3dee-4777-88c1-287bf9774455" ], "display_name": false }, { "uuid": "3a6b19fb-07ee-4908-a17e-0cd52735421e", "name": "Oxycodone", "stdName": "OXYCODONE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "f12e88bd-934b-4a8d-bab7-7c414a0f5577", "9faf2a97-f635-4953-805a-6ef64046d742", "705adcdf-5cce-49c4-a182-a017f097af97", "4e5243a9-a5e5-4e8f-af1e-87acef6106ec", "1163d2cd-035f-42cc-8a7f-037a90b0c1ff", "b82b98de-8dea-47b8-b1d0-5bfe8d1f51dd", "b41bec2a-35a8-4814-8b86-4778870a7217", "42210e5c-8f0d-4924-b85e-11026aabafec", "4f22020c-a86c-4fcd-a247-1d6a5e78d088", "8c036d08-2a2d-40c6-830e-e61682eea97c", "07faf2bb-df06-4364-b456-18f14f98e0f2", "a0063ec4-10e5-48aa-836c-cdedb3fc90a9", "fe852a8f-ae26-4f06-9291-a9e9cebe82c5", "ad00b975-a48a-4c21-ade7-ecdbedd1588b", "b3ef8f53-ba76-456b-a265-8b27ec2fddaa" ], "display_name": true, "domains": [ "drug" ], "name_orgs": [ { "uuid": "aa1d1f78-8f16-41c3-aeb2-84df899332c1", "name_org": "INN" }, { "uuid": "525332ff-1ce0-4328-909b-12832f1a5377", "name_org": "USAN" } ] }, { "uuid": "46552f9e-6938-b84a-8938-b1653a22719a", "name": "Oxycodone [WHO-DD]", "stdName": "OXYCODONE [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "6da9f569-56bc-f9c9-8f83-567770331150" ], "display_name": false }, { "uuid": "964042ad-2cc9-4dc7-bf63-50fee8aaecbf", "name": "PAVINAL", "stdName": "PAVINAL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "d339fb6f-3dee-4777-88c1-287bf9774455" ], "display_name": false }, { "uuid": "f0a42a89-b308-44bc-9819-b22354930a60", "name": "PF-00345439", "stdName": "PF-00345439", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "549018c6-38af-410c-92a0-eb454c7d979c" ], "display_name": false }, { "uuid": "fece3b48-14e3-4bb1-8516-d55742d15dc4", "name": "PTI 821", "stdName": "PTI 821", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "d339fb6f-3dee-4777-88c1-287bf9774455" ], "display_name": false }, { "uuid": "8cf2326a-5245-45ba-844d-cc8ccfa7fe54", "name": "PTI-821", "stdName": "PTI-821", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "7e52e309-1c66-4661-94ac-7ebe2e040486" ], "display_name": false }, { "uuid": "748a016f-b991-45f4-b923-f4d2ef5d5d9e", "name": "REMOXY", "stdName": "REMOXY", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "7e52e309-1c66-4661-94ac-7ebe2e040486" ], "display_name": false }, { "uuid": "a3e56f84-2663-4986-a04b-4bf98d739577", "name": "XTAMPZA", "stdName": "XTAMPZA", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "95ecfb8a-b7cd-47ae-adc8-e21ec2c529a7" ], "display_name": false }, { "uuid": "6f15a8f8-d024-40c3-8032-919f1521377c", "name": "XTAMPZA ER", "stdName": "XTAMPZA ER", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "391007dc-7c51-3788-bfe3-3106b35dd409" ], "display_name": false }, { "uuid": "100db4ce-0be8-486e-ba07-d49ff521b14f", "name": "oxycodone [INN]", "stdName": "OXYCODONE [INN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4f22020c-a86c-4fcd-a247-1d6a5e78d088", "3255e67b-87b3-4e89-ad1a-c39eb1b30fb6" ], "display_name": false } ], "properties": [ { "uuid": "b36a9411-5dd3-4ac7-a894-e4d95c1aae55", "name": "Biological Half-life", "value": { "uuid": "b98b51ac-ae36-4590-9e41-dc51ba6a0ce0", "high": 5, "low": 3, "units": "hours" }, "defining": false, "property_type": "PHARMACOKINETIC", "references": [ "fb276346-59a8-c356-9ca5-e03cd8d982f3" ] }, { "uuid": "91eaf37c-f8b2-4653-ba04-93f35fa9b1ba", "name": "Tmax", "value": { "uuid": "69584a12-7a11-43ba-9373-199702040ba1", "average": 4.5, "units": "hours", "non_numeric_value": "ORAL DOSE" }, "defining": false, "property_type": "PHARMACOKINETIC", "references": [ "037d2eb9-7a49-2086-d9ee-669bb23503df" ] }, { "uuid": "3b8d0fea-ef7d-4e83-8db4-49bb3413c6a0", "name": "Volume of Distribution", "value": { "uuid": "394122e0-b764-4a31-b505-79ff65975f25", "average": 2.6, "units": "Liters/Kilogram" }, "defining": false, "property_type": "PHARMACOKINETIC" }, { "uuid": "864bca71-5d88-483e-8e6d-0285f0087d3c", "name": "MAXIMUM TOLERATED DOSE", "value": { "uuid": "5e9a1a95-a210-4542-bc3d-68bbdb82dfe0", "average": 288, "units": "mg/day", "non_numeric_value": "ORAL DOSE" }, "defining": false, "property_type": "TOXICITY" } ], "modifications": { "uuid": "73eb32ba-6ed5-4051-b2b6-19ce49cb7023" } } ] }