{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "fe40e06c-2ed0-45be-b528-cb5ed732f3b3",
          "code": "58436-28-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=58436-28-5",
          "code_system": "CAS",
          "references": [
            "bc4943aa-7a97-430a-9307-6674a6f93841",
            "821e8a98-b26e-42d7-8ac9-00894dcc5a68"
          ]
        },
        {
          "uuid": "c4ee396d-f45d-499b-b09b-c63c561b3991",
          "code": "185914",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/185914",
          "code_system": "PUBCHEM",
          "references": [
            "bc4943aa-7a97-430a-9307-6674a6f93841"
          ]
        },
        {
          "uuid": "9d06f124-8f6f-4070-8514-c680176430fe",
          "code": "CBY43AY0TT",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e27fc835-33ba-f535-6c64-79a11500c07d",
          "code": "DB08466",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB08466",
          "code_system": "DRUG BANK",
          "references": [
            "46a3724d-dfb2-5b63-d56e-e433bd1ca7f9"
          ]
        },
        {
          "uuid": "4798746b-be2b-25d2-d2b5-12cab498df03",
          "code": "4582",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:4582",
          "code_system": "CHEBI",
          "references": [
            "46a3724d-dfb2-5b63-d56e-e433bd1ca7f9"
          ]
        },
        {
          "uuid": "6c5f8228-fa4d-d819-448b-05e589c7b119",
          "code": "Dihydro-resveratrol",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Dihydro-resveratrol",
          "code_system": "WIKIPEDIA",
          "references": [
            "4c9c1906-4fdd-c9ab-1d78-9e8d0045d74c"
          ]
        },
        {
          "uuid": "e29f1e89-b1cd-24b0-bbfc-b1d0e8cd2c21",
          "code": "DTXSID60973983",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60973983",
          "code_system": "EPA CompTox",
          "references": [
            "46a3724d-dfb2-5b63-d56e-e433bd1ca7f9"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "519c8610-b713-ddcf-8684-a317bbf899eb",
          "name": "1,3-BENZENEDIOL, 5-(2-(4-HYDROXYPHENYL)ETHYL)-",
          "stdName": "1,3-BENZENEDIOL, 5-(2-(4-HYDROXYPHENYL)ETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a6ed48c4-429b-f942-ac4c-379767c6f7ee"
          ],
          "display_name": false
        },
        {
          "uuid": "5f0004b2-d2cf-1ccf-563b-7a42ac6b080a",
          "name": "3,4',5-TRIHYDROXYBIBENZYL",
          "stdName": "3,4',5-TRIHYDROXYBIBENZYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a6ed48c4-429b-f942-ac4c-379767c6f7ee"
          ],
          "display_name": false
        },
        {
          "uuid": "b519299e-7074-4401-bf15-579f218333fb",
          "name": "5-(2-(4-HYDROXYPHENYL)ETHYL)BENZENE-1,3-DIOL",
          "stdName": "5-(2-(4-HYDROXYPHENYL)ETHYL)BENZENE-1,3-DIOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a1cf4c16-8396-41e2-8bc9-8a7288eebe8a"
          ],
          "display_name": false
        },
        {
          "uuid": "e6a0e5aa-c977-ce97-de03-cf90f316a1c8",
          "name": "5-(4-HYDROXYPHENETHYL)BENZENE-1,3-DIOL",
          "stdName": "5-(4-HYDROXYPHENETHYL)BENZENE-1,3-DIOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a6ed48c4-429b-f942-ac4c-379767c6f7ee"
          ],
          "display_name": false
        },
        {
          "uuid": "be885754-0010-d17b-bc35-06521bc6110d",
          "name": "DIHYDRORESVERATROL",
          "stdName": "DIHYDRORESVERATROL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a6ed48c4-429b-f942-ac4c-379767c6f7ee"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "a1cf4c16-8396-41e2-8bc9-8a7288eebe8a",
          "citation": "Drug Bank",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "bc4943aa-7a97-430a-9307-6674a6f93841",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393550000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "668e362b-bbdb-4819-b565-ff5db5ddabfc",
          "citation": "Drug Bank DB08466",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4c9c1906-4fdd-c9ab-1d78-9e8d0045d74c",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "a6ed48c4-429b-f942-ac4c-379767c6f7ee",
          "citation": "stn",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "46a3724d-dfb2-5b63-d56e-e433bd1ca7f9",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "821e8a98-b26e-42d7-8ac9-00894dcc5a68",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8bde5c86-34fe-4e29-bab3-61436624d9ab",
          "id": "8bde5c86-34fe-4e29-bab3-61436624d9ab",
          "molfile": "\n  Marvin  01132107162D          \n\n 17 18  0  0  0  0            999 V2000\n    3.2015   -1.4637    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4870   -1.0512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4870   -0.2262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7725    0.1863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0581   -0.2262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3436    0.1863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3709   -0.2262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0853    0.1863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7998   -0.2262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5143    0.1863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2288   -0.2262    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5143    1.0113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7998    1.4238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7998    2.2488    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0853    1.0113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0581   -1.0512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7725   -1.4637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n 17  2  2  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n 16  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 15  8  2  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 10  1  0  0  0  0\n 12 13  2  0  0  0  0\n 14 13  1  0  0  0  0\n 13 15  1  0  0  0  0\n 16 17  1  0  0  0  0\nM  END",
          "smiles": "C(Cc1cc(cc(c1)O)O)c2ccc(cc2)O",
          "formula": "C14H14O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ad1121bf-c59d-45f4-84da-d3a2c273576f"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "230.2597",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "fb2e828e-50d0-4035-a840-dee544660cb5",
      "version": "9",
      "structure": {
        "id": "023f8b2f-0dc9-4ccd-ae3e-09d55febac5e",
        "molfile": "\n  Marvin  01132100262D          \n\n 17 18  0  0  0  0            999 V2000\n   13.4764   -3.0388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7619   -3.4512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7619   -4.2762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6197   -4.2762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9053   -4.6887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4764   -4.6887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1909   -4.2762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1909   -3.4512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0474   -4.6887    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4764   -2.2138    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3342   -4.6887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0486   -4.2762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7631   -4.6887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7631   -5.5137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4776   -5.9262    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0486   -5.9262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3342   -5.5137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  8  1  0  0  0  0\n  2  1  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  6  2  0  0  0  0\n  4 11  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  5  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  3  1  0  0  0  0\n 10  1  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 14  2  0  0  0  0\n 17 11  2  0  0  0  0\n 17 16  1  0  0  0  0\nM  END",
        "smiles": "C(Cc1cc(cc(c1)O)O)c2ccc(cc2)O",
        "formula": "C14H14O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "230.2597",
        "optical_activity": "NONE",
        "references": [
          "668e362b-bbdb-4819-b565-ff5db5ddabfc"
        ],
        "stereo_centers": 0
      },
      "unii": "CBY43AY0TT"
    }
  ]
}