{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "4da4cce5-f47b-4c44-b27b-e0bb9665852a",
          "code": "3064-73-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=3064-73-1",
          "code_system": "CAS",
          "references": [
            "b639696a-b29e-4e21-9653-107827a9f60c",
            "34e95bda-4827-46e4-b88f-452fc271053a"
          ]
        },
        {
          "uuid": "e8f1a110-1c45-4500-b0bd-c850e3f4655b",
          "code": "221-312-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.019.375",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "b639696a-b29e-4e21-9653-107827a9f60c"
          ]
        },
        {
          "uuid": "59fef0b7-8d7c-40d5-b96b-12605837b131",
          "code": "76470",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/76470",
          "code_system": "PUBCHEM",
          "references": [
            "b639696a-b29e-4e21-9653-107827a9f60c"
          ]
        },
        {
          "uuid": "344f55a9-71c6-b719-24fa-b58b5316aa4d",
          "code": "DTXSID7062823",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7062823",
          "code_system": "EPA CompTox",
          "references": [
            "2a46963d-42b1-ec02-3436-6f97d9913721"
          ]
        },
        {
          "uuid": "779348e3-abc1-46a5-b5b9-debf871ec424",
          "code": "CCB3DC6HV9",
          "type": "PRIMARY",
          "code_system": "FDA UNII",
          "references": [
            "34e95bda-4827-46e4-b88f-452fc271053a"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e36fb792-daee-4c0e-a404-4781dff73207",
          "name": "Bis(diisobutylthiocarbamoyl) disulfide",
          "stdName": "BIS(DIISOBUTYLTHIOCARBAMOYL) DISULFIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "34e95bda-4827-46e4-b88f-452fc271053a"
          ],
          "display_name": true
        },
        {
          "uuid": "3e8c08d4-656e-494e-bc5a-0e35d0b41fd4",
          "name": "Disulfide, bis(diisobutylthiocarbamoyl)",
          "stdName": "DISULFIDE, BIS(DIISOBUTYLTHIOCARBAMOYL)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "34e95bda-4827-46e4-b88f-452fc271053a"
          ],
          "display_name": false
        },
        {
          "uuid": "f32d1f0a-2024-4352-a96f-a7b8eeb8fd6c",
          "name": "Thioperoxydicarbonic diamide ([(H2N)C(S)]2S2), N,N,N′,N′-tetrakis(2-methylpropyl)-",
          "stdName": "THIOPEROXYDICARBONIC DIAMIDE (((H2N)C(S))2S2), N,N,N',N'-TETRAKIS(2-METHYLPROPYL)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "34e95bda-4827-46e4-b88f-452fc271053a"
          ],
          "display_name": false
        },
        {
          "uuid": "058f6ef5-c5ca-4e9f-8865-86328e6c7377",
          "name": "Thioperoxydicarbonic diamide ([(H2N)C(S)]2S2), tetrakis(2-methylpropyl)-",
          "stdName": "THIOPEROXYDICARBONIC DIAMIDE (((H2N)C(S))2S2), TETRAKIS(2-METHYLPROPYL)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f828a5cf-3e4f-47d9-82d0-7b57453f821b",
            "424047b7-3e36-44cc-97bb-708ade29fd0e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f828a5cf-3e4f-47d9-82d0-7b57453f821b",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "424047b7-3e36-44cc-97bb-708ade29fd0e",
          "citation": "EPA",
          "doc_type": "EPA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b639696a-b29e-4e21-9653-107827a9f60c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393767000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2a46963d-42b1-ec02-3436-6f97d9913721",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=3064-73-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "34e95bda-4827-46e4-b88f-452fc271053a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "7ff44d3d-03af-4025-ac82-7cd8129b07ae",
          "id": "7ff44d3d-03af-4025-ac82-7cd8129b07ae",
          "molfile": "\n  Marvin  01132106392D          \n\n 24 23  0  0  0  0            999 V2000\n    7.2404   -6.3035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9515   -5.8894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6626   -6.3035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9515   -5.0528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2404   -4.6346    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2404   -3.7979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9515   -3.3797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9515   -2.5431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6626   -3.7979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5294   -5.0528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5294   -5.8894    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8182   -4.6346    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1072   -5.0528    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3962   -4.6346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6850   -5.0528    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3962   -3.7979    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6850   -3.3797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6850   -2.5431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9363   -2.5348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6558   -1.6898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1072   -3.3797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1072   -2.5431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0989   -1.7191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8182   -2.5348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 10  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  7  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 16 14  1  0  0  0  0\n 17 16  1  0  0  0  0\n 21 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 18  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 22  1  0  0  0  0\nM  END",
          "smiles": "CC(C)CN(CC(C)C)C(=S)SSC(=S)N(CC(C)C)CC(C)C",
          "formula": "C18H36N2S4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "423313f5-1cff-4e7a-bac9-5821afd02f27"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "408.7569",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "1ac6d9ae-06cb-416f-8d08-ae23a8a4ca12",
      "version": "6",
      "structure": {
        "id": "1cd7d137-c19a-4892-9db3-616bf2a9fe7a",
        "molfile": "\n   JSDraw211062315092D\n\n 24 23  0  0  0  0              0 V2000\n   30.0772   -8.0860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.7261   -7.3060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.7261   -5.7460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.3751   -8.0860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.0240   -7.3060    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   26.0240   -5.7460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.6730   -4.9659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.6730   -3.4059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.3220   -5.7460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.6730   -8.0860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.6730   -9.6460    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   23.3220   -7.3060    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   21.9709   -8.0860    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   20.6199   -7.3060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.6199   -5.7460    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   19.2688   -8.0860    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   17.9178   -7.3060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.9178   -5.7460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.5668   -4.9659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.2688   -4.9659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.2688   -9.6460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.9178  -10.4261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.9178  -11.9861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.5668   -9.6460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  5 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 14 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  1  0  0  0  0\n 16 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  1  0  0  0  0\nM  END",
        "smiles": "CC(C)CN(CC(C)C)C(=S)SSC(=S)N(CC(C)C)CC(C)C",
        "formula": "C18H36N2S4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "408.7569",
        "optical_activity": "NONE",
        "references": [
          "f828a5cf-3e4f-47d9-82d0-7b57453f821b"
        ],
        "stereo_centers": 0
      },
      "unii": "CCB3DC6HV9"
    }
  ]
}